CA1292023C - Ski binding - Google Patents
Ski bindingInfo
- Publication number
- CA1292023C CA1292023C CA000507438A CA507438A CA1292023C CA 1292023 C CA1292023 C CA 1292023C CA 000507438 A CA000507438 A CA 000507438A CA 507438 A CA507438 A CA 507438A CA 1292023 C CA1292023 C CA 1292023C
- Authority
- CA
- Canada
- Prior art keywords
- boot
- spring
- sole
- ski
- stop
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 230000027455 binding Effects 0.000 title claims abstract description 44
- 238000009739 binding Methods 0.000 title claims abstract description 44
- 230000033001 locomotion Effects 0.000 claims abstract description 21
- 230000000452 restraining effect Effects 0.000 claims abstract description 3
- 101710125089 Bindin Proteins 0.000 description 11
- 230000008901 benefit Effects 0.000 description 8
- 230000000875 corresponding effect Effects 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 230000013011 mating Effects 0.000 description 2
- OWNRRUFOJXFKCU-UHFFFAOYSA-N Bromadiolone Chemical compound C=1C=C(C=2C=CC(Br)=CC=2)C=CC=1C(O)CC(C=1C(OC2=CC=CC=C2C=1O)=O)C1=CC=CC=C1 OWNRRUFOJXFKCU-UHFFFAOYSA-N 0.000 description 1
- 241000905957 Channa melasoma Species 0.000 description 1
- 101100310856 Drosophila melanogaster spri gene Proteins 0.000 description 1
- 241000820057 Ithone Species 0.000 description 1
- 101100345589 Mus musculus Mical1 gene Proteins 0.000 description 1
- 241000428533 Rhis Species 0.000 description 1
- 241000153282 Theope Species 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 108010052322 limitin Proteins 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63C—SKATES; SKIS; ROLLER SKATES; DESIGN OR LAYOUT OF COURTS, RINKS OR THE LIKE
- A63C9/00—Ski bindings
- A63C9/20—Non-self-releasing bindings with special sole edge holders instead of toe-straps
Landscapes
- Footwear And Its Accessory, Manufacturing Method And Apparatuses (AREA)
- Crystals, And After-Treatments Of Crystals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU3878643 | 1985-04-24 | ||
| SU853878643A SU1377128A1 (ru) | 1985-04-24 | 1985-04-24 | Лыжна принадлежность |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1292023C true CA1292023C (en) | 1991-11-12 |
Family
ID=21171122
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000507438A Expired - Lifetime CA1292023C (en) | 1985-04-24 | 1986-04-24 | Ski binding |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4948158A (enExample) |
| EP (1) | EP0220329A4 (enExample) |
| JP (2) | JPS63501130A (enExample) |
| CA (1) | CA1292023C (enExample) |
| DE (1) | DE8610696U1 (enExample) |
| FI (1) | FI865146A0 (enExample) |
| FR (1) | FR2582531B3 (enExample) |
| HU (1) | HU195738B (enExample) |
| IT (1) | IT207192Z2 (enExample) |
| SU (1) | SU1377128A1 (enExample) |
| WO (1) | WO1986006288A1 (enExample) |
| YU (1) | YU45777B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SU1560246A1 (ru) * | 1985-04-24 | 1990-04-30 | Ленинградский Политехнический Институт Им.М.И.Калинина | Лыжна принадлежность |
| FR2645760B1 (fr) * | 1989-04-12 | 1991-06-14 | Salomon Sa | Dispositif de fixation d'une chaussure a un ski de fond |
| US6374517B2 (en) * | 1994-04-29 | 2002-04-23 | Salomon S.A. | Sole for a sport boot and a sport boot including such sole |
| FR2719229B1 (fr) * | 1994-04-29 | 1996-06-28 | Salomon Sa | Dispositif de fixation d'une chaussure à un ski de fond. |
| US6644683B1 (en) | 1998-07-22 | 2003-11-11 | Rottefella As | Ski binding, especially for cross-country skis |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA607720A (en) * | 1960-11-01 | G. Landry Gaetan | Ski fitting | |
| DE1221121B (de) * | 1963-07-17 | 1966-07-14 | Gerhard Friz Dipl Ing | Skisicherheitsbindung |
| NO119070B (enExample) * | 1968-02-15 | 1970-03-16 | N Eie | |
| DE2365630A1 (de) * | 1972-02-11 | 1975-09-25 | Odd Guttulsrud | Skibindung |
| US4023824A (en) * | 1972-06-15 | 1977-05-17 | Von Besser Kurt | Ski binding apparatus |
| US3947053A (en) * | 1973-05-25 | 1976-03-30 | Vereinigte Baubeschlagfabriken Gretsch & Co. | Retaining mechanism for safety ski bindings |
| AT330629B (de) * | 1974-03-22 | 1976-07-12 | Smolka & Co Wiener Metall | Skibindung mit einem trittgestell |
| DE2600899A1 (de) * | 1975-01-28 | 1976-07-29 | Jean Joseph Alfred Beyl | Skisicherheitsbindung |
| US3979131A (en) * | 1975-03-18 | 1976-09-07 | Ginther George E | Ski binding |
| US4017096A (en) * | 1975-08-08 | 1977-04-12 | Maurice Pinsonnault | Ski harness |
| SE7609577L (sv) * | 1976-08-30 | 1978-03-01 | Kjellstroem Ab Brdr | Skidbinsle |
| SU719643A1 (ru) * | 1977-12-15 | 1980-03-05 | Maksimov Nikolaj | Лыжное крепление |
| DE2805514A1 (de) * | 1978-02-09 | 1979-08-16 | Kreis Truma Geraetebau | Langlauf-skibindung |
| DE2853390C2 (de) * | 1978-12-11 | 1982-11-11 | Alfred Gembruch GmbH & Co KG, 5880 Lüdenscheid | Sohlenhalter-Skibindung |
| US4487427A (en) * | 1979-08-03 | 1984-12-11 | S.A. Etablissements Francois Salomon & Fils | System for binding a boot to a ski |
| EP0096094B1 (en) * | 1982-06-11 | 1987-01-21 | Nike International Ltd. | Sole for cross-country ski shoe |
| DE3240750A1 (de) * | 1982-11-04 | 1984-05-10 | Leningradskij politechničeskij institut imeni M.I. Kalinina, Leningrad | Skibindung |
| SE8403719L (sv) * | 1984-07-16 | 1986-01-17 | Nyboverken Ab | Ny anordning for forbettrad golvventilation och sett att anvenda anordningen |
| SU1560246A1 (ru) * | 1985-04-24 | 1990-04-30 | Ленинградский Политехнический Институт Им.М.И.Калинина | Лыжна принадлежность |
| SU1377129A1 (ru) * | 1985-04-26 | 1988-02-28 | Ленинградский Политехнический Институт Им.М.И.Калинина | Лыжна принадлежность |
-
1985
- 1985-04-24 SU SU853878643A patent/SU1377128A1/ru active
-
1986
- 1986-04-18 WO PCT/SU1986/000031 patent/WO1986006288A1/ru not_active Ceased
- 1986-04-18 HU HU863313A patent/HU195738B/hu not_active IP Right Cessation
- 1986-04-18 JP JP61502690A patent/JPS63501130A/ja active Pending
- 1986-04-18 FI FI865146A patent/FI865146A0/fi not_active Application Discontinuation
- 1986-04-18 EP EP19860902958 patent/EP0220329A4/ru not_active Withdrawn
- 1986-04-18 DE DE8610696U patent/DE8610696U1/de not_active Expired
- 1986-04-22 JP JP1986060860U patent/JPH0324197Y2/ja not_active Expired
- 1986-04-23 IT IT8621646U patent/IT207192Z2/it active
- 1986-04-24 FR FR8605933A patent/FR2582531B3/fr not_active Expired
- 1986-04-24 CA CA000507438A patent/CA1292023C/en not_active Expired - Lifetime
- 1986-04-25 YU YU68686A patent/YU45777B/sh unknown
-
1989
- 1989-03-14 US US07/325,047 patent/US4948158A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| JPS63501130A (ja) | 1988-04-28 |
| JPS61180078U (enExample) | 1986-11-10 |
| EP0220329A4 (fr) | 1988-05-31 |
| YU68686A (en) | 1988-02-29 |
| IT8621646V0 (it) | 1986-04-23 |
| WO1986006288A1 (fr) | 1986-11-06 |
| JPH0324197Y2 (enExample) | 1991-05-27 |
| FI865146L (fi) | 1986-12-17 |
| EP0220329A1 (de) | 1987-05-06 |
| FI865146A7 (fi) | 1986-12-17 |
| DE8610696U1 (de) | 1986-06-12 |
| SU1377128A1 (ru) | 1988-02-28 |
| FR2582531B3 (fr) | 1987-07-31 |
| FR2582531A3 (fr) | 1986-12-05 |
| IT207192Z2 (it) | 1987-12-14 |
| HU195738B (en) | 1988-07-28 |
| US4948158A (en) | 1990-08-14 |
| FI865146A0 (fi) | 1986-12-17 |
| HUT43267A (en) | 1987-10-28 |
| YU45777B (sh) | 1992-07-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1292023C (en) | Ski binding | |
| GB2240383A (en) | Adjustable steering column mechanism. | |
| US3937480A (en) | Safety ski binding | |
| DE972545T1 (de) | Skischuhbindungssystem für Snowboards | |
| ATE187091T1 (de) | Bindung für snowboards | |
| US4182524A (en) | Safety ski binding | |
| US4765641A (en) | Safety ski binding | |
| US5071155A (en) | Toe piece for a safety ski-binding | |
| JPS6449584A (en) | Fastener for safety ski binding | |
| US3930660A (en) | Ski binding | |
| US4252337A (en) | Ski brake | |
| US4361343A (en) | Ski brake | |
| US4842294A (en) | Ski binding | |
| US4066277A (en) | Ski boot heel binding having improved unlocking device | |
| DE3168129D1 (en) | Ski binding | |
| US4684146A (en) | Heel holder | |
| EP0428480A3 (en) | Plate safety binding | |
| US4484763A (en) | Heelholder for a safety ski binding | |
| ATE191155T1 (de) | Automatische snowboardbindung | |
| US4008907A (en) | Heel pieces of ski bindings | |
| US3687471A (en) | Ski safety binding | |
| US4796908A (en) | Ski binding | |
| US4749208A (en) | Ski binding | |
| CA1060059A (en) | Ski binding having releasable plate retaining the ski boot | |
| EP0087289A3 (en) | Shackle |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKLA | Lapsed |