CA1158518A - Liquid detergent composition - Google Patents
Liquid detergent compositionInfo
- Publication number
- CA1158518A CA1158518A CA000380478A CA380478A CA1158518A CA 1158518 A CA1158518 A CA 1158518A CA 000380478 A CA000380478 A CA 000380478A CA 380478 A CA380478 A CA 380478A CA 1158518 A CA1158518 A CA 1158518A
- Authority
- CA
- Canada
- Prior art keywords
- sodium
- alkyl
- potassium
- carbon atoms
- ethylene oxide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 63
- 239000003599 detergent Substances 0.000 title claims abstract description 14
- 239000007788 liquid Substances 0.000 title claims abstract description 12
- 239000004094 surface-active agent Substances 0.000 claims abstract description 12
- 239000003381 stabilizer Substances 0.000 claims abstract description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 9
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical group [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims abstract description 5
- -1 monoethanolammonium Chemical compound 0.000 claims description 40
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 38
- 125000004432 carbon atom Chemical group C* 0.000 claims description 28
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 19
- 239000002736 nonionic surfactant Substances 0.000 claims description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 16
- 239000003945 anionic surfactant Substances 0.000 claims description 15
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 12
- 229910052708 sodium Inorganic materials 0.000 claims description 12
- 239000007859 condensation product Substances 0.000 claims description 11
- 239000011591 potassium Substances 0.000 claims description 11
- 229910052700 potassium Inorganic materials 0.000 claims description 11
- 229960003975 potassium Drugs 0.000 claims description 11
- 235000015424 sodium Nutrition 0.000 claims description 11
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 10
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 claims description 10
- 239000011734 sodium Substances 0.000 claims description 10
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 9
- 239000000194 fatty acid Substances 0.000 claims description 9
- 229930195729 fatty acid Natural products 0.000 claims description 9
- 150000001412 amines Chemical class 0.000 claims description 7
- 230000000087 stabilizing effect Effects 0.000 claims description 7
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical class C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 6
- 150000001408 amides Chemical class 0.000 claims description 6
- 229910052749 magnesium Inorganic materials 0.000 claims description 6
- 239000011777 magnesium Substances 0.000 claims description 6
- 150000001298 alcohols Chemical class 0.000 claims description 5
- 235000001055 magnesium Nutrition 0.000 claims description 5
- 229940091250 magnesium supplement Drugs 0.000 claims description 5
- 239000000463 material Substances 0.000 claims description 5
- 230000001737 promoting effect Effects 0.000 claims description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 4
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 claims description 4
- 150000004665 fatty acids Chemical class 0.000 claims description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 4
- 235000019832 sodium triphosphate Nutrition 0.000 claims description 4
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 229920000151 polyglycol Polymers 0.000 claims description 3
- 239000010695 polyglycol Substances 0.000 claims description 3
- 150000003254 radicals Chemical class 0.000 claims description 3
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 claims description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 claims description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- WZEMSIKSCALWJZ-UHFFFAOYSA-N azane;ethanol Chemical compound N.CCO.CCO WZEMSIKSCALWJZ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 235000012000 cholesterol Nutrition 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 229920000642 polymer Polymers 0.000 claims description 2
- AVTYONGGKAJVTE-OLXYHTOASA-L potassium L-tartrate Chemical compound [K+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O AVTYONGGKAJVTE-OLXYHTOASA-L 0.000 claims description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 2
- 229940093956 potassium carbonate Drugs 0.000 claims description 2
- 235000011181 potassium carbonates Nutrition 0.000 claims description 2
- 239000001508 potassium citrate Substances 0.000 claims description 2
- 229960002635 potassium citrate Drugs 0.000 claims description 2
- QEEAPRPFLLJWCF-UHFFFAOYSA-K potassium citrate (anhydrous) Chemical compound [K+].[K+].[K+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O QEEAPRPFLLJWCF-UHFFFAOYSA-K 0.000 claims description 2
- 229940098424 potassium pyrophosphate Drugs 0.000 claims description 2
- 239000001472 potassium tartrate Substances 0.000 claims description 2
- 229940111695 potassium tartrate Drugs 0.000 claims description 2
- 235000011005 potassium tartrates Nutrition 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 2
- 229940001593 sodium carbonate Drugs 0.000 claims description 2
- 235000017550 sodium carbonate Nutrition 0.000 claims description 2
- 239000001509 sodium citrate Substances 0.000 claims description 2
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 claims description 2
- GCLGEJMYGQKIIW-UHFFFAOYSA-H sodium hexametaphosphate Chemical compound [Na]OP1(=O)OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])O1 GCLGEJMYGQKIIW-UHFFFAOYSA-H 0.000 claims description 2
- 235000019982 sodium hexametaphosphate Nutrition 0.000 claims description 2
- 229940048086 sodium pyrophosphate Drugs 0.000 claims description 2
- 239000001433 sodium tartrate Substances 0.000 claims description 2
- 229960002167 sodium tartrate Drugs 0.000 claims description 2
- 235000011004 sodium tartrates Nutrition 0.000 claims description 2
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 claims description 2
- 235000019818 tetrasodium diphosphate Nutrition 0.000 claims description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 claims description 2
- XASWYPVFCVEQSU-UHFFFAOYSA-N 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;potassium Chemical compound [K].OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O XASWYPVFCVEQSU-UHFFFAOYSA-N 0.000 claims 1
- ZGTMUACCHSMWAC-UHFFFAOYSA-L EDTA disodium salt (anhydrous) Chemical compound [Na+].[Na+].OC(=O)CN(CC([O-])=O)CCN(CC(O)=O)CC([O-])=O ZGTMUACCHSMWAC-UHFFFAOYSA-L 0.000 claims 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- HELHAJAZNSDZJO-OLXYHTOASA-L sodium L-tartrate Chemical compound [Na+].[Na+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O HELHAJAZNSDZJO-OLXYHTOASA-L 0.000 claims 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 claims 1
- 229960001790 sodium citrate Drugs 0.000 claims 1
- 235000011083 sodium citrates Nutrition 0.000 claims 1
- DZCAZXAJPZCSCU-UHFFFAOYSA-K sodium nitrilotriacetate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O DZCAZXAJPZCSCU-UHFFFAOYSA-K 0.000 claims 1
- SSEKFEYOIGLOIZ-UHFFFAOYSA-K tripotassium 2-(2-aminoethylamino)ethanol triacetate Chemical compound [K+].[K+].[K+].CC([O-])=O.CC([O-])=O.CC([O-])=O.NCCNCCO SSEKFEYOIGLOIZ-UHFFFAOYSA-K 0.000 claims 1
- JEVFKQIDHQGBFB-UHFFFAOYSA-K tripotassium;2-[bis(carboxylatomethyl)amino]acetate Chemical compound [K+].[K+].[K+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O JEVFKQIDHQGBFB-UHFFFAOYSA-K 0.000 claims 1
- USIPWJRLUGPSJM-UHFFFAOYSA-K trisodium 2-(2-aminoethylamino)ethanol triacetate Chemical compound [Na+].[Na+].[Na+].CC([O-])=O.CC([O-])=O.CC([O-])=O.NCCNCCO USIPWJRLUGPSJM-UHFFFAOYSA-K 0.000 claims 1
- 238000004851 dishwashing Methods 0.000 abstract description 8
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 abstract 1
- 235000019441 ethanol Nutrition 0.000 description 18
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Natural products OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 239000002585 base Substances 0.000 description 6
- 125000000129 anionic group Chemical group 0.000 description 5
- 125000006353 oxyethylene group Chemical group 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 239000002689 soil Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 235000013162 Cocos nucifera Nutrition 0.000 description 4
- 244000060011 Cocos nucifera Species 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- HLZKNKRTKFSKGZ-UHFFFAOYSA-N tetradecan-1-ol Chemical compound CCCCCCCCCCCCCCO HLZKNKRTKFSKGZ-UHFFFAOYSA-N 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 235000019197 fats Nutrition 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 235000019589 hardness Nutrition 0.000 description 3
- 230000002209 hydrophobic effect Effects 0.000 description 3
- 150000002894 organic compounds Chemical class 0.000 description 3
- 102000004169 proteins and genes Human genes 0.000 description 3
- 108090000623 proteins and genes Proteins 0.000 description 3
- 229940083542 sodium Drugs 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- JRZJOMJEPLMPRA-UHFFFAOYSA-N 1-nonene Chemical compound CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 235000014633 carbohydrates Nutrition 0.000 description 2
- 150000001720 carbohydrates Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 229940096386 coconut alcohol Drugs 0.000 description 2
- UZABCLFSICXBCM-UHFFFAOYSA-N ethoxy hydrogen sulfate Chemical compound CCOOS(O)(=O)=O UZABCLFSICXBCM-UHFFFAOYSA-N 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 229940043348 myristyl alcohol Drugs 0.000 description 2
- ONLRKTIYOMZEJM-UHFFFAOYSA-N n-methylmethanamine oxide Chemical compound C[NH+](C)[O-] ONLRKTIYOMZEJM-UHFFFAOYSA-N 0.000 description 2
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 2
- 229920005862 polyol Polymers 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- 229940071104 xylenesulfonate Drugs 0.000 description 2
- XFRVVPUIAFSTFO-UHFFFAOYSA-N 1-Tridecanol Chemical compound CCCCCCCCCCCCCO XFRVVPUIAFSTFO-UHFFFAOYSA-N 0.000 description 1
- KWKAKUADMBZCLK-UHFFFAOYSA-N 1-octene Chemical compound CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 1
- FXNDIJDIPNCZQJ-UHFFFAOYSA-N 2,4,4-trimethylpent-1-ene Chemical group CC(=C)CC(C)(C)C FXNDIJDIPNCZQJ-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- DUIOKRXOKLLURE-UHFFFAOYSA-N 2-octylphenol Chemical compound CCCCCCCCC1=CC=CC=C1O DUIOKRXOKLLURE-UHFFFAOYSA-N 0.000 description 1
- JBVOQKNLGSOPNZ-UHFFFAOYSA-N 2-propan-2-ylbenzenesulfonic acid Chemical compound CC(C)C1=CC=CC=C1S(O)(=O)=O JBVOQKNLGSOPNZ-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 235000003166 Opuntia robusta Nutrition 0.000 description 1
- 244000218514 Opuntia robusta Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000019482 Palm oil Nutrition 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- ZZXDRXVIRVJQBT-UHFFFAOYSA-M Xylenesulfonate Chemical compound CC1=CC=CC(S([O-])(=O)=O)=C1C ZZXDRXVIRVJQBT-UHFFFAOYSA-M 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- LHIJANUOQQMGNT-UHFFFAOYSA-N aminoethylethanolamine Chemical compound NCCNCCO LHIJANUOQQMGNT-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000004599 antimicrobial Substances 0.000 description 1
- ZXVOCOLRQJZVBW-UHFFFAOYSA-N azane;ethanol Chemical compound N.CCO ZXVOCOLRQJZVBW-UHFFFAOYSA-N 0.000 description 1
- 238000005815 base catalysis Methods 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229940077731 carbohydrate nutrients Drugs 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000000875 corresponding effect Effects 0.000 description 1
- 229940071118 cumenesulfonate Drugs 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229910052816 inorganic phosphate Inorganic materials 0.000 description 1
- 229940053326 magnesium salt Drugs 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000006179 pH buffering agent Substances 0.000 description 1
- 239000002540 palm oil Substances 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 238000011056 performance test Methods 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 235000011082 potassium citrates Nutrition 0.000 description 1
- GHKGUEZUGFJUEJ-UHFFFAOYSA-M potassium;4-methylbenzenesulfonate Chemical compound [K+].CC1=CC=C(S([O-])(=O)=O)C=C1 GHKGUEZUGFJUEJ-UHFFFAOYSA-M 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- SIXNTGDWLSRMIC-UHFFFAOYSA-N sodium;toluene Chemical compound [Na].CC1=CC=CC=C1 SIXNTGDWLSRMIC-UHFFFAOYSA-N 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000001180 sulfating effect Effects 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000000271 synthetic detergent Substances 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- JZBRFIUYUGTUGG-UHFFFAOYSA-J tetrapotassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical compound [K+].[K+].[K+].[K+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O JZBRFIUYUGTUGG-UHFFFAOYSA-J 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- ZXGOACRTCPRVON-UHFFFAOYSA-K trisodium;2-sulfonatobutanedioate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(C([O-])=O)S([O-])(=O)=O ZXGOACRTCPRVON-UHFFFAOYSA-K 0.000 description 1
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/0005—Other compounding ingredients characterised by their effect
- C11D3/0094—High foaming compositions
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/02—Anionic compounds
- C11D1/12—Sulfonic acids or sulfuric acid esters; Salts thereof
- C11D1/29—Sulfates of polyoxyalkylene ethers
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/02—Anionic compounds
- C11D1/37—Mixtures of compounds all of which are anionic
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/38—Cationic compounds
- C11D1/52—Carboxylic amides, alkylolamides or imides or their condensation products with alkylene oxides
- C11D1/521—Carboxylic amides (R1-CO-NR2R3), where R1, R2 and R3 are alkyl or alkenyl groups
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/38—Cationic compounds
- C11D1/52—Carboxylic amides, alkylolamides or imides or their condensation products with alkylene oxides
- C11D1/523—Carboxylic alkylolamides, or dialkylolamides, or hydroxycarboxylic amides (R1-CO-NR2R3), where R1, R2 or R3 contain one hydroxy group per alkyl group
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/66—Non-ionic compounds
- C11D1/72—Ethers of polyoxyalkylene glycols
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/66—Non-ionic compounds
- C11D1/74—Carboxylates or sulfonates esters of polyoxyalkylene glycols
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/66—Non-ionic compounds
- C11D1/75—Amino oxides
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US16303180A | 1980-06-26 | 1980-06-26 | |
| US163,031 | 1980-06-26 | ||
| US06/223,541 US4316824A (en) | 1980-06-26 | 1981-01-08 | Liquid detergent composition containing alkyl sulfate and alkyl ethoxylated sulfate |
| US223,541 | 1981-01-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1158518A true CA1158518A (en) | 1983-12-13 |
Family
ID=26859273
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000380478A Expired CA1158518A (en) | 1980-06-26 | 1981-06-24 | Liquid detergent composition |
| CA000543159A Expired CA1255992B (en) | 1980-06-26 | 1987-07-28 | Liquid detergent composition |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000543159A Expired CA1255992B (en) | 1980-06-26 | 1987-07-28 | Liquid detergent composition |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4316824A (OSRAM) |
| CA (2) | CA1158518A (OSRAM) |
| GB (1) | GB2078246A (OSRAM) |
| GR (1) | GR74550B (OSRAM) |
| MX (1) | MX155647A (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5474713A (en) * | 1994-03-23 | 1995-12-12 | Amway Corporation | High actives cleaning compositions and methods of use |
Families Citing this family (113)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4436653A (en) | 1981-04-06 | 1984-03-13 | The Procter & Gamble Company | Stable liquid detergent compositions |
| EP0068520B1 (en) * | 1981-04-06 | 1986-12-03 | THE PROCTER & GAMBLE COMPANY | Built liquid detergent compositions containing ternary active systems |
| US4411810A (en) * | 1981-11-06 | 1983-10-25 | Basf Wyandotte Corporation | Low-foaming nonionic surfactant for machine dishwashing detergent |
| DE3151679A1 (de) * | 1981-12-28 | 1983-07-07 | Henkel KGaA, 4000 Düsseldorf | "verwendung von viskositaetsreglern fuer tensidkonzentrate" |
| US4412945A (en) * | 1982-01-04 | 1983-11-01 | Lion Corporation | Aqueous high concentration slurry of alcohol ethoxylate |
| US4487710A (en) * | 1982-03-01 | 1984-12-11 | The Procter & Gamble Company | Granular detergents containing anionic surfactant and ethoxylated surfactant solubility aid |
| DE3232616A1 (de) * | 1982-09-02 | 1984-03-08 | Henkel KGaA, 4000 Düsseldorf | Fluessiges, von anorganischen geruestsalzen im wesentlichen freies wasch- und reinigungsmittel |
| GB8310529D0 (en) * | 1983-04-19 | 1983-05-25 | Unilever Plc | General-purpose cleaning composition |
| US4904359A (en) * | 1985-10-31 | 1990-02-27 | The Procter & Gamble Company | Liquid detergent composition containing polymeric surfactant |
| US5167872A (en) * | 1985-10-31 | 1992-12-01 | The Procter & Gamble Company | Comprising anionic surfactant polymeric nonionic surfactant and betaine surfactant |
| DE3642564A1 (de) * | 1985-12-12 | 1987-07-09 | Lion Corp | Fluessiges wasch- und reinigungsmittel |
| US4830187A (en) * | 1986-12-22 | 1989-05-16 | E. R. Squibb & Sons, Inc. | Means for disposal of articles by flushing and ostomy pouches particularly suited for such disposal |
| US4930942A (en) * | 1986-12-22 | 1990-06-05 | E. R. Squibb & Sons, Inc. | Method of disposal of articles by flushing |
| US4762738A (en) * | 1986-12-22 | 1988-08-09 | E. R. Squibb & Sons, Inc. | Means for disposal of articles by flushing and ostomy pouches particularly suited for such disposal |
| DE3724500A1 (de) * | 1987-07-24 | 1989-02-02 | Henkel Kgaa | Alkylsulfat-ethersulfat-gemische und deren verwendung |
| US5269960A (en) * | 1988-09-25 | 1993-12-14 | The Clorox Company | Stable liquid aqueous enzyme detergent |
| US5152933A (en) * | 1990-08-20 | 1992-10-06 | Basf Corporation | Ethylene oxide/propylene oxide copolymers as co-surfactants with detergency boosting properties in compositions also containing alkyl benzene sulfonate and ethoxylated alcohol |
| US5378409A (en) * | 1990-11-16 | 1995-01-03 | The Procter & Gamble Co. | Light duty dishwashing detergent composition containing an alkyl ethoxy carboxylate surfactant and ions |
| CA2055048C (en) * | 1990-11-16 | 1996-05-14 | Kofi Ofosu-Asante | Alkaline light-duty dishwashing detergent composition containing an alkyl ethoxy carboxylate surfactant, magnesium ions, chelator and buffer |
| US5565146A (en) * | 1991-04-15 | 1996-10-15 | Cologate-Palmolive Co. | Light duty liquid detergent compositions |
| US5480586A (en) * | 1991-04-15 | 1996-01-02 | Colgate-Palmolive Co. | Light duty liquid detergent compostion comprising a sulfosuccinamate-containing surfactant blend |
| US5244593A (en) * | 1992-01-10 | 1993-09-14 | The Procter & Gamble Company | Colorless detergent compositions with enhanced stability |
| RU2114907C1 (ru) * | 1992-02-19 | 1998-07-10 | Дзе Проктер Энд Гэмбл Компани | Водная моющая композиция для твердых поверхностей и способ улучшения качества раствора |
| US5298195A (en) * | 1992-03-09 | 1994-03-29 | Amway Corporation | Liquid dishwashing detergent |
| EP0656046A4 (en) * | 1992-08-21 | 1995-09-20 | Procter & Gamble | CONCENTRATED LIQUID DETERGENT COMPOSITION COMPRISING ALKYL ETHER SULFATE AND PROCESS FOR PREPARING THE SAME. |
| US5545354A (en) * | 1992-09-01 | 1996-08-13 | The Procter & Gamble Company | Liquid or gel dishwashing detergent containing a polyhydroxy fatty acid amide, calcium ions and an alkylpolyethoxypolycarboxylate |
| US5451342A (en) * | 1993-05-28 | 1995-09-19 | Henkel Corporation | Waterwhite clear liquid detergent compositions |
| PE4995A1 (es) * | 1993-06-30 | 1995-03-01 | Procter & Gamble | Gel detergente que contiene alquilsulfatos etoxilados y sulfonatos secundarios |
| US5472631A (en) * | 1993-08-16 | 1995-12-05 | Harris; Jack W. | Method of removing oil-based paint from painting articles |
| EP0639833A1 (en) * | 1993-08-19 | 1995-02-22 | The Procter & Gamble Company | The use of magnesium ions in hard surface cleaners for improved shine, and cleaners obtained accordingly |
| US5397506A (en) * | 1993-08-20 | 1995-03-14 | Ecolab Inc. | Solid cleaner |
| USH1559H (en) * | 1993-08-25 | 1996-07-02 | Shell Oil Company | Secondary alkyl sulfate-containing light duty liquid detergent compositions |
| US5415801A (en) * | 1993-08-27 | 1995-05-16 | The Procter & Gamble Company | Concentrated light duty liquid or gel dishwashing detergent compositions containing sugar |
| US5415814A (en) * | 1993-08-27 | 1995-05-16 | The Procter & Gamble Company | Concentrated liquid or gel light duty dishwashing detergent composition containing calcium xylene sulfonate |
| US5417893A (en) * | 1993-08-27 | 1995-05-23 | The Procter & Gamble Company | Concentrated liquid or gel light duty dishwashing detergent compositions containing calcium ions and disulfonate surfactants |
| US5977054A (en) * | 1993-09-01 | 1999-11-02 | The Procter & Gamble Company | Mildly acidic hard surface cleaning compositions containing amine oxide detergent surfactants |
| USH1467H (en) * | 1993-11-16 | 1995-08-01 | Shell Oil Company | Detergent formulations containing a surface active composition containing a nonionic surfactant component and a secondary alkyl sulfate anionic surfactant component |
| WO1995020028A1 (en) * | 1994-01-25 | 1995-07-27 | The Procter & Gamble Company | Low to moderate sudsing detergent compositions containing long chain amine oxide |
| JPH09508166A (ja) * | 1994-01-25 | 1997-08-19 | ザ、プロクター、エンド、ギャンブル、カンパニー | 長鎖アミンオキシドを含有する高起泡性の軽質液状またはゲル状皿洗い洗剤組成物 |
| WO1995020025A1 (en) * | 1994-01-25 | 1995-07-27 | The Procter & Gamble Company | Low sudsing detergent compositions containing long chain amine oxide and branched alkyl carboxylates |
| CA2147674C (en) * | 1994-05-16 | 1999-03-30 | David Robert Zint | Shaped semi-solid or solid dishwashing detergent |
| EP0698658A1 (en) * | 1994-08-23 | 1996-02-28 | The Procter & Gamble Company | Detergent compositions |
| US5560878A (en) * | 1994-11-30 | 1996-10-01 | The Procter & Gamble Company | Method and apparatus for making stretchable absorbent articles |
| US5565135A (en) * | 1995-01-24 | 1996-10-15 | The Procter & Gamble Company | Highly aqueous, cost effective liquid detergent compositions |
| US5587356A (en) * | 1995-04-03 | 1996-12-24 | The Procter & Gamble Company | Thickened, highly aqueous, cost effective liquid detergent compositions |
| DE19534369C2 (de) * | 1995-09-15 | 2000-06-15 | Cognis Deutschland Gmbh | Wäßrige Handgeschirrspülmittel |
| US5827397A (en) * | 1995-10-10 | 1998-10-27 | Shell Oil Company | Mixed office wastepaper deinking process |
| US5837099A (en) * | 1995-10-10 | 1998-11-17 | Shell Oil Company | Office wastepaper deinking process |
| US5719118A (en) * | 1995-10-30 | 1998-02-17 | Tomah Products, Inc. | Detergent compositions having polyalkoxylated amine foam stabilizers and method for cleaning including stabilized detergent foam |
| US6221822B1 (en) | 1995-10-30 | 2001-04-24 | Tomah Products, Inc. | Detergent compositions having polyalkoxylated amine foam stabilizers |
| WO1997016517A1 (en) * | 1995-10-30 | 1997-05-09 | The Procter & Gamble Company | Thickened, highly aqueous, cost effective liquid detergent compositions |
| US5837668A (en) * | 1996-04-30 | 1998-11-17 | Rhodia Inc. | Acyloxyalkane sulfonate and amphoteric surfactant blend compositions and methods for preparing same |
| US5773405A (en) * | 1997-03-13 | 1998-06-30 | Milliken Research Corporation | Cleaner compositions containing surfactant and poly (oxyalkylene)-substituted reactive dye colorant |
| CN1267323A (zh) * | 1997-06-13 | 2000-09-20 | 普罗格特-甘布尔公司 | 具有理想的低温稳定性和理想的去油垢和起泡特性的轻垢型液体洗餐具洗涤剂组合物 |
| US5965508A (en) * | 1997-10-21 | 1999-10-12 | Stepan Company | Soap bar compositions comprising alpha sulfonated fatty acid alkyl esters and long chain fatty acids |
| US6099589A (en) * | 1997-12-30 | 2000-08-08 | Kay Chemical Company | Presoak detergent with optical brightener |
| US20040116324A1 (en) * | 1999-09-16 | 2004-06-17 | Arienzo Gerald V. | Animal scent lure and delivery system |
| US6683044B1 (en) | 1999-09-16 | 2004-01-27 | Gerald V. Arienzo | Animal scent lure and delivery system |
| WO2001023274A1 (en) | 1999-09-30 | 2001-04-05 | The Procter & Gamble Company | Detergent package with means to mask amine malodours |
| KR100364988B1 (ko) * | 2000-02-23 | 2002-12-18 | 주식회사 엘지생활건강 | 저자극 액체 세정제 조성물 |
| US20020032147A1 (en) * | 2000-07-13 | 2002-03-14 | The Procter & Gamble Company | Perfume composition and cleaning compositions comprising the perfume composition |
| DE10100337A1 (de) * | 2001-01-05 | 2002-08-22 | Henkel Kgaa | Tensidhaltige Reinigungs- oder Spülmittel-Formulierung |
| US20040087460A1 (en) * | 2001-11-13 | 2004-05-06 | Colgate-Palmolive Company | Cleaning wipe |
| US6652869B2 (en) * | 2001-11-13 | 2003-11-25 | Colgate-Palmolive Company | For dish washing application |
| US20060258551A1 (en) * | 2002-01-31 | 2006-11-16 | Ospinal Carlos E | Soap bar compositions comprising alpha sulfonated alkyl ester and polyhydric alcohol and process for producing the same |
| EP1476132A4 (en) * | 2002-01-31 | 2008-11-12 | Stepan Co | SOAP BAG COMPOSITIONS COMPRISING ALKHA-SULFONATED FATTY ACID ALKYLERS AND POLYOLS, AND METHODS FOR PRODUCING THE SAME |
| US20060241003A1 (en) * | 2002-01-31 | 2006-10-26 | Ospinal Carlos E | Soap bar compositions comprising alpha sulfonated alkyl ester and polyhydric alcohol and process for producing the same |
| MY148956A (en) * | 2002-01-31 | 2013-06-14 | Stepan Co | Soap bar compositions comprising alpha sulfonated alkyl esters or sulfonated fatty acid and process for producing the same |
| US20040029757A1 (en) * | 2002-08-08 | 2004-02-12 | Ecolab Inc. | Hand dishwashing detergent composition and methods for manufacturing and using |
| US6583103B1 (en) | 2002-08-09 | 2003-06-24 | S.C. Johnson & Son, Inc. | Two part cleaning formula resulting in an effervescent liquid |
| ES2279353T3 (es) | 2003-02-28 | 2007-08-16 | THE PROCTER & GAMBLE COMPANY | Kit generador de espuma que contiene un dispensador que genera espuma y una composicion que contiene un elevado nivel de tensioactivo. |
| GB0307290D0 (en) * | 2003-03-31 | 2003-05-07 | Cole Paul G | Enhancing silver tarnish-resistance |
| US7087567B2 (en) * | 2003-04-14 | 2006-08-08 | Colgate-Palmolive Company | Antibacterial light duty liquid cleaning composition |
| US6838421B2 (en) | 2003-05-19 | 2005-01-04 | Colgate-Palmolive Company | Bathroom cleaning composition |
| US20050020465A1 (en) * | 2003-07-23 | 2005-01-27 | Colgate-Palmolive Company | Liquid dish cleaning compositions |
| US7033986B2 (en) * | 2003-08-28 | 2006-04-25 | Colgate-Palmolive Company | Liquid dish cleaning compositions comprising a mixture of alkyl benzene sulfonates and alkyl ether sulfates |
| EP1674560A1 (en) * | 2004-12-21 | 2006-06-28 | The Procter & Gamble Company | Dishwashing detergent composition |
| WO2006116099A1 (en) | 2005-04-21 | 2006-11-02 | Colgate-Palmolive Company | Liquid detergent composition |
| CA2649407C (en) | 2006-04-21 | 2012-11-20 | Colgate-Palmolive Company | Composition for visibility and impact of suspended materials |
| MX2009006393A (es) | 2006-12-15 | 2009-09-02 | Colgate Palmolive Co | Composición detergente líquida. |
| CA2709134C (en) | 2007-12-18 | 2014-08-12 | Colgate-Palmolive Company | Alkaline cleaning compositions |
| EP2245128B1 (en) * | 2007-12-18 | 2014-05-21 | Colgate-Palmolive Company | Degreasing all purpose cleaning compositions and methods |
| WO2009143091A1 (en) | 2008-05-23 | 2009-11-26 | Colgate-Palmolive Company | Liquid cleaning compositions and manufacture |
| US20110166370A1 (en) | 2010-01-12 | 2011-07-07 | Charles Winston Saunders | Scattered Branched-Chain Fatty Acids And Biological Production Thereof |
| EP2652107B1 (en) | 2010-12-13 | 2019-03-27 | Colgate-Palmolive Company | Dilutable concentrated cleaning composition |
| CN103380204B (zh) | 2011-02-17 | 2016-02-03 | 宝洁公司 | 包含c10-c13烷基苯基磺酸盐的混合物的组合物 |
| US20120213726A1 (en) | 2011-02-17 | 2012-08-23 | Phillip Richard Green | Bio-based linear alkylphenyl sulfonates |
| MX342215B (es) | 2011-06-22 | 2016-09-21 | Colgate Palmolive Co | Composiciones liquidas de limpieza de sal. |
| WO2012177276A1 (en) | 2011-06-22 | 2012-12-27 | Colgate-Palmolive Company | Choline salt cleaning compositions |
| CA2888770C (en) | 2012-12-07 | 2020-04-28 | Colgate-Palmolive Company | Cleaning composition |
| AU2012397265B2 (en) | 2012-12-19 | 2016-02-25 | Colgate-Palmolive Company | Oral gel comprising zinc - amino acid complex |
| EP2934445B1 (en) | 2012-12-19 | 2017-10-04 | Colgate-Palmolive Company | Teeth whitening methods, visually perceptible signals and compositions therefor comprising zinc amino acid halides |
| US9750670B2 (en) | 2012-12-19 | 2017-09-05 | Colgate-Palmolive Company | Zinc amino acid complex with cysteine |
| US9675823B2 (en) | 2012-12-19 | 2017-06-13 | Colgate-Palmolive Company | Two component compositions containing zinc amino acid halide complexes and cysteine |
| MX352357B (es) | 2012-12-19 | 2017-11-22 | Colgate Palmolive Co | Productos para el cuidado oral que contienen un complejo de zinc tetrabásico-aminoácido-halogenuro. |
| US9498421B2 (en) | 2012-12-19 | 2016-11-22 | Colgate-Palmolive Company | Two component compositions containing tetrabasic zinc-amino acid halide complexes and cysteine |
| US9943473B2 (en) | 2012-12-19 | 2018-04-17 | Colgate-Palmolive Company | Zinc lysine halide complex |
| KR20150097551A (ko) | 2012-12-19 | 2015-08-26 | 콜게이트-파아므올리브캄파니 | 아연 아미노산 할라이드 구강 청결제 |
| CA2892422C (en) | 2012-12-19 | 2019-10-01 | Colgate-Palmolive Company | Oral care products comprising zinc oxide and trimethylglycine |
| KR20150095701A (ko) | 2012-12-19 | 2015-08-21 | 콜게이트-파아므올리브캄파니 | 아연 아미노산 할라이드를 포함하는 구강 관리 조성물 |
| US9504858B2 (en) | 2012-12-19 | 2016-11-29 | Colgate-Palmolive Company | Zinc amino acid halide complex with cysteine |
| HK1216016A1 (zh) | 2012-12-19 | 2016-10-07 | Colgate-Palmolive Company | 鋅氨基酸絡合物與半胱氨酸 |
| CA2892179C (en) | 2012-12-19 | 2020-03-31 | Colgate-Palmolive Company | Composition with zinc amino acid/trimethylglycine halide precursors |
| CA2892411C (en) | 2012-12-19 | 2019-09-10 | Colgate-Palmolive Company | Antiperspirant products with protein and antiperspirant salts |
| US9861563B2 (en) | 2012-12-19 | 2018-01-09 | Colgate-Palmolive Company | Oral care products comprising tetrabasic zinc chloride and trimethylglycine |
| US10188112B2 (en) | 2012-12-19 | 2019-01-29 | Colgate-Palmolive Company | Personal cleansing compositions containing zinc amino acid/trimethylglycine halide |
| ES2624655T3 (es) | 2012-12-19 | 2017-07-17 | Colgate-Palmolive Company | Complejo de cinc-lisina |
| CN105473697B (zh) | 2013-08-29 | 2019-02-15 | 高露洁-棕榄公司 | 含水液体组合物 |
| US20160319222A1 (en) * | 2013-12-26 | 2016-11-03 | Colgate-Palmolive Company | Pearlescent cleansing compositions |
| USD815838S1 (en) | 2016-07-15 | 2018-04-24 | Colgate-Palmolive Company | Toothbrush |
| CN109963930A (zh) | 2016-10-31 | 2019-07-02 | 沙特基础工业全球技术有限公司 | 在去除美容品污渍中作为活性成分的甘油乙氧基化物 |
| WO2021113568A1 (en) | 2019-12-05 | 2021-06-10 | The Procter & Gamble Company | Method of making a cleaning composition |
| US12122981B2 (en) | 2019-12-05 | 2024-10-22 | The Procter & Gamble Company | Cleaning composition |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL200262A (OSRAM) * | 1954-09-30 | |||
| US3413331A (en) * | 1965-03-26 | 1968-11-26 | Standard Chem Products Inc | Sulfation of a mixture of primary and secondary alcohols |
| US3468805A (en) * | 1965-10-22 | 1969-09-23 | Gaf Corp | Detergent composition |
| US3755407A (en) * | 1967-02-10 | 1973-08-28 | Chevron Res | Sulfation process for secondary alcohols |
| US3775349A (en) * | 1970-06-29 | 1973-11-27 | Ethyl Corp | Detergent formulations containing alkyl polyethoxy sulfate mixtures |
| FR2136913B1 (OSRAM) * | 1971-05-07 | 1973-05-11 | Colgate Palmolive Co | |
| US3928249A (en) * | 1972-02-07 | 1975-12-23 | Procter & Gamble | Liquid detergent composition |
| US4024078A (en) * | 1975-03-31 | 1977-05-17 | The Procter & Gamble Company | Liquid detergent composition |
| JPS5236106A (en) * | 1975-09-16 | 1977-03-19 | Kao Corp | Liquid detergent composition |
| US4079020A (en) * | 1975-11-07 | 1978-03-14 | Lever Brothers Company | Cleaning composition |
-
1981
- 1981-01-08 US US06/223,541 patent/US4316824A/en not_active Expired - Lifetime
- 1981-06-08 GB GB8117527A patent/GB2078246A/en not_active Withdrawn
- 1981-06-19 GR GR65289A patent/GR74550B/el unknown
- 1981-06-24 CA CA000380478A patent/CA1158518A/en not_active Expired
- 1981-06-25 MX MX188012A patent/MX155647A/es unknown
-
1987
- 1987-07-28 CA CA000543159A patent/CA1255992B/en not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5474713A (en) * | 1994-03-23 | 1995-12-12 | Amway Corporation | High actives cleaning compositions and methods of use |
Also Published As
| Publication number | Publication date |
|---|---|
| US4316824A (en) | 1982-02-23 |
| MX155647A (es) | 1988-04-11 |
| GR74550B (OSRAM) | 1984-06-29 |
| CA1255992B (en) | 1989-06-20 |
| GB2078246A (en) | 1982-01-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1158518A (en) | Liquid detergent composition | |
| US4492646A (en) | Liquid dishwashing detergent containing anionic surfactant, suds stabilizer and highly ethoxylated nonionic drainage promotor | |
| US4904359A (en) | Liquid detergent composition containing polymeric surfactant | |
| US5167872A (en) | Comprising anionic surfactant polymeric nonionic surfactant and betaine surfactant | |
| US6281178B1 (en) | Reduced residue hard surface cleaner comprising hydrotrope | |
| US7467633B2 (en) | Enhanced solubilization using extended chain surfactants | |
| US7115550B2 (en) | Liquid dish cleaning compositions | |
| US5891836A (en) | Light-duty liquid or gel dishwashing detergent compositions which are micro emulsions and which have desirable greasy food soil removal and sudsing characteristics | |
| US6274539B1 (en) | Light-duty liquid or gel dishwashing detergent compositions having controlled pH and desirable food soil removal, rheological and sudsing characteristics | |
| WO1998047990A1 (en) | Detergent composition | |
| EP0071411B1 (en) | Detergent compositions | |
| JP2010047763A (ja) | 低温での改善された物理的安定性を有する洗剤組成物 | |
| US3507798A (en) | Built detergents containing nonionic polyoxyalkylene surface active materials | |
| GB2130235A (en) | Liquid detergent compositions | |
| US5152933A (en) | Ethylene oxide/propylene oxide copolymers as co-surfactants with detergency boosting properties in compositions also containing alkyl benzene sulfonate and ethoxylated alcohol | |
| US4199468A (en) | Alkaline dishwasher detergent | |
| US4329246A (en) | Alkaline dishwasher detergent | |
| US6423678B1 (en) | Alcohol ethoxylate-peg ether of glycerin | |
| EP0222557B1 (en) | Liquid detergent composition | |
| USH1467H (en) | Detergent formulations containing a surface active composition containing a nonionic surfactant component and a secondary alkyl sulfate anionic surfactant component | |
| EP0034039B1 (en) | Liquid detergent composition | |
| MXPA97003374A (en) | Lig work liquid cleaning compositions | |
| AU7071998A (en) | Light-duty liquid or gel dishwashing detergent compositions having controlled pH and desirable foood soil removal and sudsing characteristics | |
| CA1210299A (en) | Liquid detergent compositions having high reserve alkalinity | |
| US4191661A (en) | Alkaline dishwasher detergent |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MZSU | Surrender |