CA1157793A - Homogeneous enzyme-containing liquid detergent compositions containing saturated fatty acids - Google Patents
Homogeneous enzyme-containing liquid detergent compositions containing saturated fatty acidsInfo
- Publication number
- CA1157793A CA1157793A CA000364195A CA364195A CA1157793A CA 1157793 A CA1157793 A CA 1157793A CA 000364195 A CA000364195 A CA 000364195A CA 364195 A CA364195 A CA 364195A CA 1157793 A CA1157793 A CA 1157793A
- Authority
- CA
- Canada
- Prior art keywords
- composition
- weight
- acid
- enzyme
- accordance
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 107
- 239000003599 detergent Substances 0.000 title claims abstract description 42
- 102000004190 Enzymes Human genes 0.000 title claims abstract description 33
- 108090000790 Enzymes Proteins 0.000 title claims abstract description 33
- 239000007788 liquid Substances 0.000 title claims abstract description 22
- 150000004671 saturated fatty acids Chemical class 0.000 title claims abstract description 21
- 235000003441 saturated fatty acids Nutrition 0.000 title claims abstract description 14
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims abstract description 33
- 239000011575 calcium Substances 0.000 claims abstract description 33
- 229910052791 calcium Inorganic materials 0.000 claims abstract description 33
- 239000002253 acid Substances 0.000 claims abstract description 5
- 150000007513 acids Chemical class 0.000 claims abstract description 3
- 229940088598 enzyme Drugs 0.000 claims description 31
- 125000004432 carbon atom Chemical group C* 0.000 claims description 30
- 125000000217 alkyl group Chemical group 0.000 claims description 21
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 15
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 claims description 15
- 102000035195 Peptidases Human genes 0.000 claims description 14
- 108091005804 Peptidases Proteins 0.000 claims description 14
- 239000004094 surface-active agent Substances 0.000 claims description 13
- 125000000129 anionic group Chemical group 0.000 claims description 11
- 239000002736 nonionic surfactant Substances 0.000 claims description 11
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 claims description 10
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 9
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 9
- 239000000194 fatty acid Substances 0.000 claims description 9
- 229930195729 fatty acid Natural products 0.000 claims description 9
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 8
- 239000004365 Protease Substances 0.000 claims description 8
- 239000003945 anionic surfactant Substances 0.000 claims description 8
- 150000004665 fatty acids Chemical class 0.000 claims description 8
- 235000019253 formic acid Nutrition 0.000 claims description 7
- 229920001296 polysiloxane Polymers 0.000 claims description 7
- 239000005639 Lauric acid Substances 0.000 claims description 5
- 239000004280 Sodium formate Substances 0.000 claims description 5
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 claims description 5
- 235000019254 sodium formate Nutrition 0.000 claims description 5
- 102000013142 Amylases Human genes 0.000 claims description 4
- 108010065511 Amylases Proteins 0.000 claims description 4
- 235000011054 acetic acid Nutrition 0.000 claims description 4
- 235000019418 amylase Nutrition 0.000 claims description 4
- 229940025131 amylases Drugs 0.000 claims description 4
- 235000019864 coconut oil Nutrition 0.000 claims description 3
- 239000003240 coconut oil Substances 0.000 claims description 3
- 150000003009 phosphonic acids Chemical class 0.000 claims description 2
- 229920001281 polyalkylene Polymers 0.000 claims description 2
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 claims 1
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexamethylene diamine Natural products NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 claims 1
- 239000004615 ingredient Substances 0.000 abstract description 13
- 239000000654 additive Substances 0.000 abstract description 4
- 230000000996 additive effect Effects 0.000 abstract description 3
- 150000001735 carboxylic acids Chemical class 0.000 abstract 1
- 230000000694 effects Effects 0.000 abstract 1
- 229920006395 saturated elastomer Polymers 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 17
- -1 alkali-metal salts Chemical class 0.000 description 12
- 239000007859 condensation product Substances 0.000 description 11
- 239000000047 product Substances 0.000 description 10
- 239000004435 Oxo alcohol Substances 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 230000002255 enzymatic effect Effects 0.000 description 9
- 239000000344 soap Substances 0.000 description 9
- 239000003963 antioxidant agent Substances 0.000 description 8
- 235000006708 antioxidants Nutrition 0.000 description 8
- JSPLKZUTYZBBKA-UHFFFAOYSA-N trioxidane Chemical class OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- 150000002191 fatty alcohols Chemical class 0.000 description 7
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 7
- 239000003605 opacifier Substances 0.000 description 7
- 239000003352 sequestering agent Substances 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 150000001412 amines Chemical class 0.000 description 6
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 6
- 150000003871 sulfonates Chemical class 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 239000001110 calcium chloride Substances 0.000 description 4
- 229910001628 calcium chloride Inorganic materials 0.000 description 4
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 239000000975 dye Substances 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 230000002209 hydrophobic effect Effects 0.000 description 4
- DNIAPMSPPWPWGF-UHFFFAOYSA-N monopropylene glycol Natural products CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 4
- 239000002304 perfume Substances 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 241000894007 species Species 0.000 description 4
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 3
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 3
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 3
- 235000013162 Cocos nucifera Nutrition 0.000 description 3
- 244000060011 Cocos nucifera Species 0.000 description 3
- 102000005158 Subtilisins Human genes 0.000 description 3
- 108010056079 Subtilisins Proteins 0.000 description 3
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 3
- 230000003078 antioxidant effect Effects 0.000 description 3
- 125000002091 cationic group Chemical group 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 description 3
- 201000011243 gastrointestinal stromal tumor Diseases 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229960004063 propylene glycol Drugs 0.000 description 3
- 230000002797 proteolythic effect Effects 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- 239000004255 Butylated hydroxyanisole Substances 0.000 description 2
- 239000004322 Butylated hydroxytoluene Substances 0.000 description 2
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- PKCAPWCIDSEHOW-UHFFFAOYSA-N P(O)(O)=O.P(O)(O)=O.P(O)(O)=O.P(O)(O)=O.P(O)(O)=O.N(CCO)CCO Chemical compound P(O)(O)=O.P(O)(O)=O.P(O)(O)=O.P(O)(O)=O.P(O)(O)=O.N(CCO)CCO PKCAPWCIDSEHOW-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 150000004996 alkyl benzenes Chemical class 0.000 description 2
- 230000003625 amylolytic effect Effects 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 235000019282 butylated hydroxyanisole Nutrition 0.000 description 2
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 2
- 229910001424 calcium ion Inorganic materials 0.000 description 2
- 239000003093 cationic surfactant Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 230000008094 contradictory effect Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 238000007046 ethoxylation reaction Methods 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000003752 hydrotrope Substances 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 239000002563 ionic surfactant Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000000963 oxybis(methylene) group Chemical group [H]C([H])(*)OC([H])([H])* 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 235000013772 propylene glycol Nutrition 0.000 description 2
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 239000003760 tallow Substances 0.000 description 2
- 150000004670 unsaturated fatty acids Chemical class 0.000 description 2
- 235000021122 unsaturated fatty acids Nutrition 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical class CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- TWJNQYPJQDRXPH-UHFFFAOYSA-N 2-cyanobenzohydrazide Chemical compound NNC(=O)C1=CC=CC=C1C#N TWJNQYPJQDRXPH-UHFFFAOYSA-N 0.000 description 1
- SGHSRBYSXCNJLP-UHFFFAOYSA-N 2-methyl-4,6-di(nonyl)phenol Chemical compound CCCCCCCCCC1=CC(C)=C(O)C(CCCCCCCCC)=C1 SGHSRBYSXCNJLP-UHFFFAOYSA-N 0.000 description 1
- JBVOQKNLGSOPNZ-UHFFFAOYSA-N 2-propan-2-ylbenzenesulfonic acid Chemical class CC(C)C1=CC=CC=C1S(O)(=O)=O JBVOQKNLGSOPNZ-UHFFFAOYSA-N 0.000 description 1
- HXIQYSLFEXIOAV-UHFFFAOYSA-N 2-tert-butyl-4-(5-tert-butyl-4-hydroxy-2-methylphenyl)sulfanyl-5-methylphenol Chemical compound CC1=CC(O)=C(C(C)(C)C)C=C1SC1=CC(C(C)(C)C)=C(O)C=C1C HXIQYSLFEXIOAV-UHFFFAOYSA-N 0.000 description 1
- IMOYOUMVYICGCA-UHFFFAOYSA-N 2-tert-butyl-4-hydroxyanisole Chemical compound COC1=CC=C(O)C=C1C(C)(C)C IMOYOUMVYICGCA-UHFFFAOYSA-N 0.000 description 1
- MRBKEAMVRSLQPH-UHFFFAOYSA-N 3-tert-butyl-4-hydroxyanisole Chemical compound COC1=CC=C(O)C(C(C)(C)C)=C1 MRBKEAMVRSLQPH-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229940120146 EDTMP Drugs 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- 235000021360 Myristic acid Nutrition 0.000 description 1
- TUNFSRHWOTWDNC-UHFFFAOYSA-N Myristic acid Natural products CCCCCCCCCCCCCC(O)=O TUNFSRHWOTWDNC-UHFFFAOYSA-N 0.000 description 1
- IXSIVJKDJQWHCL-UHFFFAOYSA-N P(O)(O)=O.P(O)(O)=O.P(O)(O)=O.P(O)(O)=O.P(O)(O)=O.NCCNCCN Chemical compound P(O)(O)=O.P(O)(O)=O.P(O)(O)=O.P(O)(O)=O.P(O)(O)=O.NCCNCCN IXSIVJKDJQWHCL-UHFFFAOYSA-N 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 241000208465 Proteaceae Species 0.000 description 1
- 241000502253 Talpa occidentalis Species 0.000 description 1
- KIDJHPQACZGFTI-UHFFFAOYSA-N [6-[bis(phosphonomethyl)amino]hexyl-(phosphonomethyl)amino]methylphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CCCCCCN(CP(O)(O)=O)CP(O)(O)=O KIDJHPQACZGFTI-UHFFFAOYSA-N 0.000 description 1
- YDONNITUKPKTIG-UHFFFAOYSA-N [Nitrilotris(methylene)]trisphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O YDONNITUKPKTIG-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- CZBZUDVBLSSABA-UHFFFAOYSA-N butylated hydroxyanisole Chemical compound COC1=CC=C(O)C(C(C)(C)C)=C1.COC1=CC=C(O)C=C1C(C)(C)C CZBZUDVBLSSABA-UHFFFAOYSA-N 0.000 description 1
- 229940043253 butylated hydroxyanisole Drugs 0.000 description 1
- 229940095259 butylated hydroxytoluene Drugs 0.000 description 1
- 150000001669 calcium Chemical class 0.000 description 1
- VSGNNIFQASZAOI-UHFFFAOYSA-L calcium acetate Chemical compound [Ca+2].CC([O-])=O.CC([O-])=O VSGNNIFQASZAOI-UHFFFAOYSA-L 0.000 description 1
- 239000001639 calcium acetate Substances 0.000 description 1
- 235000011092 calcium acetate Nutrition 0.000 description 1
- 229960005147 calcium acetate Drugs 0.000 description 1
- 229960002713 calcium chloride Drugs 0.000 description 1
- 235000011148 calcium chloride Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000010668 complexation reaction Methods 0.000 description 1
- 125000002592 cumenyl group Chemical group C1(=C(C=CC=C1)*)C(C)C 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 230000009849 deactivation Effects 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 229940090960 diethylenetriamine pentamethylene phosphonic acid Drugs 0.000 description 1
- 229940079919 digestives enzyme preparation Drugs 0.000 description 1
- 239000004205 dimethyl polysiloxane Substances 0.000 description 1
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 1
- DUYCTCQXNHFCSJ-UHFFFAOYSA-N dtpmp Chemical compound OP(=O)(O)CN(CP(O)(O)=O)CCN(CP(O)(=O)O)CCN(CP(O)(O)=O)CP(O)(O)=O DUYCTCQXNHFCSJ-UHFFFAOYSA-N 0.000 description 1
- NFDRPXJGHKJRLJ-UHFFFAOYSA-N edtmp Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CCN(CP(O)(O)=O)CP(O)(O)=O NFDRPXJGHKJRLJ-UHFFFAOYSA-N 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 description 1
- 235000011285 magnesium acetate Nutrition 0.000 description 1
- 239000011654 magnesium acetate Substances 0.000 description 1
- 229940069446 magnesium acetate Drugs 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 229960002337 magnesium chloride Drugs 0.000 description 1
- 235000011147 magnesium chloride Nutrition 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical class [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 235000019419 proteases Nutrition 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000009919 sequestration Effects 0.000 description 1
- 230000002226 simultaneous effect Effects 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 239000002888 zwitterionic surfactant Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/38—Products with no well-defined composition, e.g. natural products
- C11D3/386—Preparations containing enzymes, e.g. protease or amylase
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US123,856 | 1980-02-22 | ||
| US06/123,856 US4287082A (en) | 1980-02-22 | 1980-02-22 | Homogeneous enzyme-containing liquid detergent compositions containing saturated acids |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1157793A true CA1157793A (en) | 1983-11-29 |
Family
ID=22411307
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000364195A Expired CA1157793A (en) | 1980-02-22 | 1980-11-06 | Homogeneous enzyme-containing liquid detergent compositions containing saturated fatty acids |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4287082A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS56129298A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1157793A (cg-RX-API-DMAC7.html) |
| MX (1) | MX151982A (cg-RX-API-DMAC7.html) |
| PH (1) | PH15536A (cg-RX-API-DMAC7.html) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ATE7823T1 (de) * | 1980-01-29 | 1984-06-15 | Vickers Limited | Entwickler und verfahren zum entwickeln strahlenempfindlicher platten unter verwendung derselben. |
| US4518694A (en) * | 1980-07-30 | 1985-05-21 | The Drackett Company | Aqueous compositions containing stabilized enzymes |
| US4561998A (en) * | 1982-05-24 | 1985-12-31 | The Procter & Gamble Company | Near-neutral pH detergents containing anionic surfactant, cosurfactant and fatty acid |
| US4421514A (en) * | 1982-08-03 | 1983-12-20 | Colgate-Palmolive | Antistatic laundry treatment |
| US4529525A (en) * | 1982-08-30 | 1985-07-16 | Colgate-Palmolive Co. | Stabilized enzyme-containing detergent compositions |
| MX161813A (es) * | 1982-12-13 | 1990-12-28 | Colgate Palmolive Co | Mejoras a composicion detergente liquida |
| JPS59141515A (ja) * | 1983-02-02 | 1984-08-14 | Suntory Ltd | 発酵養毛化粧料の製造方法 |
| EP0118933B1 (en) * | 1983-02-14 | 1988-06-01 | THE PROCTER & GAMBLE COMPANY | Stabilized aqueous enzyme composition |
| US4511490A (en) * | 1983-06-27 | 1985-04-16 | The Clorox Company | Cooperative enzymes comprising alkaline or mixtures of alkaline and neutral proteases without stabilizers |
| US4490285A (en) * | 1983-08-02 | 1984-12-25 | The Procter & Gamble Company | Heavy-duty liquid detergent composition |
| US4507219A (en) * | 1983-08-12 | 1985-03-26 | The Proctor & Gamble Company | Stable liquid detergent compositions |
| JPS6067409A (ja) * | 1983-09-22 | 1985-04-17 | Suntory Ltd | 頭髪用化粧料 |
| US4661287A (en) * | 1983-10-05 | 1987-04-28 | Colgate-Palmolive Company | Stable soil release promoting enzymatic liquid detergent composition |
| US4548727A (en) * | 1983-10-06 | 1985-10-22 | The Drackett Company | Aqueous compositions containing stabilized enzymes |
| GB8401875D0 (en) * | 1984-01-25 | 1984-02-29 | Procter & Gamble | Liquid detergent compositions |
| US4537706A (en) * | 1984-05-14 | 1985-08-27 | The Procter & Gamble Company | Liquid detergents containing boric acid to stabilize enzymes |
| US4537707A (en) * | 1984-05-14 | 1985-08-27 | The Procter & Gamble Company | Liquid detergents containing boric acid and formate to stabilize enzymes |
| US4747977A (en) * | 1984-11-09 | 1988-05-31 | The Procter & Gamble Company | Ethanol-free liquid laundry detergent compositions |
| US4759876A (en) * | 1985-03-19 | 1988-07-26 | Colgate-Palmolive Company | Stable soil release promoting enzymatic liquid detergent composition |
| US4798679A (en) * | 1987-05-11 | 1989-01-17 | The Procter & Gamble Co. | Controlled sudsing stable isotropic liquid detergent compositions |
| US5156761A (en) * | 1988-07-20 | 1992-10-20 | Dorrit Aaslyng | Method of stabilizing an enzymatic liquid detergent composition |
| US5269960A (en) * | 1988-09-25 | 1993-12-14 | The Clorox Company | Stable liquid aqueous enzyme detergent |
| US5275753A (en) * | 1989-01-10 | 1994-01-04 | The Procter & Gamble Company | Stabilized alkaline liquid detergent compositions containing enzyme and peroxygen bleach |
| US5221495A (en) * | 1990-04-13 | 1993-06-22 | Colgate-Palmolive Company | Enzyme stabilizing composition and stabilized enzyme containing built detergent compositions |
| US5364553A (en) * | 1990-04-13 | 1994-11-15 | Colgate-Palmolive Company | Stabilized built aqueous liquid softergent compositions |
| US5071586A (en) * | 1990-07-27 | 1991-12-10 | Lever Brothers Company, Division Of Conopco, Inc. | Protease-containing compositions stabilized by propionic acid or salt thereof |
| US5589448A (en) * | 1993-02-17 | 1996-12-31 | The Clorox Company | High water liquid enzyme prewash composition |
| US5789364A (en) * | 1993-02-17 | 1998-08-04 | The Clorox Company | High water liquid enzyme prewash composition |
| NZ273214A (en) * | 1993-09-14 | 1998-04-27 | Procter & Gamble | Light duty liquid or gel dishwashing detergent composition comprising surfactant and active protease, provision of mildness benefits to the skin |
| DE4422433A1 (de) * | 1994-06-28 | 1996-01-04 | Cognis Bio Umwelt | Mehrenzymgranulat |
| US6140293A (en) * | 1996-06-19 | 2000-10-31 | The Procter & Gamble Company | Detergent compositions comprising a specific amylase and a protease |
| US5672213A (en) * | 1995-08-18 | 1997-09-30 | Alcon Laboratories, Inc. | Liquid enzyme compositions containing aromatic acid derivatives |
| DE19725508A1 (de) | 1997-06-17 | 1998-12-24 | Clariant Gmbh | Wasch- und Reinigungsmittel |
| GB2329901A (en) * | 1997-09-30 | 1999-04-07 | Reckitt & Colman Inc | Acidic hard surface cleaning and disinfecting compositions |
| US6420332B1 (en) | 1998-12-23 | 2002-07-16 | Joseph J. Simpson | Blood and organic stain remover |
| US6753306B2 (en) | 1998-12-23 | 2004-06-22 | Joseph J. Simpson | Germicidal and disinfectant composition |
| DK2144625T3 (da) * | 2006-12-05 | 2022-05-09 | Marizyme Inc | Enzymsammensætning med reguleret frigivelse og anvendelsesfremgangsmåder |
| US20110166370A1 (en) | 2010-01-12 | 2011-07-07 | Charles Winston Saunders | Scattered Branched-Chain Fatty Acids And Biological Production Thereof |
| CA2827658A1 (en) | 2011-02-17 | 2012-08-23 | The Procter & Gamble Company | Bio-based linear alkylphenyl sulfonates |
| CN103380204B (zh) | 2011-02-17 | 2016-02-03 | 宝洁公司 | 包含c10-c13烷基苯基磺酸盐的混合物的组合物 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3325364A (en) * | 1966-04-18 | 1967-06-13 | Us Vitamin Pharm Corp | Process for stabilizing enzyme compositions |
| US3557002A (en) * | 1967-11-15 | 1971-01-19 | Procter & Gamble | Stabilized aqueous enzyme preparation |
| BE759360A (cg-RX-API-DMAC7.html) * | 1969-11-25 | 1971-05-24 | Procter & Gamble Europ | |
| IT1106254B (it) * | 1976-03-08 | 1985-11-11 | Procter & Gamble Europ | Composizione detergente liquida contenente enzimi |
-
1980
- 1980-02-22 US US06/123,856 patent/US4287082A/en not_active Expired - Lifetime
- 1980-11-06 CA CA000364195A patent/CA1157793A/en not_active Expired
- 1980-11-10 MX MX184691A patent/MX151982A/es unknown
- 1980-11-10 JP JP15806080A patent/JPS56129298A/ja active Granted
- 1980-11-12 PH PH24850A patent/PH15536A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0323600B2 (cg-RX-API-DMAC7.html) | 1991-03-29 |
| US4287082A (en) | 1981-09-01 |
| JPS56129298A (en) | 1981-10-09 |
| MX151982A (es) | 1985-05-23 |
| PH15536A (en) | 1983-02-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1157793A (en) | Homogeneous enzyme-containing liquid detergent compositions containing saturated fatty acids | |
| US4305837A (en) | Stabilized aqueous enzyme composition | |
| US4318818A (en) | Stabilized aqueous enzyme composition | |
| EP0028865B2 (en) | Homogeneous enzyme-containing liquid detergent compositions containing saturated fatty acids | |
| US4285841A (en) | Highly concentrated fatty acid containing liquid detergent compositions | |
| CA1207256A (en) | Stabilized enzyme-containing detergent compositions | |
| EP0151678B1 (en) | Stable liquid detergent compositions | |
| US4111855A (en) | Liquid enzyme containing detergent composition | |
| US3676374A (en) | Enzyme-containing liquid detergent compositions | |
| CA1133407A (en) | Liquid detergent compositions | |
| US5039446A (en) | Liquid detergent with stabilized enzyme | |
| CA1284446C (en) | Homogeneous concentrated liquid detergent compositions containing ternary surfactant system | |
| JPS5932517B2 (ja) | 酵素含有液状洗浄用組成物 | |
| CA2122986C (en) | Color-stabilization system in liquid detergent compositions | |
| US5156761A (en) | Method of stabilizing an enzymatic liquid detergent composition | |
| EP0348183A2 (en) | Enzyme-containing liquid detergents | |
| JPH0241398A (ja) | 安定化酵素液体洗剤組成物 | |
| EP0028866B1 (en) | Stabilised aqueous enzyme composition containing formate and calcium ions | |
| NZ232056A (en) | Aqueous liquid detergent containing magnesium ions as enzyme stabiliser | |
| EP0118933B1 (en) | Stabilized aqueous enzyme composition | |
| US6121225A (en) | Stable aqueous enzyme compositions | |
| JPS5811196B2 (ja) | 安定な水性酵素組成物 | |
| GB1572605A (en) | Liqid enzyme containing detergent composition | |
| AU642276B2 (en) | Protease-containing liquid detergent compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |