CA2235782C - Germicidal dishwashing detergent compositions - Google Patents
Germicidal dishwashing detergent compositions Download PDFInfo
- Publication number
- CA2235782C CA2235782C CA002235782A CA2235782A CA2235782C CA 2235782 C CA2235782 C CA 2235782C CA 002235782 A CA002235782 A CA 002235782A CA 2235782 A CA2235782 A CA 2235782A CA 2235782 C CA2235782 C CA 2235782C
- Authority
- CA
- Canada
- Prior art keywords
- weight
- parts
- germicidal
- alkyl
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 144
- 230000002070 germicidal effect Effects 0.000 title claims abstract description 48
- 239000003599 detergent Substances 0.000 title claims abstract description 36
- 238000004851 dishwashing Methods 0.000 title claims abstract description 33
- -1 anionic alkyl ether carboxylate Chemical class 0.000 claims abstract description 69
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 42
- 239000002736 nonionic surfactant Substances 0.000 claims abstract description 34
- 238000004140 cleaning Methods 0.000 claims abstract description 32
- 150000001875 compounds Chemical class 0.000 claims abstract description 26
- 239000004094 surface-active agent Substances 0.000 claims abstract description 26
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 23
- 239000007788 liquid Substances 0.000 claims abstract description 16
- 239000000654 additive Substances 0.000 claims abstract description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 27
- 125000000217 alkyl group Chemical group 0.000 claims description 21
- 238000012360 testing method Methods 0.000 claims description 19
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 14
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 13
- 230000009467 reduction Effects 0.000 claims description 12
- 230000002209 hydrophobic effect Effects 0.000 claims description 11
- 150000001768 cations Chemical class 0.000 claims description 9
- 150000003254 radicals Chemical class 0.000 claims description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 8
- 230000000087 stabilizing effect Effects 0.000 claims description 8
- 241001138501 Salmonella enterica Species 0.000 claims description 7
- 241000191967 Staphylococcus aureus Species 0.000 claims description 7
- 238000005406 washing Methods 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 150000001408 amides Chemical class 0.000 claims description 5
- 238000010411 cooking Methods 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 4
- 239000000725 suspension Substances 0.000 claims description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 3
- 230000000249 desinfective effect Effects 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004171 alkoxy aryl group Chemical group 0.000 claims description 2
- 125000003368 amide group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 238000009833 condensation Methods 0.000 claims description 2
- 230000005494 condensation Effects 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 230000008569 process Effects 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims 2
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 claims 1
- 239000002202 Polyethylene glycol Substances 0.000 claims 1
- 229920001223 polyethylene glycol Polymers 0.000 claims 1
- 230000000694 effects Effects 0.000 abstract description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 abstract description 7
- 238000011012 sanitization Methods 0.000 abstract description 4
- 239000012895 dilution Substances 0.000 description 31
- 238000010790 dilution Methods 0.000 description 31
- 239000000470 constituent Substances 0.000 description 27
- 238000009472 formulation Methods 0.000 description 20
- 238000005187 foaming Methods 0.000 description 16
- 239000006260 foam Substances 0.000 description 12
- 229910052708 sodium Inorganic materials 0.000 description 11
- 235000002639 sodium chloride Nutrition 0.000 description 11
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- 239000003381 stabilizer Substances 0.000 description 9
- 235000014113 dietary fatty acids Nutrition 0.000 description 8
- 239000000194 fatty acid Substances 0.000 description 8
- 229930195729 fatty acid Natural products 0.000 description 8
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 7
- 239000003945 anionic surfactant Substances 0.000 description 7
- 230000000844 anti-bacterial effect Effects 0.000 description 7
- 229910052791 calcium Inorganic materials 0.000 description 7
- 150000004665 fatty acids Chemical class 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 239000003093 cationic surfactant Substances 0.000 description 6
- 239000003352 sequestering agent Substances 0.000 description 6
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 5
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 229960003237 betaine Drugs 0.000 description 5
- 239000011575 calcium Substances 0.000 description 5
- 238000011156 evaluation Methods 0.000 description 5
- 150000003138 primary alcohols Chemical class 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 4
- 241000894006 Bacteria Species 0.000 description 4
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 229940027983 antiseptic and disinfectant quaternary ammonium compound Drugs 0.000 description 4
- 239000000872 buffer Substances 0.000 description 4
- 239000008367 deionised water Substances 0.000 description 4
- 229910021641 deionized water Inorganic materials 0.000 description 4
- 239000003205 fragrance Substances 0.000 description 4
- 239000000499 gel Substances 0.000 description 4
- 229930182470 glycoside Natural products 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N protonated dimethyl amine Natural products CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 150000003868 ammonium compounds Chemical class 0.000 description 3
- 125000000129 anionic group Chemical group 0.000 description 3
- 230000000845 anti-microbial effect Effects 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 150000002338 glycosides Chemical class 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 229960003975 potassium Drugs 0.000 description 3
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 3
- 239000012898 sample dilution Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 2
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 2
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- AOMUHOFOVNGZAN-UHFFFAOYSA-N N,N-bis(2-hydroxyethyl)dodecanamide Chemical compound CCCCCCCCCCCC(=O)N(CCO)CCO AOMUHOFOVNGZAN-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 125000006177 alkyl benzyl group Chemical group 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 230000003377 anti-microbal effect Effects 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 230000001580 bacterial effect Effects 0.000 description 2
- 229960005069 calcium Drugs 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- MRUAUOIMASANKQ-UHFFFAOYSA-O carboxymethyl-[3-(dodecanoylamino)propyl]-dimethylazanium Chemical compound CCCCCCCCCCCC(=O)NCCC[N+](C)(C)CC(O)=O MRUAUOIMASANKQ-UHFFFAOYSA-O 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 239000000645 desinfectant Substances 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 125000002791 glucosyl group Chemical group C1([C@H](O)[C@@H](O)[C@H](O)[C@H](O1)CO)* 0.000 description 2
- 125000001165 hydrophobic group Chemical group 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000000787 lecithin Substances 0.000 description 2
- 235000010445 lecithin Nutrition 0.000 description 2
- 229940067606 lecithin Drugs 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 150000002772 monosaccharides Chemical class 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 150000002892 organic cations Chemical class 0.000 description 2
- 125000000963 oxybis(methylene) group Chemical group [H]C([H])(*)OC([H])([H])* 0.000 description 2
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 2
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 2
- 229920000053 polysorbate 80 Polymers 0.000 description 2
- 229940068968 polysorbate 80 Drugs 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 230000000063 preceeding effect Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 230000003381 solubilizing effect Effects 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- 239000006150 trypticase soy agar Substances 0.000 description 2
- YGKOYVNJPRSSRX-UHFFFAOYSA-M (4-dodecylphenyl)methyl-trimethylazanium;chloride Chemical compound [Cl-].CCCCCCCCCCCCC1=CC=C(C[N+](C)(C)C)C=C1 YGKOYVNJPRSSRX-UHFFFAOYSA-M 0.000 description 1
- GQNZWGIEBRBTOZ-UHFFFAOYSA-N (hexadecylamino)methyl-dimethyl-phenylazanium Chemical compound CCCCCCCCCCCCCCCCNC[N+](C)(C)C1=CC=CC=C1 GQNZWGIEBRBTOZ-UHFFFAOYSA-N 0.000 description 1
- AEQDJSLRWYMAQI-UHFFFAOYSA-N 2,3,9,10-tetramethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline Chemical compound C1CN2CC(C(=C(OC)C=C3)OC)=C3CC2C2=C1C=C(OC)C(OC)=C2 AEQDJSLRWYMAQI-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- URDCARMUOSMFFI-UHFFFAOYSA-N 2-[2-[bis(carboxymethyl)amino]ethyl-(2-hydroxyethyl)amino]acetic acid Chemical compound OCCN(CC(O)=O)CCN(CC(O)=O)CC(O)=O URDCARMUOSMFFI-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- BDDLHHRCDSJVKV-UHFFFAOYSA-N 7028-40-2 Chemical compound CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O BDDLHHRCDSJVKV-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- OCUCCJIRFHNWBP-IYEMJOQQSA-L Copper gluconate Chemical class [Cu+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O OCUCCJIRFHNWBP-IYEMJOQQSA-L 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- VVNCNSJFMMFHPL-VKHMYHEASA-N D-penicillamine Chemical compound CC(C)(S)[C@@H](N)C(O)=O VVNCNSJFMMFHPL-VKHMYHEASA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical group OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- RSPISYXLHRIGJD-UHFFFAOYSA-N OOOO Chemical compound OOOO RSPISYXLHRIGJD-UHFFFAOYSA-N 0.000 description 1
- 229920002257 Plurafac® Polymers 0.000 description 1
- RVGRUAULSDPKGF-UHFFFAOYSA-N Poloxamer Chemical compound C1CO1.CC1CO1 RVGRUAULSDPKGF-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- 229910006146 SO3M1 Inorganic materials 0.000 description 1
- SDZMETJIBMTWQC-UHFFFAOYSA-N [K].CC(=O)ON(OC(C)=O)OC(C)=O Chemical class [K].CC(=O)ON(OC(C)=O)OC(C)=O SDZMETJIBMTWQC-UHFFFAOYSA-N 0.000 description 1
- VXLCKSFMONBCLQ-UHFFFAOYSA-N [Na]CC[Na] Chemical group [Na]CC[Na] VXLCKSFMONBCLQ-UHFFFAOYSA-N 0.000 description 1
- PVTDRWOKWUJOIU-UHFFFAOYSA-M [ethoxy-(2-octylphenyl)-phenoxymethyl]-ethyl-dimethylazanium;chloride Chemical compound [Cl-].CCCCCCCCC1=CC=CC=C1C(OCC)([N+](C)(C)CC)OC1=CC=CC=C1 PVTDRWOKWUJOIU-UHFFFAOYSA-M 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000318 alkali metal phosphate Inorganic materials 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- LHIJANUOQQMGNT-UHFFFAOYSA-N aminoethylethanolamine Chemical compound NCCNCCO LHIJANUOQQMGNT-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- HDHICXMXQDZNGS-UHFFFAOYSA-N azanium dimethylazanium dichloride Chemical compound [Cl-].[NH4+].[Cl-].C[NH2+]C HDHICXMXQDZNGS-UHFFFAOYSA-N 0.000 description 1
- UREZNYTWGJKWBI-UHFFFAOYSA-M benzethonium chloride Chemical compound [Cl-].C1=CC(C(C)(C)CC(C)(C)C)=CC=C1OCCOCC[N+](C)(C)CC1=CC=CC=C1 UREZNYTWGJKWBI-UHFFFAOYSA-M 0.000 description 1
- VZWMKHUMEIECPK-UHFFFAOYSA-M benzyl-dimethyl-octadecylazanium;bromide Chemical compound [Br-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 VZWMKHUMEIECPK-UHFFFAOYSA-M 0.000 description 1
- XIWFQDBQMCDYJT-UHFFFAOYSA-M benzyl-dimethyl-tridecylazanium;chloride Chemical class [Cl-].CCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 XIWFQDBQMCDYJT-UHFFFAOYSA-M 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- 239000001354 calcium citrate Substances 0.000 description 1
- 239000001427 calcium tartrate Substances 0.000 description 1
- 235000011035 calcium tartrate Nutrition 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001767 cationic compounds Chemical class 0.000 description 1
- DVBJBNKEBPCGSY-UHFFFAOYSA-M cetylpyridinium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+]1=CC=CC=C1 DVBJBNKEBPCGSY-UHFFFAOYSA-M 0.000 description 1
- 101150082996 cfl1 gene Proteins 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 229940098691 coco monoethanolamide Drugs 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 229940043237 diethanolamine Drugs 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-O diethylammonium Chemical compound CC[NH2+]CC HPNMFZURTQLUMO-UHFFFAOYSA-O 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- KOEHFKDKKINDQG-UHFFFAOYSA-N dimethyl-phenyl-tridecylazanium Chemical compound CCCCCCCCCCCCC[N+](C)(C)C1=CC=CC=C1 KOEHFKDKKINDQG-UHFFFAOYSA-N 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- LHGPSNLCXCBBLU-UHFFFAOYSA-M dodecoxymethyl-dimethyl-phenylazanium;chloride Chemical compound [Cl-].CCCCCCCCCCCCOC[N+](C)(C)C1=CC=CC=C1 LHGPSNLCXCBBLU-UHFFFAOYSA-M 0.000 description 1
- QKHKGSULBQVNMO-UHFFFAOYSA-N dodecyl(dimethyl)azanium;hexanoate Chemical compound CCCCCC([O-])=O.CCCCCCCCCCCC[NH+](C)C QKHKGSULBQVNMO-UHFFFAOYSA-N 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000007046 ethoxylation reaction Methods 0.000 description 1
- 235000021149 fatty food Nutrition 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000004872 foam stabilizing agent Substances 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000004820 halides Chemical group 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 229910001411 inorganic cation Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 239000008204 material by function Substances 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- YWFWDNVOPHGWMX-UHFFFAOYSA-N n,n-dimethyldodecan-1-amine Chemical compound CCCCCCCCCCCCN(C)C YWFWDNVOPHGWMX-UHFFFAOYSA-N 0.000 description 1
- DVEKCXOJTLDBFE-UHFFFAOYSA-N n-dodecyl-n,n-dimethylglycinate Chemical compound CCCCCCCCCCCC[N+](C)(C)CC([O-])=O DVEKCXOJTLDBFE-UHFFFAOYSA-N 0.000 description 1
- QPUKANZXOGADOB-UHFFFAOYSA-N n-dodecyl-n-methylnitrous amide Chemical compound CCCCCCCCCCCCN(C)N=O QPUKANZXOGADOB-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000006174 pH buffer Substances 0.000 description 1
- 230000008447 perception Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920005646 polycarboxylate Polymers 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- KYKNRZGSIGMXFH-ZVGUSBNCSA-M potassium bitartrate Chemical compound [K+].OC(=O)[C@H](O)[C@@H](O)C([O-])=O KYKNRZGSIGMXFH-ZVGUSBNCSA-M 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 239000001508 potassium citrate Substances 0.000 description 1
- 229960002635 potassium citrate Drugs 0.000 description 1
- QEEAPRPFLLJWCF-UHFFFAOYSA-K potassium citrate (anhydrous) Chemical compound [K+].[K+].[K+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O QEEAPRPFLLJWCF-UHFFFAOYSA-K 0.000 description 1
- 235000011082 potassium citrates Nutrition 0.000 description 1
- AVTYONGGKAJVTE-UHFFFAOYSA-L potassium tartrate Chemical compound [K+].[K+].[O-]C(=O)C(O)C(O)C([O-])=O AVTYONGGKAJVTE-UHFFFAOYSA-L 0.000 description 1
- 239000001472 potassium tartrate Substances 0.000 description 1
- 229940111695 potassium tartrate Drugs 0.000 description 1
- 235000011005 potassium tartrates Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000518 rheometry Methods 0.000 description 1
- 229940083542 sodium Drugs 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- 239000000176 sodium gluconate Substances 0.000 description 1
- 235000012207 sodium gluconate Nutrition 0.000 description 1
- 229940005574 sodium gluconate Drugs 0.000 description 1
- 235000019982 sodium hexametaphosphate Nutrition 0.000 description 1
- GCLGEJMYGQKIIW-UHFFFAOYSA-H sodium hexametaphosphate Chemical compound [Na]OP1(=O)OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])O1 GCLGEJMYGQKIIW-UHFFFAOYSA-H 0.000 description 1
- 235000019830 sodium polyphosphate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000001433 sodium tartrate Substances 0.000 description 1
- 229960002167 sodium tartrate Drugs 0.000 description 1
- 235000011004 sodium tartrates Nutrition 0.000 description 1
- FVEFRICMTUKAML-UHFFFAOYSA-M sodium tetradecyl sulfate Chemical compound [Na+].CCCCC(CC)CCC(CC(C)C)OS([O-])(=O)=O FVEFRICMTUKAML-UHFFFAOYSA-M 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000007655 standard test method Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- JZBRFIUYUGTUGG-UHFFFAOYSA-J tetrapotassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical compound [K+].[K+].[K+].[K+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O JZBRFIUYUGTUGG-UHFFFAOYSA-J 0.000 description 1
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 1
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 1
- 239000001226 triphosphate Substances 0.000 description 1
- 235000011178 triphosphate Nutrition 0.000 description 1
- 125000002264 triphosphate group Chemical class [H]OP(=O)(O[H])OP(=O)(O[H])OP(=O)(O[H])O* 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/0005—Other compounding ingredients characterised by their effect
- C11D3/0094—High foaming compositions
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/66—Non-ionic compounds
- C11D1/83—Mixtures of non-ionic with anionic compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/86—Mixtures of anionic, cationic, and non-ionic compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/48—Medical, disinfecting agents, disinfecting, antibacterial, germicidal or antimicrobial compositions
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/02—Anionic compounds
- C11D1/04—Carboxylic acids or salts thereof
- C11D1/06—Ether- or thioether carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/38—Cationic compounds
- C11D1/62—Quaternary ammonium compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/66—Non-ionic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB9521837.6A GB9521837D0 (en) | 1995-10-25 | 1995-10-25 | Improved compositions containing organic compounds |
| GB9521837.6 | 1995-10-25 | ||
| PCT/US1996/015462 WO1997015647A1 (en) | 1995-10-25 | 1996-09-27 | Germicidal dishwashing detergent compositions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CA2235782A1 CA2235782A1 (en) | 1997-05-01 |
| CA2235782C true CA2235782C (en) | 2009-02-17 |
Family
ID=10782881
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002235782A Expired - Lifetime CA2235782C (en) | 1995-10-25 | 1996-09-27 | Germicidal dishwashing detergent compositions |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US5728667A (enEXAMPLES) |
| EP (1) | EP0904344B1 (enEXAMPLES) |
| CN (1) | CN1103364C (enEXAMPLES) |
| AR (1) | AR004520A1 (enEXAMPLES) |
| AU (1) | AU721966B2 (enEXAMPLES) |
| BR (1) | BR9611155A (enEXAMPLES) |
| CA (1) | CA2235782C (enEXAMPLES) |
| DE (1) | DE69631436T2 (enEXAMPLES) |
| ES (1) | ES2210397T3 (enEXAMPLES) |
| GB (2) | GB9521837D0 (enEXAMPLES) |
| IN (1) | IN187239B (enEXAMPLES) |
| NZ (1) | NZ321730A (enEXAMPLES) |
| WO (1) | WO1997015647A1 (enEXAMPLES) |
| ZA (1) | ZA968889B (enEXAMPLES) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2304112A (en) * | 1995-08-04 | 1997-03-12 | Reckitt & Colman Inc | Pine oil cleaning compositions |
| US6339057B1 (en) | 1997-04-14 | 2002-01-15 | Stepan Company | High foaming detergent composition having a non-ionic surfactant base |
| US5858941A (en) * | 1997-05-12 | 1999-01-12 | Ecolab Inc. | Compositions and method for removal of oils and fats from food preparation surfaces |
| US5929024A (en) * | 1997-11-20 | 1999-07-27 | Colgate Palmolive Company | Cleaning compositions |
| GB2336371B (en) * | 1998-04-14 | 2002-05-08 | Reckitt & Colman Inc | Aqueous disinfecting and cleaning compositions |
| GB2338242A (en) * | 1998-06-10 | 1999-12-15 | Reckitt & Colman Inc | Germicidal laundry detergent |
| US6140289A (en) * | 2000-01-24 | 2000-10-31 | Colgate-Palmolive Company | Antimicrobial cleaning composition containing a cationic surfactant |
| US6387871B2 (en) | 2000-04-14 | 2002-05-14 | Alticor Inc. | Hard surface cleaner containing an alkyl polyglycoside |
| US6187735B1 (en) * | 2000-05-05 | 2001-02-13 | Colgate-Palmolive Co | Light duty liquid detergent |
| US6369013B1 (en) * | 2000-05-05 | 2002-04-09 | Colgate-Palmolive Co | Liquid detergent compositions |
| WO2002021916A2 (en) * | 2000-09-14 | 2002-03-21 | Stepan Company | Antimicrobial ternary surfactant blend comprising cationic, anionic, and bridging surfactants, and methods of preparing same |
| GB0023898D0 (en) * | 2000-09-29 | 2000-11-15 | Reckitt Benckiser Inc | Improvements in or relating to organic compositions |
| US20020183233A1 (en) * | 2000-12-14 | 2002-12-05 | The Clorox Company, Delaware Corporation | Bactericidal cleaning wipe |
| US20030100465A1 (en) * | 2000-12-14 | 2003-05-29 | The Clorox Company, A Delaware Corporation | Cleaning composition |
| US7799751B2 (en) * | 2000-12-14 | 2010-09-21 | The Clorox Company | Cleaning composition |
| GB0031827D0 (en) | 2000-12-29 | 2001-02-14 | Unilever Plc | Detergent compositions |
| GB0031823D0 (en) | 2000-12-29 | 2001-02-14 | Unilever Plc | Detergent compositions |
| US6616922B2 (en) | 2001-03-27 | 2003-09-09 | The Dial Corporation | Antibacterial compositions |
| US6395698B1 (en) * | 2001-06-11 | 2002-05-28 | Mason Chemical Company | Corrosion resistant sanitizing/disinfecting cleaning and wood preservative formulation |
| GB2391234A (en) * | 2002-07-24 | 2004-02-04 | Reckitt Benckiser Inc | Hard surface cleaning compositions |
| WO2007079022A2 (en) * | 2005-12-30 | 2007-07-12 | The Dial Corporation | Antibacterial compositions comprising quaternary ammonium germicides and alkamine oxides having reduced irritation potential |
| US7244453B1 (en) | 2006-01-24 | 2007-07-17 | Lucia Mihalchick Litman | Anti-chlorine shampoo composition |
| ES2293826B1 (es) * | 2006-06-07 | 2008-12-16 | Kao Corporation S.A. | Composicion detergente. |
| JP2010226089A (ja) * | 2009-01-14 | 2010-10-07 | Rohm & Haas Electronic Materials Llc | 半導体ウェハをクリーニングする方法 |
| GB201000122D0 (en) * | 2010-01-06 | 2010-02-17 | Reckitt & Colman Overseas | Antimicrobial hand soap composition |
| WO2012012049A2 (en) * | 2010-06-30 | 2012-01-26 | Huiwen Liu | Antimicrobial complexes |
| WO2017055205A1 (en) * | 2015-10-01 | 2017-04-06 | Unilever Plc | Powder laundry detergent composition |
| CN108112578A (zh) * | 2017-11-06 | 2018-06-05 | 中国人民解放军陆军防化学院 | 复配通用型消毒剂 |
| CN108126357A (zh) * | 2018-01-17 | 2018-06-08 | 厦门卡拉风娱乐有限公司 | 一种光致发光泡泡水组合物 |
| US10948027B2 (en) * | 2019-03-08 | 2021-03-16 | Schaeffler Technologies AG & Co. KG | Wet clutch friction plate |
| CN113874482A (zh) * | 2019-05-22 | 2021-12-31 | 雷克特本克斯尔有限责任公司 | 具有增强的病菌去除功效的洗涤剂配方 |
| CN117918351B (zh) * | 2024-01-18 | 2024-10-01 | 广东星帮尼科技股份有限公司 | 季铵盐消毒剂、制备方法及其在衣物清洁中的应用 |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1562961A (en) * | 1977-03-18 | 1980-03-19 | Unilever Ltd | Germicidal compositions |
| US4272395A (en) * | 1978-05-30 | 1981-06-09 | Lever Brothers Company | Germicidal compositions |
| US4264457A (en) * | 1980-02-04 | 1981-04-28 | Desoto, Inc. | Cationic liquid laundry detergent and fabric softener |
| JPS6030720B2 (ja) * | 1981-06-05 | 1985-07-18 | 花王株式会社 | 洗浄剤組成物 |
| US4493773A (en) * | 1982-05-10 | 1985-01-15 | The Procter & Gamble Company | Low phosphate, softening laundry detergent containing ethoxylated nonionic, alkylpolysaccharide and cationic surfactants |
| US4576729A (en) * | 1983-08-10 | 1986-03-18 | Sterling Drug Inc. | Liquid disinfectant laundry detergents |
| US4965063A (en) * | 1985-05-24 | 1990-10-23 | Irene Casey | Cleaner and disinfectant with dye |
| DE3639885A1 (de) * | 1986-11-21 | 1988-06-01 | Benckiser Gmbh Joh A | Reiniger mit desinfizierender wirkung |
| EP0295093B1 (en) * | 1987-06-12 | 1991-06-05 | Unilever Plc | Liquid machine dishwashing composition |
| FI902495A7 (fi) * | 1989-05-22 | 1990-11-23 | Procter & Gamble | Neste- tai geelimäinen astianpesudetergenttikoostumus, joka pinta-aktiivisena aineena sisältää alkyylietoksikarboksylaattia |
| US5230823A (en) * | 1989-05-22 | 1993-07-27 | The Procter & Gamble Company | Light-duty liquid or gel dishwashing detergent composition containing an alkyl ethoxy carboxylate surfactant |
| US5080830A (en) * | 1990-04-26 | 1992-01-14 | Akzo N.V. | Water-dispersible compositions comprised of quaternary ammonium compounds |
| US5378409A (en) * | 1990-11-16 | 1995-01-03 | The Procter & Gamble Co. | Light duty dishwashing detergent composition containing an alkyl ethoxy carboxylate surfactant and ions |
| US5409621A (en) * | 1991-03-25 | 1995-04-25 | Lever Brothers Company, Division Of Conopco, Inc. | Fabric softening composition |
| AU3729893A (en) * | 1992-03-16 | 1993-10-21 | Procter & Gamble Company, The | Fabric softening compositions containing mixtures of softener material and highly ethoxylated curd dispersant |
| US5399280A (en) * | 1993-07-22 | 1995-03-21 | The Procter & Gamble Company | Acidic liquid detergent compositions for bathrooms |
| US5415813A (en) * | 1993-11-22 | 1995-05-16 | Colgate-Palmolive Company | Liquid hard surface cleaning composition with grease release agent |
| JP2952555B2 (ja) * | 1993-12-28 | 1999-09-27 | 花王株式会社 | 硬質表面洗浄剤組成物 |
| EP0698660B1 (en) * | 1994-08-22 | 2001-09-26 | Kao Corporation | Detergent composition for hard surface |
| GB2309706B (en) * | 1996-01-31 | 2000-02-09 | Reckitt & Colman Inc | Liquid detergent composition comprising quaternary ammonium surfactant having germicidal properties |
-
1995
- 1995-10-25 GB GBGB9521837.6A patent/GB9521837D0/en active Pending
-
1996
- 1996-09-27 CN CN96198873A patent/CN1103364C/zh not_active Expired - Lifetime
- 1996-09-27 AU AU75133/96A patent/AU721966B2/en not_active Expired
- 1996-09-27 BR BR9611155A patent/BR9611155A/pt not_active IP Right Cessation
- 1996-09-27 EP EP96937641A patent/EP0904344B1/en not_active Expired - Lifetime
- 1996-09-27 DE DE69631436T patent/DE69631436T2/de not_active Expired - Lifetime
- 1996-09-27 ES ES96937641T patent/ES2210397T3/es not_active Expired - Lifetime
- 1996-09-27 WO PCT/US1996/015462 patent/WO1997015647A1/en active IP Right Grant
- 1996-09-27 NZ NZ321730A patent/NZ321730A/en unknown
- 1996-09-27 CA CA002235782A patent/CA2235782C/en not_active Expired - Lifetime
- 1996-10-07 IN IN2185DE1996 patent/IN187239B/en unknown
- 1996-10-17 GB GB9621631A patent/GB2306501B/en not_active Expired - Lifetime
- 1996-10-21 AR ARP960104834A patent/AR004520A1/es unknown
- 1996-10-23 ZA ZA9608889A patent/ZA968889B/xx unknown
-
1997
- 1997-03-19 US US08/820,096 patent/US5728667A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| BR9611155A (pt) | 1999-04-06 |
| US5728667A (en) | 1998-03-17 |
| CN1204360A (zh) | 1999-01-06 |
| AR004520A1 (es) | 1998-12-16 |
| ES2210397T3 (es) | 2004-07-01 |
| EP0904344A4 (enEXAMPLES) | 1999-03-31 |
| DE69631436T2 (de) | 2004-12-02 |
| ZA968889B (en) | 1997-08-05 |
| AU721966B2 (en) | 2000-07-20 |
| GB2306501A (en) | 1997-05-07 |
| NZ321730A (en) | 1999-10-28 |
| MX9803249A (es) | 1998-09-30 |
| CA2235782A1 (en) | 1997-05-01 |
| AU7513396A (en) | 1997-05-15 |
| EP0904344A1 (en) | 1999-03-31 |
| EP0904344B1 (en) | 2004-01-28 |
| IN187239B (enEXAMPLES) | 2002-03-09 |
| GB9521837D0 (en) | 1996-01-03 |
| GB9621631D0 (en) | 1996-12-11 |
| CN1103364C (zh) | 2003-03-19 |
| WO1997015647A1 (en) | 1997-05-01 |
| GB2306501B (en) | 1998-01-28 |
| DE69631436D1 (de) | 2004-03-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2235782C (en) | Germicidal dishwashing detergent compositions | |
| US5798329A (en) | Germicidal liquid laundry detergent compositions | |
| EP0842251B1 (en) | Reduced residue hard surface cleaner comprising hydrotrope | |
| US6090768A (en) | Germicidal liquid laundry detergent compositions including optical brighteners | |
| US6013615A (en) | Antimicrobial hard surface cleaner | |
| US6017869A (en) | Aqueous cleaning and disinfecting compositions which include quaternary ammonium compounds, block copolymer surfactants and further mitigating compounds which compositions feature reduced irritation | |
| US6143710A (en) | Aqueous cleaning and disinfecting compositions having reduced irritation characteristics based on quaternary ammonium compounds including block copolymer surfactants and further surfactants | |
| EP1399530B1 (en) | Biocidal cleaning composition | |
| EP0958340B1 (en) | Abrasive cleaning compositions | |
| US6022841A (en) | Aqueous cleaning and disinfecting compositions based on quaternary ammonium compounds including alkoxylated fatty acid amines having reduced irritation characteristics | |
| EP1149150A1 (en) | Germicidal blooming type compositions containing biphenyl solvents | |
| WO2000018867A1 (en) | Antimicrobial detergent compositions | |
| AU672930B2 (en) | Antimicrobial dish washing liquid | |
| CA2273484A1 (en) | Aqueous disinfecting cleaning composition | |
| MXPA98003249A (es) | Composiciones detergentes germicidas para lavar vajillas | |
| HK1011868A (en) | Disinfecting and cleaning compositions | |
| MXPA01007628A (es) | Composiciones germicidas de tipo resplandeciente que contienen solventes de bifenilo |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| MKEX | Expiry |
Effective date: 20160927 |