CA1222491A - Thermostat attachment for a valve - Google Patents
Thermostat attachment for a valveInfo
- Publication number
- CA1222491A CA1222491A CA000436726A CA436726A CA1222491A CA 1222491 A CA1222491 A CA 1222491A CA 000436726 A CA000436726 A CA 000436726A CA 436726 A CA436726 A CA 436726A CA 1222491 A CA1222491 A CA 1222491A
- Authority
- CA
- Canada
- Prior art keywords
- knob
- plate
- base
- axially
- supporting bearing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000008093 supporting effect Effects 0.000 claims abstract description 40
- 230000008878 coupling Effects 0.000 claims description 26
- 238000010168 coupling process Methods 0.000 claims description 26
- 238000005859 coupling reaction Methods 0.000 claims description 26
- 238000011049 filling Methods 0.000 claims description 5
- 230000006835 compression Effects 0.000 claims description 4
- 238000007906 compression Methods 0.000 claims description 4
- 230000009975 flexible effect Effects 0.000 claims description 4
- 230000003245 working effect Effects 0.000 claims 1
- 239000002775 capsule Substances 0.000 abstract description 14
- 230000000717 retained effect Effects 0.000 abstract description 8
- 210000002105 tongue Anatomy 0.000 description 9
- 238000010276 construction Methods 0.000 description 8
- 230000002093 peripheral effect Effects 0.000 description 7
- 229920003023 plastic Polymers 0.000 description 4
- 239000004033 plastic Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000005755 formation reaction Methods 0.000 description 3
- 238000001746 injection moulding Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- XTPJLNSARGBDNC-UHFFFAOYSA-N 3-[diethyl(prop-2-ynyl)azaniumyl]propane-1-sulfonate Chemical compound C#CC[N+](CC)(CC)CCCS([O-])(=O)=O XTPJLNSARGBDNC-UHFFFAOYSA-N 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G05—CONTROLLING; REGULATING
- G05D—SYSTEMS FOR CONTROLLING OR REGULATING NON-ELECTRIC VARIABLES
- G05D23/00—Control of temperature
- G05D23/01—Control of temperature without auxiliary power
- G05D23/12—Control of temperature without auxiliary power with sensing element responsive to pressure or volume changes in a confined fluid
- G05D23/125—Control of temperature without auxiliary power with sensing element responsive to pressure or volume changes in a confined fluid the sensing element being placed outside a regulating fluid flow
Landscapes
- Physics & Mathematics (AREA)
- Fluid Mechanics (AREA)
- General Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Automation & Control Theory (AREA)
- Temperature-Responsive Valves (AREA)
- Safety Valves (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3236372A DE3236372C2 (de) | 1982-10-01 | 1982-10-01 | Thermostataufsatz für ein Ventil |
| DEP3236372.9 | 1982-10-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1222491A true CA1222491A (en) | 1987-06-02 |
Family
ID=6174673
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000436726A Expired CA1222491A (en) | 1982-10-01 | 1983-09-14 | Thermostat attachment for a valve |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4508262A (esLanguage) |
| JP (1) | JPS59137677A (esLanguage) |
| CA (1) | CA1222491A (esLanguage) |
| DE (1) | DE3236372C2 (esLanguage) |
| DK (1) | DK157148C (esLanguage) |
| FR (1) | FR2534042B1 (esLanguage) |
| GB (1) | GB2129556B (esLanguage) |
| SE (1) | SE453322B (esLanguage) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3345511C2 (de) * | 1983-12-16 | 1986-11-20 | Fa. Rud. Otto Meyer, 2000 Hamburg | Vorrichtung zur Einschränkung des konvektiven Wärmeübergangs |
| DE3529614A1 (de) * | 1985-08-19 | 1987-02-26 | Danfoss As | Thermostatisch betaetigtes heizkoerperventil |
| DE3914037A1 (de) * | 1989-04-28 | 1990-10-31 | Boehringer Mannheim Gmbh | Testtraegeranalysegeraet |
| DE4038141C1 (esLanguage) * | 1990-11-30 | 1992-05-27 | Danfoss A/S, Nordborg, Dk | |
| DE4123856A1 (de) * | 1991-07-18 | 1993-01-21 | Grohe Armaturen Friedrich | Stellvorrichtung fuer ein mischventil |
| DE4141789A1 (de) * | 1991-12-18 | 1993-06-24 | Grohe Armaturen Friedrich | Stellvorrichtung fuer ein mischventil |
| DE9318911U1 (de) * | 1993-12-09 | 1994-02-10 | Theodor Heimeier Metallwerk GmbH & Co. KG, 59597 Erwitte | Thermostatventil |
| US5931375A (en) * | 1994-09-23 | 1999-08-03 | Frese Armatur A/S | Valve for a system having an energy-carrying medium |
| SE502895C2 (sv) * | 1994-12-02 | 1996-02-12 | Arcu Formplast Ab | Temperaturavkänningsanordning |
| DE19615848C2 (de) * | 1996-04-20 | 2000-01-20 | Honeywell Ag | Thermostatisch gesteuerte Einstellvorrichtung für Heizungsventile |
| DE19917781C2 (de) * | 1999-04-20 | 2002-08-01 | Danfoss As | Heizungsventil-Thermostataufsatz |
| DE19955261C2 (de) | 1999-11-17 | 2001-10-04 | Danfoss As | Ventil, insbesondere Thermostatventil für Heizungsanlagen |
| DE19955258C2 (de) * | 1999-11-17 | 2001-09-20 | Danfoss As | Ventil, insbesondere Thermostatventil für Heizungsanlagen |
| DE19955259C2 (de) | 1999-11-17 | 2001-09-20 | Danfoss As | Ventil, insbesondere Thermostatventil für Heizungsanlagen |
| DE19955263C2 (de) | 1999-11-17 | 2001-09-20 | Danfoss As | Ventil, insbesondere Thermostatventil für Heizungsanlagen |
| DE19955257C1 (de) | 1999-11-17 | 2001-06-28 | Danfoss As | Ventil, insbesondere Thermostatventil für Heizungsanlagen |
| DE19955264C2 (de) * | 1999-11-17 | 2001-09-20 | Danfoss As | Ventil, insbesondere Thermostatventil für Heizungsanlagen |
| DE10022729C2 (de) * | 2000-05-10 | 2003-06-18 | Danfoss As | Ventil,insbesondere Thermostatventil für Heizungsanlagen |
| DE10119589C1 (de) * | 2001-04-21 | 2003-02-13 | Danfoss As | Ventil, insbesondere Thermostatventil für Heizungsanlagen |
| DE10119588C1 (de) * | 2001-04-21 | 2003-02-13 | Danfoss As | Ventil |
| DE10153988B4 (de) * | 2001-11-06 | 2011-07-21 | Grohe AG, 58675 | Sollwerteinstellvorrichtung an einem thermostatisch geregelten Mischventil |
| US7163157B2 (en) * | 2003-12-02 | 2007-01-16 | Watts Regulator Co. | Automatic compensating valve for individual shower and tub/shower combination fixtures |
| GB0814959D0 (en) * | 2008-08-15 | 2008-09-24 | Pegler Ltd | Compact control head for a thermostatic valve |
| EP3056727B1 (en) * | 2015-02-11 | 2019-05-15 | Danfoss A/S | Hydraulic machine |
| DE102019128364A1 (de) * | 2019-10-21 | 2021-04-22 | Horcher Gmbh | Ventilanordnung |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1172090B (de) * | 1964-06-11 | Danfoss A/S, Nordborg (Dänemark) | Thermostatisch betätigtes Ventil | |
| US2045332A (en) * | 1933-07-13 | 1936-06-23 | Johnson Service Co | Temperature regulator |
| DE1180591B (de) * | 1963-07-13 | 1964-10-29 | Danfoss As | Thermostatisch betaetigtes Ventil |
| DK125870B (da) * | 1963-07-13 | 1973-05-14 | Danfoss As | Termostatisk betjent ventil. |
| AT278455B (de) * | 1966-08-17 | 1970-02-10 | Danfoss As | Ventil mit Aufsatz für ein thermostatisches Betätigungssystem |
| CH473348A (fr) * | 1967-04-17 | 1969-05-31 | Piemontesi Jean | Vanne thermostatique comprenant un organe d'actionnement mobile dont la position est commandée par une membrane étanche déformable obturant une chambre mise en pression |
| DE1916929B2 (de) * | 1969-04-02 | 1972-12-14 | Licentia Patent Verwaltungs GmbH, 6000 Frankfurt | Thermostatisches ventil mit loesbare aufgesetztem thermostatteil |
| US3735776A (en) * | 1970-06-12 | 1973-05-29 | Danfoss As | Valve for a heating element |
| DE2531555A1 (de) * | 1975-07-15 | 1977-02-03 | Braukmann Armaturen | Thermostat-radiatorventil |
| DE2921522C2 (de) * | 1979-05-28 | 1981-02-12 | Danfoss A/S, Nordborg (Daenemark) | Drehgriff für Heizkörper-Thermostatventile |
-
1982
- 1982-10-01 DE DE3236372A patent/DE3236372C2/de not_active Expired
-
1983
- 1983-09-12 US US06/531,412 patent/US4508262A/en not_active Expired - Lifetime
- 1983-09-14 CA CA000436726A patent/CA1222491A/en not_active Expired
- 1983-09-21 DK DK430083A patent/DK157148C/da not_active IP Right Cessation
- 1983-09-28 SE SE8305265A patent/SE453322B/sv not_active IP Right Cessation
- 1983-09-30 FR FR8315635A patent/FR2534042B1/fr not_active Expired
- 1983-09-30 GB GB08326257A patent/GB2129556B/en not_active Expired
- 1983-09-30 JP JP58180900A patent/JPS59137677A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DK430083A (da) | 1984-04-02 |
| DK157148B (da) | 1989-11-13 |
| JPS59137677A (ja) | 1984-08-07 |
| FR2534042A1 (fr) | 1984-04-06 |
| SE8305265D0 (sv) | 1983-09-28 |
| DK430083D0 (da) | 1983-09-21 |
| DE3236372A1 (de) | 1984-04-05 |
| SE453322B (sv) | 1988-01-25 |
| DE3236372C2 (de) | 1987-04-30 |
| JPS649507B2 (esLanguage) | 1989-02-17 |
| GB2129556B (en) | 1986-02-19 |
| GB2129556A (en) | 1984-05-16 |
| DK157148C (da) | 1990-04-16 |
| US4508262A (en) | 1985-04-02 |
| GB8326257D0 (en) | 1983-11-02 |
| SE8305265L (sv) | 1984-04-02 |
| FR2534042B1 (fr) | 1988-12-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1222491A (en) | Thermostat attachment for a valve | |
| EP0737286B1 (en) | Thermostat top part for radiator valves | |
| US4733688A (en) | Mixer valve | |
| US5143286A (en) | Thermostatic valve | |
| US4089461A (en) | Thermostatic radiator valve | |
| US6460858B1 (en) | Mechanical seal | |
| US4753418A (en) | Non-rise faucet assembly having stem locator cap to insure proper sealing | |
| US4290553A (en) | Rotary knob for thermostatic valves of radiators | |
| FI59856C (fi) | Termostatfoersedd blandarkran | |
| JPH0445713B2 (esLanguage) | ||
| GB2286675A (en) | Case for thermostat | |
| US5067688A (en) | Solenoid valve | |
| US4508263A (en) | Thermostatic valve | |
| JPS6218764B2 (esLanguage) | ||
| JPH0252144B2 (esLanguage) | ||
| ES1014318U (es) | Valvula de retencion o de inmersion con obturador de disco. | |
| GB2185799A (en) | Adjustable-length gas spring with valve locking mechanism | |
| US6116574A (en) | Expansion valve | |
| JPS6411872B2 (esLanguage) | ||
| US3272433A (en) | Thermostatic valves | |
| EP3193060B1 (en) | Valve, in particular heat exchanger valve | |
| GB2312269A (en) | Locking thermostatic valve head against rotation | |
| KR20040034682A (ko) | 브레이크 피스톤용 열 차폐장치 및 그것을 합체한브레이크 액추에이터 | |
| CA1077906A (en) | Thermostatic radiator valve | |
| JPS5925911B2 (ja) | ラジエタ−用弁のためのサ−モスタツト装置 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |