CA1217486A - Synthesis of thiazoles - Google Patents
Synthesis of thiazolesInfo
- Publication number
- CA1217486A CA1217486A CA000454003A CA454003A CA1217486A CA 1217486 A CA1217486 A CA 1217486A CA 000454003 A CA000454003 A CA 000454003A CA 454003 A CA454003 A CA 454003A CA 1217486 A CA1217486 A CA 1217486A
- Authority
- CA
- Canada
- Prior art keywords
- mixture
- chloro
- product
- formula
- bromo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000015572 biosynthetic process Effects 0.000 title claims description 6
- 238000003786 synthesis reaction Methods 0.000 title claims description 5
- 150000003557 thiazoles Chemical class 0.000 title description 3
- 150000001350 alkyl halides Chemical class 0.000 claims abstract description 13
- 238000000034 method Methods 0.000 claims description 28
- 230000008569 process Effects 0.000 claims description 28
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 16
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 14
- 125000001246 bromo group Chemical group Br* 0.000 claims description 12
- 239000012024 dehydrating agents Substances 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 10
- SLYRGJDSFOCAAI-UHFFFAOYSA-N 1,3-thiazolidin-2-one Chemical compound O=C1NCCS1 SLYRGJDSFOCAAI-UHFFFAOYSA-N 0.000 claims description 9
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- -1 pyrrolidino, piperidino Chemical group 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 6
- 125000002346 iodo group Chemical group I* 0.000 claims description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 claims description 6
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 claims description 3
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 claims description 3
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 claims description 3
- NIRCAUPPZAUKDX-UHFFFAOYSA-N 5-benzyl-2-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-6-methylpyridazin-3-one Chemical compound O=C1C=C(CC=2C=CC=CC=2)C(C)=NN1CN(CC1)CCN1C1=CC=CC(Cl)=C1 NIRCAUPPZAUKDX-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- 229910019201 POBr3 Inorganic materials 0.000 claims description 2
- 229910006121 SOBr2 Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 229910020667 PBr3 Inorganic materials 0.000 claims 1
- 229910020656 PBr5 Inorganic materials 0.000 claims 1
- 229910019213 POCl3 Inorganic materials 0.000 claims 1
- 229910006024 SO2Cl2 Inorganic materials 0.000 claims 1
- 229910006124 SOCl2 Inorganic materials 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- IPNPIHIZVLFAFP-UHFFFAOYSA-N phosphorus tribromide Chemical compound BrP(Br)Br IPNPIHIZVLFAFP-UHFFFAOYSA-N 0.000 claims 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 abstract description 3
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 abstract 2
- 239000000203 mixture Substances 0.000 description 51
- 239000000047 product Substances 0.000 description 41
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 36
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical group ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 29
- SUNMBRGCANLOEG-UHFFFAOYSA-N 1,3-dichloroacetone Chemical compound ClCC(=O)CCl SUNMBRGCANLOEG-UHFFFAOYSA-N 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 239000010410 layer Substances 0.000 description 15
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 239000000706 filtrate Substances 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- 239000007858 starting material Substances 0.000 description 11
- 238000004458 analytical method Methods 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000012065 filter cake Substances 0.000 description 9
- 239000000543 intermediate Substances 0.000 description 9
- VJJZXQCIDAQYNQ-UHFFFAOYSA-N 1-[4-(chloromethyl)-1,3-thiazol-2-yl]-n,n-dimethylmethanamine;hydrochloride Chemical compound Cl.CN(C)CC1=NC(CCl)=CS1 VJJZXQCIDAQYNQ-UHFFFAOYSA-N 0.000 description 7
- QNEVCTUHZWPHJE-UHFFFAOYSA-N 4-(chloromethyl)-2-[(dimethylamino)methyl]-5h-1,3-thiazol-4-ol Chemical compound CN(C)CC1=NC(O)(CCl)CS1 QNEVCTUHZWPHJE-UHFFFAOYSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000008367 deionised water Substances 0.000 description 6
- 229910021641 deionized water Inorganic materials 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- GQGHFSJGSKEKJZ-UHFFFAOYSA-N 2-(dimethylamino)ethanethioamide Chemical compound CN(C)CC(N)=S GQGHFSJGSKEKJZ-UHFFFAOYSA-N 0.000 description 5
- 239000007810 chemical reaction solvent Substances 0.000 description 5
- OQANDCSWKZVVQI-UHFFFAOYSA-N 2-(dimethylamino)ethanethioamide;hydrochloride Chemical compound [Cl-].C[NH+](C)CC(N)=S OQANDCSWKZVVQI-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 229940093499 ethyl acetate Drugs 0.000 description 4
- 235000019439 ethyl acetate Nutrition 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 229960001701 chloroform Drugs 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 2
- VWVZFHRDLPHBEG-UHFFFAOYSA-N 1-(chloromethyl)-4-methylsulfanylbenzene Chemical group CSC1=CC=C(CCl)C=C1 VWVZFHRDLPHBEG-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- DIKBFYAXUHHXCS-UHFFFAOYSA-N bromoform Chemical compound BrC(Br)Br DIKBFYAXUHHXCS-UHFFFAOYSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 229940113088 dimethylacetamide Drugs 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- OGFAWKRXZLGJSK-UHFFFAOYSA-N 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone Chemical compound OC1=CC(O)=CC=C1C(=O)CC1=CC=C([N+]([O-])=O)C=C1 OGFAWKRXZLGJSK-UHFFFAOYSA-N 0.000 description 1
- BUDMJAMXOTXJAA-UHFFFAOYSA-N 1-[4-(chloromethyl)-1,3-thiazol-2-yl]-n,n-dimethylmethanamine Chemical compound CN(C)CC1=NC(CCl)=CS1 BUDMJAMXOTXJAA-UHFFFAOYSA-N 0.000 description 1
- MXQBRPGQOFGQDZ-UHFFFAOYSA-N 1-[4-(chloromethyl)-2-ethyl-1,3-thiazol-5-yl]-n-methylmethanamine Chemical compound CCC1=NC(CCl)=C(CNC)S1 MXQBRPGQOFGQDZ-UHFFFAOYSA-N 0.000 description 1
- FDMDNIIUCZHKFE-UHFFFAOYSA-N 2-[[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]methylsulfanyl]ethanamine Chemical compound CN(C)CC1=NC(CSCCN)=CS1 FDMDNIIUCZHKFE-UHFFFAOYSA-N 0.000 description 1
- OGMADIBCHLQMIP-UHFFFAOYSA-N 2-aminoethanethiol;hydron;chloride Chemical compound Cl.NCCS OGMADIBCHLQMIP-UHFFFAOYSA-N 0.000 description 1
- VZWOXDYRBDIHMA-UHFFFAOYSA-N 2-methyl-1,3-thiazole Chemical compound CC1=NC=CS1 VZWOXDYRBDIHMA-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- INYWZIMQKOYAJV-UHFFFAOYSA-N 2-phenyl-4,5-dihydro-1,3-thiazole Chemical compound S1CCN=C1C1=CC=CC=C1 INYWZIMQKOYAJV-UHFFFAOYSA-N 0.000 description 1
- MKQGJQWDMGKYIS-UHFFFAOYSA-N 4,5-dihydro-1,3-thiazol-4-ol Chemical compound OC1CSC=N1 MKQGJQWDMGKYIS-UHFFFAOYSA-N 0.000 description 1
- QKWSLYINUYKIRF-UHFFFAOYSA-N 4-(chloromethyl)-1,3-thiazole Chemical class ClCC1=CSC=N1 QKWSLYINUYKIRF-UHFFFAOYSA-N 0.000 description 1
- IUPOTNKZQQCTAA-UHFFFAOYSA-N 4-(chloromethyl)-2-(pyrrolidin-1-ylmethyl)-1,3-thiazole Chemical compound ClCC1=CSC(CN2CCCC2)=N1 IUPOTNKZQQCTAA-UHFFFAOYSA-N 0.000 description 1
- DMLCXKGYCJOQLY-UHFFFAOYSA-N 4-(chloromethyl)-n,n-dimethyl-1,3-thiazol-2-amine Chemical compound CN(C)C1=NC(CCl)=CS1 DMLCXKGYCJOQLY-UHFFFAOYSA-N 0.000 description 1
- WLIMJCNCVLQJMJ-UHFFFAOYSA-N 4-chloro-2-methyl-1,3-thiazole Chemical class CC1=NC(Cl)=CS1 WLIMJCNCVLQJMJ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 101150041968 CDC13 gene Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical group O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- QIOZLISABUUKJY-UHFFFAOYSA-N Thiobenzamide Chemical compound NC(=S)C1=CC=CC=C1 QIOZLISABUUKJY-UHFFFAOYSA-N 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 229940022663 acetate Drugs 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000003699 antiulcer agent Substances 0.000 description 1
- 150000007656 barbituric acids Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229950005228 bromoform Drugs 0.000 description 1
- 229950005499 carbon tetrachloride Drugs 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- UFULAYFCSOUIOV-UHFFFAOYSA-N cysteamine Chemical compound NCCS UFULAYFCSOUIOV-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- HQRPHMAXFVUBJX-UHFFFAOYSA-M lithium;hydrogen carbonate Chemical class [Li+].OC([O-])=O HQRPHMAXFVUBJX-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- XKMCSTAVBYONDR-UHFFFAOYSA-N n-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-2-methylbutan-1-amine Chemical compound CCC(C)CNCC1=NC(CCl)=CS1 XKMCSTAVBYONDR-UHFFFAOYSA-N 0.000 description 1
- HWSFABGWAXURNG-UHFFFAOYSA-N n-methyl-1-(2-propan-2-yl-1,3-thiazol-4-yl)methanamine Chemical compound CNCC1=CSC(C(C)C)=N1 HWSFABGWAXURNG-UHFFFAOYSA-N 0.000 description 1
- SGXXNSQHWDMGGP-IZZDOVSWSA-N nizatidine Chemical compound [O-][N+](=O)\C=C(/NC)NCCSCC1=CSC(CN(C)C)=N1 SGXXNSQHWDMGGP-IZZDOVSWSA-N 0.000 description 1
- 229960004872 nizatidine Drugs 0.000 description 1
- 238000001225 nuclear magnetic resonance method Methods 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229940127557 pharmaceutical product Drugs 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- ZLMJMSJWJFRBEC-OUBTZVSYSA-N potassium-40 Chemical compound [40K] ZLMJMSJWJFRBEC-OUBTZVSYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- CBDKQYKMCICBOF-UHFFFAOYSA-N thiazoline Chemical class C1CN=CS1 CBDKQYKMCICBOF-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- YUKQRDCYNOVPGJ-UHFFFAOYSA-N thioacetamide Chemical compound CC(N)=S YUKQRDCYNOVPGJ-UHFFFAOYSA-N 0.000 description 1
- DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D277/28—Radicals substituted by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/08—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D277/12—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/14—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US493,883 | 1983-05-12 | ||
| US06/493,883 US4468517A (en) | 1983-05-12 | 1983-05-12 | Synthesis of thiazoles |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1217486A true CA1217486A (en) | 1987-02-03 |
Family
ID=23962095
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000454003A Expired CA1217486A (en) | 1983-05-12 | 1984-05-10 | Synthesis of thiazoles |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4468517A (OSRAM) |
| EP (1) | EP0125887B1 (OSRAM) |
| JP (1) | JPS59212482A (OSRAM) |
| KR (1) | KR860001510B1 (OSRAM) |
| CA (1) | CA1217486A (OSRAM) |
| DE (1) | DE3461638D1 (OSRAM) |
| DK (1) | DK161142C (OSRAM) |
| GB (1) | GB2140802B (OSRAM) |
| GR (1) | GR82074B (OSRAM) |
| HU (1) | HU189111B (OSRAM) |
| IE (1) | IE57395B1 (OSRAM) |
| IL (1) | IL71786A (OSRAM) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES2151480T3 (es) * | 1991-05-21 | 2001-01-01 | Lilly Co Eli | Procedimiento para preparar productos intermedios de nizatidina y compuestos relacionados. |
| US5541335A (en) * | 1994-07-11 | 1996-07-30 | Torcan Chemical Ltd. | Process for preparing nizatidine |
| JP4917243B2 (ja) * | 2001-05-23 | 2012-04-18 | 日本曹達株式会社 | チアゾール化合物の製造方法 |
| AU2003245032A1 (en) * | 2003-02-10 | 2004-08-30 | Dinesh R. Kumar | An improved process for preparing nizatidine intermediate |
| CN106279060A (zh) * | 2016-08-10 | 2017-01-04 | 四川摩尔生物制药有限公司 | 尼扎替丁原料药的制备方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3391151A (en) * | 1966-05-23 | 1968-07-02 | American Home Prod | Benzhydrylthiazole derivatives |
| JPS5516145B2 (OSRAM) * | 1971-10-18 | 1980-04-30 | ||
| US4375547A (en) * | 1980-10-02 | 1983-03-01 | Eli Lilly And Company | N-Methyl-N'-2-([(2-dimethylaminomethyl)-4-thiazolyl]methylthio)ethyl 2-nitro-1,1-ethenediamine |
-
1983
- 1983-05-12 US US06/493,883 patent/US4468517A/en not_active Expired - Lifetime
-
1984
- 1984-05-09 IL IL71786A patent/IL71786A/xx not_active IP Right Cessation
- 1984-05-09 JP JP59093825A patent/JPS59212482A/ja active Granted
- 1984-05-10 EP EP84303160A patent/EP0125887B1/en not_active Expired
- 1984-05-10 GR GR74668A patent/GR82074B/el unknown
- 1984-05-10 GB GB08411887A patent/GB2140802B/en not_active Expired
- 1984-05-10 CA CA000454003A patent/CA1217486A/en not_active Expired
- 1984-05-10 IE IE1161/84A patent/IE57395B1/en not_active IP Right Cessation
- 1984-05-10 DE DE8484303160T patent/DE3461638D1/de not_active Expired
- 1984-05-10 DK DK232184A patent/DK161142C/da not_active IP Right Cessation
- 1984-05-11 HU HU841848A patent/HU189111B/hu not_active IP Right Cessation
- 1984-05-11 KR KR1019840002547A patent/KR860001510B1/ko not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US4468517A (en) | 1984-08-28 |
| HUT36104A (en) | 1985-08-28 |
| GB2140802A (en) | 1984-12-05 |
| DE3461638D1 (en) | 1987-01-22 |
| DK232184D0 (da) | 1984-05-10 |
| EP0125887B1 (en) | 1986-12-10 |
| KR860001510B1 (ko) | 1986-09-30 |
| JPH0579672B2 (OSRAM) | 1993-11-04 |
| IE841161L (en) | 1984-11-12 |
| DK161142C (da) | 1991-11-18 |
| EP0125887A1 (en) | 1984-11-21 |
| DK232184A (da) | 1984-11-13 |
| IE57395B1 (en) | 1992-08-26 |
| HU189111B (en) | 1986-06-30 |
| IL71786A0 (en) | 1984-09-30 |
| GB8411887D0 (en) | 1984-06-13 |
| IL71786A (en) | 1987-10-20 |
| DK161142B (da) | 1991-06-03 |
| GB2140802B (en) | 1986-10-15 |
| JPS59212482A (ja) | 1984-12-01 |
| GR82074B (OSRAM) | 1984-12-13 |
| KR840008800A (ko) | 1984-12-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0008203B1 (en) | Thiazolidine derivatives, preparing same and pharmaceutical compositions comprising same | |
| CA1263115A (en) | Derivatives of 1,2,5-thiadiazole-1-oxides and 1,1- dioxides as histamine h2-antagonists | |
| CA1217486A (en) | Synthesis of thiazoles | |
| US4001223A (en) | Adamantane-piperazine derivatives | |
| WO2007060448A2 (en) | Chemical process for the preparation of an amido-phenoxybenzoic acid compound | |
| EP0259663B1 (en) | Process for producing tetrafluorophihalic acid | |
| US4292431A (en) | Process for the production of hydroxymethylimidazoles | |
| SU715021A3 (ru) | Способ получени производных 2,1,3-тиадиазин-4-он-2,2-диоксида | |
| CA1064038A (en) | 3-(.alpha.-IMINOBENZYL)-4-HYDROXY-6-PHENYL-2(1H)PYRIDONE COMPOUNDS | |
| CA1089472A (en) | Thiazolidine derivatives and process for their manufacture | |
| US4555577A (en) | 2,4-Dichloro-5-thiazolecarboxaldehyde and a process for its preparation | |
| EP0212569B1 (en) | Thiation process | |
| FI69838C (fi) | Foerfarande foer framstaellning av 1,2,3-tiadiazol-5-ylurinaemnen | |
| SE444944B (sv) | Forfarande for framstellning av s-trietylfosfinguld-2,3,4,6-tetra-o-acetyl-1-tio-beta-d-glukopyranosid (auranofin) | |
| US4156735A (en) | Thiazolidine derivatives | |
| KR870001793B1 (ko) | N-설파모일-3-(2-구아니디노티아졸-4-일메틸티오)프로피온아미딘 유도체의 제조방법 | |
| KR890000993B1 (ko) | 3-{{{2-{(엔-알킬아미노이미노메틸)아미노}-4-티아졸릴}메틸}티오}-엔-(아랄킬아미노술포닐)프로판이미드아미드 유도체의 제조방법 | |
| JPS5839675A (ja) | 2−アミノ−5−メルカプト−1,3,4−チアジアゾ−ルの製法 | |
| KR790001861B1 (ko) | 티아졸리딘 유도체의 제조방법 | |
| US3047576A (en) | 1, 1'-(hexafluoroglutaryl)-bis(4-phenylpiperazine) | |
| JP2690742B2 (ja) | 複素環アミン誘導体 | |
| EP0272909A2 (en) | Synthesis of aminothioacetamides | |
| JPH10120674A (ja) | 2−メチル−3−(3,4−メチレンジオキシフェニル)アクリルアルデヒドの製法 | |
| KR100229175B1 (ko) | 세펨 유도체의 제조방법 | |
| EP0112067A2 (en) | Phthalidylammonium compounds and their production, and their use in the production of 1-phthalidyl-5-fluorouracil derivatives and formulations containing such derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |