CA1258072A - 5-heteroarylimidazol-2-ones - Google Patents
5-heteroarylimidazol-2-onesInfo
- Publication number
- CA1258072A CA1258072A CA000466458A CA466458A CA1258072A CA 1258072 A CA1258072 A CA 1258072A CA 000466458 A CA000466458 A CA 000466458A CA 466458 A CA466458 A CA 466458A CA 1258072 A CA1258072 A CA 1258072A
- Authority
- CA
- Canada
- Prior art keywords
- compound
- wlth
- compounds
- pharmaceutically acceptable
- heart
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 claims abstract description 24
- 150000003839 salts Chemical class 0.000 claims abstract description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 3
- 239000001257 hydrogen Substances 0.000 claims abstract description 3
- 206010019280 Heart failures Diseases 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims 1
- 239000008194 pharmaceutical composition Substances 0.000 claims 1
- 125000001072 heteroaryl group Chemical group 0.000 abstract description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- 230000003177 cardiotonic effect Effects 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 241000282472 Canis lupus familiaris Species 0.000 description 5
- -1 1so-propyl Chemical group 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 230000002093 peripheral effect Effects 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- RNLQIBCLLYYYFJ-UHFFFAOYSA-N amrinone Chemical compound N1C(=O)C(N)=CC(C=2C=CN=CC=2)=C1 RNLQIBCLLYYYFJ-UHFFFAOYSA-N 0.000 description 3
- 229960002105 amrinone Drugs 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 244000025254 Cannabis sativa Species 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 239000000150 Sympathomimetic Substances 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000001154 acute effect Effects 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 230000000747 cardiac effect Effects 0.000 description 2
- 239000000496 cardiotonic agent Substances 0.000 description 2
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 2
- 239000010931 gold Substances 0.000 description 2
- 229910052737 gold Inorganic materials 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 2
- 230000002107 myocardial effect Effects 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 2
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 2
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 1
- 125000003229 2-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241000208011 Digitalis Species 0.000 description 1
- JRWZLRBJNMZMFE-UHFFFAOYSA-N Dobutamine Chemical compound C=1C=C(O)C(O)=CC=1CCNC(C)CCC1=CC=C(O)C=C1 JRWZLRBJNMZMFE-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 241001163743 Perlodes Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 241000534944 Thia Species 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- 229940022663 acetate Drugs 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000002368 cardiac glycoside Substances 0.000 description 1
- 229940097217 cardiac glycoside Drugs 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 238000011443 conventional therapy Methods 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 229960001089 dobutamine Drugs 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- 229960003638 dopamine Drugs 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 210000002837 heart atrium Anatomy 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-M hexadecanoate Chemical compound CCCCCCCCCCCCCCCC([O-])=O IPCSVZSSVZVIGE-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 239000012729 immediate-release (IR) formulation Substances 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 239000004041 inotropic agent Substances 0.000 description 1
- 229940124975 inotropic drug Drugs 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 208000028867 ischemia Diseases 0.000 description 1
- 229940039009 isoproterenol Drugs 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 229940039748 oxalate Drugs 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- 239000002831 pharmacologic agent Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 1
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229930002534 steroid glycoside Natural products 0.000 description 1
- 150000008143 steroidal glycosides Chemical class 0.000 description 1
- 229940127230 sympathomimetic drug Drugs 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 229940070710 valerate Drugs 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 239000005526 vasoconstrictor agent Substances 0.000 description 1
- 229940124549 vasodilator Drugs 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
- 230000002861 ventricular Effects 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/53—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/46—Oxygen atoms
- C07D213/50—Ketonic radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
- Treating Waste Gases (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US554,498 | 1983-11-23 | ||
| US06/554,498 US4532250A (en) | 1983-11-23 | 1983-11-23 | 5-Heteroarylimidazol-2-ones having cardiotonic activity |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1258072A true CA1258072A (en) | 1989-08-01 |
Family
ID=24213587
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000466458A Expired CA1258072A (en) | 1983-11-23 | 1984-10-26 | 5-heteroarylimidazol-2-ones |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4532250A (enExample) |
| EP (1) | EP0162102B1 (enExample) |
| JP (1) | JPS61500494A (enExample) |
| AU (1) | AU570529B2 (enExample) |
| CA (1) | CA1258072A (enExample) |
| DE (1) | DE3480475D1 (enExample) |
| IT (1) | IT1178243B (enExample) |
| WO (1) | WO1985002402A1 (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4649146A (en) * | 1983-01-31 | 1987-03-10 | Fujisawa Pharmaceutical Co., Ltd. | Thiazole derivatives and pharmaceutical composition comprising the same |
| GR851296B (enExample) * | 1984-05-29 | 1985-11-25 | Pfizer | |
| US4728661A (en) * | 1985-11-13 | 1988-03-01 | Merrell Dow Pharmaceuticals Inc. | Cardiotonic phenyl oxazolones |
| US4670450A (en) * | 1985-11-13 | 1987-06-02 | Merrell Dow Pharmaceuticals Inc. | Cardiotonic thiazolones |
| US4698353A (en) * | 1985-11-13 | 1987-10-06 | Merrell Dow Pharmaceuticals Inc. | Cardiotonic heterocyclic oxazolones |
| GB8529362D0 (en) * | 1985-11-28 | 1986-01-02 | Pfizer Ltd | Quinolone cardiac stimulants |
| US4999365A (en) * | 1987-03-20 | 1991-03-12 | Merrell Dow Pharmaceuticals Inc. | Method of reducing reperfusion injury with imidazol-2-thiones |
| US4743607A (en) * | 1987-05-29 | 1988-05-10 | Merrell Dow Pharmaceuticals Inc. | Cardiotonic tricyclic imidazolones |
| US4803210A (en) * | 1987-05-29 | 1989-02-07 | Merrell Dow Pharmaceuticals Inc. | Cardiotonic tricyclic oxazolones |
| GB8827820D0 (en) * | 1988-11-29 | 1988-12-29 | Janssen Pharmaceutica Nv | (1h-azol-1-ylmethyl)substituted quinoline derivatives |
| US5593991A (en) * | 1993-07-16 | 1997-01-14 | Adams; Jerry L. | Imidazole compounds, use and process of making |
| AR017200A1 (es) | 1997-12-23 | 2001-08-22 | Astrazeneca Ab | Compuestos inhibidores de la proteina cinasa c, sales farmaceuticamente aceptables de los mismos, formulaciones farmaceuitcas que los comprenden, usode las mismas y proceso para la sintesis de dichos compuestos |
| SE9800835D0 (sv) | 1998-03-13 | 1998-03-13 | Astra Ab | New Compounds |
| US6492406B1 (en) | 1999-05-21 | 2002-12-10 | Astrazeneca Ab | Pharmaceutically active compounds |
| US6346625B1 (en) | 1999-06-23 | 2002-02-12 | Astrazeneca Ab | Protein kinase inhibitors |
| EP1439174B1 (en) * | 2001-10-22 | 2012-03-21 | Mitsubishi Tanabe Pharma Corporation | 4-IMIDAZOLIN-2-ONE COMPOUNDS AS p38 MAP KINASE INHIBITORS |
| AU2004201666C1 (en) * | 2001-10-22 | 2006-10-12 | Tanabe Seiyaku Co., Ltd. | 4-Imidazolin-2-one compounds |
| US7473695B2 (en) * | 2001-10-22 | 2009-01-06 | Mitsubishi Tanabe Pharma Corporation | 4-imidazolin-2-one compounds |
| DK1628968T3 (da) * | 2003-04-21 | 2011-07-25 | Mitsubishi Tanabe Pharma Corp | 4-imidazolin-2-on-forbindelser |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2585388A (en) * | 1948-11-17 | 1952-02-12 | Lilly Co Eli | Preparation of 2-mercaptoimidazoles |
| US3303199A (en) * | 1963-07-15 | 1967-02-07 | Geigy Chem Corp | Certain imidazolone derivatives and process for making same |
| IL26729A (en) * | 1965-10-21 | 1970-10-30 | Geigy Ag J R | 2-mercaptoimidazole derivatives and process for their preparation |
| US3641049A (en) * | 1968-10-29 | 1972-02-08 | Jan Olof Sandstrom | Imidazoline-2-thiones |
| US3538104A (en) * | 1969-02-28 | 1970-11-03 | Geigy Chem Corp | Pyridyl-2-imidazolones |
| JPS5343958B2 (enExample) * | 1972-07-29 | 1978-11-24 | ||
| US4053480A (en) * | 1976-04-26 | 1977-10-11 | Velsicol Chemical Corporation | 1-thiadiazolyl-5-phenoxy- and phenylthioalkanoyloxy imidazolidinones |
| US4405635A (en) * | 1979-06-18 | 1983-09-20 | Merrell Dow Pharmaceuticals Inc. | 4-Aroylimidazol-2-ones and their use as pharmaceuticals |
| US4636516A (en) * | 1981-02-19 | 1987-01-13 | Yamanouchi Pharmaceutical Co., Ltd. | 3,5-di-tert-butyl-4-hydroxyphenyl-substituted heterocyclic compounds |
| US4405628A (en) * | 1981-03-05 | 1983-09-20 | Merrell Dow Pharmaceuticals Inc. | 4-Pyridylimidazolones and method of use |
| NZ202351A (en) * | 1981-11-04 | 1986-02-21 | Merrell Dow Pharma | Imidazole carboxamines |
| PH19153A (en) * | 1981-11-04 | 1986-01-15 | Merrell Dow Pharma | Treatment of cardiac failure using imidazolecarboxylic acid derivatives |
-
1983
- 1983-11-23 US US06/554,498 patent/US4532250A/en not_active Expired - Fee Related
-
1984
- 1984-10-26 CA CA000466458A patent/CA1258072A/en not_active Expired
- 1984-11-13 DE DE8585900282T patent/DE3480475D1/de not_active Expired
- 1984-11-13 EP EP85900282A patent/EP0162102B1/en not_active Expired
- 1984-11-13 WO PCT/US1984/001854 patent/WO1985002402A1/en not_active Ceased
- 1984-11-13 JP JP59504367A patent/JPS61500494A/ja active Granted
- 1984-11-13 AU AU36783/84A patent/AU570529B2/en not_active Ceased
- 1984-11-16 IT IT49177/84A patent/IT1178243B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| US4532250A (en) | 1985-07-30 |
| JPS61500494A (ja) | 1986-03-20 |
| EP0162102A1 (en) | 1985-11-27 |
| IT8449177A0 (it) | 1984-11-16 |
| EP0162102B1 (en) | 1989-11-15 |
| IT1178243B (it) | 1987-09-09 |
| JPH0572390B2 (enExample) | 1993-10-12 |
| DE3480475D1 (de) | 1989-12-21 |
| IT8449177A1 (it) | 1986-05-16 |
| AU3678384A (en) | 1985-06-13 |
| AU570529B2 (en) | 1988-03-17 |
| WO1985002402A1 (en) | 1985-06-06 |
| EP0162102A4 (en) | 1986-03-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1258072A (en) | 5-heteroarylimidazol-2-ones | |
| KR890002290B1 (ko) | 피페라진 유도체 및 그의 제조방법 | |
| US12398127B2 (en) | Thyroid hormone receptor beta agonist compounds | |
| JPS62501417A (ja) | 二環式ヘテロアリ−ルチアゾ−ル化合物、これを含む強心薬組成物およびその使用 | |
| JP2660086B2 (ja) | 脳及び心機能障害改善剤 | |
| EP0058614B1 (en) | 1-ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-1,8 naphtyridine-3-carboxylic acid. sesquihydrate, processes for the preparation thereof and use thereof as antibacterial agents | |
| JPH0283369A (ja) | 抗不整脈剤 | |
| HU186788B (en) | Process for producing new 2-guanidino-4-imidazolyl-thizaole derivatives | |
| EP0819118B1 (en) | Potassium ion channel blockers | |
| AU726239B2 (en) | 2-phenoxyaniline derivatives | |
| US6753334B2 (en) | Preparation of sodium-hydrogen exchanger type-1 inhibitors | |
| TW448048B (en) | Pharmaceutical composition for treating Tourette's syndrome | |
| CA2100158A1 (en) | 3-hydroxypyridin-4-one derivatives as pharmaceutical compositions | |
| CA2351075A1 (en) | Pyridinium derivatives for the treatment of diabetic and aging-related vascular complications | |
| US3869474A (en) | 3,4-dihydroxy-benzylalcohol amino derivatives | |
| KR20000017411A (ko) | 조폴레스태트 일수화물의 동질이상체 | |
| SU1087519A1 (ru) | Соли производных 1,2,4-оксадиазолин-5-она про вл ющие свойства регул торов де тельности сердечно-сосудистой системы | |
| JPS63255266A (ja) | 抗不整脈剤 | |
| HU207511B (en) | Process for producing pirimidinium derivatives, nonionic formes of them and pharmaceutical compositions containing them | |
| TW400320B (en) | A benzoylguanidine compound having Na<+>/H<+> exchanger inhibitory activity, its preparation processes and the pharmaceutical compositions comprising the same | |
| US2810725A (en) | Pyridoxal derivatives of isonicotinic acid hydrazide | |
| JPH0519549B2 (enExample) | ||
| TWI276622B (en) | Crystalline forms of the sodium salt of 5-chloro-2-methoxy-N-(2-(4-methoxy -3-methylaminothiocarbonylaminosulfonylphenyl)ethyl)benzamide | |
| JPS5943947B2 (ja) | N−置換モラノリン誘導体 | |
| JPS5865276A (ja) | 不整脈抑制性フエネチルピペリジン化合物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |