CA2149977C - Optical tape duplicator - Google Patents
Optical tape duplicator Download PDFInfo
- Publication number
- CA2149977C CA2149977C CA002149977A CA2149977A CA2149977C CA 2149977 C CA2149977 C CA 2149977C CA 002149977 A CA002149977 A CA 002149977A CA 2149977 A CA2149977 A CA 2149977A CA 2149977 C CA2149977 C CA 2149977C
- Authority
- CA
- Canada
- Prior art keywords
- tape
- optical tape
- optical
- radiant energy
- master
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 230000003287 optical effect Effects 0.000 title claims abstract description 161
- 238000000034 method Methods 0.000 claims description 15
- 230000005855 radiation Effects 0.000 claims description 9
- 238000010586 diagram Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 3
- 230000004888 barrier function Effects 0.000 description 2
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 235000012771 pancakes Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000012780 transparent material Substances 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B7/00—Recording or reproducing by optical means, e.g. recording using a thermal beam of optical radiation by modifying optical properties or the physical structure, reproducing using an optical beam at lower power by sensing optical properties; Record carriers therefor
- G11B7/24—Record carriers characterised by shape, structure or physical properties, or by the selection of the material
- G11B7/24003—Shapes of record carriers other than disc shape
- G11B7/24009—Tapes, long films or long sheets
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B7/00—Recording or reproducing by optical means, e.g. recording using a thermal beam of optical radiation by modifying optical properties or the physical structure, reproducing using an optical beam at lower power by sensing optical properties; Record carriers therefor
- G11B7/002—Recording, reproducing or erasing systems characterised by the shape or form of the carrier
- G11B7/003—Recording, reproducing or erasing systems characterised by the shape or form of the carrier with webs, filaments or wires, e.g. belts, spooled tapes or films of quasi-infinite extent
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B7/00—Recording or reproducing by optical means, e.g. recording using a thermal beam of optical radiation by modifying optical properties or the physical structure, reproducing using an optical beam at lower power by sensing optical properties; Record carriers therefor
- G11B7/28—Re-recording, i.e. transcribing information from one optical record carrier on to one or more similar or dissimilar record carriers
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B11/00—Recording on or reproducing from the same record carrier wherein for these two operations the methods are covered by different main groups of groups G11B3/00 - G11B7/00 or by different subgroups of group G11B9/00; Record carriers therefor
- G11B11/10—Recording on or reproducing from the same record carrier wherein for these two operations the methods are covered by different main groups of groups G11B3/00 - G11B7/00 or by different subgroups of group G11B9/00; Record carriers therefor using recording by magnetic means or other means for magnetisation or demagnetisation of a record carrier, e.g. light induced spin magnetisation; Demagnetisation by thermal or stress means in the presence or not of an orienting magnetic field
- G11B11/105—Recording on or reproducing from the same record carrier wherein for these two operations the methods are covered by different main groups of groups G11B3/00 - G11B7/00 or by different subgroups of group G11B9/00; Record carriers therefor using recording by magnetic means or other means for magnetisation or demagnetisation of a record carrier, e.g. light induced spin magnetisation; Demagnetisation by thermal or stress means in the presence or not of an orienting magnetic field using a beam of light or a magnetic field for recording by change of magnetisation and a beam of light for reproducing, i.e. magneto-optical, e.g. light-induced thermomagnetic recording, spin magnetisation recording, Kerr or Faraday effect reproducing
- G11B11/10502—Recording on or reproducing from the same record carrier wherein for these two operations the methods are covered by different main groups of groups G11B3/00 - G11B7/00 or by different subgroups of group G11B9/00; Record carriers therefor using recording by magnetic means or other means for magnetisation or demagnetisation of a record carrier, e.g. light induced spin magnetisation; Demagnetisation by thermal or stress means in the presence or not of an orienting magnetic field using a beam of light or a magnetic field for recording by change of magnetisation and a beam of light for reproducing, i.e. magneto-optical, e.g. light-induced thermomagnetic recording, spin magnetisation recording, Kerr or Faraday effect reproducing characterised by the transducing operation to be executed
- G11B11/10504—Recording
Landscapes
- Optical Recording Or Reproduction (AREA)
- Optical Record Carriers And Manufacture Thereof (AREA)
- Electronic Switches (AREA)
- Illuminated Signs And Luminous Advertising (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/269,309 US5563867A (en) | 1994-06-30 | 1994-06-30 | Optical tape duplicator |
| US08/269,309 | 1994-06-30 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CA2149977A1 CA2149977A1 (en) | 1995-12-31 |
| CA2149977C true CA2149977C (en) | 2000-03-07 |
Family
ID=23026706
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002149977A Expired - Fee Related CA2149977C (en) | 1994-06-30 | 1995-05-23 | Optical tape duplicator |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US5563867A (index.php) |
| EP (1) | EP0692783A3 (index.php) |
| JP (1) | JP3079012B2 (index.php) |
| KR (1) | KR100264227B1 (index.php) |
| CN (1) | CN1072809C (index.php) |
| AU (1) | AU2010595A (index.php) |
| BR (1) | BR9502706A (index.php) |
| CA (1) | CA2149977C (index.php) |
| MY (1) | MY130548A (index.php) |
| RU (1) | RU2152635C1 (index.php) |
| SG (1) | SG49547A1 (index.php) |
| TW (1) | TW289819B (index.php) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TW258811B (en) * | 1994-07-28 | 1995-10-01 | Philips Electronics Nv | manufacturing tape-like information carriers, web-like intermediate carrier |
| US5995470A (en) * | 1996-04-11 | 1999-11-30 | Sony Corporation | Method of recording and reproducing information signals and apparatus for editing the same |
| US6690639B2 (en) * | 2001-10-19 | 2004-02-10 | Eastman Kodak Company | Optical tape transport system using focus stabilizer |
| DE10330421A1 (de) * | 2003-07-04 | 2005-02-03 | Leonhard Kurz Gmbh & Co. Kg | Belichtungsstation für Folienbahnen |
| US8339573B2 (en) * | 2009-05-27 | 2012-12-25 | 3M Innovative Properties Company | Method and apparatus for photoimaging a substrate |
| JP2014013307A (ja) * | 2012-07-04 | 2014-01-23 | Dainippon Printing Co Ltd | ホログラム製造装置およびホログラム製造方法 |
Family Cites Families (94)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1250894A (en) * | 1917-09-12 | 1917-12-18 | Samuel Edward Kately | Paper-moistening device. |
| US1381840A (en) * | 1920-03-30 | 1921-06-14 | Jeapes William Cecil | Cinematograph-film-feeding apparatus |
| US1591466A (en) * | 1922-03-09 | 1926-07-06 | Eastman Kodak Co | Photographic printer |
| US1725944A (en) * | 1924-05-28 | 1929-08-27 | Spoor Thompson Machine Company | Film printer |
| US1801450A (en) * | 1926-11-12 | 1931-04-21 | Freeman H Owens | Optical printer |
| US1828364A (en) * | 1928-01-18 | 1931-10-20 | Paramount Publix Corp | Film contact system |
| US2052624A (en) * | 1932-08-29 | 1936-09-01 | Ilford Ltd | Method of, and means for, controlling the printing exposure in the production of positive cinematograph films |
| US2037806A (en) * | 1933-04-08 | 1936-04-21 | Hoe & Co R | Paper and web handling mechanism for printing machines |
| US2408310A (en) * | 1944-01-04 | 1946-09-24 | Gen Aniline & Film Corp | Mechanism for contact printing |
| US2552255A (en) * | 1946-12-17 | 1951-05-08 | Eastman Kodak Co | Continuously driven printing machine |
| US2569793A (en) * | 1948-03-08 | 1951-10-02 | Hanovia Chemical & Mfg Co | Ultraviolet irradiation |
| US2747478A (en) * | 1951-04-28 | 1956-05-29 | Eastman Kodak Co | Continuously driven printing machine |
| US2890621A (en) * | 1954-09-24 | 1959-06-16 | Gen Electric | Photographic printing method and apparatus |
| US2849298A (en) * | 1955-05-03 | 1958-08-26 | St Regis Paper Co | Printed circuitry laminates and production thereof |
| DE1021385B (de) * | 1956-03-08 | 1957-12-27 | Zindler Lumoprint Kg | Verfahren und Vorrichtung zum Herstellen von Kopien auf elektrostatischem Wege |
| US2983250A (en) * | 1958-01-30 | 1961-05-09 | Cons Electrodynamics Corp | Liquid coating apparatus |
| US3054339A (en) * | 1958-10-29 | 1962-09-18 | Marcograph Ltd | Apparatus for addressing envelopes |
| US3057275A (en) * | 1958-10-29 | 1962-10-09 | Xerox Corp | Image keeping |
| US3148600A (en) * | 1960-01-13 | 1964-09-15 | Itt | Combined plural carrier electrostatic printing and display system |
| US3308731A (en) * | 1961-03-22 | 1967-03-14 | Rca Corp | Electrostatic printing |
| US3120163A (en) * | 1961-04-20 | 1964-02-04 | Gittler Allan | Printing device |
| DE1241707B (de) * | 1961-07-27 | 1967-06-01 | Gerhard Ritzerfeld | Kopiermaschine zum Kopieren von durchleuchtungsfaehigen Vorlagen |
| US3169465A (en) * | 1961-12-15 | 1965-02-16 | Eastman Kodak Co | Contact printing apparatus |
| US3161120A (en) * | 1963-02-25 | 1964-12-15 | Fma Inc | Apparatus for bringing ribbon-type media together |
| US3157102A (en) * | 1963-05-28 | 1964-11-17 | Victoreen Instr Company | Printer-processor apparatus |
| US3262381A (en) * | 1963-09-30 | 1966-07-26 | Deluxe Lab Inc | Method and apparatus for improving upon the reproduction of images recorded on a photographic film |
| US3320867A (en) * | 1964-09-01 | 1967-05-23 | Miller Holzwarth Inc | Repetitive contact printer |
| DE1248068B (de) * | 1966-04-28 | 1967-08-24 | Meteor Siegen Appbau Paul Schm | Transportvorrichtung fuer Einzelblaetter aus lichtempfindlichem Material |
| BE680532A (index.php) * | 1966-05-04 | 1966-10-17 | ||
| US3447872A (en) * | 1966-05-26 | 1969-06-03 | Nb Jackets Corp | Ultraviolet exposure duplicating machine for microfilm |
| US3468606A (en) * | 1968-01-08 | 1969-09-23 | Extek Inc | Method and apparatus for contact printing film |
| US3689991A (en) * | 1968-03-01 | 1972-09-12 | Gen Electric | A method of manufacturing a semiconductor device utilizing a flexible carrier |
| US3562005A (en) * | 1968-04-09 | 1971-02-09 | Western Electric Co | Method of generating precious metal-reducing patterns |
| US3582207A (en) * | 1968-09-12 | 1971-06-01 | Minnesota Mining & Mfg | Apparatus for making multiple copies of an image web |
| GB1297626A (index.php) * | 1969-01-13 | 1972-11-29 | ||
| US3669720A (en) * | 1969-06-25 | 1972-06-13 | Inca Inks | Printing and coating method |
| US3614223A (en) * | 1969-07-03 | 1971-10-19 | Eastman Kodak Co | Liquid gate |
| US3644040A (en) * | 1969-08-07 | 1972-02-22 | Extek Microsystems Inc | Apparatus for continuous contact printing |
| US3644039A (en) * | 1969-11-17 | 1972-02-22 | Varo | Contact printer for photosensitive material |
| US3642377A (en) * | 1969-12-02 | 1972-02-15 | Xerox Corp | Color printing system |
| US3636350A (en) * | 1970-03-02 | 1972-01-18 | Minnesota Mining & Mfg | Thermal copying machine |
| US3685906A (en) * | 1970-05-22 | 1972-08-22 | Addressograph Multigraph | Apparatus and means for making duplicates of a microfilm original |
| US3676001A (en) * | 1970-05-22 | 1972-07-11 | Addressograph Multigraph | Process for making duplicates of microfilm |
| US3751165A (en) * | 1970-06-12 | 1973-08-07 | Canon Kk | Photographic contact printing device |
| US3712735A (en) * | 1970-09-25 | 1973-01-23 | Amp Inc | Apparatus for photo etching |
| US3734617A (en) * | 1971-04-26 | 1973-05-22 | Scott Paper Co | Film depletion detection system |
| US3736385A (en) * | 1971-06-01 | 1973-05-29 | Du Pont | Storage and retrieval of analog information with magnetooptic readout |
| US3854817A (en) * | 1971-08-09 | 1974-12-17 | R Erech | Apparatus for continuous contact duplication |
| JPS48103044U (index.php) * | 1972-03-03 | 1973-12-03 | ||
| US3817618A (en) * | 1973-04-30 | 1974-06-18 | R Riley | Microfiche duplicating means |
| JPS5216009Y2 (index.php) * | 1973-05-10 | 1977-04-11 | ||
| US3853400A (en) * | 1973-06-06 | 1974-12-10 | Bell & Howell Co | Liquid applicator for a photographic printer |
| US3977780A (en) * | 1974-09-25 | 1976-08-31 | Xerox Corporation | Electrostatic reproduction method and apparatus |
| GB1495756A (en) * | 1974-12-06 | 1977-12-21 | Hilton R | Photographic printing by direct contact |
| US3968563A (en) * | 1975-03-27 | 1976-07-13 | E. I. Du Pont De Nemours And Company | Precision registration system for leads |
| US3998544A (en) * | 1975-06-13 | 1976-12-21 | Terminal Data Corporation | Synchronous auxiliary camera projector |
| US4173407A (en) * | 1975-12-15 | 1979-11-06 | Coulter Information Systems, Inc. | Electrophotographic contact duplicating apparatus and method |
| US4122475A (en) * | 1976-01-26 | 1978-10-24 | Addressograph-Multigraph Corporation | Microfiche developer |
| US4056321A (en) * | 1976-06-25 | 1977-11-01 | Dymat Photomatrix Corporation | Microfiche duplicating apparatus |
| SE7802219L (sv) * | 1977-03-11 | 1978-09-12 | Rotter Johann | Byggkomponentsats for optikkonstruktioner samt derav framstellda optiska apparater |
| US4105329A (en) * | 1977-04-26 | 1978-08-08 | Carter Equipment Co., Inc. | Total immersion transfer of photographic images between sprocket-registered strips of film |
| JPS541622A (en) * | 1977-06-06 | 1979-01-08 | Dainippon Screen Mfg | Contact printing device for sensitive material |
| US4190352A (en) * | 1977-06-30 | 1980-02-26 | Bell Telephone Laboratories, Incorporated | Method and apparatus for continuously patterning a photosensitive tape |
| US4201581A (en) * | 1978-03-13 | 1980-05-06 | Eastman Kodak Company | Method of providing close contact for contact printing |
| US4175858A (en) * | 1978-04-17 | 1979-11-27 | Quantor Corporation | Film duplicator |
| GB2038009B (en) * | 1978-11-17 | 1982-10-27 | Gasse R W | Contact printing |
| US4661941A (en) * | 1979-09-18 | 1987-04-28 | Rca Corporation | Optical video or data tape record and playback apparatus |
| DE2938906A1 (de) * | 1979-09-26 | 1981-04-16 | Hansa-Technik Gmbh, 2000 Hamburg | Lichtpausapparat |
| US4302103A (en) * | 1980-07-14 | 1981-11-24 | Barthel Zeunen | Precision contact printer |
| US4324484A (en) * | 1980-10-01 | 1982-04-13 | Bell & Howell Company | Microfilm filing system |
| US4423956A (en) * | 1981-02-27 | 1984-01-03 | Eastman Kodak Company | Vapor deposit contact printing method and apparatus |
| US4374618A (en) * | 1981-03-16 | 1983-02-22 | Ibm Corporation | Microfilm camera having a moving lens |
| US4416540A (en) * | 1981-11-23 | 1983-11-22 | Peter Nicholson | Apparatus and method for holographic contact copying |
| DE3220637A1 (de) * | 1982-06-02 | 1983-12-08 | Hans 6250 Limburg Haus | Vorrichtung zum einbringen, ausbringen und trennen von kopier- und belichtungsgutschichten |
| US4520472A (en) * | 1983-02-07 | 1985-05-28 | Rca Corporation | Beam expansion and relay optics for laser diode array |
| US4567585A (en) * | 1983-10-31 | 1986-01-28 | Daniel Gelbart | Optical tape recorder using linear scanning |
| US4674867A (en) * | 1984-01-17 | 1987-06-23 | Kabushiki Kaisha Shashin Kogyo | Photographic contact printing apparatus for duplicating of original color picture |
| GB8516986D0 (en) * | 1985-07-04 | 1985-08-07 | Haughton A E | Reproduction of optically readable data |
| US4626099A (en) * | 1985-10-17 | 1986-12-02 | Bell & Howell Company | Film duplication system for microimage recorders |
| DE3538192A1 (de) * | 1985-10-26 | 1987-04-30 | Hans Haus | Vorrichtung zum einbringen von kopier- und belichtungsgutschichtungen in eine einrichtung zum kontinuierlichen belichten dieses gutes |
| JPS62173623A (ja) * | 1986-01-28 | 1987-07-30 | Toshiba Corp | 磁気転写装置 |
| KR900003521B1 (ko) * | 1986-02-28 | 1990-05-21 | 삼성전자 주식회사 | 광테이프 기록재생용 레이저 드럼 |
| US4884260A (en) * | 1986-04-23 | 1989-11-28 | Drexler Technology Corporation | Data recording system for optical memory tape |
| DE3788456T2 (de) * | 1986-06-16 | 1994-04-07 | Fuji Photo Film Co Ltd | Mikrofilm-Duplikatgerät. |
| US4815067A (en) * | 1986-10-06 | 1989-03-21 | Thorn Emi Plc. | Optical rotary headwheel tape recording system |
| US4743091A (en) * | 1986-10-30 | 1988-05-10 | Daniel Gelbart | Two dimensional laser diode array |
| IL88056A (en) * | 1988-10-14 | 1993-03-15 | Univ Ben Gurion | Process and device for the deionization of ion- containing aqueous solutions |
| US5077724A (en) * | 1989-05-22 | 1991-12-31 | Del Mar Avionics | Optical tape cartridge |
| JP2751456B2 (ja) * | 1989-09-13 | 1998-05-18 | ソニー株式会社 | 光テープ記録再生方法 |
| US4965621A (en) * | 1989-11-17 | 1990-10-23 | Eastman Kodak Company | Compact light collimator for a scanning contact printer |
| JPH03209630A (ja) * | 1990-01-11 | 1991-09-12 | Victor Co Of Japan Ltd | 転写型ダビング装置及びそのマスタテープ |
| US5215808A (en) * | 1990-09-04 | 1993-06-01 | Eastman Kodak Company | Optical tape recording media with integral dust-defocusing transparent film |
| US5081617A (en) * | 1990-09-24 | 1992-01-14 | Creo Products Inc. | Optical system for simultaneous reading of multiple data tracks |
| US5177724A (en) * | 1991-10-08 | 1993-01-05 | Crea Products Inc. | Optical tape recorder using a resonant flexure scanner |
-
1994
- 1994-06-30 US US08/269,309 patent/US5563867A/en not_active Expired - Fee Related
-
1995
- 1995-05-18 AU AU20105/95A patent/AU2010595A/en not_active Abandoned
- 1995-05-18 SG SG1995000468A patent/SG49547A1/en unknown
- 1995-05-23 CA CA002149977A patent/CA2149977C/en not_active Expired - Fee Related
- 1995-06-07 MY MYPI95001496A patent/MY130548A/en unknown
- 1995-06-07 RU RU95109857/28A patent/RU2152635C1/ru active
- 1995-06-07 BR BR9502706A patent/BR9502706A/pt active Search and Examination
- 1995-06-22 TW TW084106408A patent/TW289819B/zh active
- 1995-06-23 EP EP95304413A patent/EP0692783A3/en not_active Ceased
- 1995-06-28 JP JP07162588A patent/JP3079012B2/ja not_active Expired - Lifetime
- 1995-06-30 KR KR1019950018622A patent/KR100264227B1/ko not_active Expired - Fee Related
- 1995-06-30 CN CN95107753A patent/CN1072809C/zh not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| CN1072809C (zh) | 2001-10-10 |
| KR960002214A (ko) | 1996-01-26 |
| AU2010595A (en) | 1996-01-18 |
| KR100264227B1 (ko) | 2000-08-16 |
| EP0692783A2 (en) | 1996-01-17 |
| US5563867A (en) | 1996-10-08 |
| RU2152635C1 (ru) | 2000-07-10 |
| RU95109857A (ru) | 1997-05-10 |
| JP3079012B2 (ja) | 2000-08-21 |
| EP0692783A3 (en) | 1996-08-21 |
| JPH08111025A (ja) | 1996-04-30 |
| MY130548A (en) | 2007-06-29 |
| TW289819B (index.php) | 1996-11-01 |
| CA2149977A1 (en) | 1995-12-31 |
| SG49547A1 (en) | 1998-06-15 |
| CN1115434A (zh) | 1996-01-24 |
| BR9502706A (pt) | 1996-03-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3674942A (en) | Magnetic recording and reproducing apparatus of cassette type | |
| US4970612A (en) | Magnetic tape apparatus comprising a control unit for controlling tape buffers, the tape tension and the tape-transport | |
| US4524925A (en) | Optical data tape cartridge having wide angle read/write surface | |
| US2658398A (en) | Magnetic sound-recording and reproducing machine | |
| US4939715A (en) | Tape scanning apparatus | |
| CA2149977C (en) | Optical tape duplicator | |
| US4354211A (en) | Magnetic tape apparatus | |
| CA1070014A (en) | Playback apparatus, in particular a video player | |
| US4112472A (en) | Longitudinal scan, cam shaped, turntable rotor for magnetic recording | |
| JPH06301124A (ja) | 映画フィルム用音声記録装置及び映画フィルム用音声記録システム | |
| AU715422B2 (en) | Optical tape duplicator | |
| US5003424A (en) | Apparatus for changing the helix angle of magnetic tape relative to a rotary head scanner | |
| US2115503A (en) | Mechanism for winding endless films | |
| EP0323167A2 (en) | Helical scan tape record apparatus and method | |
| JP2712650B2 (ja) | 光学式記録再生装置 | |
| US4020999A (en) | Endless loop cartridge for video | |
| US3343759A (en) | Tape cartridge and winding mechanism | |
| US5513163A (en) | Optical tape recording/reproducing apparatus | |
| US4428011A (en) | Vented magnetic tape read head | |
| US5036410A (en) | System for random access to information on a magnetic tape | |
| US4912488A (en) | Camera with image input from linear array of electric-to-light transducers | |
| US3636273A (en) | Apparatus for driving tape in a cartridge | |
| US4984113A (en) | Information storage and reproduction apparatus and method employing a flexible belt record member | |
| US3582201A (en) | Audiovisual record member and playback means therefore | |
| JPS63869B2 (index.php) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| MKLA | Lapsed |