CA1205941A - Filler-containing plastic molding composition, a process for its preparation, and its use - Google Patents
Filler-containing plastic molding composition, a process for its preparation, and its useInfo
- Publication number
- CA1205941A CA1205941A CA000418454A CA418454A CA1205941A CA 1205941 A CA1205941 A CA 1205941A CA 000418454 A CA000418454 A CA 000418454A CA 418454 A CA418454 A CA 418454A CA 1205941 A CA1205941 A CA 1205941A
- Authority
- CA
- Canada
- Prior art keywords
- parts
- alkaline earth
- earth metal
- weight
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 50
- 239000000945 filler Substances 0.000 title claims abstract description 16
- 238000010137 moulding (plastic) Methods 0.000 title claims abstract description 4
- 238000000034 method Methods 0.000 title claims description 5
- 238000002360 preparation method Methods 0.000 title 1
- -1 polyoxymethylene Polymers 0.000 claims abstract description 76
- 239000002318 adhesion promoter Substances 0.000 claims abstract description 28
- 229930040373 Paraformaldehyde Natural products 0.000 claims abstract description 27
- 229920006324 polyoxymethylene Polymers 0.000 claims abstract description 25
- 238000000465 moulding Methods 0.000 claims abstract description 17
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims abstract description 16
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 45
- 125000004432 carbon atom Chemical group C* 0.000 claims description 26
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 21
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 claims description 11
- 229920001577 copolymer Polymers 0.000 claims description 10
- 229920001519 homopolymer Polymers 0.000 claims description 10
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 7
- 150000001342 alkaline earth metals Chemical group 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 229910001413 alkali metal ion Inorganic materials 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000000654 additive Substances 0.000 claims description 2
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 claims description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 claims 2
- 239000000470 constituent Substances 0.000 claims 1
- 239000002253 acid Substances 0.000 abstract description 12
- 150000007513 acids Chemical class 0.000 abstract description 11
- 229920000642 polymer Polymers 0.000 abstract description 8
- 229910052783 alkali metal Inorganic materials 0.000 abstract description 3
- 150000003460 sulfonic acids Chemical class 0.000 abstract description 3
- 150000001340 alkali metals Chemical class 0.000 abstract 1
- 239000011159 matrix material Substances 0.000 abstract 1
- 238000012360 testing method Methods 0.000 description 24
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 22
- 235000010216 calcium carbonate Nutrition 0.000 description 20
- 239000011734 sodium Substances 0.000 description 20
- 229960003563 calcium carbonate Drugs 0.000 description 19
- MTHSVFCYNBDYFN-UHFFFAOYSA-N anhydrous diethylene glycol Natural products OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 14
- 229940032330 sulfuric acid Drugs 0.000 description 11
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 9
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 8
- 229960005069 calcium Drugs 0.000 description 8
- 239000011575 calcium Substances 0.000 description 8
- 229910052791 calcium Inorganic materials 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 8
- 238000009826 distribution Methods 0.000 description 8
- 159000000000 sodium salts Chemical class 0.000 description 8
- 230000000052 comparative effect Effects 0.000 description 7
- 239000002245 particle Substances 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- 238000012545 processing Methods 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical class C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 5
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 5
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 4
- OGNVQLDIPUXYDH-ZPKKHLQPSA-N (2R,3R,4S)-3-(2-methylpropanoylamino)-4-(4-phenyltriazol-1-yl)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid Chemical compound CC(C)C(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(O)=O)=C[C@@H]1N1N=NC(C=2C=CC=CC=2)=C1 OGNVQLDIPUXYDH-ZPKKHLQPSA-N 0.000 description 3
- LDMOEFOXLIZJOW-UHFFFAOYSA-N 1-dodecanesulfonic acid Chemical compound CCCCCCCCCCCCS(O)(=O)=O LDMOEFOXLIZJOW-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 150000004292 cyclic ethers Chemical class 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 229940088417 precipitated calcium carbonate Drugs 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 3
- 229910015900 BF3 Inorganic materials 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- LEHOTFFKMJEONL-UHFFFAOYSA-N Uric Acid Chemical compound N1C(=O)NC(=O)C2=C1NC(=O)N2 LEHOTFFKMJEONL-UHFFFAOYSA-N 0.000 description 2
- TVWHNULVHGKJHS-UHFFFAOYSA-N Uric acid Natural products N1C(=O)NC(=O)C2NC(=O)NC21 TVWHNULVHGKJHS-UHFFFAOYSA-N 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 229930188620 butyrolactone Natural products 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000005520 cutting process Methods 0.000 description 2
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- SNRUBQQJIBEYMU-UHFFFAOYSA-N dodecane Chemical compound CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 2
- 229940117927 ethylene oxide Drugs 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 239000001095 magnesium carbonate Substances 0.000 description 2
- 235000014380 magnesium carbonate Nutrition 0.000 description 2
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- WKQSAIMSWSDTIX-UHFFFAOYSA-M sodium hexadec-2-ene-1-sulfonate Chemical compound [Na+].CCCCCCCCCCCCCC=CCS([O-])(=O)=O WKQSAIMSWSDTIX-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 229940116269 uric acid Drugs 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- ORTVZLZNOYNASJ-UPHRSURJSA-N (z)-but-2-ene-1,4-diol Chemical compound OC\C=C/CO ORTVZLZNOYNASJ-UPHRSURJSA-N 0.000 description 1
- AUAGGMPIKOZAJZ-UHFFFAOYSA-N 1,3,6-trioxocane Chemical compound C1COCOCCO1 AUAGGMPIKOZAJZ-UHFFFAOYSA-N 0.000 description 1
- CZLMRJZAHXYRIX-UHFFFAOYSA-N 1,3-dioxepane Chemical compound C1CCOCOC1 CZLMRJZAHXYRIX-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- WDUXFOPUOLGSJU-KHPPLWFESA-N 1-[[(z)-octadec-9-enoyl]amino]ethanesulfonic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)NC(C)S(O)(=O)=O WDUXFOPUOLGSJU-KHPPLWFESA-N 0.000 description 1
- KVGOXGQSTGQXDD-UHFFFAOYSA-N 1-decane-sulfonic-acid Chemical compound CCCCCCCCCCS(O)(=O)=O KVGOXGQSTGQXDD-UHFFFAOYSA-N 0.000 description 1
- CMCBDXRRFKYBDG-UHFFFAOYSA-N 1-dodecoxydodecane Chemical compound CCCCCCCCCCCCOCCCCCCCCCCCC CMCBDXRRFKYBDG-UHFFFAOYSA-N 0.000 description 1
- QYKAWPGWVFEIID-UHFFFAOYSA-N 2-(undecanoylamino)ethanesulfonic acid Chemical compound CCCCCCCCCCC(=O)NCCS(O)(=O)=O QYKAWPGWVFEIID-UHFFFAOYSA-N 0.000 description 1
- HPILSDOMLLYBQF-UHFFFAOYSA-N 2-[1-(oxiran-2-ylmethoxy)butoxymethyl]oxirane Chemical compound C1OC1COC(CCC)OCC1CO1 HPILSDOMLLYBQF-UHFFFAOYSA-N 0.000 description 1
- SEFYJVFBMNOLBK-UHFFFAOYSA-N 2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxymethyl]oxirane Chemical compound C1OC1COCCOCCOCC1CO1 SEFYJVFBMNOLBK-UHFFFAOYSA-N 0.000 description 1
- AXGQEJBMPJZXKY-UHFFFAOYSA-N 2-acetyloxytetradecane-1-sulfonic acid Chemical compound CCCCCCCCCCCCC(CS(O)(=O)=O)OC(C)=O AXGQEJBMPJZXKY-UHFFFAOYSA-N 0.000 description 1
- UXPUMTCLHVWFKC-UHFFFAOYSA-N 2-dodecanoyloxyethanesulfonic acid Chemical compound CCCCCCCCCCCC(=O)OCCS(O)(=O)=O UXPUMTCLHVWFKC-UHFFFAOYSA-N 0.000 description 1
- YUBGJSHFULOAKN-UHFFFAOYSA-N 2-hydroxyhexadecane-1-sulfonic acid Chemical compound CCCCCCCCCCCCCCC(O)CS(O)(=O)=O YUBGJSHFULOAKN-UHFFFAOYSA-N 0.000 description 1
- BVGDAZBTIVRTGO-UONOGXRCSA-N 3-[(1r)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[4-methoxy-6-[(2s)-2-methylpiperazin-1-yl]pyridin-3-yl]pyridin-2-amine Chemical compound C1([C@@H](C)OC=2C(N)=NC=C(C=2)C2=CN=C(C=C2OC)N2[C@H](CNCC2)C)=C(Cl)C=CC(F)=C1Cl BVGDAZBTIVRTGO-UONOGXRCSA-N 0.000 description 1
- BAKUAUDFCNFLBX-UHFFFAOYSA-N 4,7-dihydro-1,3-dioxepine Chemical compound C1OCC=CCO1 BAKUAUDFCNFLBX-UHFFFAOYSA-N 0.000 description 1
- IUDNGVFSUHFMCF-UHFFFAOYSA-N 4-(chloromethyl)-1,3-dioxolane Chemical compound ClCC1COCO1 IUDNGVFSUHFMCF-UHFFFAOYSA-N 0.000 description 1
- 239000004135 Bone phosphate Substances 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 241001050985 Disco Species 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- KCFRUUYAXCDZNZ-UHFFFAOYSA-N N-dodecanoyltaurine Chemical compound CCCCCCCCCCCC(=O)NCCS(O)(=O)=O KCFRUUYAXCDZNZ-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- FQYUMYWMJTYZTK-UHFFFAOYSA-N Phenyl glycidyl ether Chemical class C1OC1COC1=CC=CC=C1 FQYUMYWMJTYZTK-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- UMILHIMHKXVDGH-UHFFFAOYSA-N Triethylene glycol diglycidyl ether Chemical compound C1OC1COCCOCCOCCOCC1CO1 UMILHIMHKXVDGH-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 230000002730 additional effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 229920005601 base polymer Polymers 0.000 description 1
- 125000003354 benzotriazolyl group Chemical class N1N=NC2=C1C=CC=C2* 0.000 description 1
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical class C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 1
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- FNAQSUUGMSOBHW-UHFFFAOYSA-H calcium citrate Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O.[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O FNAQSUUGMSOBHW-UHFFFAOYSA-H 0.000 description 1
- 239000001354 calcium citrate Substances 0.000 description 1
- MKJXYGKVIBWPFZ-UHFFFAOYSA-L calcium lactate Chemical compound [Ca+2].CC(O)C([O-])=O.CC(O)C([O-])=O MKJXYGKVIBWPFZ-UHFFFAOYSA-L 0.000 description 1
- 239000001527 calcium lactate Substances 0.000 description 1
- 229960002401 calcium lactate Drugs 0.000 description 1
- 235000011086 calcium lactate Nutrition 0.000 description 1
- HHSPVTKDOHQBKF-UHFFFAOYSA-J calcium;magnesium;dicarbonate Chemical compound [Mg+2].[Ca+2].[O-]C([O-])=O.[O-]C([O-])=O HHSPVTKDOHQBKF-UHFFFAOYSA-J 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- ZWAJLVLEBYIOTI-UHFFFAOYSA-N cyclohexene oxide Chemical compound C1CCCC2OC21 ZWAJLVLEBYIOTI-UHFFFAOYSA-N 0.000 description 1
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohexene oxide Natural products O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- IRUZVFMAOOLZCM-UHFFFAOYSA-N dodecane-4-sulfonic acid Chemical compound CCCCCCCCC(S(O)(=O)=O)CCC IRUZVFMAOOLZCM-UHFFFAOYSA-N 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- KVFIJIWMDBAGDP-UHFFFAOYSA-N ethylpyrazine Chemical compound CCC1=CN=CC=N1 KVFIJIWMDBAGDP-UHFFFAOYSA-N 0.000 description 1
- 229960005237 etoglucid Drugs 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N ferric oxide Chemical compound O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 239000000727 fraction Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- UIKRCFJTBVTDHX-UHFFFAOYSA-N hexadec-2-ene-1-sulfonic acid Chemical compound CCCCCCCCCCCCCC=CCS(O)(=O)=O UIKRCFJTBVTDHX-UHFFFAOYSA-N 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical compound CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000009863 impact test Methods 0.000 description 1
- 230000003116 impacting effect Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 239000011256 inorganic filler Substances 0.000 description 1
- 229910003475 inorganic filler Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 235000015250 liver sausages Nutrition 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical compound [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 239000003595 mist Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- TXSUIVPRHHQNTM-UHFFFAOYSA-N n'-(3-methylanilino)-n-phenyliminobenzenecarboximidamide Chemical compound CC1=CC=CC(NN=C(N=NC=2C=CC=CC=2)C=2C=CC=CC=2)=C1 TXSUIVPRHHQNTM-UHFFFAOYSA-N 0.000 description 1
- AXWCIZPJQUQIIX-UHFFFAOYSA-N nonane-2-sulfonic acid Chemical compound CCCCCCCC(C)S(O)(=O)=O AXWCIZPJQUQIIX-UHFFFAOYSA-N 0.000 description 1
- ARDSQJLUSITVJA-UHFFFAOYSA-N nonane-5-sulfonic acid Chemical compound CCCCC(S(O)(=O)=O)CCCC ARDSQJLUSITVJA-UHFFFAOYSA-N 0.000 description 1
- 239000002667 nucleating agent Substances 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- WLGDAKIJYPIYLR-UHFFFAOYSA-N octane-1-sulfonic acid Chemical compound CCCCCCCCS(O)(=O)=O WLGDAKIJYPIYLR-UHFFFAOYSA-N 0.000 description 1
- LHQXHHDBJMMPCQ-UHFFFAOYSA-N octane-2-sulfonic acid Chemical compound CCCCCCC(C)S(O)(=O)=O LHQXHHDBJMMPCQ-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000001282 organosilanes Chemical class 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000005704 oxymethylene group Chemical group [H]C([H])([*:2])O[*:1] 0.000 description 1
- NAHIZHJHSUSESF-UHFFFAOYSA-N perchloryl acetate Chemical compound CC(=O)OCl(=O)(=O)=O NAHIZHJHSUSESF-UHFFFAOYSA-N 0.000 description 1
- 229920003196 poly(1,3-dioxolane) Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000000075 primary alcohol group Chemical group 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000002226 simultaneous effect Effects 0.000 description 1
- HJZOEUCFUSCGLT-UHFFFAOYSA-M sodium;2-acetyloxydodecane-1-sulfonate Chemical compound [Na+].CCCCCCCCCCC(CS([O-])(=O)=O)OC(C)=O HJZOEUCFUSCGLT-UHFFFAOYSA-M 0.000 description 1
- YRYGQUYZXADJLY-UHFFFAOYSA-M sodium;2-hydroxydodecane-1-sulfonate Chemical compound [Na+].CCCCCCCCCCC(O)CS([O-])(=O)=O YRYGQUYZXADJLY-UHFFFAOYSA-M 0.000 description 1
- QIFLYJMCXGORQF-UHFFFAOYSA-M sodium;2-hydroxytetradecane-1-sulfonate Chemical compound [Na+].CCCCCCCCCCCCC(O)CS([O-])(=O)=O QIFLYJMCXGORQF-UHFFFAOYSA-M 0.000 description 1
- REDQTGKOQGIWPG-UHFFFAOYSA-M sodium;2-undecanoyloxyethanesulfonate Chemical compound [Na+].CCCCCCCCCCC(=O)OCCS([O-])(=O)=O REDQTGKOQGIWPG-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 238000009757 thermoplastic moulding Methods 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 235000013337 tricalcium citrate Nutrition 0.000 description 1
- UYPYRKYUKCHHIB-UHFFFAOYSA-N trimethylamine N-oxide Chemical compound C[N+](C)(C)[O-] UYPYRKYUKCHHIB-UHFFFAOYSA-N 0.000 description 1
- SJEYEFOHSMBQIX-UHFFFAOYSA-N undecane-1-sulfonic acid Chemical compound CCCCCCCCCCCS(O)(=O)=O SJEYEFOHSMBQIX-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/18—Oxygen-containing compounds, e.g. metal carbonyls
- C08K3/24—Acids; Salts thereof
- C08K3/26—Carbonates; Bicarbonates
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/41—Compounds containing sulfur bound to oxygen
- C08K5/42—Sulfonic acids; Derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP3151814.1 | 1981-12-29 | ||
| DE19813151814 DE3151814A1 (de) | 1981-12-29 | 1981-12-29 | "fuellstoff enthaltende kunststoff-formmasse, verfahren zu ihrer herstellung sowie deren verwendung" |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1205941A true CA1205941A (en) | 1986-06-10 |
Family
ID=6149958
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000418454A Expired CA1205941A (en) | 1981-12-29 | 1982-12-23 | Filler-containing plastic molding composition, a process for its preparation, and its use |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4456710A (https=) |
| EP (1) | EP0083084B1 (https=) |
| JP (1) | JPS58118844A (https=) |
| AT (1) | ATE19260T1 (https=) |
| CA (1) | CA1205941A (https=) |
| DE (2) | DE3151814A1 (https=) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3303760A1 (de) | 1983-02-04 | 1984-08-09 | Hoechst Ag, 6230 Frankfurt | Schlagzaeh modifiziertes polyoxymethylen und daraus hergestellte formkoerper |
| US4954545A (en) * | 1987-07-27 | 1990-09-04 | Phillips Petroleum Company | Process for cleaning polymer processing equipment |
| GB8724959D0 (en) * | 1987-10-24 | 1987-11-25 | Dow Corning Sa | Filled compositions |
| GB8724958D0 (en) * | 1987-10-24 | 1987-11-25 | Dow Corning Sa | Filled compositions & additives |
| US5156913A (en) * | 1989-12-11 | 1992-10-20 | Hoechst Celanese Corp. | Glass reinforced acetal polymer products |
| US5773503A (en) * | 1996-12-11 | 1998-06-30 | Luzenac America, Inc. | Compacted mineral filler pellet and method for making the same |
| US6815479B1 (en) * | 1999-02-19 | 2004-11-09 | E. I. Du Pont De Nemours And Company | Toughened high modulus mineral filled polyoxymethylene polymers |
| WO2002014429A1 (en) * | 2000-08-17 | 2002-02-21 | E.I. Du Pont De Nemours And Company | Toughened, high-modulus polyacetals |
| DE10047488B4 (de) * | 2000-09-26 | 2006-12-07 | Ticona Gmbh | Eingefärbte Polyoxymethylen-Formmassen und daraus hergestellte Formteile |
| WO2002026885A1 (de) * | 2000-09-26 | 2002-04-04 | Ticona Gmbh | Eingefärbte polyoxymethylen-formmassen und daraus hergestellte formteile |
| US20040242747A1 (en) * | 2003-05-30 | 2004-12-02 | Malay Nandi | Polyoxymethylene homopolymer with improved thermal stability |
| WO2005071011A1 (ja) * | 2004-01-21 | 2005-08-04 | Asahi Kasei Chemicals Corporation | ポリアセタール樹脂組成物 |
| JP4730948B2 (ja) * | 2005-08-03 | 2011-07-20 | 旭化成ケミカルズ株式会社 | ポリアセタール樹脂組成物 |
| US8631583B2 (en) | 2005-10-31 | 2014-01-21 | Dennis Moss | Bagel slicer |
| US20080127497A1 (en) * | 2005-10-31 | 2008-06-05 | Dennis Moss | Blade assembly |
| EP2036944A1 (en) * | 2007-09-14 | 2009-03-18 | SOLVAY (Société Anonyme) | Polymer compositions |
| US9061920B2 (en) * | 2009-11-10 | 2015-06-23 | Omya International Ag | Precipitated magnesium carbonate |
| EP2390285A1 (en) | 2010-05-28 | 2011-11-30 | Omya Development AG | Process for the preparation of surface treated mineral filler products and uses of same |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2841504A (en) * | 1953-09-01 | 1958-07-01 | Wyandotte Chemicals Corp | Surface coated calcium carbonate pigments |
| GB1025675A (en) * | 1962-06-06 | 1966-04-14 | Celanese Corp | Surface treatment of oxymethylene polymers |
| DE1220129B (de) * | 1963-10-25 | 1966-06-30 | Hoechst Ag | Verfahren zur Oberflaechenbehandlung von Polyacetal-Formkoerpern |
| DE2538954A1 (de) * | 1975-09-02 | 1977-03-10 | Hoechst Ag | Verfahren zur herstellung von oxymethylenpolymeren |
| DE2735160A1 (de) * | 1977-08-04 | 1979-02-22 | Hoechst Ag | Fuellstoff enthaltende kunststoff- formmasse |
| DE2818240A1 (de) * | 1978-04-26 | 1979-11-08 | Hoechst Ag | Thermoplastische formmassen auf basis von polyoxymethylenen |
| US4274987A (en) * | 1978-09-11 | 1981-06-23 | Nl Industries, Inc. | Coupling agents for thermoplastic composites |
| JPS5919588B2 (ja) * | 1978-09-27 | 1984-05-07 | ライオン株式会社 | 無臭性樹脂組成物 |
| DE2910586B2 (de) * | 1979-03-17 | 1981-01-29 | Hoechst Ag, 6000 Frankfurt | Füllstoff enthaltende Polyolefin-Formmasse und Verfahren zu ihrer Herstellung |
| US4274995A (en) * | 1979-12-31 | 1981-06-23 | Stauffer Chemical Company | Filled polyolefin compositions having improved thermal stability |
-
1981
- 1981-12-29 DE DE19813151814 patent/DE3151814A1/de not_active Withdrawn
-
1982
- 1982-12-13 US US06/449,160 patent/US4456710A/en not_active Expired - Fee Related
- 1982-12-23 CA CA000418454A patent/CA1205941A/en not_active Expired
- 1982-12-23 AT AT82111956T patent/ATE19260T1/de not_active IP Right Cessation
- 1982-12-23 DE DE8282111956T patent/DE3270693D1/de not_active Expired
- 1982-12-23 EP EP82111956A patent/EP0083084B1/de not_active Expired
- 1982-12-27 JP JP57227185A patent/JPS58118844A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4456710A (en) | 1984-06-26 |
| DE3151814A1 (de) | 1983-07-07 |
| DE3270693D1 (en) | 1986-05-22 |
| EP0083084B1 (de) | 1986-04-16 |
| EP0083084A2 (de) | 1983-07-06 |
| JPH0326222B2 (https=) | 1991-04-10 |
| ATE19260T1 (de) | 1986-05-15 |
| EP0083084A3 (en) | 1984-01-11 |
| JPS58118844A (ja) | 1983-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1205941A (en) | Filler-containing plastic molding composition, a process for its preparation, and its use | |
| CA1266538A (en) | Toughened polyoxymethylene and shaped articles produced therefrom | |
| US4978725A (en) | Toughened polyoxymethylene and shaped articles produced therefrom | |
| US2993025A (en) | Polyoxymethylene compositions stabilized with a synthetic superpolyamide | |
| US5240639A (en) | Foaming agent | |
| CA1057885A (en) | Molding composition based on oxymethylene polymers | |
| CA1136791A (en) | Filler-containing molding composition and process for its manufacture | |
| TW324732B (en) | Biodegradable polymers, the preparation thereof and the use thereof for the production of biodegradable moldings the invention relates to a biodegradable polyetheresteramide, which is produced by reacting a mixture comprising a polyetheresteramide P1, vinyl ether and a compound D. | |
| PL80934B1 (en) | Thermoplastic molding compositions on the basis of polyoxymethylenes[us3704275a] | |
| US3795715A (en) | Thermoplastic moulding compositions on the basis of polyacetal and process for their preparation | |
| US2718509A (en) | Plasticized resin compositions | |
| US3595937A (en) | Thermoplastic polyester moulding compositions containing polyacetals | |
| DE3421864A1 (de) | Thermoplastische formmassen auf der basis von polyoxymethylen und polymeren adipatcarbonatmischestern | |
| DE60012950T2 (de) | Polyacetalharzzusammensetzung | |
| US4111912A (en) | Process for the manufacture of coarse-granular oxymethylene polymers | |
| CN1012373B (zh) | 具有改进的耐磨性的增韧聚缩醛 | |
| US3631124A (en) | Thermoplastic moulding compositions on the basis of polyacetals | |
| CA1067245A (en) | Process for the manufacture of granular oxymethylene polymers | |
| EP0536483B1 (en) | Polymer mixture from ABS or ABS + PC and a copolyether ester block copolymer; articles formed therefrom | |
| US5045607A (en) | Acetal polymer blends | |
| JP3115473B2 (ja) | 変性ポリオキシメチレン共重合体の製造法 | |
| US3835097A (en) | Light degradable thermoplastic molding composition based on polyacetals | |
| CN101568594A (zh) | 聚缩醛树脂组合物 | |
| US3959188A (en) | Surfactants and their use in foamable polymer compositions | |
| JP3093139B2 (ja) | 変性ポリオキシメチレン共重合体、その製造法及びそれを含有する組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |