CA1317182C - Liquid cleaning products - Google Patents
Liquid cleaning productsInfo
- Publication number
- CA1317182C CA1317182C CA000550083A CA550083A CA1317182C CA 1317182 C CA1317182 C CA 1317182C CA 000550083 A CA000550083 A CA 000550083A CA 550083 A CA550083 A CA 550083A CA 1317182 C CA1317182 C CA 1317182C
- Authority
- CA
- Canada
- Prior art keywords
- product according
- cleaning product
- acid
- structurant
- solvent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 238000004140 cleaning Methods 0.000 title claims abstract description 85
- 239000007788 liquid Substances 0.000 title claims abstract description 79
- 239000007787 solid Substances 0.000 claims abstract description 128
- 239000002904 solvent Substances 0.000 claims abstract description 98
- 239000002253 acid Substances 0.000 claims abstract description 81
- 239000004094 surface-active agent Substances 0.000 claims abstract description 54
- 150000003839 salts Chemical class 0.000 claims abstract description 46
- 239000000203 mixture Substances 0.000 claims description 104
- 239000002245 particle Substances 0.000 claims description 74
- -1 cationic quaternary ammonium salt Chemical class 0.000 claims description 53
- 239000000463 material Substances 0.000 claims description 48
- 239000004615 ingredient Substances 0.000 claims description 37
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 35
- 125000000217 alkyl group Chemical group 0.000 claims description 34
- 239000003795 chemical substances by application Substances 0.000 claims description 32
- 239000004744 fabric Substances 0.000 claims description 32
- 229910052783 alkali metal Inorganic materials 0.000 claims description 28
- 125000004432 carbon atom Chemical group C* 0.000 claims description 28
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims description 26
- 150000007513 acids Chemical class 0.000 claims description 24
- 235000019832 sodium triphosphate Nutrition 0.000 claims description 23
- 239000010457 zeolite Substances 0.000 claims description 22
- 229910021536 Zeolite Inorganic materials 0.000 claims description 19
- 239000007844 bleaching agent Substances 0.000 claims description 19
- 239000012190 activator Substances 0.000 claims description 18
- 238000003860 storage Methods 0.000 claims description 17
- 239000002736 nonionic surfactant Substances 0.000 claims description 16
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 15
- 239000000194 fatty acid Substances 0.000 claims description 15
- 229930195729 fatty acid Natural products 0.000 claims description 15
- 229910000323 aluminium silicate Inorganic materials 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 13
- 102000004190 Enzymes Human genes 0.000 claims description 12
- 108090000790 Enzymes Proteins 0.000 claims description 12
- 150000001340 alkali metals Chemical class 0.000 claims description 12
- 239000012876 carrier material Substances 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 12
- 238000005191 phase separation Methods 0.000 claims description 12
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 11
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 11
- 239000004927 clay Substances 0.000 claims description 11
- 150000004665 fatty acids Chemical class 0.000 claims description 11
- 230000002378 acidificating effect Effects 0.000 claims description 10
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical group CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 claims description 9
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 9
- 239000003945 anionic surfactant Substances 0.000 claims description 9
- 150000002191 fatty alcohols Chemical class 0.000 claims description 9
- 239000000787 lecithin Substances 0.000 claims description 9
- 235000010445 lecithin Nutrition 0.000 claims description 9
- 229940067606 lecithin Drugs 0.000 claims description 9
- 125000003342 alkenyl group Chemical group 0.000 claims description 8
- 125000002091 cationic group Chemical group 0.000 claims description 8
- 230000003750 conditioning effect Effects 0.000 claims description 8
- 125000002950 monocyclic group Chemical group 0.000 claims description 8
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical group CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 claims description 7
- 150000001450 anions Chemical class 0.000 claims description 7
- 150000001768 cations Chemical class 0.000 claims description 7
- 239000011356 non-aqueous organic solvent Substances 0.000 claims description 7
- 229920000570 polyether Polymers 0.000 claims description 7
- 239000011343 solid material Substances 0.000 claims description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 6
- 229910021532 Calcite Inorganic materials 0.000 claims description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 6
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 6
- 229910006069 SO3H Inorganic materials 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 238000005260 corrosion Methods 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000002304 perfume Substances 0.000 claims description 6
- 239000002841 Lewis acid Substances 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 239000004202 carbamide Substances 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 230000007797 corrosion Effects 0.000 claims description 5
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 5
- 239000003112 inhibitor Substances 0.000 claims description 5
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 5
- 150000007517 lewis acids Chemical class 0.000 claims description 5
- 150000004965 peroxy acids Chemical class 0.000 claims description 5
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims description 5
- 159000000000 sodium salts Chemical class 0.000 claims description 5
- 239000003381 stabilizer Substances 0.000 claims description 5
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 4
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical group CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 claims description 4
- 239000007848 Bronsted acid Substances 0.000 claims description 4
- 159000000013 aluminium salts Chemical class 0.000 claims description 4
- 150000003863 ammonium salts Chemical class 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 150000001735 carboxylic acids Chemical class 0.000 claims description 4
- 150000005690 diesters Chemical class 0.000 claims description 4
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 239000003352 sequestering agent Substances 0.000 claims description 4
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 claims description 4
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 150000001242 acetic acid derivatives Chemical class 0.000 claims description 3
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 3
- 229910000329 aluminium sulfate Inorganic materials 0.000 claims description 3
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 230000002209 hydrophobic effect Effects 0.000 claims description 3
- 150000002500 ions Chemical class 0.000 claims description 3
- 230000003641 microbiacidal effect Effects 0.000 claims description 3
- 150000002763 monocarboxylic acids Chemical class 0.000 claims description 3
- 150000002903 organophosphorus compounds Chemical class 0.000 claims description 3
- 150000003007 phosphonic acid derivatives Chemical class 0.000 claims description 3
- 229920000137 polyphosphoric acid Polymers 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 235000011149 sulphuric acid Nutrition 0.000 claims description 3
- 229910052723 transition metal Inorganic materials 0.000 claims description 3
- 239000002888 zwitterionic surfactant Substances 0.000 claims description 3
- 239000004150 EU approved colour Substances 0.000 claims description 2
- 229910004727 OSO3H Inorganic materials 0.000 claims description 2
- 150000001299 aldehydes Chemical class 0.000 claims description 2
- 150000001335 aliphatic alkanes Chemical group 0.000 claims description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 2
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 2
- 150000003973 alkyl amines Chemical class 0.000 claims description 2
- 125000005456 glyceride group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 150000002576 ketones Chemical class 0.000 claims description 2
- 229940006093 opthalmologic coloring agent diagnostic Drugs 0.000 claims description 2
- 150000002892 organic cations Chemical class 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- 235000011007 phosphoric acid Nutrition 0.000 claims description 2
- 150000003016 phosphoric acids Chemical class 0.000 claims description 2
- 239000002861 polymer material Substances 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 150000003624 transition metals Chemical class 0.000 claims description 2
- 150000002891 organic anions Chemical class 0.000 claims 2
- 229910021653 sulphate ion Inorganic materials 0.000 claims 2
- 101100295741 Gallus gallus COR4 gene Proteins 0.000 claims 1
- 150000001449 anionic compounds Chemical class 0.000 claims 1
- 239000013078 crystal Substances 0.000 claims 1
- 150000002193 fatty amides Chemical class 0.000 claims 1
- 229910001412 inorganic anion Inorganic materials 0.000 claims 1
- 230000009467 reduction Effects 0.000 abstract description 13
- 238000012360 testing method Methods 0.000 abstract description 8
- 239000003960 organic solvent Substances 0.000 abstract description 5
- 239000000047 product Substances 0.000 description 72
- 230000000694 effects Effects 0.000 description 33
- 238000001935 peptisation Methods 0.000 description 30
- 238000004062 sedimentation Methods 0.000 description 23
- 239000011734 sodium Substances 0.000 description 22
- 239000003599 detergent Substances 0.000 description 20
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 17
- 239000000126 substance Substances 0.000 description 17
- 229920002257 Plurafac® Polymers 0.000 description 16
- 238000005259 measurement Methods 0.000 description 14
- 108010059892 Cellulase Proteins 0.000 description 13
- 229940106157 cellulase Drugs 0.000 description 13
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- 230000015572 biosynthetic process Effects 0.000 description 11
- 238000005406 washing Methods 0.000 description 11
- 229940088598 enzyme Drugs 0.000 description 10
- URAYPUMNDPQOKB-UHFFFAOYSA-N triacetin Chemical compound CC(=O)OCC(OC(C)=O)COC(C)=O URAYPUMNDPQOKB-UHFFFAOYSA-N 0.000 description 10
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 9
- 125000000129 anionic group Chemical group 0.000 description 9
- 229910052708 sodium Inorganic materials 0.000 description 9
- 230000007423 decrease Effects 0.000 description 8
- 239000000377 silicon dioxide Substances 0.000 description 8
- 238000009472 formulation Methods 0.000 description 7
- 239000000344 soap Substances 0.000 description 7
- 229910000029 sodium carbonate Inorganic materials 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 229920000604 Polyethylene Glycol 200 Polymers 0.000 description 6
- 239000003082 abrasive agent Substances 0.000 description 6
- 239000007850 fluorescent dye Substances 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 229920001983 poloxamer Polymers 0.000 description 6
- 235000017550 sodium carbonate Nutrition 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 6
- 238000007711 solidification Methods 0.000 description 6
- 230000008023 solidification Effects 0.000 description 6
- 108010084185 Cellulases Proteins 0.000 description 5
- 102000005575 Cellulases Human genes 0.000 description 5
- 229910019142 PO4 Inorganic materials 0.000 description 5
- 229920002125 Sokalan® Polymers 0.000 description 5
- 235000013877 carbamide Nutrition 0.000 description 5
- 150000007942 carboxylates Chemical class 0.000 description 5
- 229920001577 copolymer Polymers 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 235000013773 glyceryl triacetate Nutrition 0.000 description 5
- 238000005342 ion exchange Methods 0.000 description 5
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 5
- 235000021317 phosphate Nutrition 0.000 description 5
- 230000008569 process Effects 0.000 description 5
- 241000894007 species Species 0.000 description 5
- 229960002622 triacetin Drugs 0.000 description 5
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- 108091005804 Peptidases Proteins 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 4
- 150000004996 alkyl benzenes Chemical class 0.000 description 4
- 238000013459 approach Methods 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- 239000002979 fabric softener Substances 0.000 description 4
- 239000003349 gelling agent Substances 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 239000012535 impurity Substances 0.000 description 4
- 238000010348 incorporation Methods 0.000 description 4
- 150000004682 monohydrates Chemical class 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 235000019198 oils Nutrition 0.000 description 4
- 150000004967 organic peroxy acids Chemical class 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 4
- 239000010452 phosphate Substances 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 230000002035 prolonged effect Effects 0.000 description 4
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 4
- APSBXTVYXVQYAB-UHFFFAOYSA-M sodium docusate Chemical compound [Na+].CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC APSBXTVYXVQYAB-UHFFFAOYSA-M 0.000 description 4
- ZITBHNVGLSVXEF-UHFFFAOYSA-N 2-[2-(16-methylheptadecoxy)ethoxy]ethanol Chemical compound CC(C)CCCCCCCCCCCCCCCOCCOCCO ZITBHNVGLSVXEF-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical class OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 102000035195 Peptidases Human genes 0.000 description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical group CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 239000001768 carboxy methyl cellulose Substances 0.000 description 3
- 239000003093 cationic surfactant Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000012459 cleaning agent Substances 0.000 description 3
- 239000000084 colloidal system Substances 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 230000003993 interaction Effects 0.000 description 3
- 239000007791 liquid phase Substances 0.000 description 3
- 238000003801 milling Methods 0.000 description 3
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 3
- 235000014593 oils and fats Nutrition 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 238000002203 pretreatment Methods 0.000 description 3
- 239000002994 raw material Substances 0.000 description 3
- 230000002441 reversible effect Effects 0.000 description 3
- 229910021647 smectite Inorganic materials 0.000 description 3
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 3
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 3
- RYYKJJJTJZKILX-UHFFFAOYSA-M sodium octadecanoate Chemical class [Na+].CCCCCCCCCCCCCCCCCC([O-])=O RYYKJJJTJZKILX-UHFFFAOYSA-M 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 241000182988 Assa Species 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- 229910015400 FeC13 Inorganic materials 0.000 description 2
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 150000008043 acidic salts Chemical class 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 238000005273 aeration Methods 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 125000006177 alkyl benzyl group Chemical group 0.000 description 2
- 150000005215 alkyl ethers Chemical group 0.000 description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 230000003625 amylolytic effect Effects 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000002216 antistatic agent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 238000004061 bleaching Methods 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 238000004891 communication Methods 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 229940071106 ethylenediaminetetraacetate Drugs 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 239000010419 fine particle Substances 0.000 description 2
- 239000001087 glyceryl triacetate Substances 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical class C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 239000012263 liquid product Substances 0.000 description 2
- 230000007774 longterm Effects 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- 229910052752 metalloid Inorganic materials 0.000 description 2
- 150000002738 metalloids Chemical class 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 108010020132 microbial serine proteinases Proteins 0.000 description 2
- 239000002052 molecular layer Substances 0.000 description 2
- 229910052901 montmorillonite Inorganic materials 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 238000012856 packing Methods 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- 235000020030 perry Nutrition 0.000 description 2
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 2
- 125000003703 phosphorus containing inorganic group Chemical group 0.000 description 2
- 229920001444 polymaleic acid Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 150000003138 primary alcohols Chemical class 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000013049 sediment Substances 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 229960001922 sodium perborate Drugs 0.000 description 2
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 2
- 229940014800 succinic anhydride Drugs 0.000 description 2
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 2
- 150000004685 tetrahydrates Chemical class 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 150000003626 triacylglycerols Chemical class 0.000 description 2
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- BPSYZMLXRKCSJY-UHFFFAOYSA-N 1,3,2-dioxaphosphepan-2-ium 2-oxide Chemical compound O=[P+]1OCCCCO1 BPSYZMLXRKCSJY-UHFFFAOYSA-N 0.000 description 1
- KWMLJOLKUYYJFJ-UHFFFAOYSA-N 2,3,4,5,6,7-Hexahydroxyheptanoic acid Chemical group OCC(O)C(O)C(O)C(O)C(O)C(O)=O KWMLJOLKUYYJFJ-UHFFFAOYSA-N 0.000 description 1
- CFPOJWPDQWJEMO-UHFFFAOYSA-N 2-(1,2-dicarboxyethoxy)butanedioic acid Chemical class OC(=O)CC(C(O)=O)OC(C(O)=O)CC(O)=O CFPOJWPDQWJEMO-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- NSMMFSKPGXCMOE-UHFFFAOYSA-N 2-[2-(2-sulfophenyl)ethenyl]benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1C=CC1=CC=CC=C1S(O)(=O)=O NSMMFSKPGXCMOE-UHFFFAOYSA-N 0.000 description 1
- PUAQLLVFLMYYJJ-UHFFFAOYSA-N 2-aminopropiophenone Chemical compound CC(N)C(=O)C1=CC=CC=C1 PUAQLLVFLMYYJJ-UHFFFAOYSA-N 0.000 description 1
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 description 1
- VHRDNLUUKOEZIS-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid;2-methyloxirane Chemical compound CC1CO1.CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O VHRDNLUUKOEZIS-UHFFFAOYSA-N 0.000 description 1
- JBVOQKNLGSOPNZ-UHFFFAOYSA-N 2-propan-2-ylbenzenesulfonic acid Chemical class CC(C)C1=CC=CC=C1S(O)(=O)=O JBVOQKNLGSOPNZ-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- JBNHKYQZNSPSOR-UHFFFAOYSA-N 4-(carboxymethylperoxy)-4-oxobutanoic acid Chemical class OC(=O)CCC(=O)OOCC(O)=O JBNHKYQZNSPSOR-UHFFFAOYSA-N 0.000 description 1
- LMYSNFBROWBKMB-UHFFFAOYSA-N 4-[2-(dipropylamino)ethyl]benzene-1,2-diol Chemical compound CCCN(CCC)CCC1=CC=C(O)C(O)=C1 LMYSNFBROWBKMB-UHFFFAOYSA-N 0.000 description 1
- ZUGHSJIRMAZPBK-UHFFFAOYSA-N 4-chlorobenzene-1,2-dicarboperoxoic acid Chemical compound OOC(=O)C1=CC=C(Cl)C=C1C(=O)OO ZUGHSJIRMAZPBK-UHFFFAOYSA-N 0.000 description 1
- JXSRRBVHLUJJFC-UHFFFAOYSA-N 7-amino-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile Chemical compound N1=CC(C#N)=C(N)N2N=C(SC)N=C21 JXSRRBVHLUJJFC-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- 241000607534 Aeromonas Species 0.000 description 1
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- 241000750142 Auricula Species 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 241000193830 Bacillus <bacterium> Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- JPKKWAZYHHVKRR-UHFFFAOYSA-N C(C)(=O)O.[F].[F].[F] Chemical compound C(C)(=O)O.[F].[F].[F] JPKKWAZYHHVKRR-UHFFFAOYSA-N 0.000 description 1
- 101100084503 Caenorhabditis elegans pas-3 gene Proteins 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical group [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241001175273 Colga Species 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 241000237379 Dolabella Species 0.000 description 1
- 229940120146 EDTMP Drugs 0.000 description 1
- 101710166469 Endoglucanase Proteins 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 241000223198 Humicola Species 0.000 description 1
- 241000223199 Humicola grisea Species 0.000 description 1
- 241001480714 Humicola insolens Species 0.000 description 1
- HETCEOQFVDFGSY-UHFFFAOYSA-N Isopropenyl acetate Chemical compound CC(=C)OC(C)=O HETCEOQFVDFGSY-UHFFFAOYSA-N 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- 239000004367 Lipase Substances 0.000 description 1
- 102000004882 Lipase Human genes 0.000 description 1
- 108090001060 Lipase Proteins 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229910021380 Manganese Chloride Inorganic materials 0.000 description 1
- GLFNIEUTAYBVOC-UHFFFAOYSA-L Manganese chloride Chemical compound Cl[Mn]Cl GLFNIEUTAYBVOC-UHFFFAOYSA-L 0.000 description 1
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 1
- IWDPHPYIPOWCRS-UHFFFAOYSA-N N1=C(Cl)N=C(Cl)N=C1Cl.NC(=C(C1=C(C(=CC=C1)S(=O)(=O)O)S(=O)(=O)O)N)C1=CC=CC=C1 Chemical compound N1=C(Cl)N=C(Cl)N=C1Cl.NC(=C(C1=C(C(=CC=C1)S(=O)(=O)O)S(=O)(=O)O)N)C1=CC=CC=C1 IWDPHPYIPOWCRS-UHFFFAOYSA-N 0.000 description 1
- RXTCWPTWYYNTOA-UHFFFAOYSA-N O=P1OCCCCCO1 Chemical compound O=P1OCCCCCO1 RXTCWPTWYYNTOA-UHFFFAOYSA-N 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 235000006894 Primula auricula Nutrition 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 240000001987 Pyrus communis Species 0.000 description 1
- 235000019484 Rapeseed oil Nutrition 0.000 description 1
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 description 1
- UDQKLVFQAFYISR-UHFFFAOYSA-N S(=O)(=O)(O)C(COC(O)=O)C1=CC=CC=C1.[Na] Chemical compound S(=O)(=O)(O)C(COC(O)=O)C1=CC=CC=C1.[Na] UDQKLVFQAFYISR-UHFFFAOYSA-N 0.000 description 1
- 239000004902 Softening Agent Substances 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical compound ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- ZGJVTOHMNLDNNU-UHFFFAOYSA-N acetic acid;heptanoic acid Chemical compound CC(O)=O.CCCCCCC(O)=O ZGJVTOHMNLDNNU-UHFFFAOYSA-N 0.000 description 1
- 150000001243 acetic acids Chemical class 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000002730 additional effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052910 alkali metal silicate Inorganic materials 0.000 description 1
- 125000004450 alkenylene group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000005263 alkylenediamine group Polymers 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 125000004419 alkynylene group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- CEGOLXSVJUTHNZ-UHFFFAOYSA-K aluminium tristearate Chemical compound [Al+3].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CEGOLXSVJUTHNZ-UHFFFAOYSA-K 0.000 description 1
- 239000002280 amphoteric surfactant Substances 0.000 description 1
- 230000002547 anomalous effect Effects 0.000 description 1
- VMPVEPPRYRXYNP-UHFFFAOYSA-I antimony(5+);pentachloride Chemical compound Cl[Sb](Cl)(Cl)(Cl)Cl VMPVEPPRYRXYNP-UHFFFAOYSA-I 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- RRDBXTBGGXLZHD-UHFFFAOYSA-N benzene-1,4-dicarboperoxoic acid Chemical compound OOC(=O)C1=CC=C(C(=O)OO)C=C1 RRDBXTBGGXLZHD-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 239000004067 bulking agent Substances 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- QBWCMBCROVPCKQ-UHFFFAOYSA-N chlorous acid Chemical class OCl=O QBWCMBCROVPCKQ-UHFFFAOYSA-N 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 229910052593 corundum Inorganic materials 0.000 description 1
- 239000010431 corundum Substances 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- UNWDCFHEVIWFCW-UHFFFAOYSA-N decanediperoxoic acid Chemical compound OOC(=O)CCCCCCCCC(=O)OO UNWDCFHEVIWFCW-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- REZZEXDLIUJMMS-UHFFFAOYSA-M dimethyldioctadecylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC REZZEXDLIUJMMS-UHFFFAOYSA-M 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- CQAIPTBBCVQRMD-UHFFFAOYSA-L dipotassium;phosphono phosphate Chemical compound [K+].[K+].OP(O)(=O)OP([O-])([O-])=O CQAIPTBBCVQRMD-UHFFFAOYSA-L 0.000 description 1
- 229940042400 direct acting antivirals phosphonic acid derivative Drugs 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- YHAIUSTWZPMYGG-UHFFFAOYSA-L disodium;2,2-dioctyl-3-sulfobutanedioate Chemical compound [Na+].[Na+].CCCCCCCCC(C([O-])=O)(C(C([O-])=O)S(O)(=O)=O)CCCCCCCC YHAIUSTWZPMYGG-UHFFFAOYSA-L 0.000 description 1
- 239000004664 distearyldimethylammonium chloride (DHTDMAC) Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- NFDRPXJGHKJRLJ-UHFFFAOYSA-N edtmp Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CCN(CP(O)(O)=O)CP(O)(O)=O NFDRPXJGHKJRLJ-UHFFFAOYSA-N 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- KIWBPDUYBMNFTB-UHFFFAOYSA-M ethyl sulfate Chemical compound CCOS([O-])(=O)=O KIWBPDUYBMNFTB-UHFFFAOYSA-M 0.000 description 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000005189 flocculation Methods 0.000 description 1
- 230000016615 flocculation Effects 0.000 description 1
- 235000019256 formaldehyde Nutrition 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000003976 glyceryl group Chemical group [H]C([*])([H])C(O[H])([H])C(O[H])([H])[H] 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 125000001046 glycoluril group Chemical group [H]C12N(*)C(=O)N(*)C1([H])N(*)C(=O)N2* 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 159000000011 group IA salts Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 210000000514 hepatopancreas Anatomy 0.000 description 1
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 1
- GBXAHFXTHNBQRX-UHFFFAOYSA-N hexanediperoxoic acid Chemical compound OOC(=O)CCCCC(=O)OO GBXAHFXTHNBQRX-UHFFFAOYSA-N 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical class Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910052816 inorganic phosphate Inorganic materials 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 238000005304 joining Methods 0.000 description 1
- 235000019421 lipase Nutrition 0.000 description 1
- 230000002366 lipolytic effect Effects 0.000 description 1
- 235000014666 liquid concentrate Nutrition 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- 239000011565 manganese chloride Substances 0.000 description 1
- 235000002867 manganese chloride Nutrition 0.000 description 1
- 229940099607 manganese chloride Drugs 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 1
- 235000019796 monopotassium phosphate Nutrition 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- SXLLDUPXUVRMEE-UHFFFAOYSA-N nonanediperoxoic acid Chemical compound OOC(=O)CCCCCCCC(=O)OO SXLLDUPXUVRMEE-UHFFFAOYSA-N 0.000 description 1
- 229920001542 oligosaccharide Polymers 0.000 description 1
- 150000002482 oligosaccharides Chemical class 0.000 description 1
- 239000005022 packaging material Substances 0.000 description 1
- 150000002942 palmitic acid derivatives Chemical class 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000011236 particulate material Substances 0.000 description 1
- 229940023462 paste product Drugs 0.000 description 1
- HWGNBUXHKFFFIH-UHFFFAOYSA-I pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O HWGNBUXHKFFFIH-UHFFFAOYSA-I 0.000 description 1
- 125000005342 perphosphate group Chemical group 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- PTMHPRAIXMAOOB-UHFFFAOYSA-N phosphoramidic acid Chemical class NP(O)(O)=O PTMHPRAIXMAOOB-UHFFFAOYSA-N 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- PJNZPQUBCPKICU-UHFFFAOYSA-N phosphoric acid;potassium Chemical compound [K].OP(O)(O)=O PJNZPQUBCPKICU-UHFFFAOYSA-N 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 229910052615 phyllosilicate Inorganic materials 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920005646 polycarboxylate Polymers 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical class [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000009290 primary effect Effects 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000000518 rheometry Methods 0.000 description 1
- WBHHMMIMDMUBKC-XLNAKTSKSA-N ricinelaidic acid Chemical compound CCCCCC[C@@H](O)C\C=C\CCCCCCCC(O)=O WBHHMMIMDMUBKC-XLNAKTSKSA-N 0.000 description 1
- 229960003656 ricinoleic acid Drugs 0.000 description 1
- FEUQNCSVHBHROZ-UHFFFAOYSA-N ricinoleic acid Natural products CCCCCCC(O[Si](C)(C)C)CC=CCCCCCCCC(=O)OC FEUQNCSVHBHROZ-UHFFFAOYSA-N 0.000 description 1
- 239000000565 sealant Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical class [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000003019 stabilising effect Effects 0.000 description 1
- 230000003335 steric effect Effects 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 125000005156 substituted alkylene group Chemical group 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 230000003319 supportive effect Effects 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- DFBNNGXIZUHDPO-UHFFFAOYSA-J tetrasodium;[[hydroxy(oxido)phosphoryl]oxy-oxidophosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].OP([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O DFBNNGXIZUHDPO-UHFFFAOYSA-J 0.000 description 1
- 229910001428 transition metal ion Inorganic materials 0.000 description 1
- 229940035339 tri-chlor Drugs 0.000 description 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 229960004319 trichloroacetic acid Drugs 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
- 239000001226 triphosphate Substances 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000004711 α-olefin Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/38—Cationic compounds
- C11D1/60—Sulfonium or phosphonium compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/66—Non-ionic compounds
- C11D1/72—Ethers of polyoxyalkylene glycols
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0004—Non aqueous liquid compositions comprising insoluble particles
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/08—Liquid soap, e.g. for dispensers; capsuled
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Cleaning Implements For Floors, Carpets, Furniture, Walls, And The Like (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB868625974A GB8625974D0 (en) | 1986-10-30 | 1986-10-30 | Non-aqueous liquid detergent |
| GB8625974 | 1986-10-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1317182C true CA1317182C (en) | 1993-05-04 |
Family
ID=10606550
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000550083A Expired - Fee Related CA1317182C (en) | 1986-10-30 | 1987-10-23 | Liquid cleaning products |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US5389284A (enExample) |
| EP (1) | EP0266199B2 (enExample) |
| JP (1) | JP2543726B2 (enExample) |
| KR (1) | KR920000899B1 (enExample) |
| AU (1) | AU606620B2 (enExample) |
| BR (1) | BR8705776A (enExample) |
| CA (1) | CA1317182C (enExample) |
| CH (1) | CH678191A5 (enExample) |
| DE (1) | DE3751814T3 (enExample) |
| ES (1) | ES2086288T5 (enExample) |
| FR (3) | FR2606026B2 (enExample) |
| GB (2) | GB8625974D0 (enExample) |
| IT (1) | IT1211494B (enExample) |
| NO (1) | NO170690C (enExample) |
| NZ (1) | NZ222288A (enExample) |
| TR (1) | TR25523A (enExample) |
| ZA (1) | ZA878119B (enExample) |
Families Citing this family (61)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4931195A (en) * | 1987-07-15 | 1990-06-05 | Colgate-Palmolive Company | Low viscosity stable non-aqueous suspension containing organophilic clay and low density filler |
| ZA884860B (en) * | 1987-07-15 | 1990-03-28 | Colgate Palmolive Co | Stable non-aqueous cleaning composition containing low density filler and method of use |
| US4830782A (en) * | 1987-08-31 | 1989-05-16 | Colgate-Palmolive Company | Hot water wash cycle built nonaqueous liquid nonionic laundry detergent composition containing amphoteric surfactant and method of use |
| NZ226288A (en) * | 1987-09-30 | 1991-02-26 | Colgate Palmolive Co | Stable non-aqueous suspensions for fabrics |
| GB8810191D0 (en) * | 1988-04-29 | 1988-06-02 | Unilever Plc | Liquid cleaning products |
| GB8810195D0 (en) * | 1988-04-29 | 1988-06-02 | Unilever Plc | Liquid cleaning products |
| US4988462A (en) * | 1988-04-29 | 1991-01-29 | Lever Brothers Company, Division Of Conopco, Inc. | Non-aqueous cleaning compositions containing bleach and capped nonionic surfactant |
| CA1314186C (en) * | 1988-04-29 | 1993-03-09 | Frederik Jan Schepers | Liquid cleaning products |
| US5292448A (en) * | 1988-05-10 | 1994-03-08 | Lever Brothers Company, Division Of Conopco, Inc. | Enzymatic detergent composition |
| US4874537A (en) * | 1988-09-28 | 1989-10-17 | The Clorox Company | Stable liquid nonaqueous detergent compositions |
| GB8823705D0 (en) * | 1988-10-10 | 1988-11-16 | Unilever Plc | Liquid detergent products |
| GB8824110D0 (en) * | 1988-10-14 | 1988-11-23 | Unilever Plc | Liquid cleaning products |
| GB2228944A (en) * | 1989-03-08 | 1990-09-12 | Unilever Plc | Non-aqueous liquid cleaning composition |
| GB8909253D0 (en) * | 1989-04-24 | 1989-06-07 | Unilever Plc | Packaged liquid cleaning product |
| US5714449A (en) * | 1990-02-16 | 1998-02-03 | Unilever Patent Holdings B.V. | Non-aqueous liquid cleaning products which contain modified silica |
| EP0515435B1 (en) * | 1990-02-16 | 1996-01-31 | Unilever Plc | Liquid cleaning products |
| ES2046047T3 (es) * | 1990-02-16 | 1994-01-16 | Unilever Nv | Productos limpiadores liquidos. |
| DE4024531A1 (de) * | 1990-08-02 | 1992-02-06 | Henkel Kgaa | Fluessigwaschmittel |
| GB9020360D0 (en) * | 1990-09-18 | 1990-10-31 | Unilever Plc | Process and device for dosing detergent compositions |
| EP0490436A1 (en) * | 1990-12-10 | 1992-06-17 | Unilever N.V. | Use of non-aqueous detergent compositions |
| GB9123219D0 (en) * | 1991-11-01 | 1991-12-18 | Unilever Plc | Liquid cleaning products |
| US5516511A (en) * | 1994-05-06 | 1996-05-14 | The Procter & Gamble Company | Antiperspirant gel compositions comprising chelators |
| BR9608998A (pt) * | 1995-06-20 | 1999-06-29 | Procter & Gamble | Composções detergentes líquidas contendo partículas não aquosas com tensoativo alquil benzeno sulfonato |
| US6225277B1 (en) * | 1995-10-09 | 2001-05-01 | The Procter & Gamble Company | Hard surface cleaning compositions |
| US6576602B1 (en) | 1996-06-28 | 2003-06-10 | The Procter & Gamble Company | Nonaqueous, particulate-containing liquid detergent compositions with surfactant-structured liquid phase |
| US5814592A (en) * | 1996-06-28 | 1998-09-29 | The Procter & Gamble Company | Non-aqueous, particulate-containing liquid detergent compositions with elasticized, surfactant-structured liquid phase |
| BR9710079A (pt) * | 1996-06-28 | 1999-08-10 | Procter & Gamble | Preparação de composições de detergente líquido não-aquoso que contêm partículado com fase líquida estruturada com tensoativo |
| US5773405A (en) * | 1997-03-13 | 1998-06-30 | Milliken Research Corporation | Cleaner compositions containing surfactant and poly (oxyalkylene)-substituted reactive dye colorant |
| CA2295115C (en) * | 1997-06-27 | 2003-04-22 | The Procter & Gamble Company | Non-aqueous, speckle-containing liquid detergent compositions |
| GB9803770D0 (en) * | 1998-02-23 | 1998-04-15 | Unilever Plc | Detergent compositions |
| US6461623B2 (en) * | 1998-04-13 | 2002-10-08 | Kao Corporation | Cosmetic composition |
| US5998358A (en) * | 1999-03-23 | 1999-12-07 | Ecolab Inc. | Antimicrobial acid cleaner for use on organic or food soil |
| US6565613B1 (en) * | 1999-04-29 | 2003-05-20 | Genencor International, Inc. | Cellulase detergent matrix |
| US6995125B2 (en) * | 2000-02-17 | 2006-02-07 | The Procter & Gamble Company | Detergent product |
| US6812199B2 (en) * | 2000-04-28 | 2004-11-02 | The Procter & Gamble Company | Method for treating stained materials |
| CA2405512C (en) * | 2000-05-11 | 2008-02-12 | The Procter & Gamble Company | Highly concentrated fabric softener compositions and articles containing such compositions |
| AU2001270503B2 (en) * | 2000-05-15 | 2004-04-01 | Unilever Plc | Liquid detergent composition |
| AU7971201A (en) * | 2000-07-06 | 2002-01-14 | Huntsman Int Llc | Solid-suspending systems |
| CA2415304A1 (en) * | 2000-07-19 | 2002-01-24 | The Procter & Gamble Company | Gel form automatic dishwashing compositions, methods of preparation and use thereof |
| US7074748B2 (en) * | 2001-01-19 | 2006-07-11 | The Procter & Gamble Company | Liquid composition |
| US6492312B1 (en) | 2001-03-16 | 2002-12-10 | Unilever Home & Personal Care Usa, Division Of Conopco, Inc. | Water soluble sachet with a dishwashing enhancing particle |
| GB0114850D0 (en) * | 2001-06-18 | 2001-08-08 | Unilever Plc | Water soluble package and liquid contents thereof |
| US20050119150A1 (en) * | 2002-07-04 | 2005-06-02 | Ulrich Pegelow | Portioned detergent composition |
| DE10237200A1 (de) * | 2002-08-14 | 2004-03-04 | Henkel Kgaa | Portionierte Wasch- oder Reinigungsmittelzusammensetzung |
| US20050187136A1 (en) * | 2002-08-14 | 2005-08-25 | Ulrich Pegelow | Portioned detergent compositions comprising phosphate II |
| US20050187137A1 (en) * | 2002-08-14 | 2005-08-25 | Ulrich Pegelow | Portioned cleaning agents or detergents containing phosphate |
| CA2610824C (en) * | 2005-09-23 | 2012-07-17 | Dc Chemical Co., Ltd. | Non-aqueous liquid oxygen bleach composition |
| US8394752B2 (en) * | 2008-12-18 | 2013-03-12 | The Procter & Gamble Company | Pearlescent agent slurry for liquid treatment composition |
| WO2012027140A2 (en) * | 2010-08-27 | 2012-03-01 | Anitox Corporation | Antimicrobial formulation |
| US8114343B1 (en) | 2010-12-21 | 2012-02-14 | Ecolab USA, Inc. | Corrosion inhibition of hypochlorite solutions using Zn and Ca |
| US8557178B2 (en) | 2010-12-21 | 2013-10-15 | Ecolab Usa Inc. | Corrosion inhibition of hypochlorite solutions in saturated wipes |
| US8603392B2 (en) | 2010-12-21 | 2013-12-10 | Ecolab Usa Inc. | Electrolyzed water system |
| US8114344B1 (en) | 2010-12-21 | 2012-02-14 | Ecolab Usa Inc. | Corrosion inhibition of hypochlorite solutions using sugar acids and Ca |
| US8729006B2 (en) * | 2011-06-28 | 2014-05-20 | Ecolab Usa Inc. | Methods and compositions using sodium carboxymethyl cellulose as scale control agent |
| CA2848777A1 (en) | 2011-10-20 | 2013-04-25 | Anitox Corporation | Antimicrobial formulations with pelargonic acid |
| WO2013155383A1 (en) * | 2012-04-12 | 2013-10-17 | Basf Se | Cleaning composition for dishwashing |
| DE102014202223A1 (de) | 2014-02-06 | 2015-08-06 | Henkel Ag & Co. Kgaa | Verwendung von Aminocarbonsäuren zur Stabilisierung von wasserarmen flüssigen Wasch- oder Reinigungsmittelkomponenten |
| JP2015199941A (ja) * | 2014-04-02 | 2015-11-12 | 花王株式会社 | 液体洗浄剤組成物 |
| US10030216B2 (en) | 2015-06-12 | 2018-07-24 | Crossford International, Llc | Systems and methods for cooling tower fill cleaning with a chemical gel |
| US9404069B1 (en) | 2015-06-12 | 2016-08-02 | Crossford International, Llc | Systems and methods for cooling tower fill cleaning with a chemical gel |
| MX2021014590A (es) | 2019-05-30 | 2022-01-11 | Ecolab Usa Inc | Sistema de dispensacion para transferir productos quimicos a un ensamblaje de cesta coladora. |
Family Cites Families (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA729145A (en) * | 1962-03-20 | 1966-03-01 | The Procter & Gamble Company | Built liquid detergent |
| LU52892A1 (enExample) * | 1967-01-27 | 1968-08-28 | ||
| AT291414B (de) * | 1967-01-27 | 1971-07-12 | Unilever Nv | Wasch- und Reinigungsmitell |
| DK129804A (enExample) * | 1969-01-17 | |||
| BE758553A (enExample) * | 1969-11-11 | 1971-05-05 | Unilever Nv | |
| US3960742A (en) * | 1973-06-29 | 1976-06-01 | Chemical Cleaning Composition Trust | Water-dispersable solvent emulsion type cleaner concentrate |
| US4347152A (en) * | 1976-12-02 | 1982-08-31 | Colgate-Palmolive Company | Phosphate-free concentrated particulate heavy duty laundry detergent |
| NO781898L (no) * | 1977-06-09 | 1978-12-12 | Ici Ltd | Flytende vaskemiddelblanding. |
| GB1600981A (en) * | 1977-06-09 | 1981-10-21 | Ici Ltd | Detergent composition |
| EP0028849B1 (en) * | 1979-11-09 | 1983-09-28 | Unilever N.V. | Non-aqueous, built liquid detergent composition and method for preparing same |
| DE3065199D1 (en) * | 1979-12-04 | 1983-11-10 | Ici Plc | Detergent composition |
| US4264466A (en) * | 1980-02-14 | 1981-04-28 | The Procter & Gamble Company | Mulls containing chain structure clay suspension aids |
| GB8308508D0 (en) * | 1983-03-28 | 1983-05-05 | Ici Plc | Detergent compositions |
| CA1217690A (en) * | 1983-07-07 | 1987-02-10 | Clement K. Choy | Hard surface acid cleaner |
| EG16786A (en) * | 1984-03-23 | 1991-08-30 | Clorox Co | Low-temperature effective composition and delivery systems therefor |
| US4743394A (en) * | 1984-03-23 | 1988-05-10 | Kaufmann Edward J | Concentrated non-phosphate detergent paste compositions |
| ZA852197B (en) * | 1984-04-06 | 1986-11-26 | Colgate Palmolive Co | Liquid laundry detergent composition containing polyphosphate |
| GB2158454B (en) * | 1984-04-06 | 1988-05-18 | Colgate Palmolive Co | Liquid laundry detergent composition |
| GB2158838B (en) * | 1984-04-06 | 1987-10-28 | Colgate Palmolive Co | Liquid bleaching laundry detergent composition |
| FR2564318B1 (fr) * | 1984-05-15 | 1987-04-17 | Oreal | Composition anhydre pour le nettoyage de la peau |
| JPS6142597A (ja) * | 1984-08-06 | 1986-03-01 | 花王株式会社 | 非水系ペ−スト状洗浄剤組成物 |
| US4753750A (en) * | 1984-12-31 | 1988-06-28 | Delaware | Liquid laundry detergent composition and method of use |
| US4622173A (en) * | 1984-12-31 | 1986-11-11 | Colgate-Palmolive Co. | Non-aqueous liquid laundry detergents containing three surfactants including a polycarboxylic acid ester of a non-ionic |
| US4661280A (en) * | 1985-03-01 | 1987-04-28 | Colgate | Built liquid laundry detergent composition containing salt of higher fatty acid stabilizer and method of use |
| MX162823B (es) * | 1985-03-29 | 1991-06-28 | Colgate Palmolive Co | Mejoras a composicion de detergente blanqueadora liquida para lavar ropa |
| JPS61227831A (ja) * | 1985-04-01 | 1986-10-09 | Nippon Oil & Fats Co Ltd | 非水系の固体分散剤 |
| JPS61227829A (ja) * | 1985-04-01 | 1986-10-09 | Nippon Oil & Fats Co Ltd | 非水系の固体分散剤 |
| JPS61227832A (ja) * | 1985-04-01 | 1986-10-09 | Nippon Oil & Fats Co Ltd | 非水系の固体分散剤 |
| JPS61227830A (ja) * | 1985-04-01 | 1986-10-09 | Nippon Oil & Fats Co Ltd | 非水系の固体分散剤 |
| JPS61227828A (ja) * | 1985-04-01 | 1986-10-09 | Nippon Oil & Fats Co Ltd | 非水系の固体分散剤 |
| US4744916A (en) * | 1985-07-18 | 1988-05-17 | Colgate-Palmolive Company | Non-gelling non-aqueous liquid detergent composition containing higher fatty dicarboxylic acid and method of use |
| US4769168A (en) * | 1985-08-05 | 1988-09-06 | Colgate-Palmolive Company | Low phosphate or phosphate free nonaqueous liquid nonionic laundry detergent composition and method of use |
| IN166313B (enExample) * | 1985-08-05 | 1990-04-07 | Colgate Palmolive Co | |
| US4767558A (en) * | 1985-08-05 | 1988-08-30 | Colgate-Palmolive Company | Low phosphate or phosphate free nonaqueous liquid nonionic laundry detergent composition and method of use |
| US4647393A (en) * | 1985-08-05 | 1987-03-03 | Colgate-Palmolive Company | Low phosphate or phosphate free nonaqueous liquid nonionic laundry detergent composition and method of use |
| US4655954A (en) * | 1985-08-20 | 1987-04-07 | Colgate-Palmolive Company | Low phosphate or phosphate free nonaqueous liquid nonionic laundry detergent composition and method of use |
| IN165978B (enExample) * | 1985-08-20 | 1990-02-17 | Colgate Palmolive Co | |
| NZ216987A (en) * | 1985-08-20 | 1988-09-29 | Colgate Palmolive Co | Nonaqueous liquid low phosphate laundry detergent |
| EP0217454B1 (en) * | 1985-09-30 | 1992-03-11 | Unilever N.V. | Non-aqueous liquid detergent composition and perborate anhydrous |
| GB8527772D0 (en) * | 1985-11-11 | 1985-12-18 | Unilever Plc | Non-aqueous built liquid detergent composition |
| GB8603961D0 (en) * | 1986-02-18 | 1986-03-26 | Interox Chemicals Ltd | Concentrated liquid composition |
| IN168163B (enExample) * | 1986-02-21 | 1991-02-16 | Colgate Palmolive Co | |
| US4888202A (en) * | 1986-07-31 | 1989-12-19 | Nippon Telegraph And Telephone Corporation | Method of manufacturing thin compound oxide film and apparatus for manufacturing thin oxide film |
| NZ221508A (en) * | 1986-08-28 | 1989-09-27 | Colgate Palmolive Co | Nonionic surfactants |
| US4772413A (en) * | 1986-08-28 | 1988-09-20 | Colgate-Palmolive Company | Nonaqueous liquid nonbuilt laundry detergent bleach booster composition containing diacetyl methyl amine and method of use |
| NZ221506A (en) * | 1986-08-28 | 1989-08-29 | Colgate Palmolive Co | Fabric-treating detergent composition with a suspension of insoluble inorganic particles |
| US4753748A (en) * | 1986-08-28 | 1988-06-28 | Colgate-Palmolive Company | Nonaqueous liquid automatic dishwashing detergent composition with improved rinse properties and method of use |
| US4797225A (en) * | 1986-09-08 | 1989-01-10 | Colgate-Palmolive Company | Nonaqueous liquid nonionic laundry detergent composition containing an alkali metal dithionite or sulfite reduction bleaching agent and method of use |
| NZ221505A (en) * | 1986-09-09 | 1989-08-29 | Colgate Palmolive Co | Liquid detergent compositions with peroxygen bleach and calcium cyanamide activator |
| NZ221555A (en) * | 1986-09-09 | 1989-08-29 | Colgate Palmolive Co | Detergent composition containing inorganic bleach and a liquid activator |
| AU602362B2 (en) * | 1986-10-29 | 1990-10-11 | Colgate-Palmolive Company, The | Built nonaqueous liquid nonionic laundry detergent composition containing hexylene glycol and method of use |
| US4830782A (en) * | 1987-08-31 | 1989-05-16 | Colgate-Palmolive Company | Hot water wash cycle built nonaqueous liquid nonionic laundry detergent composition containing amphoteric surfactant and method of use |
-
1986
- 1986-10-30 GB GB868625974A patent/GB8625974D0/en active Pending
-
1987
- 1987-10-23 CA CA000550083A patent/CA1317182C/en not_active Expired - Fee Related
- 1987-10-23 NZ NZ222288A patent/NZ222288A/xx unknown
- 1987-10-27 CH CH4205/87A patent/CH678191A5/de not_active IP Right Cessation
- 1987-10-27 AU AU80167/87A patent/AU606620B2/en not_active Ceased
- 1987-10-28 NO NO874494A patent/NO170690C/no unknown
- 1987-10-28 IT IT8767903A patent/IT1211494B/it active
- 1987-10-29 DE DE3751814T patent/DE3751814T3/de not_active Expired - Fee Related
- 1987-10-29 EP EP87309568A patent/EP0266199B2/en not_active Expired - Lifetime
- 1987-10-29 ES ES87309568T patent/ES2086288T5/es not_active Expired - Lifetime
- 1987-10-29 FR FR8714998A patent/FR2606026B2/fr not_active Expired - Fee Related
- 1987-10-29 BR BR8705776A patent/BR8705776A/pt not_active IP Right Cessation
- 1987-10-29 GB GB8725339A patent/GB2197339B/en not_active Expired - Fee Related
- 1987-10-29 ZA ZA878119A patent/ZA878119B/xx unknown
- 1987-10-30 KR KR1019870012128A patent/KR920000899B1/ko not_active Expired
- 1987-10-30 TR TR87/0741A patent/TR25523A/xx unknown
- 1987-10-30 JP JP62275557A patent/JP2543726B2/ja not_active Expired - Fee Related
-
1988
- 1988-02-23 FR FR8802138A patent/FR2609042B1/fr not_active Expired - Fee Related
- 1988-02-23 FR FR888802137A patent/FR2609041B1/fr not_active Expired - Fee Related
-
1990
- 1990-12-21 US US07/631,761 patent/US5389284A/en not_active Expired - Fee Related
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1317182C (en) | Liquid cleaning products | |
| EP0510762B1 (en) | Liquid cleaning products | |
| EP0385521B1 (en) | Liquid detergent products | |
| EP0340000B1 (en) | Liquid cleaning products | |
| CA1321339C (en) | Liquid cleaning products | |
| CA1323817C (en) | Liquid cleaning products | |
| AU658135B2 (en) | Liquid cleaning products | |
| CA1314186C (en) | Liquid cleaning products | |
| EP0340001B1 (en) | Liquid cleaning products | |
| GB2237285A (en) | Liquid soap composition | |
| GB2228944A (en) | Non-aqueous liquid cleaning composition | |
| AU651961B2 (en) | Non-aqueous liquid detergent composition containing a mixtureof nonionic compounds | |
| EP0339999A2 (en) | Liquid cleaning products | |
| GB2217727A (en) | Liquid cleaning products | |
| GB2219002A (en) | Processing of liquid cleaning products | |
| AU618342B2 (en) | Liquid cleaning products and liquid base therefor |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKLA | Lapsed |