CA2105157C - Conjugated diene/monovinylarene block copolymers with multiple tapered blocks - Google Patents
Conjugated diene/monovinylarene block copolymers with multiple tapered blocksInfo
- Publication number
- CA2105157C CA2105157C CA002105157A CA2105157A CA2105157C CA 2105157 C CA2105157 C CA 2105157C CA 002105157 A CA002105157 A CA 002105157A CA 2105157 A CA2105157 A CA 2105157A CA 2105157 C CA2105157 C CA 2105157C
- Authority
- CA
- Canada
- Prior art keywords
- monomer
- monovinylaromatic
- charged
- conjugated diene
- initiator
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 150000001993 dienes Chemical class 0.000 title claims abstract description 48
- 229920001400 block copolymer Polymers 0.000 title claims abstract description 26
- 239000000178 monomer Substances 0.000 claims abstract description 154
- 238000006116 polymerization reaction Methods 0.000 claims abstract description 95
- 229920001577 copolymer Polymers 0.000 claims abstract description 63
- 239000003999 initiator Substances 0.000 claims abstract description 55
- 238000000034 method Methods 0.000 claims abstract description 49
- 239000000203 mixture Substances 0.000 claims abstract description 29
- 239000007822 coupling agent Substances 0.000 claims abstract description 19
- 230000006353 environmental stress Effects 0.000 claims abstract description 9
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical group C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 70
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Natural products C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 59
- 229920000642 polymer Polymers 0.000 claims description 37
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical group C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 21
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 claims description 17
- 239000003085 diluting agent Substances 0.000 claims description 17
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 16
- 229930195733 hydrocarbon Natural products 0.000 claims description 10
- 150000002430 hydrocarbons Chemical class 0.000 claims description 10
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 239000003381 stabilizer Substances 0.000 claims description 9
- 239000004215 Carbon black (E152) Substances 0.000 claims description 8
- 239000001569 carbon dioxide Substances 0.000 claims description 8
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 8
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 235000015112 vegetable and seed oil Nutrition 0.000 claims description 5
- 239000008158 vegetable oil Substances 0.000 claims description 5
- WGOPGODQLGJZGL-UHFFFAOYSA-N lithium;butane Chemical compound [Li+].CC[CH-]C WGOPGODQLGJZGL-UHFFFAOYSA-N 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 claims description 2
- 150000002989 phenols Chemical class 0.000 claims 1
- 150000008301 phosphite esters Chemical class 0.000 claims 1
- 125000003011 styrenyl group Chemical group [H]\C(*)=C(/[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- 238000004806 packaging method and process Methods 0.000 abstract description 2
- 238000010168 coupling process Methods 0.000 description 25
- 230000008878 coupling Effects 0.000 description 24
- 238000005859 coupling reaction Methods 0.000 description 24
- 150000001875 compounds Chemical class 0.000 description 22
- 229910052717 sulfur Inorganic materials 0.000 description 22
- 229910052796 boron Inorganic materials 0.000 description 17
- 230000000052 comparative effect Effects 0.000 description 14
- 238000012360 testing method Methods 0.000 description 14
- 229920005989 resin Polymers 0.000 description 11
- 239000011347 resin Substances 0.000 description 11
- 241000894007 species Species 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 238000007792 addition Methods 0.000 description 9
- -1 4-met~lylstyrene Chemical compound 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000000155 melt Substances 0.000 description 7
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 6
- 239000004793 Polystyrene Substances 0.000 description 6
- 229920002223 polystyrene Polymers 0.000 description 6
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 5
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229910052710 silicon Inorganic materials 0.000 description 4
- 239000010703 silicon Substances 0.000 description 4
- ABDKAPXRBAPSQN-UHFFFAOYSA-N veratrole Chemical compound COC1=CC=CC=C1OC ABDKAPXRBAPSQN-UHFFFAOYSA-N 0.000 description 4
- 238000011925 1,2-addition Methods 0.000 description 3
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 235000012424 soybean oil Nutrition 0.000 description 3
- 239000003549 soybean oil Substances 0.000 description 3
- 230000000087 stabilizing effect Effects 0.000 description 3
- 150000003568 thioethers Chemical class 0.000 description 3
- SUNMBRGCANLOEG-UHFFFAOYSA-N 1,3-dichloroacetone Chemical compound ClCC(=O)CCl SUNMBRGCANLOEG-UHFFFAOYSA-N 0.000 description 2
- SDJHPPZKZZWAKF-UHFFFAOYSA-N 2,3-dimethylbuta-1,3-diene Chemical compound CC(=C)C(C)=C SDJHPPZKZZWAKF-UHFFFAOYSA-N 0.000 description 2
- 101100515517 Arabidopsis thaliana XI-I gene Proteins 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- ZERULLAPCVRMCO-UHFFFAOYSA-N Dipropyl sulfide Chemical compound CCCSCCC ZERULLAPCVRMCO-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 125000004069 aziridinyl group Chemical group 0.000 description 2
- 238000005336 cracking Methods 0.000 description 2
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- LJSQFQKUNVCTIA-UHFFFAOYSA-N diethyl sulfide Chemical compound CCSCC LJSQFQKUNVCTIA-UHFFFAOYSA-N 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 239000011414 polymer cement Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical compound C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 1
- NKJOXAZJBOMXID-UHFFFAOYSA-N 1,1'-Oxybisoctane Chemical compound CCCCCCCCOCCCCCCCC NKJOXAZJBOMXID-UHFFFAOYSA-N 0.000 description 1
- GHITVUOBZBZMND-UHFFFAOYSA-N 1,3,5-tris(bromomethyl)benzene Chemical compound BrCC1=CC(CBr)=CC(CBr)=C1 GHITVUOBZBZMND-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VLDPXPPHXDGHEW-UHFFFAOYSA-N 1-chloro-2-dichlorophosphoryloxybenzene Chemical compound ClC1=CC=CC=C1OP(Cl)(Cl)=O VLDPXPPHXDGHEW-UHFFFAOYSA-N 0.000 description 1
- OEVVKKAVYQFQNV-UHFFFAOYSA-N 1-ethenyl-2,4-dimethylbenzene Chemical compound CC1=CC=C(C=C)C(C)=C1 OEVVKKAVYQFQNV-UHFFFAOYSA-N 0.000 description 1
- VTPNYMSKBPZSTF-UHFFFAOYSA-N 1-ethenyl-2-ethylbenzene Chemical compound CCC1=CC=CC=C1C=C VTPNYMSKBPZSTF-UHFFFAOYSA-N 0.000 description 1
- NVZWEEGUWXZOKI-UHFFFAOYSA-N 1-ethenyl-2-methylbenzene Chemical compound CC1=CC=CC=C1C=C NVZWEEGUWXZOKI-UHFFFAOYSA-N 0.000 description 1
- XHUZSRRCICJJCN-UHFFFAOYSA-N 1-ethenyl-3-ethylbenzene Chemical compound CCC1=CC=CC(C=C)=C1 XHUZSRRCICJJCN-UHFFFAOYSA-N 0.000 description 1
- JZHGRUMIRATHIU-UHFFFAOYSA-N 1-ethenyl-3-methylbenzene Chemical compound CC1=CC=CC(C=C)=C1 JZHGRUMIRATHIU-UHFFFAOYSA-N 0.000 description 1
- WHFHDVDXYKOSKI-UHFFFAOYSA-N 1-ethenyl-4-ethylbenzene Chemical compound CCC1=CC=C(C=C)C=C1 WHFHDVDXYKOSKI-UHFFFAOYSA-N 0.000 description 1
- NVJUHMXYKCUMQA-UHFFFAOYSA-N 1-ethoxypropane Chemical compound CCCOCC NVJUHMXYKCUMQA-UHFFFAOYSA-N 0.000 description 1
- PKADUYXVXKJWDI-UHFFFAOYSA-N 2,2-dibromodecan-3-one Chemical compound CCCCCCCC(=O)C(C)(Br)Br PKADUYXVXKJWDI-UHFFFAOYSA-N 0.000 description 1
- UNEXNTAPUSOZAO-UHFFFAOYSA-N 2,3-bis(2-oxopropyl)cyclohexan-1-one Chemical compound CC(=O)CC1CCCC(=O)C1CC(C)=O UNEXNTAPUSOZAO-UHFFFAOYSA-N 0.000 description 1
- UOPIOAUZQKSZRO-UHFFFAOYSA-N 2,4-dibromopentan-3-one Chemical compound CC(Br)C(=O)C(C)Br UOPIOAUZQKSZRO-UHFFFAOYSA-N 0.000 description 1
- UHDXWKPTEHEGAR-UHFFFAOYSA-N 2,5,6,9-tetrachlorodeca-3,7-diene Chemical compound CC(Cl)C=CC(Cl)C(Cl)C=CC(C)Cl UHDXWKPTEHEGAR-UHFFFAOYSA-N 0.000 description 1
- OTKAWDGVSKAUGW-UHFFFAOYSA-N 3,5,5-trifluorooctan-4-one Chemical compound CCCC(F)(F)C(=O)C(F)CC OTKAWDGVSKAUGW-UHFFFAOYSA-N 0.000 description 1
- PYSRRFNXTXNWCD-UHFFFAOYSA-N 3-(2-phenylethenyl)furan-2,5-dione Chemical compound O=C1OC(=O)C(C=CC=2C=CC=CC=2)=C1 PYSRRFNXTXNWCD-UHFFFAOYSA-N 0.000 description 1
- IGLWCQMNTGCUBB-UHFFFAOYSA-N 3-methylidenepent-1-ene Chemical compound CCC(=C)C=C IGLWCQMNTGCUBB-UHFFFAOYSA-N 0.000 description 1
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 1
- 102100027708 Astrotactin-1 Human genes 0.000 description 1
- TXSWGTOCTHQLJU-UHFFFAOYSA-N CCCCCCCCCC(C=C1)=C(CCCCCCCCC)C(CCCCCCCCC)=C1P(O)(O)O Chemical compound CCCCCCCCCC(C=C1)=C(CCCCCCCCC)C(CCCCCCCCC)=C1P(O)(O)O TXSWGTOCTHQLJU-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 102100024133 Coiled-coil domain-containing protein 50 Human genes 0.000 description 1
- HTIRHQRTDBPHNZ-UHFFFAOYSA-N Dibutyl sulfide Chemical compound CCCCSCCCC HTIRHQRTDBPHNZ-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- 101000936741 Homo sapiens Astrotactin-1 Proteins 0.000 description 1
- 101000910772 Homo sapiens Coiled-coil domain-containing protein 50 Proteins 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- XOBKSJJDNFUZPF-UHFFFAOYSA-N Methoxyethane Chemical compound CCOC XOBKSJJDNFUZPF-UHFFFAOYSA-N 0.000 description 1
- 101001034845 Mus musculus Interferon-induced transmembrane protein 3 Proteins 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 229920000147 Styrene maleic anhydride Polymers 0.000 description 1
- BOTDANWDWHJENH-UHFFFAOYSA-N Tetraethyl orthosilicate Chemical compound CCO[Si](OCC)(OCC)OCC BOTDANWDWHJENH-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- DOOTYTYQINUNNV-UHFFFAOYSA-N Triethyl citrate Chemical compound CCOC(=O)CC(O)(C(=O)OCC)CC(=O)OCC DOOTYTYQINUNNV-UHFFFAOYSA-N 0.000 description 1
- AVUYXHYHTTVPRX-UHFFFAOYSA-N Tris(2-methyl-1-aziridinyl)phosphine oxide Chemical compound CC1CN1P(=O)(N1C(C1)C)N1C(C)C1 AVUYXHYHTTVPRX-UHFFFAOYSA-N 0.000 description 1
- 241000364021 Tulsa Species 0.000 description 1
- BLXLSQIOCCHAHJ-UHFFFAOYSA-N [2,3,4-tri(nonyl)phenyl] dihydrogen phosphite Chemical compound CCCCCCCCCC1=CC=C(OP(O)O)C(CCCCCCCCC)=C1CCCCCCCCC BLXLSQIOCCHAHJ-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000002730 additional effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000007824 aliphatic compounds Chemical class 0.000 description 1
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 1
- KNCZUXHSQJQWIB-UHFFFAOYSA-N anthracene-1,4,9,10-tetrone Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(=O)C=CC2=O KNCZUXHSQJQWIB-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 239000006085 branching agent Substances 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- XYWDPYKBIRQXQS-UHFFFAOYSA-N di-isopropyl sulphide Natural products CC(C)SC(C)C XYWDPYKBIRQXQS-UHFFFAOYSA-N 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- 229920005669 high impact polystyrene Polymers 0.000 description 1
- 239000004797 high-impact polystyrene Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 235000021388 linseed oil Nutrition 0.000 description 1
- 239000000944 linseed oil Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000013627 low molecular weight specie Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- WXEHBUMAEPOYKP-UHFFFAOYSA-N methylsulfanylethane Chemical compound CCSC WXEHBUMAEPOYKP-UHFFFAOYSA-N 0.000 description 1
- 239000004200 microcrystalline wax Substances 0.000 description 1
- 235000019808 microcrystalline wax Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- DIHKMUNUGQVFES-UHFFFAOYSA-N n,n,n',n'-tetraethylethane-1,2-diamine Chemical compound CCN(CC)CCN(CC)CC DIHKMUNUGQVFES-UHFFFAOYSA-N 0.000 description 1
- DAZXVJBJRMWXJP-UHFFFAOYSA-N n,n-dimethylethylamine Chemical compound CCN(C)C DAZXVJBJRMWXJP-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- PPHQUIPUBYPZLD-UHFFFAOYSA-N n-ethyl-n-methylaniline Chemical compound CCN(C)C1=CC=CC=C1 PPHQUIPUBYPZLD-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical class [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 229920013730 reactive polymer Polymers 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 239000012262 resinous product Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- AIFMYMZGQVTROK-UHFFFAOYSA-N silicon tetrabromide Chemical compound Br[Si](Br)(Br)Br AIFMYMZGQVTROK-UHFFFAOYSA-N 0.000 description 1
- 239000005049 silicon tetrachloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 230000035882 stress Effects 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 150000003440 styrenes Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- UFHILTCGAOPTOV-UHFFFAOYSA-N tetrakis(ethenyl)silane Chemical compound C=C[Si](C=C)(C=C)C=C UFHILTCGAOPTOV-UHFFFAOYSA-N 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- ZDHXKXAHOVTTAH-UHFFFAOYSA-N trichlorosilane Chemical compound Cl[SiH](Cl)Cl ZDHXKXAHOVTTAH-UHFFFAOYSA-N 0.000 description 1
- 239000005052 trichlorosilane Substances 0.000 description 1
- KXGOWZRHSOJOLF-UHFFFAOYSA-N triethyl benzene-1,3,5-tricarboxylate Chemical compound CCOC(=O)C1=CC(C(=O)OCC)=CC(C(=O)OCC)=C1 KXGOWZRHSOJOLF-UHFFFAOYSA-N 0.000 description 1
- 239000001069 triethyl citrate Substances 0.000 description 1
- VMYFZRTXGLUXMZ-UHFFFAOYSA-N triethyl citrate Natural products CCOC(=O)C(O)(C(=O)OCC)C(=O)OCC VMYFZRTXGLUXMZ-UHFFFAOYSA-N 0.000 description 1
- 235000013769 triethyl citrate Nutrition 0.000 description 1
- WPPVEXTUHHUEIV-UHFFFAOYSA-N trifluorosilane Chemical compound F[SiH](F)F WPPVEXTUHHUEIV-UHFFFAOYSA-N 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- OZHUWVSXUOMDDU-UHFFFAOYSA-N tris(ethenyl)phosphane Chemical compound C=CP(C=C)C=C OZHUWVSXUOMDDU-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F297/00—Macromolecular compounds obtained by successively polymerising different monomer systems using a catalyst of the ionic or coordination type without deactivating the intermediate polymer
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F297/00—Macromolecular compounds obtained by successively polymerising different monomer systems using a catalyst of the ionic or coordination type without deactivating the intermediate polymer
- C08F297/02—Macromolecular compounds obtained by successively polymerising different monomer systems using a catalyst of the ionic or coordination type without deactivating the intermediate polymer using a catalyst of the anionic type
- C08F297/04—Macromolecular compounds obtained by successively polymerising different monomer systems using a catalyst of the ionic or coordination type without deactivating the intermediate polymer using a catalyst of the anionic type polymerising vinyl aromatic monomers and conjugated dienes
- C08F297/044—Macromolecular compounds obtained by successively polymerising different monomer systems using a catalyst of the ionic or coordination type without deactivating the intermediate polymer using a catalyst of the anionic type polymerising vinyl aromatic monomers and conjugated dienes using a coupling agent
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Graft Or Block Polymers (AREA)
- Polymerisation Methods In General (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/982,938 | 1992-11-30 | ||
| US07/982,938 US5290875A (en) | 1992-11-30 | 1992-11-30 | Conjugated diene/monovinylarene block copolymers with multiple tapered blocks |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CA2105157A1 CA2105157A1 (en) | 1994-05-31 |
| CA2105157C true CA2105157C (en) | 1996-09-17 |
Family
ID=25529665
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002105157A Expired - Fee Related CA2105157C (en) | 1992-11-30 | 1993-08-30 | Conjugated diene/monovinylarene block copolymers with multiple tapered blocks |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US5290875A (enExample) |
| EP (1) | EP0600405B1 (enExample) |
| JP (1) | JP2935796B2 (enExample) |
| KR (1) | KR100251074B1 (enExample) |
| AT (1) | ATE147412T1 (enExample) |
| CA (1) | CA2105157C (enExample) |
| DE (1) | DE69307284T2 (enExample) |
| ES (1) | ES2096186T3 (enExample) |
| MX (1) | MX9307322A (enExample) |
| TW (1) | TW268954B (enExample) |
Families Citing this family (66)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5436298A (en) * | 1993-09-30 | 1995-07-25 | Phillips Petroleum Company | Block copolymers of monovinylarenes and conjugated dienes and preparation thereof |
| CA2134026C (en) * | 1993-11-15 | 1998-06-09 | William J. Trepka | Tapered block copolymers of monovinylarenes and conjugated dienes |
| US6265484B1 (en) * | 1993-11-15 | 2001-07-24 | Phillips Petroleum Company | Tapered block copolymers of monovinylarenes and conjugated dienes |
| US5399628A (en) * | 1993-12-02 | 1995-03-21 | Phillips Petroleum Company | Block copolymers of monovinylarenes and conjugated dienes containing two interior tapered blocks |
| FR2714384B1 (fr) * | 1993-12-29 | 1996-02-02 | Atochem Elf Sa | Copolymère bloc étoile d'un monomère vinylaromatique et d'un diène conjugué, son procédé d'obtention, et les compositions comprenant ledit copolymère et du polystyrène cristal. |
| US5438103A (en) * | 1994-03-23 | 1995-08-01 | Phillips Petroleum Company | Block copolymers of monovinylaromatic and conjugated diene monomers |
| DE19523585A1 (de) * | 1995-06-29 | 1997-01-02 | Basf Ag | Schlagzähe Formmasse aus Styrolpolymeren |
| CN1036346C (zh) * | 1995-08-04 | 1997-11-05 | 中国石油化工总公司 | 丁苯嵌段共聚物热塑弹性体及制法 |
| US6835778B2 (en) * | 1995-08-29 | 2004-12-28 | Chevron Phillips Chemical Company Lp | Conjugated diene/monovinylarene block copolymers blends |
| US6096828A (en) | 1995-08-29 | 2000-08-01 | Phillips Petroleum Company | Conjugated diene/monovinylarene block copolymers, methods for preparing same, and polymer blends |
| US6127487A (en) * | 1998-10-14 | 2000-10-03 | Phillips Petroleum Company | Process to produce coupled block copolymers and said copolymers |
| US6956084B2 (en) * | 2001-10-04 | 2005-10-18 | Bridgestone Corporation | Nano-particle preparation and applications |
| US20030181584A1 (en) * | 2002-02-07 | 2003-09-25 | Kraton Polymers U.S. Llc | Elastomeric articles prepared from controlled distribution block copolymers |
| US20040138371A1 (en) * | 2002-02-07 | 2004-07-15 | St. Clair David John | Gels from controlled distribution block copolymers |
| US6987142B2 (en) * | 2002-02-07 | 2006-01-17 | Kraton Polymers U.S. Llc | Adhesives and sealants from controlled distribution block copolymers |
| US20040115381A1 (en) * | 2002-12-12 | 2004-06-17 | Chevron Phillips Chemical Company, Lp | Method for manufacturing articles with materials containing tapered polymers |
| US7576155B2 (en) * | 2002-12-18 | 2009-08-18 | Bridgestone Corporation | Method for clay exfoliation, compositions therefore, and modified rubber containing same |
| US6875818B2 (en) | 2003-01-16 | 2005-04-05 | Bridgestone Corporation | Polymer nano-strings |
| US7714067B2 (en) * | 2003-03-19 | 2010-05-11 | Denki Kagaku Kogyo Kabushiki Kaisha | Block copolymer mixture containing star-branched block copolymer |
| JP4714020B2 (ja) * | 2003-03-19 | 2011-06-29 | 電気化学工業株式会社 | 線状ブロック共重合体組成物 |
| US7037980B2 (en) * | 2003-11-10 | 2006-05-02 | Chevron Phillips Chemical Company, Lp | Monovinylarene/conjugated diene copolymers having lower glass transition temperatures |
| US7205370B2 (en) * | 2004-01-12 | 2007-04-17 | Bridgestone Corporation | Polymeric nano-particles of flower-like structure and applications |
| US20050166551A1 (en) * | 2004-02-02 | 2005-08-04 | Keane J. A. | Multilayer high clarity shrink film comprising monovinylarene-conjugated diene copolymer |
| US7112369B2 (en) * | 2004-03-02 | 2006-09-26 | Bridgestone Corporation | Nano-sized polymer-metal composites |
| US7718737B2 (en) * | 2004-03-02 | 2010-05-18 | Bridgestone Corporation | Rubber composition containing functionalized polymer nanoparticles |
| US8063142B2 (en) | 2004-03-02 | 2011-11-22 | Bridgestone Corporation | Method of making nano-particles of selected size distribution |
| US20050215693A1 (en) * | 2004-03-29 | 2005-09-29 | Xiaorong Wang | Clay modified rubber composition and a method for manufacturing same |
| US20050228074A1 (en) * | 2004-04-05 | 2005-10-13 | Bridgestone Corporation | Amphiphilic polymer micelles and use thereof |
| US20050282956A1 (en) * | 2004-06-21 | 2005-12-22 | Xiaorong Wang | Reversible polymer/metal nano-composites and method for manufacturing same |
| US7998554B2 (en) * | 2004-07-06 | 2011-08-16 | Bridgestone Corporation | Hydrophobic surfaces with nanoparticles |
| US7572855B2 (en) | 2005-01-28 | 2009-08-11 | Bridgestone Corporation | Nano-composite and compositions manufactured thereof |
| US7579398B2 (en) * | 2005-02-02 | 2009-08-25 | Bridgestone Corporation | Nano-composite and compositions therefrom |
| US7659342B2 (en) * | 2005-02-03 | 2010-02-09 | Bridgestone Corporation | Polymer nano-particle with polar core and method for manufacturing same |
| US20070066753A1 (en) * | 2005-09-16 | 2007-03-22 | Ehrlich Martin L | Highly processible compounds of high MW conventional block copolymers and controlled distribution block copolymers |
| US7538159B2 (en) | 2005-12-16 | 2009-05-26 | Bridgestone Corporation | Nanoparticles with controlled architecture and method thereof |
| US9061900B2 (en) * | 2005-12-16 | 2015-06-23 | Bridgestone Corporation | Combined use of liquid polymer and polymeric nanoparticles for rubber applications |
| US7884160B2 (en) | 2005-12-19 | 2011-02-08 | Bridgestone Corporation | Non-spherical nanoparticles made from living triblock polymer chains |
| US8288473B2 (en) | 2005-12-19 | 2012-10-16 | Bridgestone Corporation | Disk-like nanoparticles |
| US7560510B2 (en) | 2005-12-20 | 2009-07-14 | Bridgestone Corporation | Nano-sized inorganic metal particles, preparation thereof, and application thereof in improving rubber properties |
| US8877250B2 (en) | 2005-12-20 | 2014-11-04 | Bridgestone Corporation | Hollow nano-particles and method thereof |
| US8697775B2 (en) * | 2005-12-20 | 2014-04-15 | Bridgestone Corporation | Vulcanizable nanoparticles having a core with a high glass transition temperature |
| US7601772B2 (en) * | 2005-12-20 | 2009-10-13 | Bridgestone Corporation | Nano-composite and method thereof |
| US7935184B2 (en) | 2006-06-19 | 2011-05-03 | Bridgestone Corporation | Method of preparing imidazolium surfactants |
| JP6096398B2 (ja) | 2006-07-28 | 2017-03-15 | 株式会社ブリヂストン | 重合体ナノ粒子、ゴム組成物及び使用 |
| US8415429B2 (en) | 2006-12-11 | 2013-04-09 | Chervron Phillips Chemical Company LP | Styrene butadiene block copolymers for film applications |
| US7597959B2 (en) * | 2006-12-19 | 2009-10-06 | Bridgestone Corporation | Core-shell fluorescent nanoparticles |
| US7649049B2 (en) * | 2006-12-20 | 2010-01-19 | Bridgestone Corporation | Rubber composition containing a polymer nanoparticle |
| US7829624B2 (en) * | 2007-06-29 | 2010-11-09 | Bridgestone Corporation | One-pot synthesis of nanoparticles and liquid polymer for rubber applications |
| CN101628959A (zh) * | 2008-07-15 | 2010-01-20 | 中国石油化工集团公司 | 一种可发泡苯乙烯属单体-二烯烃共聚物、其制备方法和用途 |
| WO2010078320A2 (en) | 2008-12-31 | 2010-07-08 | Bridgestone Corporation | Core-first nanoparticle formation process, nanoparticle, and composition |
| US9062144B2 (en) | 2009-04-03 | 2015-06-23 | Bridgestone Corporation | Hairy polymeric nanoparticles with first and second shell block polymer arms |
| US20100272975A1 (en) * | 2009-04-23 | 2010-10-28 | Chevron Phillips Chemical Company Lp | System and method for the production and use of lamination films |
| US9115222B2 (en) * | 2009-12-29 | 2015-08-25 | Bridgestone Corporation | Well defined, highly crosslinked nanoparticles and method for making same |
| US20110172364A1 (en) * | 2009-12-29 | 2011-07-14 | Chen Yaohong | Charged Nanoparticles And Method Of Controlling Charge |
| US9428604B1 (en) | 2011-12-30 | 2016-08-30 | Bridgestone Corporation | Nanoparticle fillers and methods of mixing into elastomers |
| KR102036541B1 (ko) | 2012-05-08 | 2019-10-25 | 덴카 주식회사 | 블록 공중합체 조성물 및 시트 |
| TWI458768B (zh) | 2012-12-28 | 2014-11-01 | Chi Mei Corp | 橡膠組成及其製造方法 |
| US9598524B1 (en) | 2015-09-18 | 2017-03-21 | Chevron Phillips Chemical Company Lp | Styrene-butadiene block copolymers with a terminal butadiene block for tubing applications |
| US9441090B1 (en) | 2015-03-12 | 2016-09-13 | Chevron Phillips Chemical Company Lp | Methods for controlling hardness of styrene-butadiene block copolymers |
| US9540475B2 (en) | 2015-03-12 | 2017-01-10 | Chevron Phillips Chemical Company Lp | Styrene-butadiene block copolymers for tubing applications |
| EP3268402B1 (en) * | 2015-03-12 | 2019-12-11 | INEOS Styrolution Group GmbH | Styrene-butadiene block copolymers for tubing applications |
| US9738781B2 (en) | 2015-09-03 | 2017-08-22 | Ineos Styrolution Group Gmbh | Blends of styrene-butadiene block copolymer with styrenic thermoplastic elastomers for tubing applications |
| US10023676B2 (en) | 2016-02-24 | 2018-07-17 | Ineos Styrolution Group Gmbh | Styrene-butadiene block copolymers with an internal butadiene block for tubing applications |
| US9828455B2 (en) | 2016-02-24 | 2017-11-28 | Ineos Styrolution Group Gmbh | Styrene-butadiene block copolymers with an internal butadiene block for tubing applications |
| KR102696384B1 (ko) * | 2021-07-23 | 2024-08-19 | 주식회사 원익홀딩스 | 자동용접장치 |
| KR102686412B1 (ko) * | 2021-07-23 | 2024-07-18 | 주식회사 원익홀딩스 | 자동용접방법 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4054616A (en) * | 1973-09-29 | 1977-10-18 | Sumitomo Chemical Company, Limited | Process for producing transparent block copolymer resins |
| US4208356A (en) * | 1974-09-17 | 1980-06-17 | Asahi Kasei Kogyo Kabushiki Kaisha | Process for producing mixture of block copolymers |
| US4167545A (en) * | 1975-11-08 | 1979-09-11 | Basf Aktiengesellschaft | Branched block copolymers and their manufacture |
| US4248981A (en) * | 1979-04-30 | 1981-02-03 | Arco Polymers, Inc. | Clear impact resistant thermoplastic star-block copolymers |
| DE2940861A1 (de) * | 1979-10-09 | 1981-04-23 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von mischungen linearer dreiblockcopolymerisate sowie formteile aus diesen |
| US4390663A (en) * | 1981-02-17 | 1983-06-28 | Atlantic Richfield Company | Semi-continuous process for making star-block copolymers |
| US4584346A (en) * | 1984-02-29 | 1986-04-22 | Phillips Petroleum Company | Craze-resistant transparent resinous polymodal block copolymers |
| US4704435A (en) * | 1986-03-24 | 1987-11-03 | Phillips Petroleum Company | Craze-resistant polymodal linear block copolymers with resinous terminal blocks |
| US4704434A (en) * | 1986-03-24 | 1987-11-03 | Phillips Petroleum Company | Craze-resistant polymodal linear block copolymers with terminal tapered blocks |
| IT1196517B (it) * | 1986-07-17 | 1988-11-16 | Montedipe Spa | Copolimeri a blocco radiali e bimodali aventi ottime proprieta' ottiche e reistenza agli urti e processo per la loro preparazione |
| CA2028410C (en) * | 1990-01-02 | 1996-09-17 | William J. Trepka | Tapered block styrene/butadiene copolymers |
| US5227419A (en) * | 1990-12-20 | 1993-07-13 | Phillips Petroleum Company | Tapered block styrene/butadiene copolymers |
| US5256736A (en) * | 1991-05-08 | 1993-10-26 | Phillips Petroleum Company | Tapered block copolymers of conjugated dienes and monovinylarenes |
-
1992
- 1992-11-30 US US07/982,938 patent/US5290875A/en not_active Expired - Lifetime
-
1993
- 1993-08-30 CA CA002105157A patent/CA2105157C/en not_active Expired - Fee Related
- 1993-11-08 TW TW082109344A patent/TW268954B/zh active
- 1993-11-23 MX MX9307322A patent/MX9307322A/es not_active IP Right Cessation
- 1993-11-24 KR KR1019930025564A patent/KR100251074B1/ko not_active Expired - Fee Related
- 1993-11-25 JP JP5294810A patent/JP2935796B2/ja not_active Expired - Fee Related
- 1993-11-29 AT AT93119192T patent/ATE147412T1/de not_active IP Right Cessation
- 1993-11-29 ES ES93119192T patent/ES2096186T3/es not_active Expired - Lifetime
- 1993-11-29 DE DE69307284T patent/DE69307284T2/de not_active Expired - Fee Related
- 1993-11-29 EP EP93119192A patent/EP0600405B1/en not_active Expired - Lifetime
- 1993-12-06 US US08/163,785 patent/US5393838A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| US5393838A (en) | 1995-02-28 |
| CA2105157A1 (en) | 1994-05-31 |
| ATE147412T1 (de) | 1997-01-15 |
| KR940011512A (ko) | 1994-06-21 |
| JPH06206953A (ja) | 1994-07-26 |
| JP2935796B2 (ja) | 1999-08-16 |
| DE69307284T2 (de) | 1997-04-30 |
| KR100251074B1 (ko) | 2000-04-15 |
| EP0600405A1 (en) | 1994-06-08 |
| TW268954B (enExample) | 1996-01-21 |
| ES2096186T3 (es) | 1997-03-01 |
| EP0600405B1 (en) | 1997-01-08 |
| US5290875A (en) | 1994-03-01 |
| MX9307322A (es) | 1994-06-30 |
| DE69307284D1 (de) | 1997-02-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2105157C (en) | Conjugated diene/monovinylarene block copolymers with multiple tapered blocks | |
| US5256736A (en) | Tapered block copolymers of conjugated dienes and monovinylarenes | |
| US5587425A (en) | Blends of copolymers of monovinylarenes and conjugated dienes containing two interior tapered blocks | |
| US5545690A (en) | Tapered block copolymers of monovinylarenes and conjugated dienes | |
| US5705569A (en) | Block copolymers of monovinylarenes and conjugated dienes and preparation thereof | |
| US6265484B1 (en) | Tapered block copolymers of monovinylarenes and conjugated dienes | |
| US4584346A (en) | Craze-resistant transparent resinous polymodal block copolymers | |
| EP0673953B1 (en) | Block copolymers of monovinylaromatic and conjugated diene monomers | |
| EP0646607B1 (en) | Block copolymers of monovinylarenes and conjugated dienes and preparation thereof | |
| EP0603852A1 (en) | Tapered block copolymers of monovinylarenes and conjugated dienes | |
| US6992136B2 (en) | Transparent block copolymers and production thereof | |
| CA1254317A (en) | Craze-resistant transparent resinous copolymers |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| MKLA | Lapsed | ||
| MKLA | Lapsed |
Effective date: 20070830 |