CA2149977C - Optical tape duplicator - Google Patents
Optical tape duplicator Download PDFInfo
- Publication number
- CA2149977C CA2149977C CA002149977A CA2149977A CA2149977C CA 2149977 C CA2149977 C CA 2149977C CA 002149977 A CA002149977 A CA 002149977A CA 2149977 A CA2149977 A CA 2149977A CA 2149977 C CA2149977 C CA 2149977C
- Authority
- CA
- Canada
- Prior art keywords
- tape
- optical tape
- optical
- radiant energy
- master
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 230000003287 optical effect Effects 0.000 title claims abstract description 161
- 238000000034 method Methods 0.000 claims description 15
- 230000005855 radiation Effects 0.000 claims description 9
- 238000010586 diagram Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 3
- 230000004888 barrier function Effects 0.000 description 2
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 235000012771 pancakes Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000012780 transparent material Substances 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B7/00—Recording or reproducing by optical means, e.g. recording using a thermal beam of optical radiation by modifying optical properties or the physical structure, reproducing using an optical beam at lower power by sensing optical properties; Record carriers therefor
- G11B7/24—Record carriers characterised by shape, structure or physical properties, or by the selection of the material
- G11B7/24003—Shapes of record carriers other than disc shape
- G11B7/24009—Tapes, long films or long sheets
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B7/00—Recording or reproducing by optical means, e.g. recording using a thermal beam of optical radiation by modifying optical properties or the physical structure, reproducing using an optical beam at lower power by sensing optical properties; Record carriers therefor
- G11B7/002—Recording, reproducing or erasing systems characterised by the shape or form of the carrier
- G11B7/003—Recording, reproducing or erasing systems characterised by the shape or form of the carrier with webs, filaments or wires, e.g. belts, spooled tapes or films of quasi-infinite extent
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B7/00—Recording or reproducing by optical means, e.g. recording using a thermal beam of optical radiation by modifying optical properties or the physical structure, reproducing using an optical beam at lower power by sensing optical properties; Record carriers therefor
- G11B7/28—Re-recording, i.e. transcribing information from one optical record carrier on to one or more similar or dissimilar record carriers
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B11/00—Recording on or reproducing from the same record carrier wherein for these two operations the methods are covered by different main groups of groups G11B3/00 - G11B7/00 or by different subgroups of group G11B9/00; Record carriers therefor
- G11B11/10—Recording on or reproducing from the same record carrier wherein for these two operations the methods are covered by different main groups of groups G11B3/00 - G11B7/00 or by different subgroups of group G11B9/00; Record carriers therefor using recording by magnetic means or other means for magnetisation or demagnetisation of a record carrier, e.g. light induced spin magnetisation; Demagnetisation by thermal or stress means in the presence or not of an orienting magnetic field
- G11B11/105—Recording on or reproducing from the same record carrier wherein for these two operations the methods are covered by different main groups of groups G11B3/00 - G11B7/00 or by different subgroups of group G11B9/00; Record carriers therefor using recording by magnetic means or other means for magnetisation or demagnetisation of a record carrier, e.g. light induced spin magnetisation; Demagnetisation by thermal or stress means in the presence or not of an orienting magnetic field using a beam of light or a magnetic field for recording by change of magnetisation and a beam of light for reproducing, i.e. magneto-optical, e.g. light-induced thermomagnetic recording, spin magnetisation recording, Kerr or Faraday effect reproducing
- G11B11/10502—Recording on or reproducing from the same record carrier wherein for these two operations the methods are covered by different main groups of groups G11B3/00 - G11B7/00 or by different subgroups of group G11B9/00; Record carriers therefor using recording by magnetic means or other means for magnetisation or demagnetisation of a record carrier, e.g. light induced spin magnetisation; Demagnetisation by thermal or stress means in the presence or not of an orienting magnetic field using a beam of light or a magnetic field for recording by change of magnetisation and a beam of light for reproducing, i.e. magneto-optical, e.g. light-induced thermomagnetic recording, spin magnetisation recording, Kerr or Faraday effect reproducing characterised by the transducing operation to be executed
- G11B11/10504—Recording
Landscapes
- Optical Recording Or Reproduction (AREA)
- Optical Record Carriers And Manufacture Thereof (AREA)
- Electronic Switches (AREA)
- Illuminated Signs And Luminous Advertising (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/269,309 US5563867A (en) | 1994-06-30 | 1994-06-30 | Optical tape duplicator |
| US08/269,309 | 1994-06-30 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CA2149977A1 CA2149977A1 (en) | 1995-12-31 |
| CA2149977C true CA2149977C (en) | 2000-03-07 |
Family
ID=23026706
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002149977A Expired - Fee Related CA2149977C (en) | 1994-06-30 | 1995-05-23 | Optical tape duplicator |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US5563867A (enExample) |
| EP (1) | EP0692783A3 (enExample) |
| JP (1) | JP3079012B2 (enExample) |
| KR (1) | KR100264227B1 (enExample) |
| CN (1) | CN1072809C (enExample) |
| AU (1) | AU2010595A (enExample) |
| BR (1) | BR9502706A (enExample) |
| CA (1) | CA2149977C (enExample) |
| MY (1) | MY130548A (enExample) |
| RU (1) | RU2152635C1 (enExample) |
| SG (1) | SG49547A1 (enExample) |
| TW (1) | TW289819B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TW258811B (en) * | 1994-07-28 | 1995-10-01 | Philips Electronics Nv | manufacturing tape-like information carriers, web-like intermediate carrier |
| US5995470A (en) * | 1996-04-11 | 1999-11-30 | Sony Corporation | Method of recording and reproducing information signals and apparatus for editing the same |
| US6690639B2 (en) * | 2001-10-19 | 2004-02-10 | Eastman Kodak Company | Optical tape transport system using focus stabilizer |
| DE10330421A1 (de) * | 2003-07-04 | 2005-02-03 | Leonhard Kurz Gmbh & Co. Kg | Belichtungsstation für Folienbahnen |
| US8339573B2 (en) * | 2009-05-27 | 2012-12-25 | 3M Innovative Properties Company | Method and apparatus for photoimaging a substrate |
| JP2014013307A (ja) * | 2012-07-04 | 2014-01-23 | Dainippon Printing Co Ltd | ホログラム製造装置およびホログラム製造方法 |
Family Cites Families (94)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1250894A (en) * | 1917-09-12 | 1917-12-18 | Samuel Edward Kately | Paper-moistening device. |
| US1381840A (en) * | 1920-03-30 | 1921-06-14 | Jeapes William Cecil | Cinematograph-film-feeding apparatus |
| US1591466A (en) * | 1922-03-09 | 1926-07-06 | Eastman Kodak Co | Photographic printer |
| US1725944A (en) * | 1924-05-28 | 1929-08-27 | Spoor Thompson Machine Company | Film printer |
| US1801450A (en) * | 1926-11-12 | 1931-04-21 | Freeman H Owens | Optical printer |
| US1828364A (en) * | 1928-01-18 | 1931-10-20 | Paramount Publix Corp | Film contact system |
| US2052624A (en) * | 1932-08-29 | 1936-09-01 | Ilford Ltd | Method of, and means for, controlling the printing exposure in the production of positive cinematograph films |
| US2037806A (en) * | 1933-04-08 | 1936-04-21 | Hoe & Co R | Paper and web handling mechanism for printing machines |
| US2408310A (en) * | 1944-01-04 | 1946-09-24 | Gen Aniline & Film Corp | Mechanism for contact printing |
| US2552255A (en) * | 1946-12-17 | 1951-05-08 | Eastman Kodak Co | Continuously driven printing machine |
| US2569793A (en) * | 1948-03-08 | 1951-10-02 | Hanovia Chemical & Mfg Co | Ultraviolet irradiation |
| US2747478A (en) * | 1951-04-28 | 1956-05-29 | Eastman Kodak Co | Continuously driven printing machine |
| US2890621A (en) * | 1954-09-24 | 1959-06-16 | Gen Electric | Photographic printing method and apparatus |
| US2849298A (en) * | 1955-05-03 | 1958-08-26 | St Regis Paper Co | Printed circuitry laminates and production thereof |
| DE1021385B (de) * | 1956-03-08 | 1957-12-27 | Zindler Lumoprint Kg | Verfahren und Vorrichtung zum Herstellen von Kopien auf elektrostatischem Wege |
| US2983250A (en) * | 1958-01-30 | 1961-05-09 | Cons Electrodynamics Corp | Liquid coating apparatus |
| US3057275A (en) * | 1958-10-29 | 1962-10-09 | Xerox Corp | Image keeping |
| US3054339A (en) * | 1958-10-29 | 1962-09-18 | Marcograph Ltd | Apparatus for addressing envelopes |
| US3148600A (en) * | 1960-01-13 | 1964-09-15 | Itt | Combined plural carrier electrostatic printing and display system |
| US3308731A (en) * | 1961-03-22 | 1967-03-14 | Rca Corp | Electrostatic printing |
| US3120163A (en) * | 1961-04-20 | 1964-02-04 | Gittler Allan | Printing device |
| DE1241707B (de) * | 1961-07-27 | 1967-06-01 | Gerhard Ritzerfeld | Kopiermaschine zum Kopieren von durchleuchtungsfaehigen Vorlagen |
| US3169465A (en) * | 1961-12-15 | 1965-02-16 | Eastman Kodak Co | Contact printing apparatus |
| US3161120A (en) * | 1963-02-25 | 1964-12-15 | Fma Inc | Apparatus for bringing ribbon-type media together |
| US3157102A (en) * | 1963-05-28 | 1964-11-17 | Victoreen Instr Company | Printer-processor apparatus |
| US3262381A (en) * | 1963-09-30 | 1966-07-26 | Deluxe Lab Inc | Method and apparatus for improving upon the reproduction of images recorded on a photographic film |
| US3320867A (en) * | 1964-09-01 | 1967-05-23 | Miller Holzwarth Inc | Repetitive contact printer |
| DE1248068B (de) * | 1966-04-28 | 1967-08-24 | Meteor Siegen Appbau Paul Schm | Transportvorrichtung fuer Einzelblaetter aus lichtempfindlichem Material |
| BE680532A (enExample) * | 1966-05-04 | 1966-10-17 | ||
| US3447872A (en) * | 1966-05-26 | 1969-06-03 | Nb Jackets Corp | Ultraviolet exposure duplicating machine for microfilm |
| US3468606A (en) * | 1968-01-08 | 1969-09-23 | Extek Inc | Method and apparatus for contact printing film |
| US3689991A (en) * | 1968-03-01 | 1972-09-12 | Gen Electric | A method of manufacturing a semiconductor device utilizing a flexible carrier |
| US3562005A (en) * | 1968-04-09 | 1971-02-09 | Western Electric Co | Method of generating precious metal-reducing patterns |
| US3582207A (en) * | 1968-09-12 | 1971-06-01 | Minnesota Mining & Mfg | Apparatus for making multiple copies of an image web |
| GB1297626A (enExample) * | 1969-01-13 | 1972-11-29 | ||
| US3669720A (en) * | 1969-06-25 | 1972-06-13 | Inca Inks | Printing and coating method |
| US3614223A (en) * | 1969-07-03 | 1971-10-19 | Eastman Kodak Co | Liquid gate |
| US3644040A (en) * | 1969-08-07 | 1972-02-22 | Extek Microsystems Inc | Apparatus for continuous contact printing |
| US3644039A (en) * | 1969-11-17 | 1972-02-22 | Varo | Contact printer for photosensitive material |
| US3642377A (en) * | 1969-12-02 | 1972-02-15 | Xerox Corp | Color printing system |
| US3636350A (en) * | 1970-03-02 | 1972-01-18 | Minnesota Mining & Mfg | Thermal copying machine |
| US3676001A (en) * | 1970-05-22 | 1972-07-11 | Addressograph Multigraph | Process for making duplicates of microfilm |
| US3685906A (en) * | 1970-05-22 | 1972-08-22 | Addressograph Multigraph | Apparatus and means for making duplicates of a microfilm original |
| US3751165A (en) * | 1970-06-12 | 1973-08-07 | Canon Kk | Photographic contact printing device |
| US3712735A (en) * | 1970-09-25 | 1973-01-23 | Amp Inc | Apparatus for photo etching |
| US3734617A (en) * | 1971-04-26 | 1973-05-22 | Scott Paper Co | Film depletion detection system |
| US3736385A (en) * | 1971-06-01 | 1973-05-29 | Du Pont | Storage and retrieval of analog information with magnetooptic readout |
| US3854817A (en) * | 1971-08-09 | 1974-12-17 | R Erech | Apparatus for continuous contact duplication |
| JPS48103044U (enExample) * | 1972-03-03 | 1973-12-03 | ||
| US3817618A (en) * | 1973-04-30 | 1974-06-18 | R Riley | Microfiche duplicating means |
| JPS5216009Y2 (enExample) * | 1973-05-10 | 1977-04-11 | ||
| US3853400A (en) * | 1973-06-06 | 1974-12-10 | Bell & Howell Co | Liquid applicator for a photographic printer |
| US3977780A (en) * | 1974-09-25 | 1976-08-31 | Xerox Corporation | Electrostatic reproduction method and apparatus |
| GB1495756A (en) * | 1974-12-06 | 1977-12-21 | Hilton R | Photographic printing by direct contact |
| US3968563A (en) * | 1975-03-27 | 1976-07-13 | E. I. Du Pont De Nemours And Company | Precision registration system for leads |
| US3998544A (en) * | 1975-06-13 | 1976-12-21 | Terminal Data Corporation | Synchronous auxiliary camera projector |
| US4173407A (en) * | 1975-12-15 | 1979-11-06 | Coulter Information Systems, Inc. | Electrophotographic contact duplicating apparatus and method |
| US4122475A (en) * | 1976-01-26 | 1978-10-24 | Addressograph-Multigraph Corporation | Microfiche developer |
| US4056321A (en) * | 1976-06-25 | 1977-11-01 | Dymat Photomatrix Corporation | Microfiche duplicating apparatus |
| SE7802219L (sv) * | 1977-03-11 | 1978-09-12 | Rotter Johann | Byggkomponentsats for optikkonstruktioner samt derav framstellda optiska apparater |
| US4105329A (en) * | 1977-04-26 | 1978-08-08 | Carter Equipment Co., Inc. | Total immersion transfer of photographic images between sprocket-registered strips of film |
| JPS541622A (en) * | 1977-06-06 | 1979-01-08 | Dainippon Screen Mfg | Contact printing device for sensitive material |
| US4190352A (en) * | 1977-06-30 | 1980-02-26 | Bell Telephone Laboratories, Incorporated | Method and apparatus for continuously patterning a photosensitive tape |
| US4201581A (en) * | 1978-03-13 | 1980-05-06 | Eastman Kodak Company | Method of providing close contact for contact printing |
| US4175858A (en) * | 1978-04-17 | 1979-11-27 | Quantor Corporation | Film duplicator |
| GB2038009B (en) * | 1978-11-17 | 1982-10-27 | Gasse R W | Contact printing |
| US4661941A (en) * | 1979-09-18 | 1987-04-28 | Rca Corporation | Optical video or data tape record and playback apparatus |
| DE2938906A1 (de) * | 1979-09-26 | 1981-04-16 | Hansa-Technik Gmbh, 2000 Hamburg | Lichtpausapparat |
| US4302103A (en) * | 1980-07-14 | 1981-11-24 | Barthel Zeunen | Precision contact printer |
| US4324484A (en) * | 1980-10-01 | 1982-04-13 | Bell & Howell Company | Microfilm filing system |
| US4423956A (en) * | 1981-02-27 | 1984-01-03 | Eastman Kodak Company | Vapor deposit contact printing method and apparatus |
| US4374618A (en) * | 1981-03-16 | 1983-02-22 | Ibm Corporation | Microfilm camera having a moving lens |
| US4416540A (en) * | 1981-11-23 | 1983-11-22 | Peter Nicholson | Apparatus and method for holographic contact copying |
| DE3220637A1 (de) * | 1982-06-02 | 1983-12-08 | Hans 6250 Limburg Haus | Vorrichtung zum einbringen, ausbringen und trennen von kopier- und belichtungsgutschichten |
| US4520472A (en) * | 1983-02-07 | 1985-05-28 | Rca Corporation | Beam expansion and relay optics for laser diode array |
| US4567585A (en) * | 1983-10-31 | 1986-01-28 | Daniel Gelbart | Optical tape recorder using linear scanning |
| US4674867A (en) * | 1984-01-17 | 1987-06-23 | Kabushiki Kaisha Shashin Kogyo | Photographic contact printing apparatus for duplicating of original color picture |
| GB8516986D0 (en) * | 1985-07-04 | 1985-08-07 | Haughton A E | Reproduction of optically readable data |
| US4626099A (en) * | 1985-10-17 | 1986-12-02 | Bell & Howell Company | Film duplication system for microimage recorders |
| DE3538192A1 (de) * | 1985-10-26 | 1987-04-30 | Hans Haus | Vorrichtung zum einbringen von kopier- und belichtungsgutschichtungen in eine einrichtung zum kontinuierlichen belichten dieses gutes |
| JPS62173623A (ja) * | 1986-01-28 | 1987-07-30 | Toshiba Corp | 磁気転写装置 |
| KR900003521B1 (ko) * | 1986-02-28 | 1990-05-21 | 삼성전자 주식회사 | 광테이프 기록재생용 레이저 드럼 |
| US4884260A (en) * | 1986-04-23 | 1989-11-28 | Drexler Technology Corporation | Data recording system for optical memory tape |
| EP0249876B1 (en) * | 1986-06-16 | 1993-12-15 | Fuji Photo Film Co., Ltd. | Microfilm duplicating apparatus |
| EP0263656A3 (en) * | 1986-10-06 | 1989-11-15 | Thorn Emi Plc | Tape recording |
| US4743091A (en) * | 1986-10-30 | 1988-05-10 | Daniel Gelbart | Two dimensional laser diode array |
| IL88056A (en) * | 1988-10-14 | 1993-03-15 | Univ Ben Gurion | Process and device for the deionization of ion- containing aqueous solutions |
| US5077724A (en) * | 1989-05-22 | 1991-12-31 | Del Mar Avionics | Optical tape cartridge |
| JP2751456B2 (ja) * | 1989-09-13 | 1998-05-18 | ソニー株式会社 | 光テープ記録再生方法 |
| US4965621A (en) * | 1989-11-17 | 1990-10-23 | Eastman Kodak Company | Compact light collimator for a scanning contact printer |
| JPH03209630A (ja) * | 1990-01-11 | 1991-09-12 | Victor Co Of Japan Ltd | 転写型ダビング装置及びそのマスタテープ |
| US5215808A (en) * | 1990-09-04 | 1993-06-01 | Eastman Kodak Company | Optical tape recording media with integral dust-defocusing transparent film |
| US5081617A (en) * | 1990-09-24 | 1992-01-14 | Creo Products Inc. | Optical system for simultaneous reading of multiple data tracks |
| US5177724A (en) * | 1991-10-08 | 1993-01-05 | Crea Products Inc. | Optical tape recorder using a resonant flexure scanner |
-
1994
- 1994-06-30 US US08/269,309 patent/US5563867A/en not_active Expired - Fee Related
-
1995
- 1995-05-18 SG SG1995000468A patent/SG49547A1/en unknown
- 1995-05-18 AU AU20105/95A patent/AU2010595A/en not_active Abandoned
- 1995-05-23 CA CA002149977A patent/CA2149977C/en not_active Expired - Fee Related
- 1995-06-07 RU RU95109857/28A patent/RU2152635C1/ru active
- 1995-06-07 BR BR9502706A patent/BR9502706A/pt active Search and Examination
- 1995-06-07 MY MYPI95001496A patent/MY130548A/en unknown
- 1995-06-22 TW TW084106408A patent/TW289819B/zh active
- 1995-06-23 EP EP95304413A patent/EP0692783A3/en not_active Ceased
- 1995-06-28 JP JP07162588A patent/JP3079012B2/ja not_active Expired - Lifetime
- 1995-06-30 KR KR1019950018622A patent/KR100264227B1/ko not_active Expired - Fee Related
- 1995-06-30 CN CN95107753A patent/CN1072809C/zh not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| RU2152635C1 (ru) | 2000-07-10 |
| CA2149977A1 (en) | 1995-12-31 |
| CN1115434A (zh) | 1996-01-24 |
| EP0692783A2 (en) | 1996-01-17 |
| CN1072809C (zh) | 2001-10-10 |
| RU95109857A (ru) | 1997-05-10 |
| US5563867A (en) | 1996-10-08 |
| KR100264227B1 (ko) | 2000-08-16 |
| JPH08111025A (ja) | 1996-04-30 |
| MY130548A (en) | 2007-06-29 |
| BR9502706A (pt) | 1996-03-12 |
| EP0692783A3 (en) | 1996-08-21 |
| JP3079012B2 (ja) | 2000-08-21 |
| AU2010595A (en) | 1996-01-18 |
| TW289819B (enExample) | 1996-11-01 |
| SG49547A1 (en) | 1998-06-15 |
| KR960002214A (ko) | 1996-01-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3674942A (en) | Magnetic recording and reproducing apparatus of cassette type | |
| US4970612A (en) | Magnetic tape apparatus comprising a control unit for controlling tape buffers, the tape tension and the tape-transport | |
| US4524925A (en) | Optical data tape cartridge having wide angle read/write surface | |
| US2658398A (en) | Magnetic sound-recording and reproducing machine | |
| US4939715A (en) | Tape scanning apparatus | |
| US4697215A (en) | Tape draw-out mechanism | |
| CA2149977C (en) | Optical tape duplicator | |
| CA1070014A (en) | Playback apparatus, in particular a video player | |
| AU715422B2 (en) | Optical tape duplicator | |
| US5003424A (en) | Apparatus for changing the helix angle of magnetic tape relative to a rotary head scanner | |
| US2115503A (en) | Mechanism for winding endless films | |
| US3869723A (en) | Magnetic recording and reproducing apparatus having dual capstans for use with cassettes | |
| EP0323167A2 (en) | Helical scan tape record apparatus and method | |
| JP2712650B2 (ja) | 光学式記録再生装置 | |
| US4020999A (en) | Endless loop cartridge for video | |
| US4428011A (en) | Vented magnetic tape read head | |
| JPH07182746A (ja) | 光テープ記録および再生装置 | |
| US5036410A (en) | System for random access to information on a magnetic tape | |
| US4912488A (en) | Camera with image input from linear array of electric-to-light transducers | |
| US3636273A (en) | Apparatus for driving tape in a cartridge | |
| US4984113A (en) | Information storage and reproduction apparatus and method employing a flexible belt record member | |
| US3582201A (en) | Audiovisual record member and playback means therefore | |
| JPS63869B2 (enExample) | ||
| US6335839B1 (en) | Magnetic head device including a playback head and a recording head maintaining contact with a film | |
| JPH0652601B2 (ja) | カセツト式記録再生装置 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| MKLA | Lapsed |