CA1217491A - 3-aryl-7-chloro-3,4-dihydroacridine-1,9(2h,10h)-dione 1-oximes and 1-hydrazone derivatives, their salts, a process for their preparation, agents containing them and their use - Google Patents
3-aryl-7-chloro-3,4-dihydroacridine-1,9(2h,10h)-dione 1-oximes and 1-hydrazone derivatives, their salts, a process for their preparation, agents containing them and their useInfo
- Publication number
- CA1217491A CA1217491A CA000438636A CA438636A CA1217491A CA 1217491 A CA1217491 A CA 1217491A CA 000438636 A CA000438636 A CA 000438636A CA 438636 A CA438636 A CA 438636A CA 1217491 A CA1217491 A CA 1217491A
- Authority
- CA
- Canada
- Prior art keywords
- denotes
- chloro
- dione
- methyl
- dihydroacridine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 20
- 238000002360 preparation method Methods 0.000 title claims abstract description 13
- 150000003839 salts Chemical class 0.000 title claims description 13
- 239000002253 acid Substances 0.000 claims abstract description 29
- 150000001875 compounds Chemical class 0.000 claims abstract description 15
- 150000003863 ammonium salts Chemical class 0.000 claims abstract description 5
- -1 trifluoromethoxy, difluorochloromethoxy, 1,1,2,2-tetrafluoroethoxy, phenoxy Chemical group 0.000 claims description 58
- 229910052757 nitrogen Inorganic materials 0.000 claims description 33
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 11
- 125000002947 alkylene group Chemical group 0.000 claims description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 8
- 239000000126 substance Substances 0.000 claims description 7
- RJWLLQWLBMJCFD-UHFFFAOYSA-N 4-methylpiperazin-1-amine Chemical compound CN1CCN(N)CC1 RJWLLQWLBMJCFD-UHFFFAOYSA-N 0.000 claims description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- 239000000047 product Substances 0.000 claims description 5
- XAOHWSFGKCJOGT-UHFFFAOYSA-N 2-(4-aminopiperazin-1-yl)ethanol Chemical compound NN1CCN(CCO)CC1 XAOHWSFGKCJOGT-UHFFFAOYSA-N 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 125000005146 naphthylsulfonyl group Chemical group C1(=CC=CC2=CC=CC=C12)S(=O)(=O)* 0.000 claims description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 7
- GILZXVOUYJEQSM-UHFFFAOYSA-N 7-chloro-3-(4-chlorophenyl)-2,3,4,10-tetrahydroacridine-1,9-dione Chemical compound C1=CC(Cl)=CC=C1C1CC(NC=2C(=CC(Cl)=CC=2)C2=O)=C2C(=O)C1 GILZXVOUYJEQSM-UHFFFAOYSA-N 0.000 claims 6
- PZRVZMZUBQJOQW-UHFFFAOYSA-N 7-chloro-3-[4-(trifluoromethyl)phenyl]-2,3,4,10-tetrahydroacridine-1,9-dione Chemical compound C1=CC(C(F)(F)F)=CC=C1C1CC(NC=2C(=CC(Cl)=CC=2)C2=O)=C2C(=O)C1 PZRVZMZUBQJOQW-UHFFFAOYSA-N 0.000 claims 4
- KLIQOXBVGOJHKN-UHFFFAOYSA-N 7-chloro-1-(4-methylpiperazin-1-yl)imino-3-[4-(trifluoromethyl)phenyl]-2,3,4,10-tetrahydroacridin-9-one Chemical compound C1CN(C)CCN1N=C1C(C(=O)C2=CC(Cl)=CC=C2N2)=C2CC(C=2C=CC(=CC=2)C(F)(F)F)C1 KLIQOXBVGOJHKN-UHFFFAOYSA-N 0.000 claims 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 2
- 125000004768 (C1-C4) alkylsulfinyl group Chemical group 0.000 claims 1
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 claims 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 1
- 125000003341 7 membered heterocyclic group Chemical group 0.000 claims 1
- 229940100198 alkylating agent Drugs 0.000 claims 1
- 239000002168 alkylating agent Substances 0.000 claims 1
- 125000005518 carboxamido group Chemical group 0.000 claims 1
- 125000000623 heterocyclic group Chemical group 0.000 claims 1
- UCFFGYASXIPWPD-UHFFFAOYSA-N methyl hypochlorite Chemical group COCl UCFFGYASXIPWPD-UHFFFAOYSA-N 0.000 claims 1
- 125000005029 naphthylthio group Chemical group C1(=CC=CC2=CC=CC=C12)S* 0.000 claims 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- 125000004193 piperazinyl group Chemical group 0.000 claims 1
- 239000002246 antineoplastic agent Substances 0.000 abstract 1
- 229940127089 cytotoxic agent Drugs 0.000 abstract 1
- 150000007857 hydrazones Chemical class 0.000 description 60
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 42
- 238000002844 melting Methods 0.000 description 32
- 230000008018 melting Effects 0.000 description 32
- 150000002923 oximes Chemical class 0.000 description 28
- 229910052796 boron Inorganic materials 0.000 description 15
- 150000007659 semicarbazones Chemical class 0.000 description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- MXWHMTNPTTVWDM-NXOFHUPFSA-N mitoguazone Chemical compound NC(N)=N\N=C(/C)\C=N\N=C(N)N MXWHMTNPTTVWDM-NXOFHUPFSA-N 0.000 description 9
- SRVJKTDHMYAMHA-WUXMJOGZSA-N thioacetazone Chemical compound CC(=O)NC1=CC=C(\C=N\NC(N)=S)C=C1 SRVJKTDHMYAMHA-WUXMJOGZSA-N 0.000 description 9
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 8
- WEYVCQFUGFRXOM-UHFFFAOYSA-N perazine Chemical compound C1CN(C)CCN1CCCN1C2=CC=CC=C2SC2=CC=CC=C21 WEYVCQFUGFRXOM-UHFFFAOYSA-N 0.000 description 8
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 8
- 229960002195 perazine Drugs 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- OWIUPIRUAQMTTK-UHFFFAOYSA-N carbazic acid Chemical compound NNC(O)=O OWIUPIRUAQMTTK-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 125000001309 chloro group Chemical group Cl* 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
- DUIOPKIIICUYRZ-UHFFFAOYSA-N semicarbazide Chemical compound NNC(N)=O DUIOPKIIICUYRZ-UHFFFAOYSA-N 0.000 description 5
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- 125000006309 butyl amino group Chemical group 0.000 description 4
- BRWIZMBXBAOCCF-UHFFFAOYSA-N hydrazinecarbothioamide Chemical compound NNC(N)=S BRWIZMBXBAOCCF-UHFFFAOYSA-N 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- RLZZZVKAURTHCP-UHFFFAOYSA-N phenanthrene-3,4-diol Chemical compound C1=CC=C2C3=C(O)C(O)=CC=C3C=CC2=C1 RLZZZVKAURTHCP-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- HAMNKKUPIHEESI-UHFFFAOYSA-N aminoguanidine Chemical compound NNC(N)=N HAMNKKUPIHEESI-UHFFFAOYSA-N 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000000068 chlorophenyl group Chemical group 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 3
- SBMSLRMNBSMKQC-UHFFFAOYSA-N pyrrolidin-1-amine Chemical compound NN1CCCC1 SBMSLRMNBSMKQC-UHFFFAOYSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- GQMVAUFIUVHMBB-UHFFFAOYSA-K trinaphthalen-2-yloxybismuthane Chemical compound C1=CC=CC2=CC(O[Bi](OC=3C=C4C=CC=CC4=CC=3)OC=3C=C4C=CC=CC4=CC=3)=CC=C21 GQMVAUFIUVHMBB-UHFFFAOYSA-K 0.000 description 3
- RHUYHJGZWVXEHW-UHFFFAOYSA-N 1,1-Dimethyhydrazine Chemical compound CN(C)N RHUYHJGZWVXEHW-UHFFFAOYSA-N 0.000 description 2
- DJTIANXYHUNHQV-UHFFFAOYSA-N 1,1-dibutylhydrazine Chemical compound CCCCN(N)CCCC DJTIANXYHUNHQV-UHFFFAOYSA-N 0.000 description 2
- WFJFGMLKAISFOZ-UHFFFAOYSA-N 1-amino-3-iminourea Chemical compound NN=C(O)N=N WFJFGMLKAISFOZ-UHFFFAOYSA-N 0.000 description 2
- YCEXZVLTZDWEFH-UHFFFAOYSA-N 2-morpholin-4-ylacetohydrazide Chemical compound NNC(=O)CN1CCOCC1 YCEXZVLTZDWEFH-UHFFFAOYSA-N 0.000 description 2
- QENGROZZUNALCE-UHFFFAOYSA-N 2-morpholin-4-ylpropanehydrazide Chemical compound NNC(=O)C(C)N1CCOCC1 QENGROZZUNALCE-UHFFFAOYSA-N 0.000 description 2
- SJMJMGVFFRSXOG-UHFFFAOYSA-N 4-benzylpiperazin-1-amine Chemical compound C1CN(N)CCN1CC1=CC=CC=C1 SJMJMGVFFRSXOG-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 241001387976 Pera Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- MZVQCMJNVPIDEA-UHFFFAOYSA-N [CH2]CN(CC)CC Chemical group [CH2]CN(CC)CC MZVQCMJNVPIDEA-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- XKLVLDXNZDIDKQ-UHFFFAOYSA-N butylhydrazine Chemical compound CCCCNN XKLVLDXNZDIDKQ-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- MKQLBNJQQZRQJU-UHFFFAOYSA-N morpholin-4-amine Chemical compound NN1CCOCC1 MKQLBNJQQZRQJU-UHFFFAOYSA-N 0.000 description 2
- 125000006308 propyl amino group Chemical group 0.000 description 2
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- OGNVQLDIPUXYDH-ZPKKHLQPSA-N (2R,3R,4S)-3-(2-methylpropanoylamino)-4-(4-phenyltriazol-1-yl)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid Chemical compound CC(C)C(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(O)=O)=C[C@@H]1N1N=NC(C=2C=CC=CC=2)=C1 OGNVQLDIPUXYDH-ZPKKHLQPSA-N 0.000 description 1
- WHTVZRBIWZFKQO-AWEZNQCLSA-N (S)-chloroquine Chemical compound ClC1=CC=C2C(N[C@@H](C)CCCN(CC)CC)=CC=NC2=C1 WHTVZRBIWZFKQO-AWEZNQCLSA-N 0.000 description 1
- SWGZHHCRMZDRSN-BTJKTKAUSA-N (Z)-but-2-enedioic acid 1-phenoxypropan-2-ylhydrazine Chemical compound OC(=O)\C=C/C(O)=O.NNC(C)COC1=CC=CC=C1 SWGZHHCRMZDRSN-BTJKTKAUSA-N 0.000 description 1
- URJZMRYOVLWXHO-UHFFFAOYSA-N 1,1-bis(methylamino)guanidine Chemical compound CNN(NC)C(N)=N URJZMRYOVLWXHO-UHFFFAOYSA-N 0.000 description 1
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 1
- GCTFJZMHTKATKY-UHFFFAOYSA-N 1,2,3,6-tetrahydropyrazin-5-amine Chemical compound NC1=NCCNC1 GCTFJZMHTKATKY-UHFFFAOYSA-N 0.000 description 1
- DIIIISSCIXVANO-UHFFFAOYSA-N 1,2-Dimethylhydrazine Chemical compound CNNC DIIIISSCIXVANO-UHFFFAOYSA-N 0.000 description 1
- CFGDUGSIBUXRMR-UHFFFAOYSA-N 1,2-dihydropyrrol-2-ide Chemical compound C=1C=[C-]NC=1 CFGDUGSIBUXRMR-UHFFFAOYSA-N 0.000 description 1
- XMFAAIVNNSITSV-UHFFFAOYSA-N 1,3-dihydropyrrol-3-ide Chemical compound C1=CNC=[C-]1 XMFAAIVNNSITSV-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- IQXXEPZFOOTTBA-UHFFFAOYSA-N 1-benzylpiperazine Chemical compound C=1C=CC=CC=1CN1CCNCC1 IQXXEPZFOOTTBA-UHFFFAOYSA-N 0.000 description 1
- WGCYRFWNGRMRJA-UHFFFAOYSA-N 1-ethylpiperazine Chemical compound CCN1CCNCC1 WGCYRFWNGRMRJA-UHFFFAOYSA-N 0.000 description 1
- DALNXMAZDJRTPB-UHFFFAOYSA-N 2-(dimethylamino)acetohydrazide Chemical compound CN(C)CC(=O)NN DALNXMAZDJRTPB-UHFFFAOYSA-N 0.000 description 1
- TVCXVUHHCUYLGX-UHFFFAOYSA-N 2-Methylpyrrole Chemical compound CC1=CC=CN1 TVCXVUHHCUYLGX-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- WRJZKSHNBALIGH-UHFFFAOYSA-N 2-piperazin-1-ium-1-ylacetate Chemical compound OC(=O)CN1CCNCC1 WRJZKSHNBALIGH-UHFFFAOYSA-N 0.000 description 1
- PTVZQOAHCSKAAS-UHFFFAOYSA-N 4-methyl-3-thiosemicarbazide Chemical compound CNC(=S)NN PTVZQOAHCSKAAS-UHFFFAOYSA-N 0.000 description 1
- JNGXJKJTJUBQSH-UHFFFAOYSA-N 4-methylpiperazine-1-carbothiohydrazide Chemical compound CN1CCN(C(=S)NN)CC1 JNGXJKJTJUBQSH-UHFFFAOYSA-N 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 1
- 241000224483 Coccidia Species 0.000 description 1
- 208000003495 Coccidiosis Diseases 0.000 description 1
- VVNCNSJFMMFHPL-VKHMYHEASA-N D-penicillamine Chemical compound CC(C)(S)[C@@H](N)C(O)=O VVNCNSJFMMFHPL-VKHMYHEASA-N 0.000 description 1
- 241000551547 Dione <red algae> Species 0.000 description 1
- 101100346656 Drosophila melanogaster strat gene Proteins 0.000 description 1
- 102100025027 E3 ubiquitin-protein ligase TRIM69 Human genes 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 101000830203 Homo sapiens E3 ubiquitin-protein ligase TRIM69 Proteins 0.000 description 1
- 241000243251 Hydra Species 0.000 description 1
- 206010023076 Isosporiasis Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 1
- SGXDXUYKISDCAZ-UHFFFAOYSA-N N,N-diethylglycine Chemical compound CCN(CC)CC(O)=O SGXDXUYKISDCAZ-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 206010034133 Pathogen resistance Diseases 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- 241000030538 Thecla Species 0.000 description 1
- 241000009298 Trigla lyra Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- LIGHQFMXKLNVMQ-UHFFFAOYSA-N [Cl].[Cl].[Cl].[P] Chemical compound [Cl].[Cl].[Cl].[P] LIGHQFMXKLNVMQ-UHFFFAOYSA-N 0.000 description 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229940058934 aminoquinoline antimalarials Drugs 0.000 description 1
- 150000005010 aminoquinolines Chemical class 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- WBLIXGSTEMXDSM-UHFFFAOYSA-N chloromethane Chemical compound Cl[CH2] WBLIXGSTEMXDSM-UHFFFAOYSA-N 0.000 description 1
- 229960003677 chloroquine Drugs 0.000 description 1
- WHTVZRBIWZFKQO-UHFFFAOYSA-N chloroquine Natural products ClC1=CC=C2C(NC(C)CCCN(CC)CC)=CC=NC2=C1 WHTVZRBIWZFKQO-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 229940075911 depen Drugs 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001891 dimethoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- PVUJTISUCSKKBS-UHFFFAOYSA-N dimethylaminothiourea Chemical compound CN(C)NC(N)=S PVUJTISUCSKKBS-UHFFFAOYSA-N 0.000 description 1
- SVZFWZRCMLRFOM-UHFFFAOYSA-N dimethylaminourea Chemical compound CN(C)NC(N)=O SVZFWZRCMLRFOM-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 1
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- JCAWCSXFQSFUCH-UHFFFAOYSA-N hydrazinyl formate Chemical compound NNOC=O JCAWCSXFQSFUCH-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- JCYWCSGERIELPG-UHFFFAOYSA-N imes Chemical class CC1=CC(C)=CC(C)=C1N1C=CN(C=2C(=CC(C)=CC=2C)C)[C]1 JCYWCSGERIELPG-UHFFFAOYSA-N 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- QRXWMOHMRWLFEY-UHFFFAOYSA-N isoniazide Chemical compound NNC(=O)C1=CC=NC=C1 QRXWMOHMRWLFEY-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- JYXPWUYLZPYOAH-UHFFFAOYSA-N methylhydrazine Chemical compound CN=N JYXPWUYLZPYOAH-UHFFFAOYSA-N 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004888 n-propyl amino group Chemical group [H]N(*)C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- IYPZRUYMFDWKSS-UHFFFAOYSA-N piperazin-1-amine Chemical compound NN1CCNCC1 IYPZRUYMFDWKSS-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 1
- YNZAFFFENDLJQG-UHFFFAOYSA-N pyrrol-1-amine Chemical compound NN1C=CC=C1 YNZAFFFENDLJQG-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- YOEWQQVKRJEPAE-UHFFFAOYSA-L succinylcholine chloride (anhydrous) Chemical compound [Cl-].[Cl-].C[N+](C)(C)CCOC(=O)CCC(=O)OCC[N+](C)(C)C YOEWQQVKRJEPAE-UHFFFAOYSA-L 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 150000003583 thiosemicarbazides Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D219/00—Heterocyclic compounds containing acridine or hydrogenated acridine ring systems
- C07D219/04—Heterocyclic compounds containing acridine or hydrogenated acridine ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the ring system
- C07D219/06—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D219/00—Heterocyclic compounds containing acridine or hydrogenated acridine ring systems
- C07D219/04—Heterocyclic compounds containing acridine or hydrogenated acridine ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the ring system
- C07D219/08—Nitrogen atoms
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02A—TECHNOLOGIES FOR ADAPTATION TO CLIMATE CHANGE
- Y02A50/00—TECHNOLOGIES FOR ADAPTATION TO CLIMATE CHANGE in human health protection, e.g. against extreme weather
- Y02A50/30—Against vector-borne diseases, e.g. mosquito-borne, fly-borne, tick-borne or waterborne diseases whose impact is exacerbated by climate change
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP3237649.9 | 1982-10-11 | ||
| DE19823237649 DE3237649A1 (de) | 1982-10-11 | 1982-10-11 | 3-aryl-7-chlor-10-hydroxy-3,4-dihydro-acridin-1,9-(2h, 10h)-dion-1-oxime und -1-hydrazonderivate, deren salze, verfahren zu ihrer herstellung, sie enthaltende mittel und ihre verwendung |
| DE19823247908 DE3247908A1 (de) | 1982-12-24 | 1982-12-24 | 3-aryl-7-chlor-3,4-dihydro-acridin-1,9-(2h,-10h)-dion-1-oxime und -1-hydrazonderivate, deren salze, verfahren zu ihrer herstellung, sie enthaltende mittel und ihre verwendung |
| DEP3247908.5 | 1982-12-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1217491A true CA1217491A (en) | 1987-02-03 |
Family
ID=25805046
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000438636A Expired CA1217491A (en) | 1982-10-11 | 1983-10-07 | 3-aryl-7-chloro-3,4-dihydroacridine-1,9(2h,10h)-dione 1-oximes and 1-hydrazone derivatives, their salts, a process for their preparation, agents containing them and their use |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4593027A (enExample) |
| EP (1) | EP0106284B1 (enExample) |
| AU (1) | AU561449B2 (enExample) |
| CA (1) | CA1217491A (enExample) |
| DE (1) | DE3372094D1 (enExample) |
| DK (1) | DK465583A (enExample) |
| ES (1) | ES526354A0 (enExample) |
| FI (1) | FI833651A7 (enExample) |
| GR (1) | GR78732B (enExample) |
| HU (1) | HU190854B (enExample) |
| IL (1) | IL69941A (enExample) |
| JO (1) | JO1266B1 (enExample) |
| MA (1) | MA19925A1 (enExample) |
| NO (1) | NO833681L (enExample) |
| NZ (1) | NZ205906A (enExample) |
| PH (1) | PH19108A (enExample) |
| PT (1) | PT77476B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4626540A (en) * | 1983-11-08 | 1986-12-02 | Warner-Lambert Company | Substituted 1-amino-4-nitro-acridinones and methods of treating bacterial infections and leukemia with them |
| IN164921B (enExample) * | 1986-07-22 | 1989-07-08 | Hoechst India | |
| US5180717A (en) * | 1988-08-16 | 1993-01-19 | The Upjohn Company | Bivalent ligands effective for blocking ACAT enzyme for lowering plasma triglycerides and for elevating HDL cholesterol |
| US5182303A (en) * | 1988-12-27 | 1993-01-26 | E. I. Du Pont De Nemours And Company | Substituted semicarbazone arthropodicides |
| US5268388A (en) * | 1988-12-27 | 1993-12-07 | E. I. Du Pont De Nemours And Company | Substituted semicarbazone arthropodicides |
| US5859028A (en) * | 1997-04-28 | 1999-01-12 | Potomax Limited Partnership | Carotenoid synthesis inhibiting herbicides and fatty acid synthesis inhibiting oxime herbicides as anti-Apicomplexa protozoan parasite agents |
| US20090324580A1 (en) * | 2006-03-09 | 2009-12-31 | Cenix Bioscience Gmbh | Use of Inhibitors of Scavenger Receptor Class Proteins for the Treatment of Infectious Diseases |
| CA2673683C (en) | 2007-01-11 | 2014-07-29 | Critical Outcome Technologies, Inc. | Compounds and method for treatment of cancer |
| EP2225226B1 (en) | 2007-12-26 | 2016-08-17 | Critical Outcome Technologies, Inc. | Compounds and their use in a method for treatment of cancer |
| WO2010006438A1 (en) | 2008-07-17 | 2010-01-21 | Critical Outcome Technologies Inc. | Thiosemicarbazone inhibitor compounds and cancer treatment methods |
| CA2794952C (en) | 2010-04-01 | 2018-05-15 | Critical Outcome Technologies Inc. | Compounds and method for treatment of hiv |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2880210A (en) * | 1959-03-31 | Acridine n-oxides | ||
| US3184452A (en) * | 1965-05-18 | New aminoalkoxy compounds and process for theik manufacture | ||
| NL132832C (enExample) * | 1961-05-26 | |||
| US3577558A (en) * | 1968-04-15 | 1971-05-04 | Sterling Drug Inc | 1-aminoalkylamino-4-alkoxymethylthioxanthene derivatives |
| DE1811409A1 (de) * | 1968-11-28 | 1970-06-18 | Bayer Ag | Mittel zur Bekaempfung von Insekten,Milben,Hasenartigen und Nagetieren |
| DE2337474C2 (de) * | 1973-07-24 | 1982-01-21 | Hoechst Ag, 6000 Frankfurt | Chemotherapeutisch wirksame Tetrahydroacridone, Verfahren zu ihrer Herstellung und sie enthaltende Mittel |
| DE2651084A1 (de) * | 1976-11-09 | 1978-12-14 | Hoechst Ag | Basisch substituirte o-(2-hydroxypropyl) -aldoxime, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| DE2748333A1 (de) * | 1977-10-28 | 1979-05-03 | Hoechst Ag | Mittel gegen malaria |
| US4178451A (en) * | 1978-07-13 | 1979-12-11 | E. R. Squibb & Sons, Inc. | 3-(Substituted hydrazino)benzisothiazole-1,1-dioxides |
| US4266062A (en) * | 1978-09-18 | 1981-05-05 | Mcneilab, Inc. | (1-Methyl-2-pyridinylidene) derivatives of guanidine |
| US4447427A (en) * | 1979-01-04 | 1984-05-08 | The United States Of America As Represented By The Secretary Of The Army | Method for treating bacterial infections with 2-acetyl- and 2-propionylpyridine thiosemicarbazones |
| US4291034A (en) * | 1980-03-20 | 1981-09-22 | Warner Lambert Company | 7-Chloro-3-substituted aryl-3,4-dihydro-1,9(2H,10H) and 10 hydroxy acridinedioneimines having antimalarial activity |
| US4440771A (en) * | 1982-02-12 | 1984-04-03 | The United States Of America As Represented By The Secretary Of The Army | 2-Acetyl quinoline thiosemicarbazones useful in treatment of gonorrhea, malaria or bacterial infections |
-
1983
- 1983-10-07 EP EP83110035A patent/EP0106284B1/de not_active Expired
- 1983-10-07 FI FI833651A patent/FI833651A7/fi not_active Application Discontinuation
- 1983-10-07 CA CA000438636A patent/CA1217491A/en not_active Expired
- 1983-10-07 DE DE8383110035T patent/DE3372094D1/de not_active Expired
- 1983-10-10 HU HU833500A patent/HU190854B/hu not_active IP Right Cessation
- 1983-10-10 IL IL69941A patent/IL69941A/xx unknown
- 1983-10-10 DK DK465583A patent/DK465583A/da not_active Application Discontinuation
- 1983-10-10 NO NO833681A patent/NO833681L/no unknown
- 1983-10-10 ES ES526354A patent/ES526354A0/es active Granted
- 1983-10-10 NZ NZ205906A patent/NZ205906A/en unknown
- 1983-10-10 GR GR72653A patent/GR78732B/el unknown
- 1983-10-10 MA MA20145A patent/MA19925A1/fr unknown
- 1983-10-10 PT PT77476A patent/PT77476B/pt unknown
- 1983-10-10 PH PH29680A patent/PH19108A/en unknown
- 1983-10-10 AU AU20004/83A patent/AU561449B2/en not_active Ceased
- 1983-10-11 US US06/540,647 patent/US4593027A/en not_active Expired - Fee Related
- 1983-10-11 JO JO19831266A patent/JO1266B1/en active
Also Published As
| Publication number | Publication date |
|---|---|
| DK465583D0 (da) | 1983-10-10 |
| ES8405616A1 (es) | 1984-06-16 |
| JO1266B1 (en) | 1985-04-20 |
| AU2000483A (en) | 1984-04-19 |
| EP0106284A1 (de) | 1984-04-25 |
| FI833651A7 (fi) | 1984-04-12 |
| US4593027A (en) | 1986-06-03 |
| NO833681L (no) | 1984-04-12 |
| ES526354A0 (es) | 1984-06-16 |
| MA19925A1 (fr) | 1984-07-01 |
| EP0106284B1 (de) | 1987-06-16 |
| FI833651A0 (fi) | 1983-10-07 |
| DK465583A (da) | 1984-04-12 |
| PH19108A (en) | 1986-01-06 |
| NZ205906A (en) | 1986-06-11 |
| IL69941A (en) | 1988-06-30 |
| GR78732B (enExample) | 1984-10-02 |
| DE3372094D1 (en) | 1987-07-23 |
| PT77476B (de) | 1986-04-16 |
| AU561449B2 (en) | 1987-05-07 |
| IL69941A0 (en) | 1984-01-31 |
| PT77476A (de) | 1983-11-01 |
| HU190854B (en) | 1986-11-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1217491A (en) | 3-aryl-7-chloro-3,4-dihydroacridine-1,9(2h,10h)-dione 1-oximes and 1-hydrazone derivatives, their salts, a process for their preparation, agents containing them and their use | |
| Celik et al. | Design, synthesis and docking studies of benzimidazole derivatives as potential EGFR inhibitors | |
| FI82696B (fi) | Foerfarande foer framstaellning av farmakologiskt vaerdefulla pteridiner. | |
| JP2002510320A (ja) | 新規な一酸化窒素放出アミジンおよびエナミン誘導ジアゼニウムジオレート、組成物およびそれらの用途、ならびにその製造方法 | |
| JPH062739B2 (ja) | 医薬用組成物 | |
| PL117396B1 (en) | Process for preparing novel derivatives of benzimidazole | |
| EP0018850A1 (en) | Substituted 9,10-anthracene-bis hydrazones and pharmaceutical compositions containing same | |
| US3898232A (en) | Isoindolin-1-one derivatives | |
| NL8403856A (nl) | 5-pyrimidinecarboxamiden en thiocarboxamiden en behandeling van leukemie en tumoren daarmee. | |
| US4258045A (en) | Inhibitor of dihydrofolate reductase | |
| EP0172744A2 (en) | Phenazinecarboxamide compounds | |
| GB1087875A (en) | Pyrazinoylguanidines | |
| US4665173A (en) | 2-acetyl- and 2-propionylpyridine selenosemicarbazones | |
| WO1988002366A1 (en) | 1,2,4-benzotriazine oxides as radiosensitizers and selective cytotoxic agents | |
| HUT67899A (en) | Thioxanthenone antitumor agents | |
| JPS59176265A (ja) | ピペラジニルアルカン化合物 | |
| GB2105324A (en) | Herbicidal n-phenylpyrazole derivatives | |
| US4011220A (en) | Pyridazinium compounds and a process for their production | |
| EP0027877B1 (en) | 5,8-dihydroxy-1,4-bis(guanidinyl-amino)anthraquinones | |
| Konstantinova et al. | 1, 2, 4-Thiadiazole 4-oxides | |
| CA1339217C (en) | 1,2,4-benzotriazine oxides as radiosensitizers and selective cytotoxic agents | |
| CA1138872A (en) | Process for the preparation of 1-aryl-1,4- dihydro-4-oxopyridazine-3-carboxamides | |
| Smith et al. | Amidrazones 9. Convenient Syntheses of 1-Alkyl-1-Phenylhydrazines and α, β-Unsaturated Amidrazones Via Base-Promoted Reactions of 1, 1-Disubstituted-3-Amino-4, 5-Dihydro-1H-Pyrazolium Salts | |
| US3957776A (en) | Novel phthalazinone compounds | |
| Etman et al. | New route for the synthesis of 3-anilino-4-aryl-hydrazono-1-phenyl-2-pyrazolin-5-ones |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |