CA1120955A - Process for the production of alkylene glycols - Google Patents
Process for the production of alkylene glycolsInfo
- Publication number
- CA1120955A CA1120955A CA000335707A CA335707A CA1120955A CA 1120955 A CA1120955 A CA 1120955A CA 000335707 A CA000335707 A CA 000335707A CA 335707 A CA335707 A CA 335707A CA 1120955 A CA1120955 A CA 1120955A
- Authority
- CA
- Canada
- Prior art keywords
- process according
- reaction
- ethylene oxide
- catalyst
- glycol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 91
- -1 alkylene glycols Chemical class 0.000 title claims abstract description 35
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 10
- 239000003054 catalyst Substances 0.000 claims abstract description 63
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 57
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims abstract description 16
- 229910052750 molybdenum Inorganic materials 0.000 claims abstract description 16
- 239000011733 molybdenum Substances 0.000 claims abstract description 16
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims abstract description 14
- 229910052721 tungsten Inorganic materials 0.000 claims abstract description 13
- 239000010937 tungsten Substances 0.000 claims abstract description 13
- 238000006243 chemical reaction Methods 0.000 claims description 128
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical class OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 84
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 68
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 57
- 239000001569 carbon dioxide Substances 0.000 claims description 34
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 34
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 claims description 22
- 239000000376 reactant Substances 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 12
- VLAPMBHFAWRUQP-UHFFFAOYSA-L molybdic acid Chemical compound O[Mo](O)(=O)=O VLAPMBHFAWRUQP-UHFFFAOYSA-L 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 10
- 229910052783 alkali metal Inorganic materials 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- CMPGARWFYBADJI-UHFFFAOYSA-L tungstic acid Chemical compound O[W](O)(=O)=O CMPGARWFYBADJI-UHFFFAOYSA-L 0.000 claims description 9
- 150000003658 tungsten compounds Chemical group 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 239000005078 molybdenum compound Substances 0.000 claims description 4
- 150000002752 molybdenum compounds Chemical group 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 230000036647 reaction Effects 0.000 claims 1
- 125000002947 alkylene group Chemical group 0.000 abstract description 42
- 239000000243 solution Substances 0.000 description 45
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 43
- 239000002994 raw material Substances 0.000 description 28
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 23
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 21
- 239000002253 acid Substances 0.000 description 20
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 20
- 238000004458 analytical method Methods 0.000 description 19
- 150000007513 acids Chemical class 0.000 description 18
- 239000007789 gas Substances 0.000 description 18
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 16
- 229910052700 potassium Inorganic materials 0.000 description 16
- 239000011591 potassium Substances 0.000 description 16
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 15
- MEFBJEMVZONFCJ-UHFFFAOYSA-N molybdate Chemical compound [O-][Mo]([O-])(=O)=O MEFBJEMVZONFCJ-UHFFFAOYSA-N 0.000 description 15
- 230000035484 reaction time Effects 0.000 description 14
- 150000002334 glycols Chemical class 0.000 description 13
- 229910001873 dinitrogen Inorganic materials 0.000 description 11
- 239000003002 pH adjusting agent Substances 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- 229910052708 sodium Inorganic materials 0.000 description 9
- 229910001220 stainless steel Inorganic materials 0.000 description 9
- 239000010935 stainless steel Substances 0.000 description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 8
- 230000036571 hydration Effects 0.000 description 7
- 238000006703 hydration reaction Methods 0.000 description 7
- 150000002500 ions Chemical class 0.000 description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000011736 potassium bicarbonate Substances 0.000 description 6
- 235000015497 potassium bicarbonate Nutrition 0.000 description 6
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 6
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 6
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 5
- 239000005977 Ethylene Substances 0.000 description 5
- 150000001340 alkali metals Chemical class 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- XMVONEAAOPAGAO-UHFFFAOYSA-N sodium tungstate Chemical compound [Na+].[Na+].[O-][W]([O-])(=O)=O XMVONEAAOPAGAO-UHFFFAOYSA-N 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- LCZVSXRMYJUNFX-UHFFFAOYSA-N 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol Chemical compound CC(O)COC(C)COC(C)CO LCZVSXRMYJUNFX-UHFFFAOYSA-N 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 4
- FYKAKDPHDGCKTF-UHFFFAOYSA-N OOOOOOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOOOOOO FYKAKDPHDGCKTF-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 230000003247 decreasing effect Effects 0.000 description 4
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000011684 sodium molybdate Substances 0.000 description 4
- 235000015393 sodium molybdate Nutrition 0.000 description 4
- TVXXNOYZHKPKGW-UHFFFAOYSA-N sodium molybdate (anhydrous) Chemical compound [Na+].[Na+].[O-][Mo]([O-])(=O)=O TVXXNOYZHKPKGW-UHFFFAOYSA-N 0.000 description 4
- PBYZMCDFOULPGH-UHFFFAOYSA-N tungstate Chemical compound [O-][W]([O-])(=O)=O PBYZMCDFOULPGH-UHFFFAOYSA-N 0.000 description 4
- RBACIKXCRWGCBB-UHFFFAOYSA-N 1,2-Epoxybutane Chemical compound CCC1CO1 RBACIKXCRWGCBB-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 3
- CQGRLHBOVUGVEA-UHFFFAOYSA-N OOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOO CQGRLHBOVUGVEA-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- AAQNGTNRWPXMPB-UHFFFAOYSA-N dipotassium;dioxido(dioxo)tungsten Chemical compound [K+].[K+].[O-][W]([O-])(=O)=O AAQNGTNRWPXMPB-UHFFFAOYSA-N 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 239000003570 air Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000010419 fine particle Substances 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 150000002484 inorganic compounds Chemical class 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 150000003018 phosphorus compounds Chemical class 0.000 description 2
- 229920001515 polyalkylene glycol Polymers 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 239000004576 sand Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- ZNOKGRXACCSDPY-UHFFFAOYSA-N tungsten trioxide Chemical compound O=[W](=O)=O ZNOKGRXACCSDPY-UHFFFAOYSA-N 0.000 description 2
- DZKDPOPGYFUOGI-UHFFFAOYSA-N tungsten(iv) oxide Chemical compound O=[W]=O DZKDPOPGYFUOGI-UHFFFAOYSA-N 0.000 description 2
- OMAWWKIPXLIPDE-UHFFFAOYSA-N (ethyldiselanyl)ethane Chemical compound CC[Se][Se]CC OMAWWKIPXLIPDE-UHFFFAOYSA-N 0.000 description 1
- 229940043375 1,5-pentanediol Drugs 0.000 description 1
- QIJNJJZPYXGIQM-UHFFFAOYSA-N 1lambda4,2lambda4-dimolybdacyclopropa-1,2,3-triene Chemical compound [Mo]=C=[Mo] QIJNJJZPYXGIQM-UHFFFAOYSA-N 0.000 description 1
- GELKGHVAFRCJNA-UHFFFAOYSA-N 2,2-Dimethyloxirane Chemical compound CC1(C)CO1 GELKGHVAFRCJNA-UHFFFAOYSA-N 0.000 description 1
- PQXKWPLDPFFDJP-UHFFFAOYSA-N 2,3-dimethyloxirane Chemical compound CC1OC1C PQXKWPLDPFFDJP-UHFFFAOYSA-N 0.000 description 1
- BTVWZWFKMIUSGS-UHFFFAOYSA-N 2-methylpropane-1,2-diol Chemical compound CC(C)(O)CO BTVWZWFKMIUSGS-UHFFFAOYSA-N 0.000 description 1
- SYURNNNQIFDVCA-UHFFFAOYSA-N 2-propyloxirane Chemical compound CCCC1CO1 SYURNNNQIFDVCA-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241001072332 Monia Species 0.000 description 1
- JLNTWVDSQRNWFU-UHFFFAOYSA-N OOOOOOO Chemical compound OOOOOOO JLNTWVDSQRNWFU-UHFFFAOYSA-N 0.000 description 1
- VAZNCFOEOCSGQL-UHFFFAOYSA-N OOOOOOOOOOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOOOOOOOOOO VAZNCFOEOCSGQL-UHFFFAOYSA-N 0.000 description 1
- 235000010678 Paulownia tomentosa Nutrition 0.000 description 1
- 240000002834 Paulownia tomentosa Species 0.000 description 1
- 101100184636 Rhodobacter capsulatus modA gene Proteins 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- VYKYLQRTMKIQFY-UHFFFAOYSA-N [Mo].[K] Chemical compound [Mo].[K] VYKYLQRTMKIQFY-UHFFFAOYSA-N 0.000 description 1
- NBZANZVJRKXVBH-GYDPHNCVSA-N alpha-Cryptoxanthin Natural products O[C@H]1CC(C)(C)C(/C=C/C(=C\C=C\C(=C/C=C/C=C(\C=C\C=C(/C=C/[C@H]2C(C)=CCCC2(C)C)\C)/C)\C)/C)=C(C)C1 NBZANZVJRKXVBH-GYDPHNCVSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- APUPEJJSWDHEBO-UHFFFAOYSA-P ammonium molybdate Chemical compound [NH4+].[NH4+].[O-][Mo]([O-])(=O)=O APUPEJJSWDHEBO-UHFFFAOYSA-P 0.000 description 1
- 239000011609 ammonium molybdate Substances 0.000 description 1
- 235000018660 ammonium molybdate Nutrition 0.000 description 1
- 229940010552 ammonium molybdate Drugs 0.000 description 1
- YVBOZGOAVJZITM-UHFFFAOYSA-P ammonium phosphomolybdate Chemical compound [NH4+].[NH4+].[NH4+].[NH4+].[O-]P([O-])=O.[O-][Mo]([O-])(=O)=O YVBOZGOAVJZITM-UHFFFAOYSA-P 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- RCMWGBKVFBTLCW-UHFFFAOYSA-N barium(2+);dioxido(dioxo)molybdenum Chemical compound [Ba+2].[O-][Mo]([O-])(=O)=O RCMWGBKVFBTLCW-UHFFFAOYSA-N 0.000 description 1
- SJPVUFMOBDBTHQ-UHFFFAOYSA-N barium(2+);dioxido(dioxo)tungsten Chemical compound [Ba+2].[O-][W]([O-])(=O)=O SJPVUFMOBDBTHQ-UHFFFAOYSA-N 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- BMRWNKZVCUKKSR-UHFFFAOYSA-N butane-1,2-diol Chemical compound CCC(O)CO BMRWNKZVCUKKSR-UHFFFAOYSA-N 0.000 description 1
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- BIOOACNPATUQFW-UHFFFAOYSA-N calcium;dioxido(dioxo)molybdenum Chemical compound [Ca+2].[O-][Mo]([O-])(=O)=O BIOOACNPATUQFW-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- OQFRENMCLHGPRB-UHFFFAOYSA-N copper;dioxido(dioxo)tungsten Chemical compound [Cu+2].[O-][W]([O-])(=O)=O OQFRENMCLHGPRB-UHFFFAOYSA-N 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- XAYGUHUYDMLJJV-UHFFFAOYSA-Z decaazanium;dioxido(dioxo)tungsten;hydron;trioxotungsten Chemical compound [H+].[H+].[NH4+].[NH4+].[NH4+].[NH4+].[NH4+].[NH4+].[NH4+].[NH4+].[NH4+].[NH4+].O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.[O-][W]([O-])(=O)=O.[O-][W]([O-])(=O)=O.[O-][W]([O-])(=O)=O.[O-][W]([O-])(=O)=O.[O-][W]([O-])(=O)=O.[O-][W]([O-])(=O)=O XAYGUHUYDMLJJV-UHFFFAOYSA-Z 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- LSALTGRCOGBBFR-UHFFFAOYSA-L dibromotungsten Chemical compound Br[W]Br LSALTGRCOGBBFR-UHFFFAOYSA-L 0.000 description 1
- ZFTFAPZRGNKQPU-UHFFFAOYSA-N dicarbonic acid Chemical compound OC(=O)OC(O)=O ZFTFAPZRGNKQPU-UHFFFAOYSA-N 0.000 description 1
- UDJQAOMQLIIJIE-UHFFFAOYSA-L dichlorotungsten Chemical compound Cl[W]Cl UDJQAOMQLIIJIE-UHFFFAOYSA-L 0.000 description 1
- XJUNRGGMKUAPAP-UHFFFAOYSA-N dioxido(dioxo)molybdenum;lead(2+) Chemical compound [Pb+2].[O-][Mo]([O-])(=O)=O XJUNRGGMKUAPAP-UHFFFAOYSA-N 0.000 description 1
- NKTZYSOLHFIEMF-UHFFFAOYSA-N dioxido(dioxo)tungsten;lead(2+) Chemical compound [Pb+2].[O-][W]([O-])(=O)=O NKTZYSOLHFIEMF-UHFFFAOYSA-N 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- CEALXSHFPPCRNM-UHFFFAOYSA-L disodium;carboxylato carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OC([O-])=O CEALXSHFPPCRNM-UHFFFAOYSA-L 0.000 description 1
- MTVMXNTVZNCVTH-UHFFFAOYSA-N ethane-1,2-diol;2-(2-hydroxyethoxy)ethanol Chemical compound OCCO.OCCOCCO MTVMXNTVZNCVTH-UHFFFAOYSA-N 0.000 description 1
- 239000013505 freshwater Substances 0.000 description 1
- 239000007792 gaseous phase Substances 0.000 description 1
- 230000000887 hydrating effect Effects 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 1
- 229910052808 lithium carbonate Inorganic materials 0.000 description 1
- NMHMDUCCVHOJQI-UHFFFAOYSA-N lithium molybdate Chemical compound [Li+].[Li+].[O-][Mo]([O-])(=O)=O NMHMDUCCVHOJQI-UHFFFAOYSA-N 0.000 description 1
- DJZHPOJZOWHJPP-UHFFFAOYSA-N magnesium;dioxido(dioxo)tungsten Chemical compound [Mg+2].[O-][W]([O-])(=O)=O DJZHPOJZOWHJPP-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- CWQXQMHSOZUFJS-UHFFFAOYSA-N molybdenum disulfide Chemical compound S=[Mo]=S CWQXQMHSOZUFJS-UHFFFAOYSA-N 0.000 description 1
- 229910052982 molybdenum disulfide Inorganic materials 0.000 description 1
- GICWIDZXWJGTCI-UHFFFAOYSA-I molybdenum pentachloride Chemical compound Cl[Mo](Cl)(Cl)(Cl)Cl GICWIDZXWJGTCI-UHFFFAOYSA-I 0.000 description 1
- ZSSVQAGPXAAOPV-UHFFFAOYSA-K molybdenum trichloride Chemical compound Cl[Mo](Cl)Cl ZSSVQAGPXAAOPV-UHFFFAOYSA-K 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 238000010979 pH adjustment Methods 0.000 description 1
- WCVRQHFDJLLWFE-UHFFFAOYSA-N pentane-1,2-diol Chemical compound CCCC(O)CO WCVRQHFDJLLWFE-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 150000004714 phosphonium salts Chemical group 0.000 description 1
- DHRLEVQXOMLTIM-UHFFFAOYSA-N phosphoric acid;trioxomolybdenum Chemical compound O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.OP(O)(O)=O DHRLEVQXOMLTIM-UHFFFAOYSA-N 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- APSBXTVYXVQYAB-UHFFFAOYSA-M sodium docusate Chemical compound [Na+].CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC APSBXTVYXVQYAB-UHFFFAOYSA-M 0.000 description 1
- 150000004763 sulfides Chemical class 0.000 description 1
- UWHCKJMYHZGTIT-UHFFFAOYSA-N tetraethylene glycol Chemical compound OCCOCCOCCOCCO UWHCKJMYHZGTIT-UHFFFAOYSA-N 0.000 description 1
- YPFBRNLUIFQCQL-UHFFFAOYSA-K tribromomolybdenum Chemical compound Br[Mo](Br)Br YPFBRNLUIFQCQL-UHFFFAOYSA-K 0.000 description 1
- UXVOMHPBSSIGNQ-UHFFFAOYSA-I tungsten(v) bromide Chemical compound Br[W](Br)(Br)(Br)Br UXVOMHPBSSIGNQ-UHFFFAOYSA-I 0.000 description 1
- WIDQNNDDTXUPAN-UHFFFAOYSA-I tungsten(v) chloride Chemical compound Cl[W](Cl)(Cl)(Cl)Cl WIDQNNDDTXUPAN-UHFFFAOYSA-I 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/09—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by hydrolysis
- C07C29/10—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by hydrolysis of ethers, including cyclic ethers, e.g. oxiranes
- C07C29/103—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by hydrolysis of ethers, including cyclic ethers, e.g. oxiranes of cyclic ethers
- C07C29/106—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by hydrolysis of ethers, including cyclic ethers, e.g. oxiranes of cyclic ethers of oxiranes
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/52—Improvements relating to the production of bulk chemicals using catalysts, e.g. selective catalysts
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/278,824 US4452648A (en) | 1979-09-14 | 1981-06-29 | Low in reactor creep ZR-base alloy tubes |
Applications Claiming Priority (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8593579A JPS5612323A (en) | 1979-07-09 | 1979-07-09 | Preparation of ethylene glycol |
| JP85935/1979 | 1979-07-09 | ||
| JP8751079A JPS5612324A (en) | 1979-07-12 | 1979-07-12 | Preparation of ethylene glycol |
| JP87510/1979 | 1979-07-12 | ||
| JP91695/1979 | 1979-07-20 | ||
| JP9169579A JPS5616431A (en) | 1979-07-20 | 1979-07-20 | Preparation of alkylene glycol |
| JP93218/1979 | 1979-07-24 | ||
| JP9321879A JPS5618930A (en) | 1979-07-24 | 1979-07-24 | Production of alkylene glycol |
| JP9615579A JPS5620529A (en) | 1979-07-30 | 1979-07-30 | Preparation of alkylene glycol |
| JP96155/1979 | 1979-07-30 | ||
| JP97377/1979 | 1979-08-01 | ||
| JP9737779A JPS5622738A (en) | 1979-08-01 | 1979-08-01 | Preparation of alkylene glycol |
| JP99471/1979 | 1979-08-06 | ||
| JP9947179A JPS5625125A (en) | 1979-08-06 | 1979-08-06 | Preparation of alkylene glycol |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1120955A true CA1120955A (en) | 1982-03-30 |
Family
ID=27565417
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000335707A Expired CA1120955A (en) | 1979-07-09 | 1979-09-14 | Process for the production of alkylene glycols |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4277632A (OSRAM) |
| BE (1) | BE878902A (OSRAM) |
| CA (1) | CA1120955A (OSRAM) |
| DE (1) | DE2938115A1 (OSRAM) |
| FR (1) | FR2460906A1 (OSRAM) |
| GB (1) | GB2053190B (OSRAM) |
| NL (1) | NL7907002A (OSRAM) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4423005A (en) * | 1981-09-25 | 1983-12-27 | Baxter Travenol Laboratories, Inc. | Determining quantitative degree of ethylene oxide exposure in sterilization processes |
| US4551566A (en) * | 1982-09-30 | 1985-11-05 | Union Carbide Corporation | Process for the production of alkylene glycols |
| US4560813A (en) * | 1984-03-28 | 1985-12-24 | Union Carbide Corporation | Processes for the production of alkylene glycol in the presence of organometalate |
| EP0158396A1 (en) * | 1984-03-28 | 1985-10-16 | Union Carbide Corporation | Continuous process for the production of alkylene glycol in the presence of organometalate |
| AU580300B2 (en) * | 1984-03-28 | 1989-01-12 | Union Carbide Corporation | Alcoholates of metalate anions and glycols produced from them |
| US4579983A (en) * | 1984-03-28 | 1986-04-01 | Union Carbide Corporation | Process for the hydrolysis of alkylene oxides using organometalates |
| US4667045A (en) * | 1984-03-28 | 1987-05-19 | Union Carbide Corporation | Organosalts of metalate anions and process for the production of alkylene glycols therewith |
| US4982021A (en) * | 1984-03-28 | 1991-01-01 | Union Carbide Chemicals And Plastics Company Inc. | Process for the production of alkylene glycols with metalate-containing solid |
| US4571440A (en) * | 1984-03-28 | 1986-02-18 | Union Carbide Corporation | Continuous process for the production of alkylene glycol in the presence of organometalate |
| CA1314566C (en) * | 1984-03-28 | 1993-03-16 | John Howard Robson | Process for the production of alkylene glycols with metalate-containing solid |
| US4579982A (en) * | 1984-03-28 | 1986-04-01 | Union Carbide Corporation | Preparation of monoalkylene glycols using two liquid phase reaction menstruum |
| US4578524A (en) * | 1984-03-28 | 1986-03-25 | Union Carbide Corporation | Carbon dioxide-enhanced monoalkylene glycol production |
| EP0226799B1 (en) * | 1985-11-18 | 1992-01-02 | MITSUI TOATSU CHEMICALS, Inc. | Method for preparing ethylene glycol and/or propylene glycol |
| US4760200A (en) * | 1985-12-31 | 1988-07-26 | Union Carbide Corporation | Process for the production of alkylene glycols |
| CA1321383C (en) * | 1987-11-25 | 1993-08-17 | Hwaili Soo | Monoalkylene glycol production using mixed metal framework compositions |
| US5349110A (en) * | 1990-08-20 | 1994-09-20 | Texaco Chemical Company | Synthesis of low molecular weight glycol ethers from oxiranes plus olefins |
| US5250743A (en) * | 1992-12-31 | 1993-10-05 | Eastman Kodak Company | Method of intercoversion of enantiomers of acyclic 1,2-dihydroxy-3-alkenes |
| US6211419B1 (en) * | 2000-04-24 | 2001-04-03 | The Dow Chemical Company | Process for the preparation of alkylene glycols |
| CN1305820C (zh) * | 2003-09-23 | 2007-03-21 | 中国石化集团天津石油化工公司 | 环氧化合物催化水合生产二元醇的工艺方法 |
| ATE420721T1 (de) * | 2004-08-05 | 2009-01-15 | Saudi Basic Ind Corp | Verfahren mit einem mit katalysator beschichteten wärmetauscher |
| US7491856B2 (en) | 2007-06-27 | 2009-02-17 | H R D Corporation | Method of making alkylene glycols |
| US8304584B2 (en) | 2007-06-27 | 2012-11-06 | H R D Corporation | Method of making alkylene glycols |
| EA019753B1 (ru) * | 2008-07-03 | 2014-06-30 | ЭйчАДи КОПЭРЕЙШН | Реактор, устройство и способ проведения гетерогенного катализа |
| CA2742498C (en) * | 2008-11-10 | 2018-02-27 | Dow Technology Investments Llc | Process for producing low color glycols |
| DE102009038398A1 (de) | 2009-08-24 | 2011-03-03 | Uhde Gmbh | Verfahren und Vorrichtung zur Herstellung von Alkylenoxiden und von Alkylenglykolen |
| CN114716299A (zh) * | 2022-05-10 | 2022-07-08 | 岳阳昌德新材料有限公司 | 丙二醇/二丙二醇/三丙二醇的制备方法 |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR816690A (fr) * | 1936-01-24 | 1937-08-13 | Distillers Co Yeast Ltd | Perfectionnements à la fabrication de dérivés du glycol |
| GB654764A (en) * | 1948-02-05 | 1951-06-27 | Distillers Co Yeast Ltd | Hydroxylation of olefinic compounds |
| US2623909A (en) * | 1950-07-12 | 1952-12-30 | Celanese Corp | Hydrolysis of 1, 2-propylene oxide to 1, 2-propylene glycol |
| FR1079226A (fr) * | 1952-04-28 | 1954-11-26 | Bataafsche Petroleum | Procédé de préparation de composés organiques polyhydroxy |
| US2833787A (en) * | 1955-03-15 | 1958-05-06 | Shell Dev | Epoxidation process using hydrogen peroxide and an acid salt of a heavy metal peracid |
| US2807651A (en) * | 1956-03-23 | 1957-09-24 | Dow Chemical Co | Method of preparing glycols and monoethers of glycols |
| US3629343A (en) * | 1968-10-11 | 1971-12-21 | Vnii Neftekhim Protsessov | Process for the production of alkylene glycols |
| FR2105292A5 (OSRAM) * | 1969-11-26 | 1972-04-28 | Raffinage Cie Francaise | |
| DE2141470A1 (de) * | 1971-08-19 | 1973-02-22 | Erdoelchemie Gmbh | Verfahren zur herstellung von aethylenglykol |
| DE2256907C3 (de) * | 1972-11-20 | 1982-03-18 | Henkel KGaA, 4000 Düsseldorf | Verfahren zur Herstellung von vicinalen Di- und Polyolen |
| IT971363B (it) * | 1972-11-30 | 1974-04-30 | Sir Soc Italiana Resine Spa | Procedimento per la preparazione del glicole etilenico |
| SU558898A1 (ru) * | 1973-07-16 | 1977-05-25 | Предприятие П/Я В-8585 | Способ получени -гликолей |
| US4014945A (en) * | 1975-08-28 | 1977-03-29 | Standard Oil Company | Process for the preparation of ethylene glycol |
| US4160116A (en) * | 1978-08-28 | 1979-07-03 | Showa Denko K.K. | Process for the production of alkylene glycols |
| JPS6045610B2 (ja) * | 1978-03-20 | 1985-10-11 | 株式会社日本触媒 | エチレングリコ−ルの製造方法 |
| JPS6045611B2 (ja) * | 1978-03-24 | 1985-10-11 | 株式会社日本触媒 | エチレングリコ−ルの製造方法 |
-
1979
- 1979-09-14 CA CA000335707A patent/CA1120955A/en not_active Expired
- 1979-09-19 US US06/076,842 patent/US4277632A/en not_active Expired - Lifetime
- 1979-09-20 NL NL7907002A patent/NL7907002A/nl not_active Application Discontinuation
- 1979-09-20 GB GB7932592A patent/GB2053190B/en not_active Expired
- 1979-09-20 BE BE0/197238A patent/BE878902A/fr not_active IP Right Cessation
- 1979-09-20 DE DE19792938115 patent/DE2938115A1/de active Granted
- 1979-09-21 FR FR7923642A patent/FR2460906A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4277632A (en) | 1981-07-07 |
| FR2460906A1 (fr) | 1981-01-30 |
| BE878902A (fr) | 1980-01-16 |
| FR2460906B1 (OSRAM) | 1984-05-18 |
| GB2053190B (en) | 1983-09-21 |
| GB2053190A (en) | 1981-02-04 |
| DE2938115A1 (de) | 1981-01-29 |
| DE2938115C2 (OSRAM) | 1990-04-05 |
| NL7907002A (nl) | 1981-01-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1120955A (en) | Process for the production of alkylene glycols | |
| CA1121389A (en) | Process for the production of alkylene glycols | |
| US5064804A (en) | Mixed metal framework compositions for monoalkylene glycol production | |
| US6608231B1 (en) | Double-metal cyanide catalysts for producing polyether polyols | |
| US6028119A (en) | Process for methanol production | |
| US20100274041A1 (en) | Method for preparing a carbamate, a catalyst applied in the method, a method for preparing the catalyst and use thereof | |
| AU1032097A (en) | Process for the preparation of alkylene glycols | |
| US5403949A (en) | Method of producing carbonic acid diester | |
| US5247103A (en) | Processes for the preparation of cyclic ethers | |
| US6528616B1 (en) | Double metal cyanide catalysts for the production of polyther polyols | |
| KR101810328B1 (ko) | 프로필렌 직접산화 반응용 촉매, 이의 제조방법 및 이를 이용한 프로필렌 직접산화 반응에 의한 프로필렌 옥사이드 제조방법 | |
| US4234748A (en) | Process for the hydration of olefins employing slurried catalyst | |
| KR20010079829A (ko) | 폴리에테르 폴리올 제조용의 이중 금속 시안화물 촉매 | |
| CA2051593A1 (en) | Process for the preparation of cyclic ethers | |
| KR100693850B1 (ko) | 디알킬 카르보네이트와 알칸디올을 동시에 제조하는 방법 | |
| US9518035B2 (en) | Method for preparing glycidol using glycerol and glycidol obtained thereby | |
| JPS6118535B2 (OSRAM) | ||
| GB2056983A (en) | Preparation of alkylene carbonates from olefins | |
| JPS6118529B2 (OSRAM) | ||
| KR101996947B1 (ko) | 프로필렌 직접산화반응 촉매용 지지체 및 이를 포함하는 프로필렌 직접산화 반응용 촉매 | |
| JP2000061304A (ja) | アルコキシル化用触媒とその製造方法、およびこの触媒を用いるアルキレンオキサイド付加物の製造方法 | |
| JPS6118531B2 (OSRAM) | ||
| JPS6118530B2 (OSRAM) | ||
| CN116237066B (zh) | 一种固体强酸催化剂及用其催化合成2,2-二(2-呋喃基)丙烷的方法 | |
| JPS6118532B2 (OSRAM) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |