CA2248367A1 - Bonded structured retroreflective sheeting - Google Patents
Bonded structured retroreflective sheeting Download PDFInfo
- Publication number
- CA2248367A1 CA2248367A1 CA002248367A CA2248367A CA2248367A1 CA 2248367 A1 CA2248367 A1 CA 2248367A1 CA 002248367 A CA002248367 A CA 002248367A CA 2248367 A CA2248367 A CA 2248367A CA 2248367 A1 CA2248367 A1 CA 2248367A1
- Authority
- CA
- Canada
- Prior art keywords
- film
- bonding agent
- structured
- retroreflective
- sealing film
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000007767 bonding agent Substances 0.000 claims abstract description 134
- 238000007789 sealing Methods 0.000 claims abstract description 114
- 229920001169 thermoplastic Polymers 0.000 claims abstract description 29
- 239000004416 thermosoftening plastic Substances 0.000 claims abstract description 20
- 239000002243 precursor Substances 0.000 claims description 60
- 230000005855 radiation Effects 0.000 claims description 60
- 229920005989 resin Polymers 0.000 claims description 50
- 239000011347 resin Substances 0.000 claims description 50
- 239000000203 mixture Substances 0.000 claims description 39
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims description 34
- 239000000178 monomer Substances 0.000 claims description 33
- 238000000034 method Methods 0.000 claims description 28
- 229920001296 polysiloxane Polymers 0.000 claims description 19
- 239000004593 Epoxy Substances 0.000 claims description 17
- 229920000728 polyester Polymers 0.000 claims description 17
- 150000003254 radicals Chemical class 0.000 claims description 16
- 125000001931 aliphatic group Chemical group 0.000 claims description 15
- 239000003085 diluting agent Substances 0.000 claims description 15
- 125000003118 aryl group Chemical group 0.000 claims description 13
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 8
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 7
- 125000002091 cationic group Chemical group 0.000 claims description 7
- 239000007787 solid Substances 0.000 claims description 7
- 238000010894 electron beam technology Methods 0.000 claims description 6
- 229920000570 polyether Polymers 0.000 claims description 6
- 238000004049 embossing Methods 0.000 claims description 4
- BLCTWBJQROOONQ-UHFFFAOYSA-N ethenyl prop-2-enoate Chemical compound C=COC(=O)C=C BLCTWBJQROOONQ-UHFFFAOYSA-N 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 2
- 238000007373 indentation Methods 0.000 claims 1
- 239000010408 film Substances 0.000 description 208
- -1 poly(methyl methacrylate) Polymers 0.000 description 66
- 239000000463 material Substances 0.000 description 62
- 229920000642 polymer Polymers 0.000 description 55
- 239000010410 layer Substances 0.000 description 25
- 229920000647 polyepoxide Polymers 0.000 description 21
- 238000000576 coating method Methods 0.000 description 20
- 238000001723 curing Methods 0.000 description 19
- WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Substances O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 16
- 239000004417 polycarbonate Substances 0.000 description 15
- 239000003086 colorant Substances 0.000 description 14
- 229920000515 polycarbonate Polymers 0.000 description 14
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 12
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 12
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 12
- 239000000049 pigment Substances 0.000 description 12
- 239000000126 substance Substances 0.000 description 12
- 125000003700 epoxy group Chemical group 0.000 description 11
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 11
- 239000011248 coating agent Substances 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 10
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 description 9
- 239000000654 additive Substances 0.000 description 9
- 239000000853 adhesive Substances 0.000 description 9
- 230000001070 adhesive effect Effects 0.000 description 9
- 229920003180 amino resin Polymers 0.000 description 9
- 125000004386 diacrylate group Chemical group 0.000 description 9
- 239000003822 epoxy resin Substances 0.000 description 9
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 9
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 9
- QEMSVZNTSXPFJA-HNAYVOBHSA-N 1-[(1s,2s)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]-4-phenylpiperidin-4-ol Chemical compound C1([C@H](O)[C@H](C)N2CCC(O)(CC2)C=2C=CC=CC=2)=CC=C(O)C=C1 QEMSVZNTSXPFJA-HNAYVOBHSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 229920006397 acrylic thermoplastic Polymers 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- ISXSCDLOGDJUNJ-UHFFFAOYSA-N tert-butyl prop-2-enoate Chemical compound CC(C)(C)OC(=O)C=C ISXSCDLOGDJUNJ-UHFFFAOYSA-N 0.000 description 8
- BQCIDUSAKPWEOX-UHFFFAOYSA-N 1,1-Difluoroethene Chemical compound FC(F)=C BQCIDUSAKPWEOX-UHFFFAOYSA-N 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- 230000015556 catabolic process Effects 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 7
- 238000006731 degradation reaction Methods 0.000 description 7
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 7
- 229920001568 phenolic resin Polymers 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N titanium dioxide Inorganic materials O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 7
- 108091092920 SmY RNA Proteins 0.000 description 6
- 241001237710 Smyrna Species 0.000 description 6
- 239000006096 absorbing agent Substances 0.000 description 6
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 description 6
- 239000004676 acrylonitrile butadiene styrene Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 238000013461 design Methods 0.000 description 6
- JZMPIUODFXBXSC-UHFFFAOYSA-N ethyl carbamate;prop-2-enoic acid Chemical compound OC(=O)C=C.OC(=O)C=C.CCOC(N)=O JZMPIUODFXBXSC-UHFFFAOYSA-N 0.000 description 6
- 229920003986 novolac Polymers 0.000 description 6
- 229920000058 polyacrylate Polymers 0.000 description 6
- 238000006116 polymerization reaction Methods 0.000 description 6
- 238000003847 radiation curing Methods 0.000 description 6
- 239000003381 stabilizer Substances 0.000 description 6
- 239000000758 substrate Substances 0.000 description 6
- CCEFMUBVSUDRLG-KXUCPTDWSA-N (4R)-limonene 1,2-epoxide Natural products C1[C@H](C(=C)C)CC[C@@]2(C)O[C@H]21 CCEFMUBVSUDRLG-KXUCPTDWSA-N 0.000 description 5
- WEEGYLXZBRQIMU-UHFFFAOYSA-N 1,8-cineole Natural products C1CC2CCC1(C)OC2(C)C WEEGYLXZBRQIMU-UHFFFAOYSA-N 0.000 description 5
- CCEFMUBVSUDRLG-XNWIYYODSA-N Limonene-1,2-epoxide Chemical compound C1[C@H](C(=C)C)CCC2(C)OC21 CCEFMUBVSUDRLG-XNWIYYODSA-N 0.000 description 5
- 239000004642 Polyimide Substances 0.000 description 5
- 230000008901 benefit Effects 0.000 description 5
- 238000010276 construction Methods 0.000 description 5
- 238000005516 engineering process Methods 0.000 description 5
- 229920002313 fluoropolymer Polymers 0.000 description 5
- 239000003999 initiator Substances 0.000 description 5
- 230000003993 interaction Effects 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 239000005011 phenolic resin Substances 0.000 description 5
- 229920001721 polyimide Polymers 0.000 description 5
- 229920002554 vinyl polymer Polymers 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- INQDDHNZXOAFFD-UHFFFAOYSA-N 2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethyl prop-2-enoate Chemical compound C=CC(=O)OCCOCCOCCOC(=O)C=C INQDDHNZXOAFFD-UHFFFAOYSA-N 0.000 description 4
- HCLJOFJIQIJXHS-UHFFFAOYSA-N 2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate Chemical compound C=CC(=O)OCCOCCOCCOCCOC(=O)C=C HCLJOFJIQIJXHS-UHFFFAOYSA-N 0.000 description 4
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 4
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 4
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 4
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 239000004952 Polyamide Substances 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000012952 cationic photoinitiator Substances 0.000 description 4
- 229920001577 copolymer Polymers 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 125000005442 diisocyanate group Chemical group 0.000 description 4
- 239000000975 dye Substances 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 239000004811 fluoropolymer Substances 0.000 description 4
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 4
- 239000012948 isocyanate Substances 0.000 description 4
- 150000002513 isocyanates Chemical class 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- 229920002647 polyamide Polymers 0.000 description 4
- 150000003673 urethanes Chemical class 0.000 description 4
- NGZXDRGWBULKFA-NSOVKSMOSA-N (+)-Bebeerine Chemical compound C([C@@H]1N(C)CCC=2C=C(C(=C(OC3=CC=C(C=C3)C[C@H]3C=4C=C(C(=CC=4CCN3C)OC)O3)C=21)O)OC)C1=CC=C(O)C3=C1 NGZXDRGWBULKFA-NSOVKSMOSA-N 0.000 description 3
- PSGCQDPCAWOCSH-UHFFFAOYSA-N (4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl) prop-2-enoate Chemical compound C1CC2(C)C(OC(=O)C=C)CC1C2(C)C PSGCQDPCAWOCSH-UHFFFAOYSA-N 0.000 description 3
- XMLYCEVDHLAQEL-UHFFFAOYSA-N 2-hydroxy-2-methyl-1-phenylpropan-1-one Chemical compound CC(C)(O)C(=O)C1=CC=CC=C1 XMLYCEVDHLAQEL-UHFFFAOYSA-N 0.000 description 3
- JHWGFJBTMHEZME-UHFFFAOYSA-N 4-prop-2-enoyloxybutyl prop-2-enoate Chemical compound C=CC(=O)OCCCCOC(=O)C=C JHWGFJBTMHEZME-UHFFFAOYSA-N 0.000 description 3
- FIHBHSQYSYVZQE-UHFFFAOYSA-N 6-prop-2-enoyloxyhexyl prop-2-enoate Chemical compound C=CC(=O)OCCCCCCOC(=O)C=C FIHBHSQYSYVZQE-UHFFFAOYSA-N 0.000 description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 3
- 239000005977 Ethylene Substances 0.000 description 3
- 239000006057 Non-nutritive feed additive Substances 0.000 description 3
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 3
- 239000003377 acid catalyst Substances 0.000 description 3
- 229920000180 alkyd Polymers 0.000 description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- 230000001413 cellular effect Effects 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- ISAOCJYIOMOJEB-UHFFFAOYSA-N desyl alcohol Natural products C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 229920001971 elastomer Polymers 0.000 description 3
- 230000007613 environmental effect Effects 0.000 description 3
- UHESRSKEBRADOO-UHFFFAOYSA-N ethyl carbamate;prop-2-enoic acid Chemical class OC(=O)C=C.CCOC(N)=O UHESRSKEBRADOO-UHFFFAOYSA-N 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 239000000976 ink Substances 0.000 description 3
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical class OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 3
- 239000004611 light stabiliser Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000004005 microsphere Substances 0.000 description 3
- 238000013008 moisture curing Methods 0.000 description 3
- 230000035515 penetration Effects 0.000 description 3
- 229920002285 poly(styrene-co-acrylonitrile) Polymers 0.000 description 3
- 230000000379 polymerizing effect Effects 0.000 description 3
- 239000004926 polymethyl methacrylate Substances 0.000 description 3
- 229920000098 polyolefin Polymers 0.000 description 3
- 229920002223 polystyrene Polymers 0.000 description 3
- 229920003987 resole Polymers 0.000 description 3
- 239000005060 rubber Substances 0.000 description 3
- 239000000523 sample Substances 0.000 description 3
- 229920000638 styrene acrylonitrile Polymers 0.000 description 3
- 238000001029 thermal curing Methods 0.000 description 3
- 229920001187 thermosetting polymer Polymers 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- ZDQNWDNMNKSMHI-UHFFFAOYSA-N 1-[2-(2-prop-2-enoyloxypropoxy)propoxy]propan-2-yl prop-2-enoate Chemical compound C=CC(=O)OC(C)COC(C)COCC(C)OC(=O)C=C ZDQNWDNMNKSMHI-UHFFFAOYSA-N 0.000 description 2
- RZVINYQDSSQUKO-UHFFFAOYSA-N 2-phenoxyethyl prop-2-enoate Chemical compound C=CC(=O)OCCOC1=CC=CC=C1 RZVINYQDSSQUKO-UHFFFAOYSA-N 0.000 description 2
- KUDUQBURMYMBIJ-UHFFFAOYSA-N 2-prop-2-enoyloxyethyl prop-2-enoate Chemical compound C=CC(=O)OCCOC(=O)C=C KUDUQBURMYMBIJ-UHFFFAOYSA-N 0.000 description 2
- 229930185605 Bisphenol Natural products 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 229920002943 EPDM rubber Polymers 0.000 description 2
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- 229940123457 Free radical scavenger Drugs 0.000 description 2
- 229920006370 Kynar Polymers 0.000 description 2
- 239000000020 Nitrocellulose Substances 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- 244000028419 Styrax benzoin Species 0.000 description 2
- 235000000126 Styrax benzoin Nutrition 0.000 description 2
- 235000008411 Sumatra benzointree Nutrition 0.000 description 2
- 229920001807 Urea-formaldehyde Polymers 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 2
- 150000008062 acetophenones Chemical class 0.000 description 2
- 239000002318 adhesion promoter Substances 0.000 description 2
- 239000012790 adhesive layer Substances 0.000 description 2
- 239000002390 adhesive tape Substances 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 239000001361 adipic acid Substances 0.000 description 2
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- WURBFLDFSFBTLW-UHFFFAOYSA-N benzil Chemical compound C=1C=CC=CC=1C(=O)C(=O)C1=CC=CC=C1 WURBFLDFSFBTLW-UHFFFAOYSA-N 0.000 description 2
- 229960002130 benzoin Drugs 0.000 description 2
- 239000012965 benzophenone Substances 0.000 description 2
- 150000008366 benzophenones Chemical class 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000004841 bisphenol A epoxy resin Substances 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- FCSHDIVRCWTZOX-DVTGEIKXSA-N clobetasol Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)CCl)(O)[C@@]1(C)C[C@@H]2O FCSHDIVRCWTZOX-DVTGEIKXSA-N 0.000 description 2
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 2
- 150000002009 diols Chemical class 0.000 description 2
- VFHVQBAGLAREND-UHFFFAOYSA-N diphenylphosphoryl-(2,4,6-trimethylphenyl)methanone Chemical compound CC1=CC(C)=CC(C)=C1C(=O)P(=O)(C=1C=CC=CC=1)C1=CC=CC=C1 VFHVQBAGLAREND-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 238000005755 formation reaction Methods 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 229920001002 functional polymer Polymers 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 235000019382 gum benzoic Nutrition 0.000 description 2
- PYGSKMBEVAICCR-UHFFFAOYSA-N hexa-1,5-diene Chemical group C=CCCC=C PYGSKMBEVAICCR-UHFFFAOYSA-N 0.000 description 2
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 2
- XMGQYMWWDOXHJM-UHFFFAOYSA-N limonene Chemical compound CC(=C)C1CCC(C)=CC1 XMGQYMWWDOXHJM-UHFFFAOYSA-N 0.000 description 2
- 230000007774 longterm Effects 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 2
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 2
- YDKNBNOOCSNPNS-UHFFFAOYSA-N methyl 1,3-benzoxazole-2-carboxylate Chemical compound C1=CC=C2OC(C(=O)OC)=NC2=C1 YDKNBNOOCSNPNS-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 229920001220 nitrocellulos Polymers 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- YNXCGLKMOXLBOD-UHFFFAOYSA-N oxolan-2-ylmethyl prop-2-enoate Chemical compound C=CC(=O)OCC1CCCO1 YNXCGLKMOXLBOD-UHFFFAOYSA-N 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- WRAQQYDMVSCOTE-UHFFFAOYSA-N phenyl prop-2-enoate Chemical class C=CC(=O)OC1=CC=CC=C1 WRAQQYDMVSCOTE-UHFFFAOYSA-N 0.000 description 2
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 2
- 229920001643 poly(ether ketone) Polymers 0.000 description 2
- 229920005668 polycarbonate resin Polymers 0.000 description 2
- 229920001601 polyetherimide Polymers 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229920006254 polymer film Polymers 0.000 description 2
- ODGAOXROABLFNM-UHFFFAOYSA-N polynoxylin Chemical class O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000007639 printing Methods 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000010526 radical polymerization reaction Methods 0.000 description 2
- 239000002516 radical scavenger Substances 0.000 description 2
- 238000000518 rheometry Methods 0.000 description 2
- 238000007650 screen-printing Methods 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 229920001897 terpolymer Polymers 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 239000012815 thermoplastic material Substances 0.000 description 2
- 229920006305 unsaturated polyester Polymers 0.000 description 2
- 229960000834 vinyl ether Drugs 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- VVUWYXJTOLSMFV-UHFFFAOYSA-N (2-hydroxy-4-octylphenyl)-phenylmethanone Chemical compound OC1=CC(CCCCCCCC)=CC=C1C(=O)C1=CC=CC=C1 VVUWYXJTOLSMFV-UHFFFAOYSA-N 0.000 description 1
- MYWOJODOMFBVCB-UHFFFAOYSA-N 1,2,6-trimethylphenanthrene Chemical compound CC1=CC=C2C3=CC(C)=CC=C3C=CC2=C1C MYWOJODOMFBVCB-UHFFFAOYSA-N 0.000 description 1
- RBACIKXCRWGCBB-UHFFFAOYSA-N 1,2-Epoxybutane Chemical compound CCC1CO1 RBACIKXCRWGCBB-UHFFFAOYSA-N 0.000 description 1
- MSAHTMIQULFMRG-UHFFFAOYSA-N 1,2-diphenyl-2-propan-2-yloxyethanone Chemical compound C=1C=CC=CC=1C(OC(C)C)C(=O)C1=CC=CC=C1 MSAHTMIQULFMRG-UHFFFAOYSA-N 0.000 description 1
- BPXVHIRIPLPOPT-UHFFFAOYSA-N 1,3,5-tris(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione Chemical compound OCCN1C(=O)N(CCO)C(=O)N(CCO)C1=O BPXVHIRIPLPOPT-UHFFFAOYSA-N 0.000 description 1
- DKEGCUDAFWNSSO-UHFFFAOYSA-N 1,8-dibromooctane Chemical compound BrCCCCCCCCBr DKEGCUDAFWNSSO-UHFFFAOYSA-N 0.000 description 1
- XUIXZBXRQFZHIT-UHFFFAOYSA-N 1-[1-(1-hydroxypropan-2-yloxy)propan-2-yloxy]-3-methoxypropan-2-ol Chemical compound COCC(O)COC(C)COC(C)CO XUIXZBXRQFZHIT-UHFFFAOYSA-N 0.000 description 1
- GRSGFPUWHKVFJW-UHFFFAOYSA-N 1-[1-(1-hydroxypropan-2-yloxy)propan-2-yloxy]-3-methoxypropan-2-ol;prop-2-enoic acid Chemical compound OC(=O)C=C.COCC(O)COC(C)COC(C)CO GRSGFPUWHKVFJW-UHFFFAOYSA-N 0.000 description 1
- PBGPBHYPCGDFEZ-UHFFFAOYSA-N 1-ethenylpiperidin-2-one Chemical compound C=CN1CCCCC1=O PBGPBHYPCGDFEZ-UHFFFAOYSA-N 0.000 description 1
- 239000012956 1-hydroxycyclohexylphenyl-ketone Substances 0.000 description 1
- PIZHFBODNLEQBL-UHFFFAOYSA-N 2,2-diethoxy-1-phenylethanone Chemical compound CCOC(OCC)C(=O)C1=CC=CC=C1 PIZHFBODNLEQBL-UHFFFAOYSA-N 0.000 description 1
- IANYIYFOTQCDBY-UHFFFAOYSA-N 2,2-dimethylbutane prop-2-enoic acid Chemical compound OC(=O)C=C.OC(=O)C=C.CCC(C)(C)C IANYIYFOTQCDBY-UHFFFAOYSA-N 0.000 description 1
- NEBBLNDVSSWJLL-UHFFFAOYSA-N 2,3-bis(2-methylprop-2-enoyloxy)propyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC(OC(=O)C(C)=C)COC(=O)C(C)=C NEBBLNDVSSWJLL-UHFFFAOYSA-N 0.000 description 1
- PUGOMSLRUSTQGV-UHFFFAOYSA-N 2,3-di(prop-2-enoyloxy)propyl prop-2-enoate Chemical compound C=CC(=O)OCC(OC(=O)C=C)COC(=O)C=C PUGOMSLRUSTQGV-UHFFFAOYSA-N 0.000 description 1
- FTALTLPZDVFJSS-UHFFFAOYSA-N 2-(2-ethoxyethoxy)ethyl prop-2-enoate Chemical compound CCOCCOCCOC(=O)C=C FTALTLPZDVFJSS-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- XSCRXCDDATUDLB-UHFFFAOYSA-N 2-(2-methylpropoxymethyl)prop-2-enamide Chemical compound CC(C)COCC(=C)C(N)=O XSCRXCDDATUDLB-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 description 1
- YIJYFLXQHDOQGW-UHFFFAOYSA-N 2-[2,4,6-trioxo-3,5-bis(2-prop-2-enoyloxyethyl)-1,3,5-triazinan-1-yl]ethyl prop-2-enoate Chemical compound C=CC(=O)OCCN1C(=O)N(CCOC(=O)C=C)C(=O)N(CCOC(=O)C=C)C1=O YIJYFLXQHDOQGW-UHFFFAOYSA-N 0.000 description 1
- LCZVSXRMYJUNFX-UHFFFAOYSA-N 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol Chemical compound CC(O)COC(C)COC(C)CO LCZVSXRMYJUNFX-UHFFFAOYSA-N 0.000 description 1
- VFBJXXJYHWLXRM-UHFFFAOYSA-N 2-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethylsulfanyl]ethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)OCCSCCOC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 VFBJXXJYHWLXRM-UHFFFAOYSA-N 0.000 description 1
- UHFFVFAKEGKNAQ-UHFFFAOYSA-N 2-benzyl-2-(dimethylamino)-1-(4-morpholin-4-ylphenyl)butan-1-one Chemical compound C=1C=C(N2CCOCC2)C=CC=1C(=O)C(CC)(N(C)C)CC1=CC=CC=C1 UHFFVFAKEGKNAQ-UHFFFAOYSA-N 0.000 description 1
- KMNCBSZOIQAUFX-UHFFFAOYSA-N 2-ethoxy-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(OCC)C(=O)C1=CC=CC=C1 KMNCBSZOIQAUFX-UHFFFAOYSA-N 0.000 description 1
- QPXVRLXJHPTCPW-UHFFFAOYSA-N 2-hydroxy-2-methyl-1-(4-propan-2-ylphenyl)propan-1-one Chemical compound CC(C)C1=CC=C(C(=O)C(C)(C)O)C=C1 QPXVRLXJHPTCPW-UHFFFAOYSA-N 0.000 description 1
- PVBUTZWGEJHWSJ-UHFFFAOYSA-N 2-morpholin-4-yl-1-phenylpropan-1-one Chemical compound C=1C=CC=CC=1C(=O)C(C)N1CCOCC1 PVBUTZWGEJHWSJ-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- WMJBVALTYVXGHW-UHFFFAOYSA-N 3,3-diphenylprop-2-enoic acid Chemical class C=1C=CC=CC=1C(=CC(=O)O)C1=CC=CC=C1 WMJBVALTYVXGHW-UHFFFAOYSA-N 0.000 description 1
- HCILJBJJZALOAL-UHFFFAOYSA-N 3-(3,5-ditert-butyl-4-hydroxyphenyl)-n'-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]propanehydrazide Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)NNC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 HCILJBJJZALOAL-UHFFFAOYSA-N 0.000 description 1
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 description 1
- ACYXOHNDKRVKLH-UHFFFAOYSA-N 5-phenylpenta-2,4-dienenitrile prop-2-enoic acid Chemical compound OC(=O)C=C.N#CC=CC=CC1=CC=CC=C1 ACYXOHNDKRVKLH-UHFFFAOYSA-N 0.000 description 1
- DXPPIEDUBFUSEZ-UHFFFAOYSA-N 6-methylheptyl prop-2-enoate Chemical compound CC(C)CCCCCOC(=O)C=C DXPPIEDUBFUSEZ-UHFFFAOYSA-N 0.000 description 1
- YDWRZBOKATXNFI-UHFFFAOYSA-N 6-methylheptyl prop-2-enoate;prop-2-enoic acid Chemical compound OC(=O)C=C.CC(C)CCCCCOC(=O)C=C YDWRZBOKATXNFI-UHFFFAOYSA-N 0.000 description 1
- 229920002126 Acrylic acid copolymer Polymers 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- LCFVJGUPQDGYKZ-UHFFFAOYSA-N Bisphenol A diglycidyl ether Chemical compound C=1C=C(OCC2OC2)C=CC=1C(C)(C)C(C=C1)=CC=C1OCC1CO1 LCFVJGUPQDGYKZ-UHFFFAOYSA-N 0.000 description 1
- 229920013683 Celanese Polymers 0.000 description 1
- 239000004970 Chain extender Substances 0.000 description 1
- 239000004971 Cross linker Substances 0.000 description 1
- 229920003261 Durez Polymers 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 101100440920 Escherichia phage 186 CP81 gene Proteins 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 206010073306 Exposure to radiation Diseases 0.000 description 1
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- OWYWGLHRNBIFJP-UHFFFAOYSA-N Ipazine Chemical compound CCN(CC)C1=NC(Cl)=NC(NC(C)C)=N1 OWYWGLHRNBIFJP-UHFFFAOYSA-N 0.000 description 1
- 239000005058 Isophorone diisocyanate Substances 0.000 description 1
- 229920004309 LEXAN™ RESIN 123R Polymers 0.000 description 1
- 229920004030 Makrolon® 2407 Polymers 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- 101100345589 Mus musculus Mical1 gene Proteins 0.000 description 1
- 241000428199 Mustelinae Species 0.000 description 1
- CNCOEDDPFOAUMB-UHFFFAOYSA-N N-Methylolacrylamide Chemical compound OCNC(=O)C=C CNCOEDDPFOAUMB-UHFFFAOYSA-N 0.000 description 1
- YFONKFDEZLYQDH-OPQQBVKSSA-N N-[(1R,2S)-2,6-dimethyindan-1-yl]-6-[(1R)-1-fluoroethyl]-1,3,5-triazine-2,4-diamine Chemical compound C[C@@H](F)C1=NC(N)=NC(N[C@H]2C3=CC(C)=CC=C3C[C@@H]2C)=N1 YFONKFDEZLYQDH-OPQQBVKSSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 101150050192 PIGM gene Proteins 0.000 description 1
- 229920001054 Poly(ethylene‐co‐vinyl acetate) Polymers 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 229920006373 Solef Polymers 0.000 description 1
- 229920006372 Soltex Polymers 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- OKKRPWIIYQTPQF-UHFFFAOYSA-N Trimethylolpropane trimethacrylate Chemical compound CC(=C)C(=O)OCC(CC)(COC(=O)C(C)=C)COC(=O)C(C)=C OKKRPWIIYQTPQF-UHFFFAOYSA-N 0.000 description 1
- 229920006383 Tyril Polymers 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 239000004708 Very-low-density polyethylene Substances 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 229910000004 White lead Inorganic materials 0.000 description 1
- 239000005083 Zinc sulfide Substances 0.000 description 1
- PSGCQDPCAWOCSH-BREBYQMCSA-N [(1r,3r,4r)-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl] prop-2-enoate Chemical compound C1C[C@@]2(C)[C@H](OC(=O)C=C)C[C@@H]1C2(C)C PSGCQDPCAWOCSH-BREBYQMCSA-N 0.000 description 1
- CSMQKNXBVDORKW-UHFFFAOYSA-N [(2,6-dimethoxybenzoyl)-(2,4,4-trimethylpentyl)phosphanyl]-(2,6-dimethoxyphenyl)methanone Chemical compound COC1=CC=CC(OC)=C1C(=O)P(CC(C)CC(C)(C)C)C(=O)C1=C(OC)C=CC=C1OC CSMQKNXBVDORKW-UHFFFAOYSA-N 0.000 description 1
- LFOXEOLGJPJZAA-UHFFFAOYSA-N [(2,6-dimethoxybenzoyl)-(2,4,4-trimethylpentyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone Chemical compound COC1=CC=CC(OC)=C1C(=O)P(=O)(CC(C)CC(C)(C)C)C(=O)C1=C(OC)C=CC=C1OC LFOXEOLGJPJZAA-UHFFFAOYSA-N 0.000 description 1
- HVVWZTWDBSEWIH-UHFFFAOYSA-N [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate Chemical compound C=CC(=O)OCC(CO)(COC(=O)C=C)COC(=O)C=C HVVWZTWDBSEWIH-UHFFFAOYSA-N 0.000 description 1
- YPCHGLDQZXOZFW-UHFFFAOYSA-N [2-[[4-methyl-3-[[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propoxy]carbonylamino]phenyl]carbamoyloxymethyl]-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate Chemical compound CC1=CC=C(NC(=O)OCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C)C=C1NC(=O)OCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C YPCHGLDQZXOZFW-UHFFFAOYSA-N 0.000 description 1
- VZTQQYMRXDUHDO-UHFFFAOYSA-N [2-hydroxy-3-[4-[2-[4-(2-hydroxy-3-prop-2-enoyloxypropoxy)phenyl]propan-2-yl]phenoxy]propyl] prop-2-enoate Chemical compound C=1C=C(OCC(O)COC(=O)C=C)C=CC=1C(C)(C)C1=CC=C(OCC(O)COC(=O)C=C)C=C1 VZTQQYMRXDUHDO-UHFFFAOYSA-N 0.000 description 1
- BGYHLZZASRKEJE-UHFFFAOYSA-N [3-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]-2,2-bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxymethyl]propyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)OCC(COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)(COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 BGYHLZZASRKEJE-UHFFFAOYSA-N 0.000 description 1
- 229920001898 acrylonitrile–EPDM–styrene Polymers 0.000 description 1
- 238000012644 addition polymerization Methods 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 125000005410 aryl sulfonium group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 125000003354 benzotriazolyl group Chemical class N1N=NC2=C1C=CC=C2* 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- MQDJYUACMFCOFT-UHFFFAOYSA-N bis[2-(1-hydroxycyclohexyl)phenyl]methanone Chemical compound C=1C=CC=C(C(=O)C=2C(=CC=CC=2)C2(O)CCCCC2)C=1C1(O)CCCCC1 MQDJYUACMFCOFT-UHFFFAOYSA-N 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 229920006026 co-polymeric resin Polymers 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- XCJYREBRNVKWGJ-UHFFFAOYSA-N copper(II) phthalocyanine Chemical compound [Cu+2].C12=CC=CC=C2C(N=C2[N-]C(C3=CC=CC=C32)=N2)=NC1=NC([C]1C=CC=CC1=1)=NC=1N=C1[C]3C=CC=CC3=C2[N-]1 XCJYREBRNVKWGJ-UHFFFAOYSA-N 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- DKUYEPUUXLQPPX-UHFFFAOYSA-N dibismuth;molybdenum;oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[Mo].[Mo].[Bi+3].[Bi+3] DKUYEPUUXLQPPX-UHFFFAOYSA-N 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001227 electron beam curing Methods 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 229940052303 ethers for general anesthesia Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229920001038 ethylene copolymer Polymers 0.000 description 1
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Substances CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 1
- 229920005648 ethylene methacrylic acid copolymer Polymers 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- MSYLJRIXVZCQHW-UHFFFAOYSA-N formaldehyde;6-phenyl-1,3,5-triazine-2,4-diamine Chemical class O=C.NC1=NC(N)=NC(C=2C=CC=CC=2)=N1 MSYLJRIXVZCQHW-UHFFFAOYSA-N 0.000 description 1
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 230000009477 glass transition Effects 0.000 description 1
- 125000003976 glyceryl group Chemical group [H]C([*])([H])C(O[H])([H])C(O[H])([H])[H] 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- VPVSTMAPERLKKM-UHFFFAOYSA-N glycoluril Chemical compound N1C(=O)NC2NC(=O)NC21 VPVSTMAPERLKKM-UHFFFAOYSA-N 0.000 description 1
- 238000007756 gravure coating Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- RBTKNAXYKSUFRK-UHFFFAOYSA-N heliogen blue Chemical compound [Cu].[N-]1C2=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=NC([N-]1)=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=N2 RBTKNAXYKSUFRK-UHFFFAOYSA-N 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical compound CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical class I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 230000005865 ionizing radiation Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000001034 iron oxide pigment Substances 0.000 description 1
- NIMLQBUJDJZYEJ-UHFFFAOYSA-N isophorone diisocyanate Chemical compound CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1 NIMLQBUJDJZYEJ-UHFFFAOYSA-N 0.000 description 1
- 239000005453 ketone based solvent Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 229940087305 limonene Drugs 0.000 description 1
- 235000001510 limonene Nutrition 0.000 description 1
- CDOSHBSSFJOMGT-UHFFFAOYSA-N linalool Chemical compound CC(C)=CCCC(C)(O)C=C CDOSHBSSFJOMGT-UHFFFAOYSA-N 0.000 description 1
- 229920000092 linear low density polyethylene Polymers 0.000 description 1
- 239000004707 linear low-density polyethylene Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229920001684 low density polyethylene Polymers 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 229940088644 n,n-dimethylacrylamide Drugs 0.000 description 1
- YLGYACDQVQQZSW-UHFFFAOYSA-N n,n-dimethylprop-2-enamide Chemical compound CN(C)C(=O)C=C YLGYACDQVQQZSW-UHFFFAOYSA-N 0.000 description 1
- FTQWRYSLUYAIRQ-UHFFFAOYSA-N n-[(octadecanoylamino)methyl]octadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NCNC(=O)CCCCCCCCCCCCCCCCC FTQWRYSLUYAIRQ-UHFFFAOYSA-N 0.000 description 1
- FOGSDLLFGSNQCW-UHFFFAOYSA-N n-[(prop-2-enoylamino)methoxymethyl]prop-2-enamide Chemical compound C=CC(=O)NCOCNC(=O)C=C FOGSDLLFGSNQCW-UHFFFAOYSA-N 0.000 description 1
- ZQXSMRAEXCEDJD-UHFFFAOYSA-N n-ethenylformamide Chemical compound C=CNC=O ZQXSMRAEXCEDJD-UHFFFAOYSA-N 0.000 description 1
- YPHQUSNPXDGUHL-UHFFFAOYSA-N n-methylprop-2-enamide Chemical compound CNC(=O)C=C YPHQUSNPXDGUHL-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000002832 nitroso derivatives Chemical class 0.000 description 1
- SSDSCDGVMJFTEQ-UHFFFAOYSA-N octadecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)CCC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 SSDSCDGVMJFTEQ-UHFFFAOYSA-N 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- RZFODFPMOHAYIR-UHFFFAOYSA-N oxepan-2-one;prop-2-enoic acid Chemical compound OC(=O)C=C.O=C1CCCCCO1 RZFODFPMOHAYIR-UHFFFAOYSA-N 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920002587 poly(1,3-butadiene) polymer Polymers 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920002492 poly(sulfone) Polymers 0.000 description 1
- 229920013639 polyalphaolefin Polymers 0.000 description 1
- 229920001707 polybutylene terephthalate Polymers 0.000 description 1
- 229920001610 polycaprolactone Polymers 0.000 description 1
- 239000004632 polycaprolactone Substances 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- 150000004291 polyenes Chemical class 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 239000002952 polymeric resin Substances 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920000069 polyphenylene sulfide Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000131 polyvinylidene Polymers 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- SCUZVMOVTVSBLE-UHFFFAOYSA-N prop-2-enenitrile;styrene Chemical compound C=CC#N.C=CC1=CC=CC=C1 SCUZVMOVTVSBLE-UHFFFAOYSA-N 0.000 description 1
- KCTAWXVAICEBSD-UHFFFAOYSA-N prop-2-enoyloxy prop-2-eneperoxoate Chemical compound C=CC(=O)OOOC(=O)C=C KCTAWXVAICEBSD-UHFFFAOYSA-N 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- WVIICGIFSIBFOG-UHFFFAOYSA-N pyrylium Chemical class C1=CC=[O+]C=C1 WVIICGIFSIBFOG-UHFFFAOYSA-N 0.000 description 1
- 150000004053 quinones Chemical class 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000002310 reflectometry Methods 0.000 description 1
- 239000012744 reinforcing agent Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 125000005373 siloxane group Chemical group [SiH2](O*)* 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000009864 tensile test Methods 0.000 description 1
- 229920006027 ternary co-polymer Polymers 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 229920006029 tetra-polymer Polymers 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 229920002803 thermoplastic polyurethane Polymers 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- HQYALQRYBUJWDH-UHFFFAOYSA-N trimethoxy(propyl)silane Chemical compound CCC[Si](OC)(OC)OC HQYALQRYBUJWDH-UHFFFAOYSA-N 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 229920001866 very low density polyethylene Polymers 0.000 description 1
- 229940117958 vinyl acetate Drugs 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical class [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 description 1
- 229910052984 zinc sulfide Inorganic materials 0.000 description 1
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 description 1
- 229910001928 zirconium oxide Inorganic materials 0.000 description 1
Classifications
-
- G—PHYSICS
- G02—OPTICS
- G02B—OPTICAL ELEMENTS, SYSTEMS OR APPARATUS
- G02B5/00—Optical elements other than lenses
- G02B5/12—Reflex reflectors
- G02B5/122—Reflex reflectors cube corner, trihedral or triple reflector type
- G02B5/124—Reflex reflectors cube corner, trihedral or triple reflector type plural reflecting elements forming part of a unitary plate or sheet
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S428/00—Stock material or miscellaneous articles
- Y10S428/913—Material designed to be responsive to temperature, light, moisture
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T156/00—Adhesive bonding and miscellaneous chemical manufacture
- Y10T156/10—Methods of surface bonding and/or assembly therefor
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T428/00—Stock material or miscellaneous articles
- Y10T428/24—Structurally defined web or sheet [e.g., overall dimension, etc.]
- Y10T428/24777—Edge feature
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T428/00—Stock material or miscellaneous articles
- Y10T428/31504—Composite [nonstructural laminate]
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T428/00—Stock material or miscellaneous articles
- Y10T428/31504—Composite [nonstructural laminate]
- Y10T428/31855—Of addition polymer from unsaturated monomers
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Optical Elements Other Than Lenses (AREA)
- Illuminated Signs And Luminous Advertising (AREA)
- Adhesive Tapes (AREA)
- Laminated Bodies (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/625,156 US5882796A (en) | 1996-04-01 | 1996-04-01 | Bonded structured retroreflective sheeting |
| US08/625,156 | 1996-04-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2248367A1 true CA2248367A1 (en) | 1997-10-09 |
Family
ID=24504835
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002248367A Abandoned CA2248367A1 (en) | 1996-04-01 | 1996-07-29 | Bonded structured retroreflective sheeting |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US5882796A (enExample) |
| EP (1) | EP0891567B1 (enExample) |
| JP (1) | JP2000508088A (enExample) |
| KR (1) | KR20000005164A (enExample) |
| CN (1) | CN1128375C (enExample) |
| AT (1) | ATE241152T1 (enExample) |
| AU (1) | AU726046B2 (enExample) |
| BR (1) | BR9612595A (enExample) |
| CA (1) | CA2248367A1 (enExample) |
| DE (1) | DE69628339T2 (enExample) |
| WO (1) | WO1997037250A1 (enExample) |
Families Citing this family (60)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6224805B1 (en) * | 1998-11-02 | 2001-05-01 | Rohm And Haas Company | Process and apparatus for forming plastic sheet |
| US6159878A (en) * | 1999-01-12 | 2000-12-12 | Omniglow Corporation | Layered reflecting and photoluminous fire resistant material |
| USD562568S1 (en) | 2004-08-17 | 2008-02-26 | Johnston Nik L | Two-dimensional sheet material |
| US20080190470A1 (en) * | 1999-01-28 | 2008-08-14 | Johnston Nik L | Golfing accessory |
| AU3584400A (en) * | 1999-01-28 | 2000-08-18 | Going For It, Llc | Article of manufacture having illusion of dimpled golf ball surface and method of creating the same |
| US6274221B2 (en) * | 1999-01-29 | 2001-08-14 | 3M Innovative Properties Company | Angular brightness microprismatic retroreflective film or sheeting incorporating a syndiotactic vinyl aromatic polymer |
| CN1100671C (zh) * | 1999-05-04 | 2003-02-05 | 李美琴 | 一种反光件的制造方法 |
| KR20010081460A (ko) * | 2000-02-14 | 2001-08-29 | 황건이 | 역반사 시트 |
| US7066800B2 (en) * | 2000-02-17 | 2006-06-27 | Applied Materials Inc. | Conductive polishing article for electrochemical mechanical polishing |
| JP2001273804A (ja) * | 2000-03-28 | 2001-10-05 | Koito Mfg Co Ltd | 車両用灯具 |
| JP2004507063A (ja) * | 2000-08-23 | 2004-03-04 | ダナ・コーポレーション | 燃料電池アセンブリ用エポキシニトリル絶縁体および密封体 |
| US6824874B1 (en) | 2000-08-23 | 2004-11-30 | Dana Corporation | Insulator and seal for fuel cell assemblies |
| US7220786B1 (en) | 2000-08-23 | 2007-05-22 | Dana Corporation | Ultraviolet radiation curable coating for MLS head gasket applications |
| JP2003029011A (ja) * | 2001-07-06 | 2003-01-29 | Three M Innovative Properties Co | 反射積層体及び再帰反射標識 |
| JP2003302510A (ja) * | 2002-04-05 | 2003-10-24 | Three M Innovative Properties Co | 反射シート |
| JP2003315516A (ja) * | 2002-04-18 | 2003-11-06 | Three M Innovative Properties Co | 反射積層体 |
| US7196120B2 (en) * | 2002-08-29 | 2007-03-27 | Dana Corporation | Ultraviolet radiation curable coating for MLS head gasket applications |
| USD487246S1 (en) | 2002-09-05 | 2004-03-02 | Polaris Industries Inc. | Embellishment for a watercraft grab handle |
| US20050282029A1 (en) * | 2004-06-18 | 2005-12-22 | 3M Innovative Properties Company | Polymerizable composition and articles therefrom |
| US7150771B2 (en) * | 2004-06-18 | 2006-12-19 | 3M Innovative Properties Company | Coated abrasive article with composite tie layer, and method of making and using the same |
| US7150770B2 (en) * | 2004-06-18 | 2006-12-19 | 3M Innovative Properties Company | Coated abrasive article with tie layer, and method of making and using the same |
| US6925965B1 (en) | 2004-07-28 | 2005-08-09 | Nite Glow Industries, Inc. | Omnidirectional reflective pet leash |
| US7219626B2 (en) * | 2004-07-28 | 2007-05-22 | Nite Glow Industries, Inc. | Pet toy having omnidirectional reflectivity |
| US7549399B2 (en) * | 2004-07-28 | 2009-06-23 | Nite Glow Industries, Inc. | Abrasion resistant omnidirectionally reflective retractable pet leash |
| US7331311B2 (en) * | 2004-07-28 | 2008-02-19 | Nite Glow Industries, Inc. | Abrasion resistant omnidirectionally reflective rope |
| US9730429B2 (en) | 2004-07-28 | 2017-08-15 | Nite Glow Industries, Inc. | Abrasion resistant omnidirectionally reflective retractable pet leash |
| US7204206B2 (en) * | 2004-07-28 | 2007-04-17 | Nite Glow Industries, Inc. | Abrasion resistant omnidirectionally reflective pet leash |
| US7246477B2 (en) * | 2004-07-28 | 2007-07-24 | Nite Glow Industries, Inc. | Omnidirectionally reflective horse halter |
| US7204207B2 (en) * | 2004-07-28 | 2007-04-17 | Nite Glow Industries, Inc. | Abrasion resistant omnidirectionally reflective jewelry |
| US20110203533A1 (en) * | 2004-07-28 | 2011-08-25 | Marni Markell Hurwitz | Flat, braided, omnidirectionally reflective collar and leash |
| US9247717B2 (en) | 2004-07-28 | 2016-02-02 | Nite Glow Industries, Inc. | Retractable flat belt reflective pet leash |
| USD609923S1 (en) | 2004-08-17 | 2010-02-16 | Going For It, Llc | Two-dimensional sheet material |
| EP1844354A1 (en) * | 2005-01-31 | 2007-10-17 | Reflexite Corporation | Fabric backed roll-up sign material and garment tapes |
| KR20060133169A (ko) * | 2005-06-20 | 2006-12-26 | 삼성전자주식회사 | 휘도 강화 필름 및 이를 구비하는 액정 표시 장치 |
| US7344575B2 (en) * | 2005-06-27 | 2008-03-18 | 3M Innovative Properties Company | Composition, treated backing, and abrasive articles containing the same |
| US7344574B2 (en) * | 2005-06-27 | 2008-03-18 | 3M Innovative Properties Company | Coated abrasive article, and method of making and using the same |
| US9207373B2 (en) | 2007-04-10 | 2015-12-08 | Stoncor Group, Inc. | Methods for fabrication and highway marking usage of agglomerated retroreflective beads |
| US7997235B2 (en) * | 2008-10-02 | 2011-08-16 | NITE Glow INDUSTRIES | Omnidirectionally reflective pet leash |
| US9291752B2 (en) | 2013-08-19 | 2016-03-22 | 3M Innovative Properties Company | Retroreflecting optical construction |
| TWI605276B (zh) | 2009-04-15 | 2017-11-11 | 3M新設資產公司 | 光學結構及包含該光學結構之顯示系統 |
| JP5727460B2 (ja) | 2009-04-15 | 2015-06-03 | スリーエム イノベイティブ プロパティズ カンパニー | 光結合を防止するための光学フィルム |
| BRPI1006654A2 (pt) | 2009-04-15 | 2016-02-10 | 3M Innovative Properties Co | construções ópticas retrorrefletoras e filmes ópticos |
| KR101770837B1 (ko) | 2009-04-15 | 2017-08-23 | 쓰리엠 이노베이티브 프로퍼티즈 컴파니 | 공극을 포함하는 광학 필름을 구비한 도광체 및 디스플레이 시스템용 백라이트 |
| US8197074B2 (en) * | 2009-08-21 | 2012-06-12 | Nite Glow Industries, Inc. | Omnidirectionally reflective buoyant rope |
| EP3495134B1 (en) | 2010-04-15 | 2020-11-25 | 3M Innovative Properties Co. | Retroreflective articles including optically active areas and optically inactive areas |
| CN102858528B (zh) | 2010-04-15 | 2016-05-11 | 3M创新有限公司 | 包括光学活性区域和光学非活性区域的回射制品 |
| CN102844175B (zh) * | 2010-04-15 | 2016-08-03 | 3M创新有限公司 | 包括光学活性区域和无光学活性区域的回射制品 |
| US20160011346A1 (en) | 2014-07-14 | 2016-01-14 | Sergiy Vasylyev | High incidence angle retroreflective sheeting |
| AT516778A1 (de) * | 2015-01-29 | 2016-08-15 | Constantia Hueck Folien Gmbh & Co Kg | Folienlaminat mit Siegelschicht |
| CA3005722C (en) * | 2015-11-06 | 2023-11-21 | 10X Technology Llc | Retroreflective traffic sign and process and apparatus for manufacturing same |
| US10793228B2 (en) | 2016-12-02 | 2020-10-06 | Polaris Industries Inc. | Structure and assembly for recessed deck portion in pontoon boat |
| DE102017123310A1 (de) * | 2017-10-06 | 2019-04-11 | Erich Utsch Ag | Tripelspiegelfolie für ein Verkehrs- und/oder Kfz-Kennzeichenschild, Retroreflektierendes Schild, Verfahren zur Herstellung einer Tripelspiegelfolie und Verfahren zur Herstellung eines retroreflektierenden Schilds |
| JP7352538B2 (ja) * | 2018-03-27 | 2023-09-28 | 日本カーバイド工業株式会社 | 再帰反射シートの製造方法及び再帰反射シート |
| JPWO2020022063A1 (ja) * | 2018-07-23 | 2021-08-05 | 三菱ケミカル株式会社 | 再帰反射シート用アクリル樹脂フィルムおよび再帰反射シート |
| JP7199284B2 (ja) * | 2019-03-28 | 2023-01-05 | 日本カーバイド工業株式会社 | 再帰反射シート |
| JP7336900B2 (ja) * | 2019-07-08 | 2023-09-01 | 日本カーバイド工業株式会社 | 再帰反射シート |
| US11192610B2 (en) | 2019-10-30 | 2021-12-07 | Polaris Industies Inc. | Multiple chine pontoon boat |
| US11992131B2 (en) | 2020-03-31 | 2024-05-28 | Polaris Industries Inc. | Adjustable seat for a boat |
| CN112140675A (zh) * | 2020-09-18 | 2020-12-29 | 深圳市鲁工材料科技实验室 | 一种无痕粘接的逆反射复合膜及用其编织装饰材料的方法 |
| US11567246B1 (en) | 2021-09-10 | 2023-01-31 | 10X Technology Llc | Retroreflective traffic sign and process and apparatus for manufacturing same |
Family Cites Families (81)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3190178A (en) * | 1961-06-29 | 1965-06-22 | Minnesota Mining & Mfg | Reflex-reflecting sheeting |
| US3176584A (en) * | 1961-10-11 | 1965-04-06 | Prismo Safety Corp | Reflex reflective sheeting and method of making same |
| US3810804A (en) * | 1970-09-29 | 1974-05-14 | Rowland Dev Corp | Method of making retroreflective material |
| US3689346A (en) * | 1970-09-29 | 1972-09-05 | Rowland Dev Corp | Method for producing retroreflective material |
| US3712706A (en) * | 1971-01-04 | 1973-01-23 | American Cyanamid Co | Retroreflective surface |
| US3811983A (en) * | 1972-06-23 | 1974-05-21 | Rowland Dev Corp | Method for producing retroreflective sheeting |
| US4025159A (en) * | 1976-02-17 | 1977-05-24 | Minnesota Mining And Manufacturing Company | Cellular retroreflective sheeting |
| US4111876A (en) * | 1976-03-30 | 1978-09-05 | Union Carbide Corporation | Impact modifiers for polyvinyl chloride |
| US4349598A (en) * | 1976-12-01 | 1982-09-14 | Minnesota Mining And Manufacturing Company | High incidence angle retroreflective material |
| US4123140A (en) * | 1977-06-30 | 1978-10-31 | Ferro Corporation | Reflecting sheeting having wide angle response |
| AU4673679A (en) * | 1979-05-07 | 1980-11-13 | Ferro Corporation | Retroreflective marking tape |
| US4202948A (en) * | 1977-09-26 | 1980-05-13 | Uniroyal, Inc. | Impact-resistant thermoplastic composition based on graft copolymer |
| JPS54114546A (en) * | 1978-02-23 | 1979-09-06 | Ibm | Coating method and apparatus therefor |
| US4345543A (en) * | 1978-02-23 | 1982-08-24 | International Business Machines Corporation | Apparatus for forming a coating on a substrate |
| US4202600A (en) * | 1978-04-24 | 1980-05-13 | Avery International Corporation | Diced retroreflective sheeting |
| US4576850A (en) * | 1978-07-20 | 1986-03-18 | Minnesota Mining And Manufacturing Company | Shaped plastic articles having replicated microstructure surfaces |
| US4243618A (en) * | 1978-10-23 | 1981-01-06 | Avery International Corporation | Method for forming retroreflective sheeting |
| US4332847A (en) * | 1979-09-20 | 1982-06-01 | Relfexite Corporation | Method for compression molding of retroreflective sheeting and sheeting produced thereby |
| DE3006804A1 (de) * | 1980-02-23 | 1981-09-10 | Bayer Ag, 5090 Leverkusen | Kerbschlagzaehe polymerisate mit verbesserter witterungsbestaendigkeit |
| US4442144A (en) * | 1980-11-17 | 1984-04-10 | International Business Machines Corporation | Method for forming a coating on a substrate |
| US4393171A (en) * | 1981-02-26 | 1983-07-12 | Labofina, S.A. | Process for preparing rubbery polymer reinforced styrenic resins |
| US4387124A (en) * | 1981-10-29 | 1983-06-07 | International Business Machines Corporation | Coating apparatus and method |
| US4436871A (en) * | 1982-05-10 | 1984-03-13 | Rohm And Haas Company | Imide-san polymer-blends |
| US4391948A (en) * | 1982-06-25 | 1983-07-05 | Borg-Warner Chemicals, Inc. | Emulsion/suspension ASA graft copolymers as flow modifiers for PVC |
| US4418120A (en) * | 1982-07-19 | 1983-11-29 | Minnesota Mining And Manufacturing Co. | Tackified crosslinked acrylic adhesives |
| US4438171A (en) * | 1982-08-09 | 1984-03-20 | Uniroyal, Inc. | Coextruded product of AES-thermoplastic graft copolymer |
| US4444840A (en) * | 1982-08-09 | 1984-04-24 | Uniroyal, Inc. | Calendered AES film |
| US4440825A (en) * | 1982-08-09 | 1984-04-03 | Uniroyal, Inc. | Laminate with skin based on AES graft copolymer |
| US4444841A (en) * | 1982-08-09 | 1984-04-24 | Uniroyal, Inc. | Extruded AES film |
| US4601861A (en) * | 1982-09-30 | 1986-07-22 | Amerace Corporation | Methods and apparatus for embossing a precision optical pattern in a resinous sheet or laminate |
| DE3312541A1 (de) * | 1983-04-07 | 1984-10-11 | Bayer Ag, 5090 Leverkusen | Pfropfpolymerisat enthaltende polymerisatpulver |
| US4588258A (en) * | 1983-09-12 | 1986-05-13 | Minnesota Mining And Manufacturing Company | Cube-corner retroreflective articles having wide angularity in multiple viewing planes |
| US4562229A (en) * | 1983-10-12 | 1985-12-31 | Occidental Chemical Corporation | Blends of polyolefin graft polymers and SMA polymers |
| US4587297A (en) * | 1983-10-12 | 1986-05-06 | Occidental Chemical Corporation | Blends of polyolefin-vinyl chloride graft polymers and condensation polymers |
| US4537933A (en) * | 1983-10-12 | 1985-08-27 | Occidental Chemical Corporation | Blends of polyolefin graft polymers and ASA polymers |
| US4528328A (en) * | 1983-10-12 | 1985-07-09 | Occidental Chemical Corporation | Blends of vinyl halide-polyolefin graft polymers and ASA polymers |
| DE3429523A1 (de) * | 1984-08-10 | 1986-02-20 | Alkor GmbH Kunststoffe, 8000 München | Schaumlaminatfolie oder -bahn |
| US4672089A (en) * | 1984-08-10 | 1987-06-09 | Amerace Corporation | Retroreflective sheeting |
| US4652274A (en) * | 1985-08-07 | 1987-03-24 | Minnesota Mining And Manufacturing Company | Coated abrasive product having radiation curable binder |
| US5064272A (en) * | 1985-11-18 | 1991-11-12 | Minnesota Mining And Manufacturing Company | Encapsulated-lens retroreflective sheeting and method of making |
| DE3615607A1 (de) * | 1986-05-09 | 1987-11-12 | Basf Ag | Thermoplastische formmasse auf basis von polycarbonat, asa und vinylaromaten/an enthaltenden copolymerisaten |
| US4831079A (en) * | 1986-06-20 | 1989-05-16 | General Electric Company | Blends of an ASA terpolymer, an acrylic polymer and an acrylate based impact modifier |
| US4731414A (en) * | 1986-06-20 | 1988-03-15 | General Electric Company | Blends of an ASA terpolymer, an acrylic polymer and an acrylate based impact modifier |
| US4751138A (en) * | 1986-08-11 | 1988-06-14 | Minnesota Mining And Manufacturing Company | Coated abrasive having radiation curable binder |
| US4775219A (en) * | 1986-11-21 | 1988-10-04 | Minnesota Mining & Manufacturing Company | Cube-corner retroreflective articles having tailored divergence profiles |
| US5070142A (en) * | 1986-12-31 | 1991-12-03 | General Electric Company | Polyetherimide-asa blends |
| US4983436A (en) * | 1987-04-15 | 1991-01-08 | Minnesota Mining And Manufacturing Company | Retroreflective sheeting with backing film |
| US5066098A (en) * | 1987-05-15 | 1991-11-19 | Minnesota Mining And Manufacturing Company | Cellular encapsulated-lens high whiteness retroreflective sheeting with flexible cover sheet |
| DE3720475A1 (de) * | 1987-06-20 | 1988-12-29 | Bayer Ag | Thermoplastische silikonkautschukpfropfpolymerisate (ii) |
| US4950696A (en) * | 1987-08-28 | 1990-08-21 | Minnesota Mining And Manufacturing Company | Energy-induced dual curable compositions |
| US4952612A (en) * | 1987-08-28 | 1990-08-28 | Minnesota Mining And Manufacturing Company | Energy-induced curable compositions |
| US4801193A (en) * | 1988-03-04 | 1989-01-31 | Reflexite Corporation | Retroreflective sheet material and method of making same |
| US4985340A (en) * | 1988-06-01 | 1991-01-15 | Minnesota Mining And Manufacturing Company | Energy curable compositions: two component curing agents |
| US4895428A (en) * | 1988-07-26 | 1990-01-23 | Minnesota Mining And Manufacturing Company | High efficiency retroreflective material |
| US4880554A (en) * | 1988-08-22 | 1989-11-14 | The Dow Chemical Company | Thermoplastic blend of polycarbonate, polymethylmethacrylate and AES |
| US5055113A (en) * | 1988-11-23 | 1991-10-08 | Minnesota Mining And Manufacturing Company | Abrasive product having binder comprising an aminoplast resin |
| US4903440A (en) * | 1988-11-23 | 1990-02-27 | Minnesota Mining And Manufacturing Company | Abrasive product having binder comprising an aminoplast resin |
| DE3839587A1 (de) * | 1988-11-24 | 1990-05-31 | Bayer Ag | Alterungsbestaendige thermoplastische formmassen mit hoher kerbschlagzaehigkeit und oberflaechenguete |
| US4894416A (en) * | 1988-12-27 | 1990-01-16 | General Electric Company | Low gloss thermoplastic blends |
| US4885335A (en) * | 1988-12-27 | 1989-12-05 | General Electric Company | Low gloss thermoplastic blends |
| IT1228300B (it) * | 1989-02-07 | 1991-06-07 | Montedipe Spa | Mescole compatibili di n aril poliglutarimmidi con copolimeri stirenici. |
| US5068285A (en) * | 1989-03-08 | 1991-11-26 | The Dow Chemical Company | Molding compositions with acrylonitrile-styrene-acrylate rubber copolymers |
| US5070665A (en) * | 1989-07-25 | 1991-12-10 | Adamen Inc. | Child's play panel |
| DE3939046A1 (de) * | 1989-11-25 | 1991-05-29 | Basf Ag | Thermoplastische formmassen mit hoher kaeltezaehigkeit |
| US5082897A (en) * | 1989-12-15 | 1992-01-21 | Monsanto Company | Polymer blends of polycarbonate, pctg and abs |
| US5104934A (en) * | 1989-12-15 | 1992-04-14 | Monsanto Company | Polymer blends of polycarbonate, PETG and ABS |
| DE4005210A1 (de) * | 1990-02-20 | 1991-08-22 | Basf Ag | Thermoplastische formmasse mit verbesserter zaehigkeit |
| DE4011162A1 (de) * | 1990-04-06 | 1991-10-10 | Basf Ag | Thermoplastische formmasse |
| US5117304A (en) * | 1990-09-21 | 1992-05-26 | Minnesota Mining And Manufacturing Company | Retroreflective article |
| US5236472A (en) * | 1991-02-22 | 1993-08-17 | Minnesota Mining And Manufacturing Company | Abrasive product having a binder comprising an aminoplast binder |
| GB2255044B (en) * | 1991-03-28 | 1993-03-24 | Swintex | Retro-reflective assembly |
| DE4111282A1 (de) * | 1991-04-08 | 1992-11-19 | Basf Ag | Thermoplastische transparente formmassen auf pmma-basis mit erhoehter spannungsrissbestaendigkeit |
| CA2064484C (en) * | 1991-04-11 | 1998-08-11 | William P. Rowland | Retroreflective sheet |
| US5213872A (en) * | 1991-04-19 | 1993-05-25 | Stimsonite Corporation | Preprinted retroreflective highway sign and method for making the sign |
| DE4211415C2 (de) * | 1992-04-04 | 1996-05-23 | Benecke Ag J H | Folie oder Formkörper aus einem mehrphasigen Kunststoff |
| US5306548A (en) * | 1992-05-20 | 1994-04-26 | The Dow Chemical Company | Coextruded weatherable film structures and laminates |
| US5272562A (en) * | 1993-02-05 | 1993-12-21 | Minnesota Mining And Manufacturing Company | Cube-corner retroreflective articles |
| US5648145A (en) * | 1993-09-10 | 1997-07-15 | Reflexite Corporation | Fire-resistant, retroreflective structure |
| US5450235A (en) * | 1993-10-20 | 1995-09-12 | Minnesota Mining And Manufacturing Company | Flexible cube-corner retroreflective sheeting |
| CN1040691C (zh) * | 1993-10-20 | 1998-11-11 | 美国3M公司 | 直接机加工凸出结构后向反射立方隅角制品及其制造方法 |
| ES2119357T3 (es) * | 1993-10-20 | 1998-10-01 | Minnesota Mining & Mfg | Estructuras laminares compuestas de esquinas cubicas retrorreflectoras ultraflexibles y metodos de fabricacion. |
-
1996
- 1996-04-01 US US08/625,156 patent/US5882796A/en not_active Expired - Lifetime
- 1996-07-29 JP JP9535230A patent/JP2000508088A/ja not_active Withdrawn
- 1996-07-29 KR KR1019980707833A patent/KR20000005164A/ko not_active Ceased
- 1996-07-29 EP EP96926181A patent/EP0891567B1/en not_active Expired - Lifetime
- 1996-07-29 AU AU66420/96A patent/AU726046B2/en not_active Ceased
- 1996-07-29 WO PCT/US1996/012461 patent/WO1997037250A1/en not_active Ceased
- 1996-07-29 CN CN96180238A patent/CN1128375C/zh not_active Expired - Fee Related
- 1996-07-29 DE DE69628339T patent/DE69628339T2/de not_active Expired - Lifetime
- 1996-07-29 CA CA002248367A patent/CA2248367A1/en not_active Abandoned
- 1996-07-29 BR BR9612595A patent/BR9612595A/pt not_active Application Discontinuation
- 1996-07-29 AT AT96926181T patent/ATE241152T1/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AU6642096A (en) | 1997-10-22 |
| CN1215477A (zh) | 1999-04-28 |
| ATE241152T1 (de) | 2003-06-15 |
| JP2000508088A (ja) | 2000-06-27 |
| KR20000005164A (ko) | 2000-01-25 |
| EP0891567B1 (en) | 2003-05-21 |
| US5882796A (en) | 1999-03-16 |
| DE69628339D1 (de) | 2003-06-26 |
| EP0891567A1 (en) | 1999-01-20 |
| BR9612595A (pt) | 1999-07-20 |
| CN1128375C (zh) | 2003-11-19 |
| DE69628339T2 (de) | 2004-04-29 |
| WO1997037250A1 (en) | 1997-10-09 |
| AU726046B2 (en) | 2000-10-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU726046B2 (en) | Bonded structured retroreflective sheeting | |
| EP0904554B1 (en) | Ultra-flexible retroreflective sheeting with coated back surface | |
| US5754338A (en) | Structured retroreflective sheeting having a rivet-like connection | |
| US5910858A (en) | Retroreflective sheeting with coated back surface | |
| WO1997037249A9 (en) | Ultra-flexible retroreflective sheeting with coated back surface | |
| EP0724737B1 (en) | Ultra-flexible retroreflective cube corner composite sheetings and methods of manufacture | |
| US5691846A (en) | Ultra-flexible retroreflective cube corner composite sheetings and methods of manufacture | |
| CA2242771C (en) | Dual orientation retroreflective sheeting | |
| KR20000065094A (ko) | 목적한광학특성을갖는초가요성역반사큐브코너복합시트및그제조방버뷰 | |
| KR20000065073A (ko) | 반짝이는큐브코너물체 | |
| EP0891568B1 (en) | Structured retroreflective sheeting having a rivet-like connection | |
| RU2173471C2 (ru) | Формованный сверхгибкий композитный световозвращающий листовой материал с кубическими уголковыми элементами, имеющий заданные оптические характеристики, и способ его изготовления | |
| HK1012717B (en) | Ultra-flexible retroreflective cube corner composite sheetings and methods of manufacture |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Discontinued |