CA1183119A - Polyolefin polymerization process and catalyst - Google Patents
Polyolefin polymerization process and catalystInfo
- Publication number
- CA1183119A CA1183119A CA000395763A CA395763A CA1183119A CA 1183119 A CA1183119 A CA 1183119A CA 000395763 A CA000395763 A CA 000395763A CA 395763 A CA395763 A CA 395763A CA 1183119 A CA1183119 A CA 1183119A
- Authority
- CA
- Canada
- Prior art keywords
- catalyst
- catalyst according
- compound
- component
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003054 catalyst Substances 0.000 title claims abstract description 171
- 238000006116 polymerization reaction Methods 0.000 title claims abstract description 37
- 229920000098 polyolefin Polymers 0.000 title description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 44
- 150000003623 transition metal compounds Chemical class 0.000 claims abstract description 23
- 238000006243 chemical reaction Methods 0.000 claims abstract description 20
- 150000004820 halides Chemical class 0.000 claims abstract description 19
- 229910052751 metal Inorganic materials 0.000 claims abstract description 17
- 239000002184 metal Substances 0.000 claims abstract description 17
- 238000000034 method Methods 0.000 claims abstract description 13
- 230000000737 periodic effect Effects 0.000 claims abstract description 8
- -1 unsaturated hydrocarbyl radicals Chemical class 0.000 claims description 54
- 239000010936 titanium Substances 0.000 claims description 40
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 31
- 229910052719 titanium Inorganic materials 0.000 claims description 31
- FHUODBDRWMIBQP-UHFFFAOYSA-N Ethyl p-anisate Chemical compound CCOC(=O)C1=CC=C(OC)C=C1 FHUODBDRWMIBQP-UHFFFAOYSA-N 0.000 claims description 28
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 claims description 28
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 claims description 21
- 150000002989 phenols Chemical class 0.000 claims description 20
- 125000004432 carbon atom Chemical group C* 0.000 claims description 19
- 229910003074 TiCl4 Inorganic materials 0.000 claims description 18
- 229910052736 halogen Inorganic materials 0.000 claims description 17
- YNLAOSYQHBDIKW-UHFFFAOYSA-M diethylaluminium chloride Chemical compound CC[Al](Cl)CC YNLAOSYQHBDIKW-UHFFFAOYSA-M 0.000 claims description 16
- 150000002367 halogens Chemical group 0.000 claims description 16
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical group [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 claims description 14
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 14
- 229910003910 SiCl4 Inorganic materials 0.000 claims description 13
- FDNAPBUWERUEDA-UHFFFAOYSA-N silicon tetrachloride Chemical compound Cl[Si](Cl)(Cl)Cl FDNAPBUWERUEDA-UHFFFAOYSA-N 0.000 claims description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 12
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 claims description 12
- 229910052723 transition metal Inorganic materials 0.000 claims description 12
- 150000003624 transition metals Chemical class 0.000 claims description 12
- 150000004780 naphthols Chemical class 0.000 claims description 10
- 150000003254 radicals Chemical class 0.000 claims description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 9
- 229910010066 TiC14 Inorganic materials 0.000 claims description 9
- 125000003118 aryl group Chemical group 0.000 claims description 9
- 230000008569 process Effects 0.000 claims description 9
- 229910052710 silicon Inorganic materials 0.000 claims description 9
- CMAOLVNGLTWICC-UHFFFAOYSA-N 2-fluoro-5-methylbenzonitrile Chemical compound CC1=CC=C(F)C(C#N)=C1 CMAOLVNGLTWICC-UHFFFAOYSA-N 0.000 claims description 8
- 125000001931 aliphatic group Chemical group 0.000 claims description 8
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 claims description 8
- 229910052720 vanadium Inorganic materials 0.000 claims description 8
- 239000004711 α-olefin Substances 0.000 claims description 8
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 7
- 150000004756 silanes Chemical class 0.000 claims description 7
- 229910052726 zirconium Inorganic materials 0.000 claims description 7
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- MTZQAGJQAFMTAQ-UHFFFAOYSA-N ethyl benzoate Chemical compound CCOC(=O)C1=CC=CC=C1 MTZQAGJQAFMTAQ-UHFFFAOYSA-N 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 150000001282 organosilanes Chemical class 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 230000001376 precipitating effect Effects 0.000 claims description 5
- 239000010703 silicon Substances 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 claims description 5
- 150000003609 titanium compounds Chemical class 0.000 claims description 5
- HXDOZKJGKXYMEW-UHFFFAOYSA-N 4-ethylphenol Chemical compound CCC1=CC=C(O)C=C1 HXDOZKJGKXYMEW-UHFFFAOYSA-N 0.000 claims description 4
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 claims description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 4
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 4
- 159000000032 aromatic acids Chemical class 0.000 claims description 4
- 235000010233 benzoic acid Nutrition 0.000 claims description 4
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 claims description 4
- 239000000376 reactant Substances 0.000 claims description 4
- ZDHXKXAHOVTTAH-UHFFFAOYSA-N trichlorosilane Chemical compound Cl[SiH](Cl)Cl ZDHXKXAHOVTTAH-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 229910004721 HSiCl3 Inorganic materials 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 3
- JRXXLCKWQFKACW-UHFFFAOYSA-N biphenylacetylene Chemical group C1=CC=CC=C1C#CC1=CC=CC=C1 JRXXLCKWQFKACW-UHFFFAOYSA-N 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 229910001629 magnesium chloride Inorganic materials 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 229910052718 tin Inorganic materials 0.000 claims description 3
- MSHFRERJPWKJFX-UHFFFAOYSA-N 4-Methoxybenzyl alcohol Chemical compound COC1=CC=C(CO)C=C1 MSHFRERJPWKJFX-UHFFFAOYSA-N 0.000 claims description 2
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 claims description 2
- LAWOZCWGWDVVSG-UHFFFAOYSA-N dioctylamine Chemical compound CCCCCCCCNCCCCCCCC LAWOZCWGWDVVSG-UHFFFAOYSA-N 0.000 claims description 2
- GPAYUJZHTULNBE-UHFFFAOYSA-N diphenylphosphine Chemical compound C=1C=CC=CC=1PC1=CC=CC=C1 GPAYUJZHTULNBE-UHFFFAOYSA-N 0.000 claims description 2
- 229910052732 germanium Inorganic materials 0.000 claims description 2
- 229910052698 phosphorus Inorganic materials 0.000 claims description 2
- 229920000548 poly(silane) polymer Polymers 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 239000000377 silicon dioxide Substances 0.000 claims description 2
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 claims description 2
- XHQZJYCNDZAGLW-UHFFFAOYSA-N 3-methoxybenzoic acid Chemical compound COC1=CC=CC(C(O)=O)=C1 XHQZJYCNDZAGLW-UHFFFAOYSA-N 0.000 claims 2
- FINHMKGKINIASC-UHFFFAOYSA-N Tetramethylpyrazine Chemical compound CC1=NC(C)=C(C)N=C1C FINHMKGKINIASC-UHFFFAOYSA-N 0.000 claims 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims 2
- YXVFYQXJAXKLAK-UHFFFAOYSA-N biphenyl-4-ol Chemical compound C1=CC(O)=CC=C1C1=CC=CC=C1 YXVFYQXJAXKLAK-UHFFFAOYSA-N 0.000 claims 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims 2
- 150000003755 zirconium compounds Chemical class 0.000 claims 2
- SJTBRFHBXDZMPS-UHFFFAOYSA-N 3-fluorophenol Chemical compound OC1=CC=CC(F)=C1 SJTBRFHBXDZMPS-UHFFFAOYSA-N 0.000 claims 1
- RHMPLDJJXGPMEX-UHFFFAOYSA-N 4-fluorophenol Chemical compound OC1=CC=C(F)C=C1 RHMPLDJJXGPMEX-UHFFFAOYSA-N 0.000 claims 1
- NIFAOMSJMGEFTQ-UHFFFAOYSA-N 4-methoxybenzenethiol Chemical compound COC1=CC=C(S)C=C1 NIFAOMSJMGEFTQ-UHFFFAOYSA-N 0.000 claims 1
- ZEYHEAKUIGZSGI-UHFFFAOYSA-N 4-methoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1 ZEYHEAKUIGZSGI-UHFFFAOYSA-N 0.000 claims 1
- WLHCBQAPPJAULW-UHFFFAOYSA-N 4-methylbenzenethiol Chemical compound CC1=CC=C(S)C=C1 WLHCBQAPPJAULW-UHFFFAOYSA-N 0.000 claims 1
- ZUTYZAFDFLLILI-UHFFFAOYSA-N 4-sec-Butylphenol Chemical compound CCC(C)C1=CC=C(O)C=C1 ZUTYZAFDFLLILI-UHFFFAOYSA-N 0.000 claims 1
- 239000005711 Benzoic acid Substances 0.000 claims 1
- ROFVEXUMMXZLPA-UHFFFAOYSA-N Bipyridyl Chemical compound N1=CC=CC=C1C1=CC=CC=N1 ROFVEXUMMXZLPA-UHFFFAOYSA-N 0.000 claims 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims 1
- 229910004151 SinCl2n+2 Inorganic materials 0.000 claims 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 claims 1
- OIKHZBFJHONJJB-UHFFFAOYSA-N dimethyl(phenyl)silicon Chemical compound C[Si](C)C1=CC=CC=C1 OIKHZBFJHONJJB-UHFFFAOYSA-N 0.000 claims 1
- OKHRRIGNGQFVEE-UHFFFAOYSA-N methyl(diphenyl)silicon Chemical group C=1C=CC=CC=1[Si](C)C1=CC=CC=C1 OKHRRIGNGQFVEE-UHFFFAOYSA-N 0.000 claims 1
- 150000001367 organochlorosilanes Chemical class 0.000 claims 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 claims 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 claims 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 claims 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 claims 1
- 150000001336 alkenes Chemical class 0.000 abstract description 9
- 239000007787 solid Substances 0.000 description 24
- 239000003085 diluting agent Substances 0.000 description 23
- 239000007788 liquid Substances 0.000 description 20
- 239000000203 mixture Substances 0.000 description 20
- 229920000642 polymer Polymers 0.000 description 20
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 20
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 20
- 238000002360 preparation method Methods 0.000 description 18
- 239000000047 product Substances 0.000 description 18
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 15
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 14
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- 230000000694 effects Effects 0.000 description 10
- 239000001257 hydrogen Substances 0.000 description 10
- 229910052739 hydrogen Inorganic materials 0.000 description 10
- 238000005342 ion exchange Methods 0.000 description 9
- 229910001507 metal halide Inorganic materials 0.000 description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 8
- 238000010438 heat treatment Methods 0.000 description 8
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 8
- 239000004215 Carbon black (E152) Substances 0.000 description 7
- 150000001993 dienes Chemical class 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- 229930195733 hydrocarbon Natural products 0.000 description 7
- 239000011777 magnesium Substances 0.000 description 7
- 238000002156 mixing Methods 0.000 description 7
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical class OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 6
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000008096 xylene Substances 0.000 description 6
- 239000004743 Polypropylene Substances 0.000 description 5
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 5
- 229910052782 aluminium Inorganic materials 0.000 description 5
- 235000019445 benzyl alcohol Nutrition 0.000 description 5
- 150000002430 hydrocarbons Chemical class 0.000 description 5
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 5
- 229920001155 polypropylene Polymers 0.000 description 5
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- 239000002879 Lewis base Substances 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 230000002140 halogenating effect Effects 0.000 description 4
- 150000007527 lewis bases Chemical class 0.000 description 4
- 235000011147 magnesium chloride Nutrition 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 150000003377 silicon compounds Chemical class 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 238000005303 weighing Methods 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 150000001559 benzoic acids Chemical class 0.000 description 3
- 150000003938 benzyl alcohols Chemical class 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000001282 iso-butane Substances 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- 150000002902 organometallic compounds Chemical class 0.000 description 3
- 230000000379 polymerizing effect Effects 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 239000012265 solid product Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- GHPYJLCQYMAXGG-WCCKRBBISA-N (2R)-2-amino-3-(2-boronoethylsulfanyl)propanoic acid hydrochloride Chemical compound Cl.N[C@@H](CSCCB(O)O)C(O)=O GHPYJLCQYMAXGG-WCCKRBBISA-N 0.000 description 2
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical compound C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 239000003849 aromatic solvent Substances 0.000 description 2
- 229950011260 betanaphthol Drugs 0.000 description 2
- 235000013361 beverage Nutrition 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- SLLGVCUQYRMELA-UHFFFAOYSA-N chlorosilicon Chemical compound Cl[Si] SLLGVCUQYRMELA-UHFFFAOYSA-N 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 238000007334 copolymerization reaction Methods 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- HBGGXOJOCNVPFY-UHFFFAOYSA-N diisononyl phthalate Chemical compound CC(C)CCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCC(C)C HBGGXOJOCNVPFY-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 125000002524 organometallic group Chemical group 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 239000002685 polymerization catalyst Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000010926 purge Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 150000003738 xylenes Chemical class 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- UAIVFDJJMVMUGY-UHFFFAOYSA-N 1,2,4-trimethylpiperazine Chemical compound CC1CN(C)CCN1C UAIVFDJJMVMUGY-UHFFFAOYSA-N 0.000 description 1
- QTYUSOHYEPOHLV-FNORWQNLSA-N 1,3-Octadiene Chemical compound CCCC\C=C\C=C QTYUSOHYEPOHLV-FNORWQNLSA-N 0.000 description 1
- RCJMVGJKROQDCB-UHFFFAOYSA-N 1,3-dimethyl-1,3-butadiene Natural products CC=CC(C)=C RCJMVGJKROQDCB-UHFFFAOYSA-N 0.000 description 1
- WHFHDVDXYKOSKI-UHFFFAOYSA-N 1-ethenyl-4-ethylbenzene Chemical compound CCC1=CC=C(C=C)C=C1 WHFHDVDXYKOSKI-UHFFFAOYSA-N 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- UUXDPRZTJZRKHE-UHFFFAOYSA-N 1-tetradecoxytetradecane;titanium Chemical compound [Ti].CCCCCCCCCCCCCCOCCCCCCCCCCCCCC UUXDPRZTJZRKHE-UHFFFAOYSA-N 0.000 description 1
- NSMWYRLQHIXVAP-UHFFFAOYSA-N 2,5-dimethylpiperazine Chemical compound CC1CNC(C)CN1 NSMWYRLQHIXVAP-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- BOTGCZBEERTTDQ-UHFFFAOYSA-N 4-Methoxy-1-naphthol Chemical compound C1=CC=C2C(OC)=CC=C(O)C2=C1 BOTGCZBEERTTDQ-UHFFFAOYSA-N 0.000 description 1
- 101100058670 Aeromonas hydrophila subsp. hydrophila (strain ATCC 7966 / DSM 30187 / BCRC 13018 / CCUG 14551 / JCM 1027 / KCTC 2358 / NCIMB 9240 / NCTC 8049) bsr gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 102100024133 Coiled-coil domain-containing protein 50 Human genes 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 101000910772 Homo sapiens Coiled-coil domain-containing protein 50 Proteins 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 1
- 101150026135 Ncln gene Proteins 0.000 description 1
- ILUJQPXNXACGAN-UHFFFAOYSA-N O-methylsalicylic acid Chemical compound COC1=CC=CC=C1C(O)=O ILUJQPXNXACGAN-UHFFFAOYSA-N 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- 229910008046 SnC14 Inorganic materials 0.000 description 1
- 229910010063 TiCl4 a Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- OLBVUFHMDRJKTK-UHFFFAOYSA-N [N].[O] Chemical compound [N].[O] OLBVUFHMDRJKTK-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical class [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- DFZMJEWPEDLXSY-UHFFFAOYSA-M bromo(dicyclohexyl)alumane Chemical compound [Br-].C1CCCCC1[Al+]C1CCCCC1 DFZMJEWPEDLXSY-UHFFFAOYSA-M 0.000 description 1
- NZIXICKPQWIFAU-UHFFFAOYSA-K bromo(dimethyl)alumane;dibromo(methyl)alumane Chemical compound C[Al](C)Br.C[Al](Br)Br NZIXICKPQWIFAU-UHFFFAOYSA-K 0.000 description 1
- SVOZEWXYCOBNAY-UHFFFAOYSA-M bromo(dioctyl)alumane Chemical compound [Br-].CCCCCCCC[Al+]CCCCCCCC SVOZEWXYCOBNAY-UHFFFAOYSA-M 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- ISFMCQATCMRFPY-UHFFFAOYSA-M chloro(diphenyl)alumane Chemical compound [Cl-].C=1C=CC=CC=1[Al+]C1=CC=CC=C1 ISFMCQATCMRFPY-UHFFFAOYSA-M 0.000 description 1
- LKRBKNPREDAJJQ-UHFFFAOYSA-M chloro-di(propan-2-yl)alumane Chemical compound [Cl-].CC(C)[Al+]C(C)C LKRBKNPREDAJJQ-UHFFFAOYSA-M 0.000 description 1
- YGHUUVGIRWMJGE-UHFFFAOYSA-N chlorodimethylsilane Chemical compound C[SiH](C)Cl YGHUUVGIRWMJGE-UHFFFAOYSA-N 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- OMCJRBRLZRVVKW-UHFFFAOYSA-N diethyl(2-methylpentyl)alumane Chemical compound CCCC(C)C[Al](CC)CC OMCJRBRLZRVVKW-UHFFFAOYSA-N 0.000 description 1
- CQYBWJYIKCZXCN-UHFFFAOYSA-N diethylaluminum Chemical compound CC[Al]CC CQYBWJYIKCZXCN-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- LDCRTTXIJACKKU-ARJAWSKDSA-N dimethyl maleate Chemical compound COC(=O)\C=C/C(=O)OC LDCRTTXIJACKKU-ARJAWSKDSA-N 0.000 description 1
- ZGMHEOLLTWPGQX-UHFFFAOYSA-M dimethylalumanylium;bromide Chemical compound C[Al](C)Br ZGMHEOLLTWPGQX-UHFFFAOYSA-M 0.000 description 1
- QICIKCXRCRCEIR-UHFFFAOYSA-L dodecylaluminum(2+);dibromide Chemical compound [Br-].[Br-].CCCCCCCCCCCC[Al+2] QICIKCXRCRCEIR-UHFFFAOYSA-L 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- HHEIMYAXCOIQCJ-UHFFFAOYSA-N ethyl 2,2-dimethylpropanoate Chemical compound CCOC(=O)C(C)(C)C HHEIMYAXCOIQCJ-UHFFFAOYSA-N 0.000 description 1
- RETLCWPMLJPOTP-UHFFFAOYSA-N ethyl 2-chlorobenzoate Chemical compound CCOC(=O)C1=CC=CC=C1Cl RETLCWPMLJPOTP-UHFFFAOYSA-N 0.000 description 1
- JJOYCHKVKWDMEA-UHFFFAOYSA-N ethyl cyclohexanecarboxylate Chemical compound CCOC(=O)C1CCCCC1 JJOYCHKVKWDMEA-UHFFFAOYSA-N 0.000 description 1
- NARCMUVKZHPJHP-UHFFFAOYSA-L ethyl(diiodo)alumane Chemical compound [I-].[I-].CC[Al+2] NARCMUVKZHPJHP-UHFFFAOYSA-L 0.000 description 1
- MGDOJPNDRJNJBK-UHFFFAOYSA-N ethylaluminum Chemical compound [Al].C[CH2] MGDOJPNDRJNJBK-UHFFFAOYSA-N 0.000 description 1
- UAIZDWNSWGTKFZ-UHFFFAOYSA-L ethylaluminum(2+);dichloride Chemical compound CC[Al](Cl)Cl UAIZDWNSWGTKFZ-UHFFFAOYSA-L 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229920001580 isotactic polymer Polymers 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 150000002681 magnesium compounds Chemical class 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 239000002923 metal particle Substances 0.000 description 1
- ITNVWQNWHXEMNS-UHFFFAOYSA-N methanolate;titanium(4+) Chemical compound [Ti+4].[O-]C.[O-]C.[O-]C.[O-]C ITNVWQNWHXEMNS-UHFFFAOYSA-N 0.000 description 1
- IRRLOYQPAMYUGE-UHFFFAOYSA-M methyl(propyl)alumanylium;bromide Chemical compound [Br-].CCC[Al+]C IRRLOYQPAMYUGE-UHFFFAOYSA-M 0.000 description 1
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 1
- XBKBZMOLSULOEA-UHFFFAOYSA-L methylaluminum(2+);dibromide Chemical compound C[Al](Br)Br XBKBZMOLSULOEA-UHFFFAOYSA-L 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 235000020030 perry Nutrition 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- 150000008039 phosphoramides Chemical class 0.000 description 1
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000069 polyphenylene sulfide Polymers 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- IOVGROKTTNBUGK-SJCJKPOMSA-N ritodrine Chemical compound N([C@@H](C)[C@H](O)C=1C=CC(O)=CC=1)CCC1=CC=C(O)C=C1 IOVGROKTTNBUGK-SJCJKPOMSA-N 0.000 description 1
- 238000001175 rotational moulding Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 230000003381 solubilizing effect Effects 0.000 description 1
- 239000002195 soluble material Substances 0.000 description 1
- OUULRIDHGPHMNQ-UHFFFAOYSA-N stibane Chemical class [SbH3] OUULRIDHGPHMNQ-UHFFFAOYSA-N 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N titanium dioxide Inorganic materials O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- JMXKSZRRTHPKDL-UHFFFAOYSA-N titanium ethoxide Chemical compound [Ti+4].CC[O-].CC[O-].CC[O-].CC[O-] JMXKSZRRTHPKDL-UHFFFAOYSA-N 0.000 description 1
- DPNUIZVZBWBCPB-UHFFFAOYSA-J titanium(4+);tetraphenoxide Chemical compound [Ti+4].[O-]C1=CC=CC=C1.[O-]C1=CC=CC=C1.[O-]C1=CC=CC=C1.[O-]C1=CC=CC=C1 DPNUIZVZBWBCPB-UHFFFAOYSA-J 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- FNZVPOPUGCLHJA-UHFFFAOYSA-N tri(icosyl)alumane Chemical compound CCCCCCCCCCCCCCCCCCCC[Al](CCCCCCCCCCCCCCCCCCCC)CCCCCCCCCCCCCCCCCCCC FNZVPOPUGCLHJA-UHFFFAOYSA-N 0.000 description 1
- 239000005052 trichlorosilane Substances 0.000 description 1
- ZIYNWDQDHKSRCE-UHFFFAOYSA-N tricyclohexylalumane Chemical compound C1CCCCC1[Al](C1CCCCC1)C1CCCCC1 ZIYNWDQDHKSRCE-UHFFFAOYSA-N 0.000 description 1
- AJSTXXYNEIHPMD-UHFFFAOYSA-N triethyl borate Chemical compound CCOB(OCC)OCC AJSTXXYNEIHPMD-UHFFFAOYSA-N 0.000 description 1
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 1
- JQPMDTQDAXRDGS-UHFFFAOYSA-N triphenylalumane Chemical compound C1=CC=CC=C1[Al](C=1C=CC=CC=1)C1=CC=CC=C1 JQPMDTQDAXRDGS-UHFFFAOYSA-N 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
- C08F10/02—Ethene
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F36/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds
- C08F36/02—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having only two carbon-to-carbon double bonds
- C08F36/04—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having only two carbon-to-carbon double bonds conjugated
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F4/00—Polymerisation catalysts
- C08F4/02—Carriers therefor
- C08F4/022—Magnesium halide as support anhydrous or hydrated or complexed by means of a Lewis base for Ziegler-type catalysts
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US240,533 | 1981-03-04 | ||
| US06/240,533 US4394291A (en) | 1981-03-04 | 1981-03-04 | Polyolefin polymerization process and catalyst |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1183119A true CA1183119A (en) | 1985-02-26 |
Family
ID=22906926
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000395763A Expired CA1183119A (en) | 1981-03-04 | 1982-02-08 | Polyolefin polymerization process and catalyst |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4394291A (enEXAMPLES) |
| EP (1) | EP0060443B1 (enEXAMPLES) |
| JP (1) | JPS57158207A (enEXAMPLES) |
| AT (1) | ATE48145T1 (enEXAMPLES) |
| BR (1) | BR8201027A (enEXAMPLES) |
| CA (1) | CA1183119A (enEXAMPLES) |
| DE (1) | DE3280033D1 (enEXAMPLES) |
| ES (1) | ES8306768A1 (enEXAMPLES) |
| GB (1) | GB2093851B (enEXAMPLES) |
| MX (1) | MX159971A (enEXAMPLES) |
| NO (1) | NO159284C (enEXAMPLES) |
| SG (1) | SG16385G (enEXAMPLES) |
Families Citing this family (54)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4477588A (en) * | 1982-12-15 | 1984-10-16 | Phillips Petroleum Company | Polyolefin polymerization process and catalyst |
| JPS59117508A (ja) * | 1982-12-24 | 1984-07-06 | Mitsui Petrochem Ind Ltd | エチレンの重合法 |
| US4525555A (en) * | 1983-01-14 | 1985-06-25 | Nippon Oil Company, Limited | Process for preparing polyolefins |
| CA1225080A (en) * | 1983-01-28 | 1987-08-04 | Gil R. Hawley | Polyolefin polymerization process and catalyst |
| CA1213267A (en) * | 1983-04-21 | 1986-10-28 | Albert P. Masino | Polyolefin polymerization process and catalyst |
| US4952737A (en) * | 1983-04-21 | 1990-08-28 | Phillips Petroleum Company | Polyolefin polymerization process and catalyst |
| US4770902A (en) * | 1983-05-23 | 1988-09-13 | National Distillers And Chemical Corporation | Method for covering an electrical conducting means |
| US4548969A (en) * | 1983-05-23 | 1985-10-22 | Maringer Melvin F | Cross-linkable rotational molding compositions |
| US4555379A (en) * | 1983-05-23 | 1985-11-26 | National Distillers And Chemical Corporation | Cross-linkable rotational molding compositions |
| US4503159A (en) * | 1983-08-19 | 1985-03-05 | Phillips Petroleum Company | Polyolefin polymerization process and catalyst |
| US4492768A (en) * | 1983-08-19 | 1985-01-08 | Phillips Petroleum Company | Polyolefin polymerization process and catalyst |
| US4585749A (en) * | 1983-09-28 | 1986-04-29 | Phillips Petroleum Company | Process for the preparation of an olefin polymerization catalyst |
| US4853444A (en) * | 1983-10-28 | 1989-08-01 | Phillips Petroleum Company | Magnesium halide hydrates and polymerization catalysts prepared therefrom |
| US4520121A (en) * | 1983-10-28 | 1985-05-28 | Inkrott Kenneth E | Magnesium halide hydrates and polymerization catalysts prepared therefrom |
| US4562168A (en) * | 1984-05-17 | 1985-12-31 | Phillips Petroleum Company | Catalyst and olefin polymerization |
| US4537870A (en) * | 1984-07-12 | 1985-08-27 | Phillips Petroleum Company | Polyolefin polymerization process and catalyst |
| US4588703A (en) * | 1984-07-18 | 1986-05-13 | Phillips Petroleum Company | Polyolefin polymerization process and catalyst |
| JPH0730128B2 (ja) * | 1984-10-04 | 1995-04-05 | チッソ株式会社 | オレフィン重合用固体触媒成分の製造法 |
| JPH0629289B2 (ja) * | 1984-11-30 | 1994-04-20 | 東ソー株式会社 | ポリエチレンの製造方法 |
| US4680351A (en) * | 1985-09-06 | 1987-07-14 | Phillips Petroleum Company | Supported polyolefin catalyst components and methods of making and using same |
| JPH085930B2 (ja) * | 1986-06-23 | 1996-01-24 | 東ソー株式会社 | ポリオレフインの製造方法 |
| US6121393A (en) * | 1987-02-17 | 2000-09-19 | Mitsui Chemicals | Process for polymerizing alpha-olefins |
| DE3876892T2 (de) * | 1987-02-17 | 1993-04-29 | Mitsui Petrochemical Ind | Verfahren zur polymerisierung von alpha-polyolefinen. |
| US5145821A (en) * | 1990-05-09 | 1992-09-08 | Quantum Chemical Corporation | Silica supported polymerization catalyst system |
| US5034365A (en) * | 1990-05-09 | 1991-07-23 | Quantum Chemical Corporation | Silica supported polymerization catalyst |
| FR2639351B1 (enEXAMPLES) * | 1988-11-23 | 1992-12-31 | Atochem | |
| US5024982A (en) * | 1988-12-14 | 1991-06-18 | Phillips Petroleum Company | Silica-containing olefin polymerization catalysts and process |
| US5270276A (en) * | 1989-04-25 | 1993-12-14 | Shell Oil Company | Process for the production of elastomeric, primarily syndiotactic polypropylene and catalysts for use in said process |
| US5270410A (en) * | 1989-04-25 | 1993-12-14 | Shell Oil Company | Process for the production of elastomeric, primarily syndiotactic polypropylene and catalysts for use in said process |
| US5238891A (en) * | 1989-06-15 | 1993-08-24 | Phillips Petroleum Company | Olefin polymerization catalyst and process |
| US4971936A (en) * | 1989-07-10 | 1990-11-20 | Shell Oil Company | Catalyst component for making primarily isotactic elastomeric polypropylene or polybutene |
| US4988655A (en) * | 1989-11-30 | 1991-01-29 | Phillips Petroleum Company | Polyolefin polymerization catalyst and method of production use |
| US5089573A (en) * | 1990-02-26 | 1992-02-18 | Shell Oil Company | Process for the production of elastomeric, primarily isotactic polyolefins and catalysts for use in said process |
| US5118767A (en) * | 1990-02-26 | 1992-06-02 | Shell Oil Company | Process for producing mildly elastomeric primarily isotatic polypropylene and poly-1-butene |
| US5118649A (en) * | 1990-02-26 | 1992-06-02 | Shell Oil Company | Process for the production of elastomeric primarily isotactic polyolefins and catalysts for use in said process |
| US5182341A (en) * | 1990-04-30 | 1993-01-26 | Masino Albert P | Olefin polymerization method |
| US5126302A (en) * | 1990-04-30 | 1992-06-30 | Quantum Chemical Corporation | Olefin polymerization catalyst and methods |
| US5232998A (en) * | 1990-05-09 | 1993-08-03 | Quantum Chemical Corporation | Olefin polymerization using silica supported catalyst |
| US5118768A (en) * | 1990-05-11 | 1992-06-02 | Shell Oil Company | Process for the production of elastomeric, primarily isotactic polyolefins and catalysts for use in said process |
| US5164352A (en) * | 1990-05-11 | 1992-11-17 | Shell Oil Company | Process for the production of elastomeric, primarily isotactic polyolefins and catalysts for use in said process |
| JP3132030B2 (ja) * | 1991-03-22 | 2001-02-05 | 東ソー株式会社 | 立体規則性ポリオレフィンの製造方法 |
| US5091490A (en) * | 1991-06-19 | 1992-02-25 | Phillips Petroleum Company | Olefin polymerization catalysts and methods |
| EP0522424B1 (en) * | 1991-07-03 | 1996-12-18 | Tosoh Corporation | Method for producing a polyolefin |
| US5244990A (en) * | 1992-01-07 | 1993-09-14 | Phillips Petroleum Company | Prepolymerized catalyst and use thereof |
| FR2686595B1 (fr) * | 1992-01-27 | 1994-05-06 | Elf Atochem Sa | Procede de fabrication de mgcl2, mgo de repartition granulometrique etroite. application de ce compose comme support de composante catalytique de polymerisation des olefines. |
| CA2093462C (en) * | 1992-06-16 | 1999-01-26 | Joel Leonard Martin | Olefin polymerization, catalyst, and precursor therefor |
| US5235011A (en) * | 1992-08-31 | 1993-08-10 | Phillips Petroleum Company | Polyolefin polymerization process, method of producing catalyst, and catalyst |
| US5362825A (en) * | 1992-07-13 | 1994-11-08 | Phillips Petroleum Company | Catalysts for polymerizing olefins and methods |
| US5206314A (en) * | 1992-08-31 | 1993-04-27 | Phillips Petroleum Company | Polyolefin polymerization process, process of producing catalyst, and catalyst |
| CA2146034A1 (en) | 1994-05-12 | 1995-11-13 | Kenneth W. Willcox | Polymer stabilization |
| BE1008702A3 (fr) * | 1994-09-22 | 1996-07-02 | Solvay | Procede de polymerisation d'olefines. |
| DE69600988T2 (de) * | 1995-10-02 | 1999-07-08 | Borealis Ag, Schwechat-Mannswoerth | Trägerkatalysator für die Olefinpolymerisation |
| US6034186A (en) * | 1997-05-16 | 2000-03-07 | Phillips Petroleum Company | Olefin polymerization processes and products thereof |
| US8277645B2 (en) | 2008-12-17 | 2012-10-02 | Jarvis Jr Ernest | Automatic retractable screen system for storm drain inlets |
Family Cites Families (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3150122A (en) * | 1957-11-07 | 1964-09-22 | Monsanto Co | Production of high-density ziegler polymers |
| US3022283A (en) * | 1958-10-27 | 1962-02-20 | Phillips Petroleum Co | Production of solid olefin polymers in the presence of acetylenic compounds using alkyl titanium halide catalysts |
| US3400110A (en) * | 1963-08-01 | 1968-09-03 | Solvay | Polymerization of olefins in the presence of a catalyst comprising an organometallic compound and the reaction product of a transition metal compound and a hydroxychloride of a bivalent metal |
| NL135604C (enEXAMPLES) * | 1965-06-25 | |||
| NL136306C (enEXAMPLES) * | 1965-11-04 | |||
| US3549717A (en) * | 1968-02-28 | 1970-12-22 | Gosei Chem Ind Co Ltd | Process for the production of 1,5,9-cyclododecatriene |
| US3676418A (en) * | 1968-07-20 | 1972-07-11 | Mitsubishi Petrochemical Co | Catalytic production of olefin polymers |
| CA920299A (en) | 1968-08-01 | 1973-01-30 | Mitsui Petrochemical Industries | Process for the polymerization and/or copolymerization of olefins with use of ziegler-type catalytsts supported on carrier |
| US3644318A (en) * | 1968-08-21 | 1972-02-22 | Hoechst Ag | Process for the polymerization of olefins |
| US3676411A (en) * | 1970-12-17 | 1972-07-11 | Goodyear Tire & Rubber | Ternary catalyst systems for the polymerization of conjugated diolefins |
| US3726845A (en) * | 1971-03-22 | 1973-04-10 | Exxon Research Engineering Co | Supplying catalyst to a reaction zone |
| US3784539A (en) * | 1971-09-07 | 1974-01-08 | Monsanto Co | Process for the polymerization of olefins |
| BE791676A (fr) * | 1971-12-08 | 1973-05-21 | Solvay | Procédé pour la polymérisation des oléfines |
| LU65587A1 (enEXAMPLES) | 1972-06-22 | 1973-12-27 | ||
| US3953414A (en) * | 1972-09-13 | 1976-04-27 | Montecatini Edison S.P.A., | Catalysts for the polymerization of olefins to spherically shaped polymers |
| US4076924A (en) * | 1974-09-03 | 1978-02-28 | Mitsui Petrochemical Industries Ltd. | Process for polymerization or copolymerizing olefins containing at least 3 carbon atoms |
| JPS565404B2 (enEXAMPLES) | 1975-02-14 | 1981-02-04 | ||
| LU72278A1 (enEXAMPLES) * | 1975-04-14 | 1977-02-03 | ||
| IT1038179B (it) | 1975-05-16 | 1979-11-20 | Montedison Spa | Procedimento di polimerizzazione di alfa olefine con almeno treatoni di carbonto |
| US4234710A (en) * | 1976-07-08 | 1980-11-18 | Phillips Petroleum Company | Catalyst and a polymerization process employing the catalyst |
| IT1042711B (it) * | 1975-09-19 | 1980-01-30 | Montedison Spa | Compnenti di catalizzatori per la polimerizzazione di olefine |
| US4039472A (en) * | 1975-11-14 | 1977-08-02 | Standard Oil Company (Indiana) | Increasing the particle size of as formed polyethylene or ethylene copolymer |
| LU76170A1 (enEXAMPLES) | 1975-11-14 | 1977-06-03 | ||
| JPS52104593A (en) * | 1976-03-01 | 1977-09-02 | Mitsui Petrochem Ind Ltd | Polymerization of olefins |
| US4107412A (en) * | 1976-11-24 | 1978-08-15 | Phillips Petroleum Company | Olefin polymerization process and catalyst therefor |
| JPS591407B2 (ja) * | 1977-03-04 | 1984-01-12 | 三井化学株式会社 | チタン触媒成分の製造方法 |
| US4167493A (en) * | 1977-03-22 | 1979-09-11 | Arco Polymers, Inc. | High efficiency catalyst for high bulk density polyethylene |
| IT1078995B (it) | 1977-05-24 | 1985-05-08 | Montedison Spa | Catalizzatori per la polimeriazzazione di olefine |
| JPS5440293A (en) * | 1977-09-05 | 1979-03-29 | Mitsubishi Petrochem Co Ltd | Olefin polymerization catalyst component |
| US4242480A (en) * | 1977-12-13 | 1980-12-30 | Phillips Petroleum Company | Catalyst and process of polymerization of alpha monoolefins |
| US4130503A (en) * | 1977-12-23 | 1978-12-19 | Phillips Petroleum Company | Phosphite in MgX2 supported TiX3 /AlCl3 catalyst system |
| NO155245C (no) * | 1978-07-24 | 1987-03-04 | Phillips Petroleum Co | Fremgangsmaate til fremstilling av en polymerisasjonskatalysator og anvendelse av katalysatoren til alkenpolymerisering. |
| US4243552A (en) * | 1978-12-11 | 1981-01-06 | Phillips Petroleum Company | Polymerization catalyst and process |
-
1981
- 1981-03-04 US US06/240,533 patent/US4394291A/en not_active Expired - Lifetime
-
1982
- 1982-02-08 CA CA000395763A patent/CA1183119A/en not_active Expired
- 1982-02-24 MX MX191553A patent/MX159971A/es unknown
- 1982-02-26 JP JP57030472A patent/JPS57158207A/ja active Granted
- 1982-02-26 BR BR8201027A patent/BR8201027A/pt not_active IP Right Cessation
- 1982-03-03 NO NO820660A patent/NO159284C/no unknown
- 1982-03-03 DE DE8282101638T patent/DE3280033D1/de not_active Expired
- 1982-03-03 EP EP82101638A patent/EP0060443B1/en not_active Expired
- 1982-03-03 AT AT82101638T patent/ATE48145T1/de not_active IP Right Cessation
- 1982-03-04 ES ES510130A patent/ES8306768A1/es not_active Expired
- 1982-03-04 GB GB8206320A patent/GB2093851B/en not_active Expired
-
1985
- 1985-03-04 SG SG163/85A patent/SG16385G/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ATE48145T1 (de) | 1989-12-15 |
| JPH0465084B2 (enEXAMPLES) | 1992-10-19 |
| GB2093851B (en) | 1985-01-09 |
| BR8201027A (pt) | 1983-01-04 |
| US4394291A (en) | 1983-07-19 |
| NO159284C (no) | 1988-12-14 |
| NO820660L (no) | 1982-09-06 |
| DE3280033D1 (en) | 1989-12-28 |
| EP0060443B1 (en) | 1989-11-23 |
| MX159971A (es) | 1989-10-17 |
| ES510130A0 (es) | 1983-06-16 |
| JPS57158207A (en) | 1982-09-30 |
| SG16385G (en) | 1985-08-16 |
| EP0060443A1 (en) | 1982-09-22 |
| NO159284B (no) | 1988-09-05 |
| GB2093851A (en) | 1982-09-08 |
| ES8306768A1 (es) | 1983-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1183119A (en) | Polyolefin polymerization process and catalyst | |
| EP0046537B1 (en) | A method of preparing a catalyst for the polymerization of olefins | |
| US4109071A (en) | Process for the polymerization of olefins | |
| JP2749731B2 (ja) | オレフィン重合用触媒の製造方法 | |
| CA1145321A (en) | Olefine polymerisation catalyst | |
| EP0036660A1 (en) | Method for producing an olefin polymerization catalyst, catalyst and polymerization process | |
| EP0045969A1 (en) | Catalyst and use of same for polymerizing olefins | |
| US4391736A (en) | Alpha-olefin polymerization | |
| US4477586A (en) | Polymerization of olefins | |
| EP0164596A1 (en) | Process for the preparation of a catalyst and olefin polymerization | |
| EP0113878B1 (en) | Polyolefin polymerization process and catalyst | |
| CA1225080A (en) | Polyolefin polymerization process and catalyst | |
| EP0171606B1 (en) | Polyolefin polymerization process and catalyst | |
| US4384982A (en) | Process and catalyst for olefin polymerization | |
| US4192772A (en) | Solid catalyst and process for the preparation thereof | |
| CA1143360A (en) | Composition of matter and method of preparing same, catalyst, method of producing the catalyst and polymerization process employing the catalyst | |
| EP0139969B1 (en) | Polyolefin polymerization process and catalyst | |
| CA2023096C (en) | Polyolefin polymerization catalyst and method of production and use | |
| US3429862A (en) | Process and catalysts for production of olefin polymers | |
| US5206314A (en) | Polyolefin polymerization process, process of producing catalyst, and catalyst | |
| JPH0822890B2 (ja) | プロピレン重合体の製造法 | |
| US5064795A (en) | Polymerization of olefins | |
| US4663403A (en) | Polymerization of olefins | |
| EP0123245B1 (en) | Polyolefin polymerization process and catalyst | |
| US4617361A (en) | Process and catalyst for olefin polymerization |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry | ||
| MKEX | Expiry |
Effective date: 20020226 |