CA1296323C - N-alkylation of dihydrolysergic acid - Google Patents
N-alkylation of dihydrolysergic acidInfo
- Publication number
- CA1296323C CA1296323C CA000519289A CA519289A CA1296323C CA 1296323 C CA1296323 C CA 1296323C CA 000519289 A CA000519289 A CA 000519289A CA 519289 A CA519289 A CA 519289A CA 1296323 C CA1296323 C CA 1296323C
- Authority
- CA
- Canada
- Prior art keywords
- acid
- mmol
- mixture
- alkyl
- added
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000002253 acid Substances 0.000 title abstract description 8
- 238000007126 N-alkylation reaction Methods 0.000 title description 3
- 238000000034 method Methods 0.000 claims abstract description 30
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical group [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 21
- 150000001875 compounds Chemical class 0.000 claims description 18
- -1 bromo, methyl Chemical group 0.000 claims description 12
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical class [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 claims description 4
- 229940077388 benzenesulfonate Drugs 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 abstract description 4
- 239000007787 solid Substances 0.000 description 19
- 239000000203 mixture Substances 0.000 description 17
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 11
- 238000003786 synthesis reaction Methods 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- 230000015572 biosynthetic process Effects 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- ORBSYPFBZQJNJE-MPKXVKKWSA-N (6ar,9r,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C1=CC([C@H]2C[C@H](CN([C@@H]2C2)C)C(O)=O)=C3C2=CNC3=C1 ORBSYPFBZQJNJE-MPKXVKKWSA-N 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 7
- 238000003828 vacuum filtration Methods 0.000 description 7
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 5
- 230000002152 alkylating effect Effects 0.000 description 5
- 239000000758 substrate Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 238000005804 alkylation reaction Methods 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- 238000010561 standard procedure Methods 0.000 description 4
- XGYGRQGHYWSQOV-POWSATBFSA-N (6ar,10ar)-7-methyl-4-pentan-3-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C1([C@@H]2[C@H](N(CC(C2)C(O)=O)C)C2)=CC=CC3=C1C2=CN3C(CC)CC XGYGRQGHYWSQOV-POWSATBFSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 238000003379 elimination reaction Methods 0.000 description 3
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 3
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- ZWOQVPFVARFZSF-UHFFFAOYSA-N cyclopentyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OC1CCCC1 ZWOQVPFVARFZSF-UHFFFAOYSA-N 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 150000002475 indoles Chemical class 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- NAGMITMLYCSORO-RJPUVWTNSA-N (6ar,10ar)-7-methyl-4-propan-2-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C1([C@@H]2[C@H](N(CC(C2)C(O)=O)C)C2)=CC=CC3=C1C2=CN3C(C)C NAGMITMLYCSORO-RJPUVWTNSA-N 0.000 description 1
- ORBSYPFBZQJNJE-GYYYEOQOSA-N (6ar,9r)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C1=CC(C2C[C@H](CN([C@@H]2C2)C)C(O)=O)=C3C2=CNC3=C1 ORBSYPFBZQJNJE-GYYYEOQOSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 102000056834 5-HT2 Serotonin Receptors Human genes 0.000 description 1
- 108091005479 5-HT2 receptors Proteins 0.000 description 1
- 206010007270 Carcinoid syndrome Diseases 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 206010026749 Mania Diseases 0.000 description 1
- 208000019695 Migraine disease Diseases 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 206010047163 Vasospasm Diseases 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 208000022531 anorexia Diseases 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 206010061428 decreased appetite Diseases 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- RHGUXDUPXYFCTE-ZWNOBZJWSA-N ergoline Chemical class C1=CC([C@@H]2[C@H](NCCC2)C2)=C3C2=CNC3=C1 RHGUXDUPXYFCTE-ZWNOBZJWSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- 206010027599 migraine Diseases 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- SLMCDJBSBDYBAX-UHFFFAOYSA-N pentan-3-yl 4-methylbenzenesulfonate Chemical compound CCC(CC)OS(=O)(=O)C1=CC=C(C)C=C1 SLMCDJBSBDYBAX-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- SDQCGKJCBWXRMK-UHFFFAOYSA-N propan-2-yl 4-methylbenzenesulfonate Chemical compound CC(C)OS(=O)(=O)C1=CC=C(C)C=C1 SDQCGKJCBWXRMK-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/04—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 8
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/782,339 US4734501A (en) | 1985-10-01 | 1985-10-01 | N-alkylation of dihydrolysergic acid |
| US782,339 | 1985-10-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1296323C true CA1296323C (en) | 1992-02-25 |
Family
ID=25125737
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000519289A Expired - Lifetime CA1296323C (en) | 1985-10-01 | 1986-09-29 | N-alkylation of dihydrolysergic acid |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4734501A (enExample) |
| EP (1) | EP0219256B1 (enExample) |
| JP (1) | JPH0670049B2 (enExample) |
| KR (1) | KR870001680B1 (enExample) |
| CN (1) | CN1013446B (enExample) |
| AT (1) | ATE62483T1 (enExample) |
| AU (1) | AU578169B2 (enExample) |
| CA (1) | CA1296323C (enExample) |
| DE (1) | DE3678665D1 (enExample) |
| DK (1) | DK170044B1 (enExample) |
| EG (1) | EG17902A (enExample) |
| ES (1) | ES2002393A6 (enExample) |
| GR (1) | GR862463B (enExample) |
| HK (1) | HK24192A (enExample) |
| HU (1) | HU196396B (enExample) |
| IE (1) | IE58690B1 (enExample) |
| IL (1) | IL80194A (enExample) |
| NZ (1) | NZ217721A (enExample) |
| PH (1) | PH23030A (enExample) |
| PT (1) | PT83449B (enExample) |
| SU (1) | SU1486062A3 (enExample) |
| ZA (1) | ZA867417B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2584719B1 (fr) * | 1985-07-11 | 1987-10-02 | Rhone Poulenc Sante | Procede de preparation des derives n-methyles du lysergol et du methoxy-10a lumilysergol |
| US4968802A (en) * | 1985-10-01 | 1990-11-06 | Eli Lilly And Company | Process of making alkoxy cycloalkanol esters of dihydrolysergic acid |
| US4845224A (en) * | 1985-10-01 | 1989-07-04 | Eli Lilly And Company | Cycloalkanol esters of dihydrolysergic acid having peripheral serotonin antagonist properties |
| IL80193A0 (en) * | 1985-10-01 | 1986-12-31 | Lilly Co Eli | Esters of dihydrolysergic acid |
| US4906639A (en) * | 1985-10-01 | 1990-03-06 | Eli Lilly And Company | Cycloalkanol esters of dihydrolysergic acid |
| US4914107A (en) * | 1989-01-17 | 1990-04-03 | Eli Lilly And Company | Method for selectively blocking 5-HT2 receptors |
| US5441961A (en) * | 1992-08-27 | 1995-08-15 | Eli Lilly And Company | Substituted cyclo or bicycloalkylamides of (8β)-6-(substituted) ergolines |
| WO2004087637A1 (en) * | 2003-03-31 | 2004-10-14 | Takasago International Corporation | Production of n-alkylamide compounds |
| CN102775402B (zh) * | 2011-05-13 | 2015-08-26 | 上海现代制药股份有限公司 | 一种制备二氢麦角酸的中间体及其制备方法 |
| RU2615949C1 (ru) * | 2015-11-18 | 2017-04-11 | Федеральное государственное казенное образовательное учреждение высшего профессионального образования "Калининградский пограничный институт Федеральной службы безопасности Российской Федерации" | Способ сигнализационного прикрытия т-образного перекрестка дорог |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1095296A (enExample) * | 1900-01-01 | |||
| US3183234A (en) * | 1963-11-21 | 1965-05-11 | Lilly Co Eli | Octahydroindoloquinolines |
| US3580916A (en) * | 1969-02-20 | 1971-05-25 | Lilly Co Eli | Hydroxyesters of hexa- and octahydroindoloquinolines |
| YU40004B (en) * | 1977-07-21 | 1985-06-30 | Lek Tovarna Farmacevtskih | Praocess for preparing n-substituted esters of 9,10-dihydrlysergic acid |
| DE3304361A1 (de) * | 1982-02-17 | 1983-08-25 | Sandoz-Patent-GmbH, 7850 Lörrach | Mutterkornalkaloide, verfahren zu deren herstellung sowie diese verbindungen enthaltende pharmazeutische zusammensetzungen |
| IL80193A0 (en) * | 1985-10-01 | 1986-12-31 | Lilly Co Eli | Esters of dihydrolysergic acid |
-
1985
- 1985-10-01 US US06/782,339 patent/US4734501A/en not_active Expired - Lifetime
-
1986
- 1986-09-29 NZ NZ217721A patent/NZ217721A/xx unknown
- 1986-09-29 CA CA000519289A patent/CA1296323C/en not_active Expired - Lifetime
- 1986-09-29 ZA ZA867417A patent/ZA867417B/xx unknown
- 1986-09-29 PT PT83449A patent/PT83449B/pt not_active IP Right Cessation
- 1986-09-29 IL IL80194A patent/IL80194A/xx not_active IP Right Cessation
- 1986-09-29 GR GR862463A patent/GR862463B/el unknown
- 1986-09-29 DE DE8686307442T patent/DE3678665D1/de not_active Expired - Lifetime
- 1986-09-29 EG EG610/86A patent/EG17902A/xx active
- 1986-09-29 AT AT86307442T patent/ATE62483T1/de active
- 1986-09-29 EP EP86307442A patent/EP0219256B1/en not_active Expired - Lifetime
- 1986-09-29 AU AU63209/86A patent/AU578169B2/en not_active Ceased
- 1986-09-29 PH PH34317A patent/PH23030A/en unknown
- 1986-09-30 ES ES8602321A patent/ES2002393A6/es not_active Expired
- 1986-09-30 IE IE258786A patent/IE58690B1/en not_active IP Right Cessation
- 1986-09-30 HU HU864145A patent/HU196396B/hu not_active IP Right Cessation
- 1986-09-30 SU SU864028225A patent/SU1486062A3/ru active
- 1986-09-30 KR KR1019860008206A patent/KR870001680B1/ko not_active Expired
- 1986-09-30 DK DK466786A patent/DK170044B1/da not_active IP Right Cessation
- 1986-09-30 CN CN86106720A patent/CN1013446B/zh not_active Expired
- 1986-09-30 JP JP61234255A patent/JPH0670049B2/ja not_active Expired - Lifetime
-
1992
- 1992-04-02 HK HK241/92A patent/HK24192A/en not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE3678665D1 (de) | 1991-05-16 |
| GR862463B (enExample) | 1987-02-02 |
| DK466786A (da) | 1987-04-02 |
| US4734501A (en) | 1988-03-29 |
| HUT41779A (en) | 1987-05-28 |
| KR870001680B1 (ko) | 1987-09-22 |
| EP0219256B1 (en) | 1991-04-10 |
| ZA867417B (en) | 1988-04-27 |
| SU1486062A3 (ru) | 1989-06-07 |
| IL80194A0 (en) | 1986-12-31 |
| CN1013446B (zh) | 1991-08-07 |
| ATE62483T1 (de) | 1991-04-15 |
| AU578169B2 (en) | 1988-10-13 |
| AU6320986A (en) | 1987-04-02 |
| PH23030A (en) | 1989-03-10 |
| NZ217721A (en) | 1989-02-24 |
| IE862587L (en) | 1987-04-01 |
| EP0219256A1 (en) | 1987-04-22 |
| KR870004027A (ko) | 1987-05-07 |
| DK170044B1 (da) | 1995-05-08 |
| EG17902A (en) | 1991-03-30 |
| HU196396B (en) | 1988-11-28 |
| PT83449A (en) | 1986-10-01 |
| JPS6284083A (ja) | 1987-04-17 |
| DK466786D0 (da) | 1986-09-30 |
| CN86106720A (zh) | 1987-04-01 |
| JPH0670049B2 (ja) | 1994-09-07 |
| PT83449B (pt) | 1989-05-12 |
| IL80194A (en) | 1990-12-23 |
| IE58690B1 (en) | 1993-11-03 |
| ES2002393A6 (es) | 1988-08-01 |
| HK24192A (en) | 1992-04-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2556722B2 (ja) | 新規なスルホンアミド化合物 | |
| CA1296323C (en) | N-alkylation of dihydrolysergic acid | |
| US4576750A (en) | Tryptophan derivative | |
| US4782152A (en) | Decyanation of pergolide intermediate | |
| US4556739A (en) | 3,4-Dialkoxy-2-alkylcarbonyl analino compounds | |
| US4555570A (en) | Substituted 4-alkyl-2-(1H) quinazolinone-1-alkanoic acid derivatives | |
| US4064244A (en) | Organic compounds | |
| US5210194A (en) | Process for preparing ergoline derivatives | |
| US4568754A (en) | Processes for the preparation of derivatives of 2-[3-(3-indolyl) 2-amino propionyloxy] acetic acid | |
| US4603210A (en) | Preparation process of acemetacin | |
| HU192836B (en) | Process for producing substituted azabicyclo-alkane derivatives and pharmaceutical compositions containing them | |
| US4001276A (en) | α-Alkyl(or aryl)thio-5-hydroxytryptophan derivative and the preparation process thereof | |
| CA1276148C (en) | Process for the preparation of -n-¬(hypoxanthin-9-yl)-pentyloxycarbonyl|-arginine | |
| CA1332837C (en) | 5- or 6-substituted .beta.-carboline-3-carboxylic acid esters | |
| McKay et al. | Analogues of Psilocin and Lysergic Acid Diethylamide I. Chloro, Nitro, and Amino Derivatives of 3-SUBSTITUTED Indoles | |
| JPH0625127B2 (ja) | 置換アザビシクロアルカン及びそれを含有する医薬 | |
| JPS6148839B2 (enExample) | ||
| EP0132964A2 (en) | 2-Azabicyclo[2.2.2]octane derivatives | |
| US3998842A (en) | Diazepino[1,2-α]indoles | |
| US5183894A (en) | 2-substituted-1-hydroxyindoles | |
| US4570001A (en) | Process for synthesizing certain N-benzoylamino indolines | |
| EP0054892B1 (en) | Synthesis of indolines | |
| US3983127A (en) | Pyrrolo[3,4-b]pyridines | |
| US5434271A (en) | 1-hydroxyindole compounds | |
| Bianchi et al. | 5‐Oxo‐1H‐4, 5‐dihydro‐1, 2, 4‐benzotriazepines. Chemical behavior towards alkylating, acidic and alkaline agents |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKLA | Lapsed |