CA1145208A - Semipermeable composite membrane - Google Patents
Semipermeable composite membraneInfo
- Publication number
- CA1145208A CA1145208A CA000335070A CA335070A CA1145208A CA 1145208 A CA1145208 A CA 1145208A CA 000335070 A CA000335070 A CA 000335070A CA 335070 A CA335070 A CA 335070A CA 1145208 A CA1145208 A CA 1145208A
- Authority
- CA
- Canada
- Prior art keywords
- group
- carbon atoms
- membrane
- polymer
- groups
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000012528 membrane Substances 0.000 title claims abstract description 143
- 239000002131 composite material Substances 0.000 title claims abstract description 43
- 229920000642 polymer Polymers 0.000 claims abstract description 146
- 150000001875 compounds Chemical class 0.000 claims abstract description 77
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 76
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 72
- 125000003277 amino group Chemical group 0.000 claims abstract description 50
- 239000000758 substrate Substances 0.000 claims abstract description 37
- 238000001223 reverse osmosis Methods 0.000 claims abstract description 36
- 238000004132 cross linking Methods 0.000 claims abstract description 21
- 125000000524 functional group Chemical group 0.000 claims abstract description 16
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims abstract description 13
- 239000000463 material Substances 0.000 claims abstract description 12
- 239000011780 sodium chloride Substances 0.000 claims abstract description 10
- 238000010612 desalination reaction Methods 0.000 claims abstract description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 106
- 125000000217 alkyl group Chemical group 0.000 claims description 63
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 47
- -1 cyano, hydroxyl Chemical group 0.000 claims description 44
- 125000005842 heteroatom Chemical group 0.000 claims description 38
- 239000000178 monomer Substances 0.000 claims description 37
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 33
- 125000005843 halogen group Chemical group 0.000 claims description 33
- 229910052757 nitrogen Inorganic materials 0.000 claims description 33
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 32
- 125000003118 aryl group Chemical group 0.000 claims description 31
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 30
- 238000000034 method Methods 0.000 claims description 29
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 27
- 229910052799 carbon Inorganic materials 0.000 claims description 26
- 239000000203 mixture Substances 0.000 claims description 25
- 125000004429 atom Chemical group 0.000 claims description 22
- 229920001577 copolymer Polymers 0.000 claims description 21
- 125000000623 heterocyclic group Chemical group 0.000 claims description 20
- 239000010408 film Substances 0.000 claims description 19
- 229910052760 oxygen Inorganic materials 0.000 claims description 19
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 18
- 239000000460 chlorine Substances 0.000 claims description 18
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 17
- 125000002947 alkylene group Chemical group 0.000 claims description 17
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 17
- 239000001301 oxygen Substances 0.000 claims description 17
- 239000001257 hydrogen Substances 0.000 claims description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 15
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 14
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 14
- 239000002904 solvent Substances 0.000 claims description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 125000001302 tertiary amino group Chemical group 0.000 claims description 11
- 150000001491 aromatic compounds Chemical class 0.000 claims description 10
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 10
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 10
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 9
- 229920002492 poly(sulfone) Polymers 0.000 claims description 9
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 8
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- 230000008569 process Effects 0.000 claims description 8
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 claims description 7
- 229910052794 bromium Chemical group 0.000 claims description 6
- 150000004820 halides Chemical class 0.000 claims description 6
- 239000010409 thin film Substances 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 125000001188 haloalkyl group Chemical group 0.000 claims description 5
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 5
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 4
- 239000005977 Ethylene Substances 0.000 claims description 4
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 4
- 239000004372 Polyvinyl alcohol Substances 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 150000001298 alcohols Chemical class 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- UWCPYKQBIPYOLX-UHFFFAOYSA-N benzene-1,3,5-tricarbonyl chloride Chemical compound ClC(=O)C1=CC(C(Cl)=O)=CC(C(Cl)=O)=C1 UWCPYKQBIPYOLX-UHFFFAOYSA-N 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 229920006037 cross link polymer Polymers 0.000 claims description 4
- 229920000620 organic polymer Polymers 0.000 claims description 4
- 229920002432 poly(vinyl methyl ether) polymer Polymers 0.000 claims description 4
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 4
- 125000005650 substituted phenylene group Chemical group 0.000 claims description 4
- 239000011593 sulfur Chemical group 0.000 claims description 4
- 125000004018 acid anhydride group Chemical group 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 125000004423 acyloxy group Chemical group 0.000 claims description 3
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims description 3
- 239000003495 polar organic solvent Substances 0.000 claims description 3
- 229920000036 polyvinylpyrrolidone Polymers 0.000 claims description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 claims description 3
- 150000003461 sulfonyl halides Chemical class 0.000 claims description 3
- 150000001450 anions Chemical class 0.000 claims description 2
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 claims description 2
- 230000006872 improvement Effects 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 claims description 2
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 claims description 2
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims 9
- 229960005419 nitrogen Drugs 0.000 claims 8
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 claims 6
- 229910006069 SO3H Inorganic materials 0.000 claims 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims 2
- JIMRSFDTUBLGOO-UHFFFAOYSA-N 1-chlorosulfonylcyclohexa-3,5-diene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(S(Cl)(=O)=O)(C(Cl)=O)C1 JIMRSFDTUBLGOO-UHFFFAOYSA-N 0.000 claims 1
- 150000001334 alicyclic compounds Chemical class 0.000 claims 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 claims 1
- 150000002391 heterocyclic compounds Chemical class 0.000 claims 1
- 239000012948 isocyanate Substances 0.000 claims 1
- 150000002513 isocyanates Chemical class 0.000 claims 1
- KGDLQPRAMMDEPD-UHFFFAOYSA-N n,n-dimethylformamide;formic acid Chemical compound OC=O.CN(C)C=O KGDLQPRAMMDEPD-UHFFFAOYSA-N 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 abstract description 2
- 239000000243 solution Substances 0.000 description 39
- 150000003839 salts Chemical class 0.000 description 29
- 150000001412 amines Chemical class 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 24
- 239000007864 aqueous solution Substances 0.000 description 22
- 230000004907 flux Effects 0.000 description 17
- 150000003254 radicals Chemical class 0.000 description 15
- 238000012360 testing method Methods 0.000 description 14
- 229920005601 base polymer Polymers 0.000 description 13
- GLUUGHFHXGJENI-UHFFFAOYSA-N diethylenediamine Natural products C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 229910052736 halogen Chemical group 0.000 description 12
- 230000003647 oxidation Effects 0.000 description 12
- 238000007254 oxidation reaction Methods 0.000 description 12
- 229920002554 vinyl polymer Polymers 0.000 description 12
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 11
- 150000002367 halogens Chemical group 0.000 description 11
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 11
- 238000011282 treatment Methods 0.000 description 10
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 10
- 239000002585 base Substances 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 9
- 239000011248 coating agent Substances 0.000 description 9
- 238000000576 coating method Methods 0.000 description 9
- 239000012153 distilled water Substances 0.000 description 9
- 239000000839 emulsion Substances 0.000 description 9
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 8
- 230000000977 initiatory effect Effects 0.000 description 8
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 239000010410 layer Substances 0.000 description 7
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 7
- 229960005141 piperazine Drugs 0.000 description 7
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 6
- 125000001931 aliphatic group Chemical group 0.000 description 6
- 238000005056 compaction Methods 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 6
- 229920000768 polyamine Polymers 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 125000002723 alicyclic group Chemical group 0.000 description 5
- 150000001721 carbon Chemical group 0.000 description 5
- 230000015556 catabolic process Effects 0.000 description 5
- 125000004122 cyclic group Chemical group 0.000 description 5
- 230000007547 defect Effects 0.000 description 5
- 238000006731 degradation reaction Methods 0.000 description 5
- 150000002500 ions Chemical class 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- SNVLJLYUUXKWOJ-UHFFFAOYSA-N methylidenecarbene Chemical compound C=[C] SNVLJLYUUXKWOJ-UHFFFAOYSA-N 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 241000894007 species Species 0.000 description 5
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 239000003431 cross linking reagent Substances 0.000 description 4
- 229930195733 hydrocarbon Natural products 0.000 description 4
- 238000010406 interfacial reaction Methods 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 238000006116 polymerization reaction Methods 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 4
- 229960001124 trientine Drugs 0.000 description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- 229920002873 Polyethylenimine Polymers 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229940048053 acrylate Drugs 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 230000004888 barrier function Effects 0.000 description 3
- 150000007514 bases Chemical class 0.000 description 3
- 125000005587 carbonate group Chemical group 0.000 description 3
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 3
- 238000000502 dialysis Methods 0.000 description 3
- 229960004132 diethyl ether Drugs 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 3
- 230000036647 reaction Effects 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000008279 sol Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 3
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- AGBXYHCHUYARJY-UHFFFAOYSA-N 2-phenylethenesulfonic acid Chemical compound OS(=O)(=O)C=CC1=CC=CC=C1 AGBXYHCHUYARJY-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- 229920000298 Cellophane Polymers 0.000 description 2
- 229920001747 Cellulose diacetate Polymers 0.000 description 2
- 241000861718 Chloris <Aves> Species 0.000 description 2
- 102100024133 Coiled-coil domain-containing protein 50 Human genes 0.000 description 2
- 241000518994 Conta Species 0.000 description 2
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical class NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- 229910015400 FeC13 Inorganic materials 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 101000910772 Homo sapiens Coiled-coil domain-containing protein 50 Proteins 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241000100287 Membras Species 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000003302 alkenyloxy group Chemical group 0.000 description 2
- 239000000956 alloy Substances 0.000 description 2
- 229910045601 alloy Inorganic materials 0.000 description 2
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 229920005565 cyclic polymer Polymers 0.000 description 2
- FJKIXWOMBXYWOQ-UHFFFAOYSA-N ethenoxyethane Chemical compound CCOC=C FJKIXWOMBXYWOQ-UHFFFAOYSA-N 0.000 description 2
- 229940012017 ethylenediamine Drugs 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 238000005755 formation reaction Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- PYGSKMBEVAICCR-UHFFFAOYSA-N hexa-1,5-diene Chemical group C=CCCC=C PYGSKMBEVAICCR-UHFFFAOYSA-N 0.000 description 2
- 239000004312 hexamethylene tetramine Substances 0.000 description 2
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000012433 hydrogen halide Substances 0.000 description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 239000003999 initiator Substances 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- 150000002736 metal compounds Chemical class 0.000 description 2
- 125000005395 methacrylic acid group Chemical group 0.000 description 2
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- BKIMMITUMNQMOS-UHFFFAOYSA-N nonane Chemical compound CCCCCCCCC BKIMMITUMNQMOS-UHFFFAOYSA-N 0.000 description 2
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 2
- 230000003204 osmotic effect Effects 0.000 description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 2
- 239000011148 porous material Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000011253 protective coating Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 102220024172 rs397515479 Human genes 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 125000002128 sulfonyl halide group Chemical group 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- OGNVQLDIPUXYDH-ZPKKHLQPSA-N (2R,3R,4S)-3-(2-methylpropanoylamino)-4-(4-phenyltriazol-1-yl)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid Chemical compound CC(C)C(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(O)=O)=C[C@@H]1N1N=NC(C=2C=CC=CC=2)=C1 OGNVQLDIPUXYDH-ZPKKHLQPSA-N 0.000 description 1
- XLYMOEINVGRTEX-ONEGZZNKSA-N (e)-4-ethoxy-4-oxobut-2-enoic acid Chemical compound CCOC(=O)\C=C\C(O)=O XLYMOEINVGRTEX-ONEGZZNKSA-N 0.000 description 1
- KEQXNNJHMWSZHK-UHFFFAOYSA-L 1,3,2,4$l^{2}-dioxathiaplumbetane 2,2-dioxide Chemical compound [Pb+2].[O-]S([O-])(=O)=O KEQXNNJHMWSZHK-UHFFFAOYSA-L 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DNJRKFKAFWSXSE-UHFFFAOYSA-N 1-chloro-2-ethenoxyethane Chemical compound ClCCOC=C DNJRKFKAFWSXSE-UHFFFAOYSA-N 0.000 description 1
- PIPWSBOFSUJCCO-UHFFFAOYSA-N 2,2-dimethylpiperazine Chemical compound CC1(C)CNCCN1 PIPWSBOFSUJCCO-UHFFFAOYSA-N 0.000 description 1
- NSMWYRLQHIXVAP-UHFFFAOYSA-N 2,5-dimethylpiperazine Chemical compound CC1CNC(C)CN1 NSMWYRLQHIXVAP-UHFFFAOYSA-N 0.000 description 1
- XUDBVJCTLZTSDC-UHFFFAOYSA-N 2-ethenylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C=C XUDBVJCTLZTSDC-UHFFFAOYSA-N 0.000 description 1
- CBECDWUDYQOTSW-UHFFFAOYSA-N 2-ethylbut-3-enal Chemical compound CCC(C=C)C=O CBECDWUDYQOTSW-UHFFFAOYSA-N 0.000 description 1
- JOMNTHCQHJPVAZ-UHFFFAOYSA-N 2-methylpiperazine Chemical compound CC1CNCCN1 JOMNTHCQHJPVAZ-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- DOWVFPAIJRADGF-UHFFFAOYSA-N 4-ethenyl-2-benzofuran-1,3-dione Chemical compound C=CC1=CC=CC2=C1C(=O)OC2=O DOWVFPAIJRADGF-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 241000256844 Apis mellifera Species 0.000 description 1
- LQVXSNNAFNGRAH-QHCPKHFHSA-N BMS-754807 Chemical compound C([C@@]1(C)C(=O)NC=2C=NC(F)=CC=2)CCN1C(=NN1C=CC=C11)N=C1NC(=NN1)C=C1C1CC1 LQVXSNNAFNGRAH-QHCPKHFHSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 102100038916 Caspase-5 Human genes 0.000 description 1
- 241000238366 Cephalopoda Species 0.000 description 1
- 239000004801 Chlorinated PVC Substances 0.000 description 1
- 229920008712 Copo Polymers 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 229920004934 Dacron® Polymers 0.000 description 1
- 101000872083 Danio rerio Delta-like protein C Proteins 0.000 description 1
- MQJKPEGWNLWLTK-UHFFFAOYSA-N Dapsone Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 MQJKPEGWNLWLTK-UHFFFAOYSA-N 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 238000005863 Friedel-Crafts acylation reaction Methods 0.000 description 1
- 101100112336 Homo sapiens CASP5 gene Proteins 0.000 description 1
- 101001052394 Homo sapiens [F-actin]-monooxygenase MICAL1 Proteins 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 101100273286 Mus musculus Casp4 gene Proteins 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 229920002845 Poly(methacrylic acid) Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 229920000491 Polyphenylsulfone Polymers 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 108091006629 SLC13A2 Proteins 0.000 description 1
- 101100341041 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) IOC2 gene Proteins 0.000 description 1
- 101100222207 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) TIS11 gene Proteins 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 102100035115 Testin Human genes 0.000 description 1
- 101710070533 Testin Proteins 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 102100024306 [F-actin]-monooxygenase MICAL1 Human genes 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 1
- 238000012644 addition polymerization Methods 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical group 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 239000013522 chelant Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- HNEGQIOMVPPMNR-IHWYPQMZSA-N citraconic acid Chemical compound OC(=O)C(/C)=C\C(O)=O HNEGQIOMVPPMNR-IHWYPQMZSA-N 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 238000007333 cyanation reaction Methods 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000000151 deposition Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000011033 desalting Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 1
- CEJLBZWIKQJOAT-UHFFFAOYSA-N dichloroisocyanuric acid Chemical compound ClN1C(=O)NC(=O)N(Cl)C1=O CEJLBZWIKQJOAT-UHFFFAOYSA-N 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- LDCRTTXIJACKKU-ARJAWSKDSA-N dimethyl maleate Chemical compound COC(=O)\C=C/C(=O)OC LDCRTTXIJACKKU-ARJAWSKDSA-N 0.000 description 1
- 238000003618 dip coating Methods 0.000 description 1
- SDIXRDNYIMOKSG-UHFFFAOYSA-L disodium methyl arsenate Chemical compound [Na+].[Na+].C[As]([O-])([O-])=O SDIXRDNYIMOKSG-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- 125000002573 ethenylidene group Chemical group [*]=C=C([H])[H] 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229940052303 ethers for general anesthesia Drugs 0.000 description 1
- KTLPNEZOGCOFJE-UHFFFAOYSA-N ethyl 2-ethenylbenzoate Chemical compound CCOC(=O)C1=CC=CC=C1C=C KTLPNEZOGCOFJE-UHFFFAOYSA-N 0.000 description 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- NHWGPUVJQFTOQX-UHFFFAOYSA-N ethyl-[2-[2-[ethyl(dimethyl)azaniumyl]ethyl-methylamino]ethyl]-dimethylazanium Chemical compound CC[N+](C)(C)CCN(C)CC[N+](C)(C)CC NHWGPUVJQFTOQX-UHFFFAOYSA-N 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- XLYMOEINVGRTEX-UHFFFAOYSA-N fumaric acid monoethyl ester Natural products CCOC(=O)C=CC(O)=O XLYMOEINVGRTEX-UHFFFAOYSA-N 0.000 description 1
- VNZYHVPAPZNCBZ-UHFFFAOYSA-N furan-2,5-dione;methyl prop-2-enoate Chemical compound COC(=O)C=C.O=C1OC(=O)C=C1 VNZYHVPAPZNCBZ-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 125000001145 hydrido group Chemical group *[H] 0.000 description 1
- ATADHKWKHYVBTJ-UHFFFAOYSA-N hydron;4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;chloride Chemical compound Cl.CNCC(O)C1=CC=C(O)C(O)=C1 ATADHKWKHYVBTJ-UHFFFAOYSA-N 0.000 description 1
- 125000005462 imide group Chemical group 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229960004592 isopropanol Drugs 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- HQRPHMAXFVUBJX-UHFFFAOYSA-M lithium;hydrogen carbonate Chemical compound [Li+].OC([O-])=O HQRPHMAXFVUBJX-UHFFFAOYSA-M 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- VHRYZQNGTZXDNX-UHFFFAOYSA-N methacryloyl chloride Chemical compound CC(=C)C(Cl)=O VHRYZQNGTZXDNX-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- MPHUYCIKFIKENX-UHFFFAOYSA-N methyl 2-ethenylbenzoate Chemical compound COC(=O)C1=CC=CC=C1C=C MPHUYCIKFIKENX-UHFFFAOYSA-N 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- JTHNLKXLWOXOQK-UHFFFAOYSA-N n-propyl vinyl ketone Natural products CCCC(=O)C=C JTHNLKXLWOXOQK-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 150000002829 nitrogen Chemical class 0.000 description 1
- 239000004745 nonwoven fabric Substances 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000005416 organic matter Substances 0.000 description 1
- 125000003431 oxalo group Chemical group 0.000 description 1
- 125000004043 oxo group Chemical group O=* 0.000 description 1
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- 150000004885 piperazines Chemical class 0.000 description 1
- 229920001495 poly(sodium acrylate) polymer Polymers 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 125000005575 polycyclic aromatic hydrocarbon group Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 229920006380 polyphenylene oxide Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 239000005373 porous glass Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- UIIIBRHUICCMAI-UHFFFAOYSA-N prop-2-ene-1-sulfonic acid Chemical compound OS(=O)(=O)CC=C UIIIBRHUICCMAI-UHFFFAOYSA-N 0.000 description 1
- ARJOQCYCJMAIFR-UHFFFAOYSA-N prop-2-enoyl prop-2-enoate Chemical compound C=CC(=O)OC(=O)C=C ARJOQCYCJMAIFR-UHFFFAOYSA-N 0.000 description 1
- 239000008213 purified water Substances 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical group 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 102220107651 rs1802645 Human genes 0.000 description 1
- 239000013535 sea water Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- MNCGMVDMOKPCSQ-UHFFFAOYSA-M sodium;2-phenylethenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C=CC1=CC=CC=C1 MNCGMVDMOKPCSQ-UHFFFAOYSA-M 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000002344 surface layer Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- FAGUFWYHJQFNRV-UHFFFAOYSA-N tetraethylenepentamine Chemical compound NCCNCCNCCNCCN FAGUFWYHJQFNRV-UHFFFAOYSA-N 0.000 description 1
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical compound FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 1
- AGGKEGLBGGJEBZ-UHFFFAOYSA-N tetramethylenedisulfotetramine Chemical compound C1N(S2(=O)=O)CN3S(=O)(=O)N1CN2C3 AGGKEGLBGGJEBZ-UHFFFAOYSA-N 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 102220588530 von Willebrand factor A domain-containing protein 5B1_R25N_mutation Human genes 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 229920003169 water-soluble polymer Polymers 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D71/00—Semi-permeable membranes for separation processes or apparatus characterised by the material; Manufacturing processes specially adapted therefor
- B01D71/06—Organic material
- B01D71/58—Other polymers having nitrogen in the main chain, with or without oxygen or carbon only
- B01D71/60—Polyamines
- B01D71/601—Polyethylenimine
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D69/00—Semi-permeable membranes for separation processes or apparatus characterised by their form, structure or properties; Manufacturing processes specially adapted therefor
- B01D69/12—Composite membranes; Ultra-thin membranes
- B01D69/125—In situ manufacturing by polymerisation, polycondensation, cross-linking or chemical reaction
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D71/00—Semi-permeable membranes for separation processes or apparatus characterised by the material; Manufacturing processes specially adapted therefor
- B01D71/06—Organic material
- B01D71/44—Polymers obtained by reactions only involving carbon-to-carbon unsaturated bonds, not provided for in a single one of groups B01D71/26-B01D71/42
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G85/00—General processes for preparing compounds provided for in this subclass
- C08G85/004—Modification of polymers by chemical after-treatment
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
- Manufacture Of Porous Articles, And Recovery And Treatment Of Waste Products (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP108,472/78 | 1978-09-06 | ||
| JP10847278A JPS5535910A (en) | 1978-09-06 | 1978-09-06 | Permselectivity composite membrane and preparation thereof |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1145208A true CA1145208A (en) | 1983-04-26 |
Family
ID=14485614
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000335070A Expired CA1145208A (en) | 1978-09-06 | 1979-09-05 | Semipermeable composite membrane |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4302336A (enExample) |
| EP (1) | EP0008945A3 (enExample) |
| JP (1) | JPS5535910A (enExample) |
| CA (1) | CA1145208A (enExample) |
Families Citing this family (110)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4259183A (en) * | 1978-11-07 | 1981-03-31 | Midwest Research Institute | Reverse osmosis membrane |
| JPS5727102A (en) * | 1980-07-28 | 1982-02-13 | Nitto Electric Ind Co Ltd | Composite semipermeable membrane and its production |
| DE3170223D1 (en) * | 1981-01-13 | 1985-06-05 | Teijin Ltd | Ion-permeable composite membrane and its use in selective separation |
| IL64967A0 (en) * | 1981-03-17 | 1982-04-30 | Aligena Ag | Semipermeable membranes containing modified polysulfones,their manufacture and their use |
| DE3271691D1 (en) * | 1981-12-21 | 1986-07-17 | Aligena Ag | Semipermeable membranes of modified polystyrene, process for their manufacture and their use |
| US4663050A (en) * | 1982-01-18 | 1987-05-05 | Standard Oil Company | Semipermeable membranes prepared from polymers containing adjacent, pendent carboxy groups |
| JPS5929003A (ja) * | 1982-08-09 | 1984-02-16 | Agency Of Ind Science & Technol | 半透性を有する高分子膜体 |
| IL70415A (en) * | 1982-12-27 | 1987-07-31 | Aligena Ag | Semipermeable encapsulated membranes,their manufacture and their use |
| EP0156840A4 (en) * | 1983-09-12 | 1987-07-08 | Memtec Ltd | TREATMENT OF POROUS MEMBRANE. |
| JPS60232085A (ja) * | 1984-04-28 | 1985-11-18 | Kanegafuchi Chem Ind Co Ltd | 無菌的濾過方法 |
| NL8402647A (nl) * | 1984-08-30 | 1986-03-17 | Wafilin Bv | Semi-permeabel samengesteld membraan uit een poly-n-vinyl-n-methylpolymeer. |
| US4851127A (en) * | 1984-11-23 | 1989-07-25 | Bend Research, Inc. | Novel amine-based presursor compounds and composite membranes thereof |
| US4661254A (en) * | 1985-05-23 | 1987-04-28 | Uop Inc. | Chlorine-resistant semipermeable membranes |
| IT1207516B (it) * | 1985-12-19 | 1989-05-25 | Enichem Polimeri | Policarbonati ramificati contenenti composti aromatici mononucleari. |
| GB2189168B (en) * | 1986-04-21 | 1989-11-29 | Aligena Ag | Composite membranes useful in the separation of low molecular weight organic compounds from aqueous solutions containing inorganic salts |
| DK169616B1 (da) * | 1986-08-27 | 1994-12-27 | Dow Danmark | Permeabel, porøs, polymerbehandlet plastmembran med hydrofil karakter, fremgangsmåder til fremstilling heraf samt anvendelse heraf |
| US4769148A (en) * | 1987-11-18 | 1988-09-06 | The Dow Chemical Company | Novel polyamide reverse osmosis membranes |
| US4859384A (en) * | 1987-11-18 | 1989-08-22 | Filmtec Corp. | Novel polyamide reverse osmosis membranes |
| IL89970A (en) * | 1989-04-14 | 1994-10-21 | Weizmann Kiryat Membrane Prod | Composite membranes containing a coated layer of crosslinked polyaromatic polymers and/or sulfonated poly (haloalkylenes) |
| US5024765A (en) * | 1989-10-02 | 1991-06-18 | Aligena Ag | Composite membranes and processes using them |
| US5118424A (en) * | 1990-11-30 | 1992-06-02 | Ionics Incorporated | Thin film composite membranes from vinyl and related nomomers |
| US5265734A (en) * | 1991-08-30 | 1993-11-30 | Membrane Products Kiryat Weitzman Ltd. | Silicon-derived solvent stable membranes |
| US5151182A (en) * | 1991-08-30 | 1992-09-29 | Membrane Products Kiryat Weizmann Ltd. | Polyphenylene oxide-derived membranes for separation in organic solvents |
| US5205934A (en) * | 1991-08-30 | 1993-04-27 | Membrane Products Kiryat Weitzman Ltd. | Silicone-derived solvent stable membranes |
| US5538535A (en) * | 1995-02-27 | 1996-07-23 | Membrane Technology And Research, Inc. | Membrane process for treatment of chlorine-containing gas streams |
| US5698318A (en) * | 1995-05-23 | 1997-12-16 | The Dow Chemical Company | Process for resin transfer molding and formulations useful to practice it |
| US5663259A (en) * | 1995-05-31 | 1997-09-02 | The Dow Chemical Company | Curable compositions which contain network polymers |
| US6139742A (en) * | 1996-10-31 | 2000-10-31 | University Of Kentucky Research Foundation | Membrane-based sorbent for heavy metal sequestration |
| US6306301B1 (en) | 1996-10-31 | 2001-10-23 | University Of Kentucky Research Foundation | Silica-based membrane sorbent for heavy metal sequestration |
| US6544418B1 (en) | 1996-10-31 | 2003-04-08 | University Of Kentucky Research Foundation | Preparing and regenerating a composite polymer and silica-based membrane |
| US6103121A (en) * | 1996-10-31 | 2000-08-15 | University Of Kentucky Research Foundation | Membrane-based sorbent for heavy metal sequestration |
| NZ336455A (en) | 1996-12-20 | 2001-04-27 | Usf Filtration & Separations | A method for cleaning porous membranes using a gas bubble system |
| DE60043597D1 (de) † | 1999-02-25 | 2010-02-04 | Pall Corp | Positiv geladene Membran |
| US6780327B1 (en) | 1999-02-25 | 2004-08-24 | Pall Corporation | Positively charged membrane |
| DE10024576A1 (de) * | 2000-05-19 | 2001-11-22 | Univ Stuttgart | Kovalent und ionisch vernetzte Polymere und Polymermembranen |
| US6783711B2 (en) * | 2000-05-23 | 2004-08-31 | Ge Osmonics, Inc. | Process for preparing a sulfonamide polymer matrix |
| US6837996B2 (en) * | 2000-05-23 | 2005-01-04 | Ge Osmonics, Inc. | Polysulfonamide matrices |
| JP5000063B2 (ja) * | 2000-05-23 | 2012-08-15 | ジーイー・オズモニクス・インコーポレイテッド | 修飾スルホンアミドポリマー |
| CN1289173C (zh) * | 2000-05-23 | 2006-12-13 | Ge奥斯莫尼克斯公司 | 用于纳米过滤的酸稳定膜 |
| AUPR143400A0 (en) * | 2000-11-13 | 2000-12-07 | Usf Filtration And Separations Group Inc. | Modified membranes |
| AUPR421501A0 (en) * | 2001-04-04 | 2001-05-03 | U.S. Filter Wastewater Group, Inc. | Potting method |
| AUPR584301A0 (en) | 2001-06-20 | 2001-07-12 | U.S. Filter Wastewater Group, Inc. | Membrane polymer compositions |
| AUPR692401A0 (en) | 2001-08-09 | 2001-08-30 | U.S. Filter Wastewater Group, Inc. | Method of cleaning membrane modules |
| US7247238B2 (en) | 2002-02-12 | 2007-07-24 | Siemens Water Technologies Corp. | Poly(ethylene chlorotrifluoroethylene) membranes |
| AUPS300602A0 (en) | 2002-06-18 | 2002-07-11 | U.S. Filter Wastewater Group, Inc. | Methods of minimising the effect of integrity loss in hollow fibre membrane modules |
| KR101002466B1 (ko) | 2002-10-10 | 2010-12-17 | 지멘스 워터 테크놀로지스 코포레이션 | 역세척 방법 |
| AU2002953111A0 (en) | 2002-12-05 | 2002-12-19 | U. S. Filter Wastewater Group, Inc. | Mixing chamber |
| US20040234791A1 (en) * | 2003-05-19 | 2004-11-25 | Ching Ta Yen | Polypropylene-graft-acrylic acid or polypropylene-graft-maleic anhydride in oxygen scavenging tie layers |
| AU2004253197B2 (en) * | 2003-07-08 | 2010-05-27 | Evoqua Water Technologies Llc | Membrane post treatment |
| AU2003903507A0 (en) | 2003-07-08 | 2003-07-24 | U. S. Filter Wastewater Group, Inc. | Membrane post-treatment |
| JP4611982B2 (ja) * | 2003-08-29 | 2011-01-12 | シーメンス・ウォーター・テクノロジーズ・コーポレーション | 逆洗方法 |
| US8808540B2 (en) * | 2003-11-14 | 2014-08-19 | Evoqua Water Technologies Llc | Module cleaning method |
| US8758621B2 (en) * | 2004-03-26 | 2014-06-24 | Evoqua Water Technologies Llc | Process and apparatus for purifying impure water using microfiltration or ultrafiltration in combination with reverse osmosis |
| EP2380854A3 (en) * | 2004-04-22 | 2012-07-04 | Siemens Industry, Inc. | Filtration apparatus comprising a membrane bioreactor and a treatment vessel for digesting organic materials |
| EP1773476A4 (en) | 2004-07-02 | 2007-07-25 | Siemens Water Tech Corp | GAS TRANSFER MEMBRANE |
| CA2571502A1 (en) | 2004-07-05 | 2006-01-12 | U.S. Filter Wastewater Group, Inc. | Hydrophilic membranes |
| CN101052457B (zh) | 2004-08-20 | 2012-07-04 | 西门子工业公司 | 正方形mbr歧管系统 |
| US8790515B2 (en) | 2004-09-07 | 2014-07-29 | Evoqua Water Technologies Llc | Reduction of backwash liquid waste |
| WO2006029456A1 (en) * | 2004-09-14 | 2006-03-23 | Siemens Water Technologies Corp. | Methods and apparatus for removing solids from a membrane module |
| NZ553771A (en) | 2004-09-15 | 2010-11-26 | Siemens Water Tech Corp | Continuously variable aeration of membrane filtration system and flow control device when used in such application |
| US7591950B2 (en) | 2004-11-02 | 2009-09-22 | Siemens Water Technologies Corp. | Submerged cross-flow filtration |
| EP1827664B1 (en) | 2004-12-03 | 2011-06-08 | Siemens Industry, Inc. | Membrane post treatment |
| NZ555856A (en) * | 2004-12-24 | 2010-03-26 | Siemens Water Tech Corp | Cleaning in membrane filtration systems |
| EP1838422A4 (en) * | 2004-12-24 | 2009-09-02 | Siemens Water Tech Corp | EASY GAS FLUSHING PROCESS AND APPROPRIATE DEVICE |
| CN101184548B (zh) | 2005-04-29 | 2011-10-05 | 西门子水技术公司 | 用于膜滤器的化学清洗剂 |
| CA2614498A1 (en) | 2005-07-14 | 2007-01-18 | Siemens Water Technologies Corp. | Monopersulfate treatment of membranes |
| US8092918B2 (en) * | 2005-08-16 | 2012-01-10 | Ge Osmonics, Inc. | Polyamide matrices and methods for their preparation and use |
| US7909179B2 (en) * | 2005-08-16 | 2011-03-22 | Ge Osmonics, Inc. | Modified polyamide matrices and methods for their preparation |
| SG140229A1 (en) | 2005-08-22 | 2008-03-28 | Siemens Water Tech Corp | An assembly for water filtration using a tube manifold to minimise backwash |
| US8038887B2 (en) * | 2005-08-24 | 2011-10-18 | Lawrence Livermore National Security, Llc | Membranes for nanometer-scale mass fast transport |
| WO2007044415A2 (en) | 2005-10-05 | 2007-04-19 | Siemens Water Technologies Corp. | Method and apparatus for treating wastewater |
| US7563363B2 (en) | 2005-10-05 | 2009-07-21 | Siemens Water Technologies Corp. | System for treating wastewater |
| NZ568167A (en) * | 2005-12-09 | 2010-04-30 | Siemens Water Tech Corp | Reduced backwash volume process |
| US20090001018A1 (en) * | 2006-01-12 | 2009-01-01 | Fufang Zha | Operating Strategies in Filtration Processes |
| US7455765B2 (en) | 2006-01-25 | 2008-11-25 | Siemens Water Technologies Corp. | Wastewater treatment system and method |
| MY145939A (en) * | 2006-07-14 | 2012-05-31 | Siemens Industry Inc | Improved monopersulfate treatment of membranes |
| WO2008025077A1 (en) * | 2006-08-31 | 2008-03-06 | Siemens Water Technologies Corp. | Low pressure backwash |
| WO2008051546A2 (en) * | 2006-10-24 | 2008-05-02 | Siemens Water Technologies Corp. | Infiltration/inflow control for membrane bioreactor |
| US20080135481A1 (en) * | 2006-12-06 | 2008-06-12 | General Electric Company | Polyarylethernitrile hollow fiber membranes |
| US20110168631A1 (en) * | 2006-12-15 | 2011-07-14 | General Electric Company | Methods and apparatuses for water filtration using polyarylether membranes |
| US7669720B2 (en) * | 2006-12-15 | 2010-03-02 | General Electric Company | Functional polyarylethers |
| US7681741B2 (en) * | 2006-12-15 | 2010-03-23 | General Electric Company | Functional polyarylethers |
| US7977451B2 (en) * | 2006-12-15 | 2011-07-12 | General Electric Company | Polyarylether membranes |
| AU2008215180A1 (en) * | 2007-02-16 | 2008-08-21 | Siemens Industry, Inc. | Membrane filtration process and design |
| CA2682707C (en) | 2007-04-02 | 2014-07-15 | Siemens Water Technologies Corp. | Improved infiltration/inflow control for membrane bioreactor |
| NZ579779A (en) * | 2007-04-04 | 2012-10-26 | Siemens Industry Inc | Filtration system including fine apertured screen |
| US9764288B2 (en) | 2007-04-04 | 2017-09-19 | Evoqua Water Technologies Llc | Membrane module protection |
| CA2686937A1 (en) * | 2007-05-29 | 2008-12-04 | Siemens Water Technologies Corp. | Membrane cleaning using an airlift pump |
| KR101625172B1 (ko) | 2007-05-29 | 2016-05-27 | 에보쿠아 워터 테크놀로지스 엘엘씨 | 수처리 시스템 |
| EP2158026A4 (en) * | 2007-06-28 | 2011-06-29 | Siemens Industry Inc | CLEANING PROCEDURE FOR SIMPLE FILTRATION SYSTEMS |
| US8940173B2 (en) * | 2008-05-29 | 2015-01-27 | Lawrence Livermore National Security, Llc | Membranes with functionalized carbon nanotube pores for selective transport |
| EP2331242B1 (en) | 2008-07-24 | 2018-09-05 | Evoqua Water Technologies LLC | Frame system for membrane filtration modules |
| EP2313172A4 (en) * | 2008-08-14 | 2013-03-13 | Siemens Industry Inc | BLOCK CONFIGURATION FOR DISTILLATION ON LARGE SCALE MEMBRANE |
| EP2315625B1 (en) * | 2008-08-20 | 2018-05-16 | Evoqua Water Technologies LLC | Improved membrane system backwash energy efficiency |
| WO2010141560A1 (en) * | 2009-06-02 | 2010-12-09 | Siemens Water Technologies Corp. | Membrane cleaning with pulsed gas slugs and global aeration |
| WO2010142673A1 (en) | 2009-06-11 | 2010-12-16 | Siemens Water Technologies Corp. | Methods for cleaning a porous polymeric membrane and a kit for cleaning a porous polymeric membrane |
| US20110049055A1 (en) * | 2009-08-31 | 2011-03-03 | General Electric Company | Reverse osmosis composite membranes for boron removal |
| WO2011079062A1 (en) * | 2009-12-21 | 2011-06-30 | Siemens Industry, Inc. | Charged porous polymeric membranes and their preparation |
| HUE045642T2 (hu) | 2010-04-30 | 2020-01-28 | Evoqua Water Tech Llc | Folyadékáramlás elosztó készülék |
| WO2012040412A1 (en) | 2010-09-24 | 2012-03-29 | Siemens Industry, Inc. | Fluid control manifold for membrane filtration system |
| CA2850522C (en) | 2011-09-30 | 2021-03-16 | Evoqua Water Technologies Llc | Shut-off valve for isolation of hollow fiber membrane filtration module |
| AU2013200833B2 (en) | 2011-09-30 | 2015-09-17 | Evoqua Water Technologies Llc | Improved manifold arrangement |
| KR102108593B1 (ko) | 2012-06-28 | 2020-05-29 | 에보쿠아 워터 테크놀로지스 엘엘씨 | 포팅 방법 |
| CN104684632A (zh) | 2012-09-14 | 2015-06-03 | 伊沃夸水处理技术有限责任公司 | 用于膜的聚合物共混物 |
| US9962865B2 (en) | 2012-09-26 | 2018-05-08 | Evoqua Water Technologies Llc | Membrane potting methods |
| DE112013004713T5 (de) | 2012-09-26 | 2015-07-23 | Evoqua Water Technologies Llc | Membransicherungsvorrichtung |
| EP2900356A1 (en) | 2012-09-27 | 2015-08-05 | Evoqua Water Technologies LLC | Gas scouring apparatus for immersed membranes |
| HUE061765T2 (hu) | 2013-10-02 | 2023-08-28 | Rohm & Haas Electronic Mat Singapore Pte Ltd | Berendezés membrán filtrációs modul javítására |
| US11439708B2 (en) | 2014-10-06 | 2022-09-13 | Lawrence Livermore National Security, Llc | Nanotube trans-membrane channels mimicking biological porins |
| CN107847869B (zh) | 2015-07-14 | 2021-09-10 | 罗门哈斯电子材料新加坡私人有限公司 | 用于过滤系统的通气装置 |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3227510A (en) * | 1958-03-04 | 1966-01-04 | Tee Pak Inc | Dyeing substrates ionically binding in localized areas catalysts for the predyeing olefin polymerization thereon |
| US3083118A (en) * | 1958-03-04 | 1963-03-26 | Tee Pak Inc | Method of depositing a polymer of olefinically unsaturated monomer within a polymeric material and the resulting product |
| US3133137A (en) * | 1960-11-29 | 1964-05-12 | Univ California | High flow porous membranes for separating water from saline solutions |
| NL271831A (enExample) * | 1960-11-29 | |||
| US3619101A (en) * | 1961-10-05 | 1971-11-09 | Oreal | Coloring live human hair with water-soluble colored polymers |
| US3471458A (en) * | 1966-12-16 | 1969-10-07 | Chevron Res | Polyimides of olefin-maleic anhydride copolymers as diesel fuel additives |
| US3494979A (en) * | 1967-11-09 | 1970-02-10 | Sinclair Research Inc | Thermosetting styrene-maleimide copolymers having n-2,3-epoxypropyl or n-aminoethyl groups,their preparation and coating compositions containing same |
| US3647086A (en) * | 1969-07-09 | 1972-03-07 | Tokuyama Soda Kk | Cation exchange membrane and method of making same |
| GB1319236A (en) * | 1969-09-08 | 1973-06-06 | Atomic Energy Authority Uk | Desalination |
| UST888010I4 (en) * | 1970-11-18 | 1971-07-20 | Defensive publication | |
| FR2173198B1 (enExample) * | 1972-02-22 | 1976-05-14 | Kanebo Ltd | |
| US4039440A (en) * | 1972-09-19 | 1977-08-02 | The United States Of America As Represented By The Secretary Of The Interior | Reverse osmosis membrane |
| DE2364675C2 (de) * | 1972-12-29 | 1983-06-23 | Kuraray Co., Ltd., Kurashiki, Okayama | Aus einer Polymerenhauptkette und Polymerenseitenketten bestehendes Copolymeres und seine Verwendung zur Herstellung von Gegenständen für biomedizinische Zwecke |
| JPS5331105B2 (enExample) * | 1973-03-27 | 1978-08-31 | ||
| DE2437395C3 (de) * | 1973-10-15 | 1979-02-08 | E.I. Du Pont De Nemours And Co., Wilmington, Del. (V.St.A.) | Folie aus fluorhaltigen Polymeren mit Sulfonylgruppen enthaltenden Seitenketten |
| US4085090A (en) * | 1974-05-31 | 1978-04-18 | Teijin Limited | Aromatic polymers containing a nitrogen-containing ring group, and process for preparation thereof |
| CH616694A5 (en) * | 1974-06-27 | 1980-04-15 | Ciba Geigy Ag | Process for the preparation of crosslinked, water-insoluble, hydrophilic copolymers |
| US3951815A (en) * | 1974-09-05 | 1976-04-20 | Universal Oil Products Company | Composite semipermeable membranes made from polyethylenimine |
| US4005012A (en) * | 1975-09-22 | 1977-01-25 | The United States Of America As Represented By The Secretary Of The Interior | Semipermeable membranes and the method for the preparation thereof |
| JPS5856378B2 (ja) * | 1976-09-08 | 1983-12-14 | 旭化成株式会社 | アクリロニトリル系重合体乾燥膜およびその製造法 |
-
1978
- 1978-09-06 JP JP10847278A patent/JPS5535910A/ja active Granted
-
1979
- 1979-09-04 US US06/072,044 patent/US4302336A/en not_active Expired - Lifetime
- 1979-09-05 CA CA000335070A patent/CA1145208A/en not_active Expired
- 1979-09-05 EP EP79301830A patent/EP0008945A3/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| EP0008945A3 (en) | 1980-08-06 |
| JPS5535910A (en) | 1980-03-13 |
| EP0008945A2 (en) | 1980-03-19 |
| JPS6111642B2 (enExample) | 1986-04-04 |
| US4302336A (en) | 1981-11-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1145208A (en) | Semipermeable composite membrane | |
| EP0010425B1 (en) | Semipermeable composite membrane and the preparation thereof | |
| CA1120795A (en) | Semipermeable composite membrane and process for preparation thereof | |
| US4388189A (en) | Process for preparation of improved semipermeable composite membranes | |
| US4360434A (en) | Amphoteric ion-permeable composite membrane | |
| US4337154A (en) | Crosslinked composite semipermeable membrane | |
| US3951815A (en) | Composite semipermeable membranes made from polyethylenimine | |
| EP0056175B1 (en) | Ion-permeable composite membrane and its use in selective separation | |
| KR0183370B1 (ko) | 방향족 폴리에스테르 또는 방향족 폴리에스테르와 폴리아미드 공중합체의 활성층을 갖는 역삼투용 복합막 | |
| US5911880A (en) | Self-wetting membranes from engineering plastics | |
| US3948823A (en) | Method of making permselective interpolymer membranes | |
| CA1335063C (en) | Composite semipermeable membrane | |
| EP0022827A1 (en) | Reverse osmosis membrane | |
| JPH01130707A (ja) | ポリアミド逆浸透膜 | |
| Ahmad et al. | Preparation and characterization of co-polyamide thin film composite membrane from piperazine and 3, 5-diaminobenzoic acid | |
| US10189948B2 (en) | Isatin copolymers having intrinsic microporosity | |
| US5207908A (en) | Semi-permeable composite membrane and process for manufacturing same | |
| EP0392982B1 (en) | Solvent stable membranes | |
| Sumitomo et al. | Polyamides as barrier materials | |
| JPH0952031A (ja) | 半透膜およびその製造方法 | |
| KR0165749B1 (ko) | 폴리 m-스티렌아미드 또는 폴리 m-스티렌아미드/방향족 폴리아미드 아로이 활성층을 갖는 역삼투 복합막 | |
| US5221482A (en) | Polyparabanic acid membrane for selective separation | |
| US10752716B2 (en) | Copolymers and terpolymers based on chlorotrifluoroethylene and vinyl chloride and uses thereof | |
| JPH04110030A (ja) | 芳香族系共重合分離膜 | |
| JPS6259604B2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |