CA1225103A - Process for making 1,2-dichloroethane - Google Patents
Process for making 1,2-dichloroethaneInfo
- Publication number
- CA1225103A CA1225103A CA000440682A CA440682A CA1225103A CA 1225103 A CA1225103 A CA 1225103A CA 000440682 A CA000440682 A CA 000440682A CA 440682 A CA440682 A CA 440682A CA 1225103 A CA1225103 A CA 1225103A
- Authority
- CA
- Canada
- Prior art keywords
- dichloroethane
- catalyst
- tetrachloroferrate
- reactor
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 18
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 title claims abstract description 17
- 239000003054 catalyst Substances 0.000 claims abstract description 22
- 239000002904 solvent Substances 0.000 claims abstract description 11
- 239000000460 chlorine Substances 0.000 claims abstract description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 9
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims abstract description 9
- 239000005977 Ethylene Substances 0.000 claims abstract description 9
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 9
- 239000011541 reaction mixture Substances 0.000 claims abstract description 8
- 239000000203 mixture Substances 0.000 claims abstract description 7
- 238000005660 chlorination reaction Methods 0.000 claims abstract description 6
- 239000000126 substance Substances 0.000 claims abstract description 3
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 claims description 8
- 239000006227 byproduct Substances 0.000 claims description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 4
- 229910021578 Iron(III) chloride Inorganic materials 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 230000015572 biosynthetic process Effects 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 150000001768 cations Chemical class 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 239000003112 inhibitor Substances 0.000 claims description 2
- 230000002401 inhibitory effect Effects 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 208000036366 Sensation of pressure Diseases 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 description 20
- 239000000047 product Substances 0.000 description 16
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 12
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 9
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 8
- 229910052742 iron Inorganic materials 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 241000132092 Aster Species 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000012856 packing Methods 0.000 description 2
- 230000036647 reaction Effects 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- PPKPKFIWDXDAGC-IHWYPQMZSA-N (z)-1,2-dichloroprop-1-ene Chemical compound C\C(Cl)=C\Cl PPKPKFIWDXDAGC-IHWYPQMZSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000234435 Lilium Species 0.000 description 1
- 241001503485 Mammuthus Species 0.000 description 1
- 241000282320 Panthera leo Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- LUTSRLYCMSCGCS-BWOMAWGNSA-N [(3s,8r,9s,10r,13s)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthren-3-yl] acetate Chemical compound C([C@@H]12)C[C@]3(C)C(=O)CC=C3[C@@H]1CC=C1[C@]2(C)CC[C@H](OC(=O)C)C1 LUTSRLYCMSCGCS-BWOMAWGNSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- QLGCEAZZWDUTTM-UHFFFAOYSA-K azanium;iron(3+);tetrachloride Chemical compound [NH4+].[Cl-].[Cl-].[Cl-].[Cl-].[Fe+3] QLGCEAZZWDUTTM-UHFFFAOYSA-K 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229910001919 chlorite Inorganic materials 0.000 description 1
- 229910052619 chlorite group Inorganic materials 0.000 description 1
- QBWCMBCROVPCKQ-UHFFFAOYSA-N chlorous acid Chemical compound OCl=O QBWCMBCROVPCKQ-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000010977 jade Substances 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- QWDJLDTYWNBUKE-UHFFFAOYSA-L magnesium bicarbonate Chemical compound [Mg+2].OC([O-])=O.OC([O-])=O QWDJLDTYWNBUKE-UHFFFAOYSA-L 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000007769 metal material Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910000859 α-Fe Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/013—Preparation of halogenated hydrocarbons by addition of halogens
- C07C17/02—Preparation of halogenated hydrocarbons by addition of halogens to unsaturated hydrocarbons
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19823245366 DE3245366A1 (de) | 1982-12-08 | 1982-12-08 | Verfahren zur herstellung von 1,2-dichlorethan |
| DEP3245366.3 | 1982-12-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1225103A true CA1225103A (en) | 1987-08-04 |
Family
ID=6180095
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000440682A Expired CA1225103A (en) | 1982-12-08 | 1983-11-08 | Process for making 1,2-dichloroethane |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4774373A (enExample) |
| EP (1) | EP0111203B2 (enExample) |
| JP (1) | JPS59116237A (enExample) |
| AU (1) | AU558826B2 (enExample) |
| BR (1) | BR8306694A (enExample) |
| CA (1) | CA1225103A (enExample) |
| CS (1) | CS240984B2 (enExample) |
| DD (1) | DD215528A5 (enExample) |
| DE (2) | DE3245366A1 (enExample) |
| ES (1) | ES527213A0 (enExample) |
| HU (1) | HU191906B (enExample) |
| IN (1) | IN159104B (enExample) |
| MX (1) | MX160807A (enExample) |
| NO (1) | NO156863C (enExample) |
| SU (1) | SU1277887A3 (enExample) |
| ZA (1) | ZA839089B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3347153A1 (de) * | 1983-12-27 | 1985-07-04 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von 1,2-dichlorethan |
| DE4026282A1 (de) * | 1990-08-20 | 1992-02-27 | Hoechst Ag | Verfahren und vorrichtung zur herstellung von hochreinem 1,2-dichlorethan mit waermerueckgewinnung |
| TW442449B (en) | 1996-07-04 | 2001-06-23 | Hoechst Ag | Process for preparing 1,2-dichloroethane by direct chlorination |
| RU2151640C1 (ru) * | 1997-09-29 | 2000-06-27 | Институт нефтехимии и катализа АН РБ и УНЦ РАН | Катализатор для гидрохлорирования ненасыщенных соединений |
| RU2152254C1 (ru) * | 1997-09-29 | 2000-07-10 | Институт нефтехимии и катализа АН РБ и УНЦ РАН | Катализатор для гидрохлорирования ненасыщенных соединений |
| JP4883974B2 (ja) * | 2005-10-03 | 2012-02-22 | 株式会社トクヤマ | 1,2−ジクロロエタンの製造方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1042558B (de) * | 1957-01-11 | 1958-11-06 | Basf Ag | Verfahren zur Herstellung gesaettigter, chlorierter Kohlenwasserstoffe |
| NL292710A (enExample) * | 1962-05-16 | |||
| US3496244A (en) * | 1965-09-14 | 1970-02-17 | Fmc Corp | Production of dichloroethane |
| DE1568310A1 (de) * | 1966-07-23 | 1970-03-05 | Huels Chemische Werke Ag | Verfahren zur Herstellung von 1,2-Dichloraethan |
| US4347391A (en) * | 1973-06-11 | 1982-08-31 | Stauffer Chemical Company | Process for preparing ethylene dichloride |
| DE3202378A1 (de) * | 1981-01-30 | 1982-08-26 | Basf Ag, 6700 Ludwigshafen | Verfahren zur kontinuierlichen herstellung von 1,2-dichlorethan |
-
1982
- 1982-12-08 DE DE19823245366 patent/DE3245366A1/de not_active Withdrawn
-
1983
- 1983-11-08 CA CA000440682A patent/CA1225103A/en not_active Expired
- 1983-11-10 IN IN1378/CAL/83A patent/IN159104B/en unknown
- 1983-11-11 ES ES527213A patent/ES527213A0/es active Granted
- 1983-11-22 EP EP83111651A patent/EP0111203B2/de not_active Expired - Lifetime
- 1983-11-22 DE DE8383111651T patent/DE3369122D1/de not_active Expired
- 1983-11-23 US US06/554,586 patent/US4774373A/en not_active Expired - Lifetime
- 1983-11-29 JP JP58223422A patent/JPS59116237A/ja active Granted
- 1983-12-06 CS CS839129A patent/CS240984B2/cs unknown
- 1983-12-06 SU SU833673517A patent/SU1277887A3/ru active
- 1983-12-06 DD DD83257559A patent/DD215528A5/de not_active IP Right Cessation
- 1983-12-06 BR BR8306694A patent/BR8306694A/pt not_active IP Right Cessation
- 1983-12-07 NO NO834509A patent/NO156863C/no not_active IP Right Cessation
- 1983-12-07 MX MX199651A patent/MX160807A/es unknown
- 1983-12-07 HU HU834187A patent/HU191906B/hu not_active IP Right Cessation
- 1983-12-07 ZA ZA839089A patent/ZA839089B/xx unknown
- 1983-12-07 AU AU22161/83A patent/AU558826B2/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| DE3369122D1 (en) | 1987-02-19 |
| ES8406407A1 (es) | 1984-08-01 |
| CS240984B2 (en) | 1986-03-13 |
| SU1277887A3 (ru) | 1986-12-15 |
| BR8306694A (pt) | 1984-07-17 |
| MX160807A (es) | 1990-05-25 |
| ZA839089B (en) | 1984-08-29 |
| US4774373A (en) | 1988-09-27 |
| DD215528A5 (de) | 1984-11-14 |
| DE3245366A1 (de) | 1984-06-14 |
| AU2216183A (en) | 1984-06-14 |
| AU558826B2 (en) | 1987-02-12 |
| NO156863B (no) | 1987-08-31 |
| NO156863C (no) | 1987-12-09 |
| EP0111203A1 (de) | 1984-06-20 |
| CS912983A2 (en) | 1985-06-13 |
| JPS59116237A (ja) | 1984-07-05 |
| JPH045007B2 (enExample) | 1992-01-30 |
| ES527213A0 (es) | 1984-08-01 |
| NO834509L (no) | 1984-06-12 |
| HUT36767A (en) | 1985-10-28 |
| HU191906B (en) | 1987-04-28 |
| EP0111203B1 (de) | 1987-01-14 |
| IN159104B (enExample) | 1987-03-21 |
| EP0111203B2 (de) | 1991-06-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4473540A (en) | High efficiency chlorine dioxide process | |
| CA1225103A (en) | Process for making 1,2-dichloroethane | |
| US5059726A (en) | Process for producing tetrabromobisphenol A | |
| JPH0240049B2 (enExample) | ||
| US2921098A (en) | Process for the preparation of 1, 1, 1-trifluoro-2-bromo-2-chloroethane | |
| US4233280A (en) | Manufacture of anhydrous hydrogen chloride by combusting chlorine-containing organic substances | |
| IL23892A (en) | Process for producing iodine pentafluoride | |
| US2601322A (en) | Process of preparing olefin dichlorides in the presence of an inhibitor for substitution reactions | |
| EP0501507B1 (en) | Process for preparing diester of carbonic acid | |
| US5296640A (en) | Process for preparing perhaloacyl chlorides | |
| EP0131378B1 (en) | Process for the production of chlorine dioxide | |
| US4196150A (en) | 1-Chloro-3,3-dimethyl-butan-2-one | |
| US2399361A (en) | Manufacture of cyanogen | |
| CA1189057A (en) | Catalyst mixture and process for making 1,2- dichloroethane | |
| US3077383A (en) | Process for the production of hydrazine hydrate | |
| US4582935A (en) | Process for producing meta-aminobenzotrifluoride | |
| US3968179A (en) | Selective preparation of 1,2-dichloroethane | |
| US4301314A (en) | Vapor phase chlorination of 1,1-dichloroethane | |
| JPS60156626A (ja) | 1,2‐ジクロルエタンの製法 | |
| US2759978A (en) | Production of chloral | |
| US2469702A (en) | Production of alkyl halides | |
| US4508695A (en) | Process for preparing hydrazines | |
| US3245754A (en) | Preparation of cyanogen chloride | |
| US4388251A (en) | Method for preparing 2-chlorobenzoyl chloride | |
| JPS6365665B2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |