CA1114818A - 1,5-benzothiazepine compounds and process for preparing the same - Google Patents
1,5-benzothiazepine compounds and process for preparing the sameInfo
- Publication number
- CA1114818A CA1114818A CA321,396A CA321396A CA1114818A CA 1114818 A CA1114818 A CA 1114818A CA 321396 A CA321396 A CA 321396A CA 1114818 A CA1114818 A CA 1114818A
- Authority
- CA
- Canada
- Prior art keywords
- compound
- general formula
- group
- whenever prepared
- hours
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- KJFRSZASZNLCDF-UHFFFAOYSA-N 1,5-benzothiazepine Chemical class S1C=CC=NC2=CC=CC=C12 KJFRSZASZNLCDF-UHFFFAOYSA-N 0.000 title claims abstract description 6
- 238000004519 manufacturing process Methods 0.000 title abstract description 3
- 239000002253 acid Substances 0.000 claims abstract description 14
- 150000003839 salts Chemical class 0.000 claims abstract description 14
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 10
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims abstract description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 8
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims abstract description 5
- 125000005843 halogen group Chemical group 0.000 claims abstract description 4
- 150000001875 compounds Chemical class 0.000 claims description 72
- 238000000034 method Methods 0.000 claims description 46
- 239000000203 mixture Substances 0.000 claims description 44
- -1 piperazine compound Chemical class 0.000 claims description 42
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 18
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 16
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 15
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 10
- 239000012280 lithium aluminium hydride Substances 0.000 claims description 9
- 239000003960 organic solvent Substances 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 8
- 239000003054 catalyst Substances 0.000 claims description 7
- 238000010438 heat treatment Methods 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 claims description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 6
- 239000012320 chlorinating reagent Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 5
- 150000003512 tertiary amines Chemical class 0.000 claims description 5
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 claims description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical class [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical class ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 claims description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 3
- 239000011575 calcium Substances 0.000 claims description 3
- 229910052791 calcium Inorganic materials 0.000 claims description 3
- 239000003638 chemical reducing agent Substances 0.000 claims description 3
- YGOYABDTPZVXLE-XLIONFOSSA-N (2r,3s)-3-[(4-methylpiperazin-1-yl)methyl]-2-phenyl-3,5-dihydro-2h-1,5-benzothiazepin-4-one Chemical compound C1CN(C)CCN1C[C@H]1C(=O)NC2=CC=CC=C2S[C@H]1C1=CC=CC=C1 YGOYABDTPZVXLE-XLIONFOSSA-N 0.000 claims description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N diethylenediamine Natural products C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 2
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 3
- 229910052794 bromium Inorganic materials 0.000 claims 3
- MPJKSKODEKFTLO-UHFFFAOYSA-N 3-(chloromethyl)-2-phenyl-3,5-dihydro-2h-1,5-benzothiazepin-4-one Chemical compound S1C2=CC=CC=C2NC(=O)C(CCl)C1C1=CC=CC=C1 MPJKSKODEKFTLO-UHFFFAOYSA-N 0.000 claims 2
- 229940086542 triethylamine Drugs 0.000 claims 2
- 125000004429 atom Chemical group 0.000 claims 1
- 230000000767 anti-ulcer Effects 0.000 abstract description 7
- 230000002401 inhibitory effect Effects 0.000 abstract description 6
- 125000003545 alkoxy group Chemical group 0.000 abstract description 4
- 230000001078 anti-cholinergic effect Effects 0.000 abstract description 4
- 239000000812 cholinergic antagonist Substances 0.000 abstract description 4
- 230000002496 gastric effect Effects 0.000 abstract description 4
- 230000028327 secretion Effects 0.000 abstract description 4
- 241000124008 Mammalia Species 0.000 abstract 1
- 229940124575 antispasmodic agent Drugs 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 48
- 238000002844 melting Methods 0.000 description 33
- 230000008018 melting Effects 0.000 description 33
- 238000004458 analytical method Methods 0.000 description 29
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 26
- 239000013078 crystal Substances 0.000 description 25
- 229910001868 water Inorganic materials 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- 239000000243 solution Substances 0.000 description 19
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 238000001914 filtration Methods 0.000 description 15
- 230000000694 effects Effects 0.000 description 14
- 238000000354 decomposition reaction Methods 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 239000003208 petroleum Substances 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- VRVRGVPWCUEOGV-UHFFFAOYSA-N 2-aminothiophenol Chemical compound NC1=CC=CC=C1S VRVRGVPWCUEOGV-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- BHKULYKFSYZBQR-UHFFFAOYSA-M 2-ethoxycarbonyl-3-phenylprop-2-enoate Chemical compound CCOC(=O)C(C([O-])=O)=CC1=CC=CC=C1 BHKULYKFSYZBQR-UHFFFAOYSA-M 0.000 description 6
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 6
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 6
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 241000699670 Mus sp. Species 0.000 description 5
- 230000007935 neutral effect Effects 0.000 description 5
- 238000007920 subcutaneous administration Methods 0.000 description 5
- 239000012065 filter cake Substances 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- 229940126062 Compound A Drugs 0.000 description 3
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 3
- FEWJPZIEWOKRBE-XIXRPRMCSA-N Mesotartaric acid Chemical compound OC(=O)[C@@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-XIXRPRMCSA-N 0.000 description 3
- 229940121948 Muscarinic receptor antagonist Drugs 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- ZVQOOHYFBIDMTQ-UHFFFAOYSA-N [methyl(oxido){1-[6-(trifluoromethyl)pyridin-3-yl]ethyl}-lambda(6)-sulfanylidene]cyanamide Chemical compound N#CN=S(C)(=O)C(C)C1=CC=C(C(F)(F)F)N=C1 ZVQOOHYFBIDMTQ-UHFFFAOYSA-N 0.000 description 3
- 230000007059 acute toxicity Effects 0.000 description 3
- 231100000403 acute toxicity Toxicity 0.000 description 3
- WPUJEWVVTKLMQI-UHFFFAOYSA-N benzene;ethoxyethane Chemical compound CCOCC.C1=CC=CC=C1 WPUJEWVVTKLMQI-UHFFFAOYSA-N 0.000 description 3
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 229940102396 methyl bromide Drugs 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 229940093956 potassium carbonate Drugs 0.000 description 3
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 208000025865 Ulcer Diseases 0.000 description 2
- 229960001138 acetylsalicylic acid Drugs 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- OQNGCCWBHLEQFN-UHFFFAOYSA-N chloroform;hexane Chemical compound ClC(Cl)Cl.CCCCCC OQNGCCWBHLEQFN-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- ZYBWTEQKHIADDQ-UHFFFAOYSA-N ethanol;methanol Chemical compound OC.CCO ZYBWTEQKHIADDQ-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N n,n-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 231100000397 ulcer Toxicity 0.000 description 2
- ZHEALSTTYMGZCL-UHFFFAOYSA-N (4-oxo-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepin-3-yl)methyl methanesulfonate Chemical compound S1C2=CC=CC=C2NC(=O)C(COS(=O)(=O)C)C1C1=CC=CC=C1 ZHEALSTTYMGZCL-UHFFFAOYSA-N 0.000 description 1
- BLZDDGUSERBWSA-UHFFFAOYSA-N (4-oxo-2-phenyl-3,5-dihydro-2h-1,5-benzothiazepin-3-yl)methyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCC1C(=O)NC2=CC=CC=C2SC1C1=CC=CC=C1 BLZDDGUSERBWSA-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- RNILRXPHLDRKQU-UHFFFAOYSA-N 1-bromobutane hydrate Chemical compound O.CCCCBr RNILRXPHLDRKQU-UHFFFAOYSA-N 0.000 description 1
- HTGCVLNFLVVCST-UHFFFAOYSA-N 1-piperazin-1-ylethanol Chemical compound CC(O)N1CCNCC1 HTGCVLNFLVVCST-UHFFFAOYSA-N 0.000 description 1
- UIKHKLFBHLPAPO-UHFFFAOYSA-N 2,3-diacetyl-2,3-dihydroxybutanedioic acid Chemical compound CC(=O)C(O)(C(O)=O)C(O)(C(C)=O)C(O)=O UIKHKLFBHLPAPO-UHFFFAOYSA-N 0.000 description 1
- VTZSNYGDHUZEHX-UHFFFAOYSA-N 2-(4-chlorophenyl)-3-(hydroxymethyl)-3,5-dihydro-2h-1,5-benzothiazepin-4-one Chemical compound S1C2=CC=CC=C2NC(=O)C(CO)C1C1=CC=C(Cl)C=C1 VTZSNYGDHUZEHX-UHFFFAOYSA-N 0.000 description 1
- KUCUZPCLQRYXRC-UHFFFAOYSA-N 2-[(4-chlorophenyl)methylidene]propanedioic acid Chemical compound OC(=O)C(C(O)=O)=CC1=CC=C(Cl)C=C1 KUCUZPCLQRYXRC-UHFFFAOYSA-N 0.000 description 1
- DTESVSJGQRBZEK-UHFFFAOYSA-N 2-[(4-methylphenyl)methylidene]propanedioic acid Chemical compound CC1=CC=C(C=C(C(O)=O)C(O)=O)C=C1 DTESVSJGQRBZEK-UHFFFAOYSA-N 0.000 description 1
- HTDLZCRRGRHIHI-UHFFFAOYSA-N 2-ethoxycarbonyl-3-(4-methoxyphenyl)prop-2-enoic acid Chemical compound CCOC(=O)C(C(O)=O)=CC1=CC=C(OC)C=C1 HTDLZCRRGRHIHI-UHFFFAOYSA-N 0.000 description 1
- VGPPLDZFLZJGMB-UHFFFAOYSA-N 3-(chloromethyl)-2-(4-chlorophenyl)-3,5-dihydro-2h-1,5-benzothiazepin-4-one Chemical compound S1C2=CC=CC=C2NC(=O)C(CCl)C1C1=CC=C(Cl)C=C1 VGPPLDZFLZJGMB-UHFFFAOYSA-N 0.000 description 1
- FXYJXCZHYLIGOD-UHFFFAOYSA-N 3-(hydroxymethyl)-2-(4-methylphenyl)-3,5-dihydro-2h-1,5-benzothiazepin-4-one Chemical compound C1=CC(C)=CC=C1C1C(CO)C(=O)NC2=CC=CC=C2S1 FXYJXCZHYLIGOD-UHFFFAOYSA-N 0.000 description 1
- IFASZVAJKOMRBY-UHFFFAOYSA-N 3-(hydroxymethyl)-2-phenyl-3,5-dihydro-2h-1,5-benzothiazepin-4-one Chemical compound S1C2=CC=CC=C2NC(=O)C(CO)C1C1=CC=CC=C1 IFASZVAJKOMRBY-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- NZKZETJGNUWEPB-UHFFFAOYSA-N 5-[2-(dimethylamino)ethyl]-2-phenyl-1,5-benzothiazepin-4-one;hydrochloride Chemical compound Cl.C=1C(=O)N(CCN(C)C)C2=CC=CC=C2SC=1C1=CC=CC=C1 NZKZETJGNUWEPB-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VPNYRYCIDCJBOM-UHFFFAOYSA-M Glycopyrronium bromide Chemical compound [Br-].C1[N+](C)(C)CCC1OC(=O)C(O)(C=1C=CC=CC=1)C1CCCC1 VPNYRYCIDCJBOM-UHFFFAOYSA-M 0.000 description 1
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 1
- 206010022998 Irritability Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- RKUNBYITZUJHSG-SPUOUPEWSA-N atropine Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-SPUOUPEWSA-N 0.000 description 1
- 229960000396 atropine Drugs 0.000 description 1
- 150000007657 benzothiazepines Chemical class 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000003218 coronary vasodilator agent Substances 0.000 description 1
- UKPBEPCQTDRZSE-UHFFFAOYSA-N cyclizine hydrochloride Chemical compound Cl.C1CN(C)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 UKPBEPCQTDRZSE-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 1
- HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 description 1
- WBFVBGCCIMFURT-UHFFFAOYSA-N ethyl 2-(4-chlorophenyl)-4-oxo-3,5-dihydro-2h-1,5-benzothiazepine-3-carboxylate Chemical compound S1C2=CC=CC=C2NC(=O)C(C(=O)OCC)C1C1=CC=C(Cl)C=C1 WBFVBGCCIMFURT-UHFFFAOYSA-N 0.000 description 1
- RJRIEKMLIDXBJM-UHFFFAOYSA-N ethyl 2-(4-methoxyphenyl)-4-oxo-3,5-dihydro-2h-1,5-benzothiazepine-3-carboxylate Chemical compound S1C2=CC=CC=C2NC(=O)C(C(=O)OCC)C1C1=CC=C(OC)C=C1 RJRIEKMLIDXBJM-UHFFFAOYSA-N 0.000 description 1
- MCGKNEPUFWEVEN-UHFFFAOYSA-N ethyl 4-oxo-2-phenyl-3,5-dihydro-2h-1,5-benzothiazepine-3-carboxylate Chemical compound S1C2=CC=CC=C2NC(=O)C(C(=O)OCC)C1C1=CC=CC=C1 MCGKNEPUFWEVEN-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229940015042 glycopyrrolate Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- QMEZUZOCLYUADC-UHFFFAOYSA-N hydrate;dihydrochloride Chemical compound O.Cl.Cl QMEZUZOCLYUADC-UHFFFAOYSA-N 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- FTKFWBRBQCQSHY-UHFFFAOYSA-N n-(3-formyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)benzamide Chemical compound S1C=2CCCCC=2C(C=O)=C1NC(=O)C1=CC=CC=C1 FTKFWBRBQCQSHY-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 1
- 210000001187 pylorus Anatomy 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229940001593 sodium carbonate Drugs 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D281/00—Heterocyclic compounds containing rings of more than six members having one nitrogen atom and one sulfur atom as the only ring hetero atoms
- C07D281/02—Seven-membered rings
- C07D281/04—Seven-membered rings having the hetero atoms in positions 1 and 4
- C07D281/08—Seven-membered rings having the hetero atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D281/10—Seven-membered rings having the hetero atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems condensed with one six-membered ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP15800/78 | 1978-02-14 | ||
| JP1580078A JPS5840954B2 (ja) | 1978-02-14 | 1978-02-14 | 1,5↓−ベンゾチアゼピン誘導体およびその塩類 |
| JP17414/78 | 1978-02-17 | ||
| JP1741478A JPS5840955B2 (ja) | 1978-02-17 | 1978-02-17 | 2,3↓−ジヒドロ↓−1,5↓−ベンゾチアゼピン誘導体 |
| JP92998/78 | 1978-07-20 | ||
| JP9299878A JPS5519249A (en) | 1978-07-29 | 1978-07-29 | Optically active 1,5-benzothiazepine derivative |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1114818A true CA1114818A (en) | 1981-12-22 |
Family
ID=27281143
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA321,396A Expired CA1114818A (en) | 1978-02-14 | 1979-02-13 | 1,5-benzothiazepine compounds and process for preparing the same |
Country Status (6)
| Country | Link |
|---|---|
| CA (1) | CA1114818A (index.php) |
| CH (1) | CH639660A5 (index.php) |
| DE (1) | DE2905637C3 (index.php) |
| ES (1) | ES477709A1 (index.php) |
| FR (1) | FR2416890A1 (index.php) |
| GB (1) | GB2017080B (index.php) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4477464A (en) * | 1983-02-10 | 1984-10-16 | Ciba-Geigy Corporation | Hetero-benzazepine derivatives and their pharmaceutical use |
| US4694002A (en) * | 1986-08-21 | 1987-09-15 | E. R. Squibb & Sons, Inc. | Benzothiazepine derivatives |
| JP2871811B2 (ja) * | 1990-02-28 | 1999-03-17 | サントリー株式会社 | 縮合7員環系化合物 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3089872A (en) * | 1961-03-31 | 1963-05-14 | Olin Mathieson | Benzothiazine and benzothiazepine compounds |
-
1979
- 1979-02-12 GB GB7904882A patent/GB2017080B/en not_active Expired
- 1979-02-13 CA CA321,396A patent/CA1114818A/en not_active Expired
- 1979-02-14 FR FR7903753A patent/FR2416890A1/fr active Granted
- 1979-02-14 DE DE19792905637 patent/DE2905637C3/de not_active Expired
- 1979-02-14 CH CH142479A patent/CH639660A5/de not_active IP Right Cessation
- 1979-02-14 ES ES477709A patent/ES477709A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2905637C3 (de) | 1981-05-21 |
| DE2905637A1 (de) | 1979-08-16 |
| ES477709A1 (es) | 1979-10-16 |
| FR2416890B1 (index.php) | 1981-11-13 |
| CH639660A5 (de) | 1983-11-30 |
| DE2905637B2 (index.php) | 1980-07-03 |
| GB2017080A (en) | 1979-10-03 |
| GB2017080B (en) | 1982-07-21 |
| FR2416890A1 (fr) | 1979-09-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR101020399B1 (ko) | 퀴놀린 유도체 및 5-ht6 리간드로서의 그의 용도 | |
| US5486512A (en) | Quinazoline derivatives as acetylcholinesterase inhibitors | |
| CA2321278A1 (en) | Novel compounds | |
| CA1114818A (en) | 1,5-benzothiazepine compounds and process for preparing the same | |
| US5512590A (en) | 5,6-dihydro-4h-imidazo 2',1':2,3!imidazo- 4,5,1-ij!quinoline and 4,5-dihydroimidazo- 1,2-a!pyrolo 1,2,3-cd!benzimidazole derivatives, their preparation and application in therapeutics | |
| JPH0477B2 (index.php) | ||
| FI63029C (fi) | Foerfarande foer framstaellning av ulcushaemmande n-substituerade 5,11-dihydro-(piperazin-1'-yl-alkanoyl)-6h-pyrido(2,3-b)(1,4)-benzodiazepin-6-on-derivater | |
| FI77456B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 3-/2-/4-(2-metoxifenyl) -1-piperazinyl/etyl/-2,4-(1h,3h)-kinazolindionderivat. | |
| US4264497A (en) | 1,5-Benzothiazepine compounds | |
| US4228167A (en) | Diuretic and vasodilating tricyclic quinazolines | |
| US4393210A (en) | 1(2H)-Isoquinolone compounds and acid addition salts thereof | |
| PL131762B1 (en) | Process for preparing novel derivatives of benzodiazepine | |
| JPS6127974A (ja) | イミノチアゾリジン誘導体 | |
| OHNO et al. | Synthesis of 2-aryl-2, 3-dihydro-3-piperazinylmethyl-1, 5-benzothiazepin-4 (5H)-ones and related compounds | |
| US4743601A (en) | Dihydro-1,4-oxazino(2,3-C)quinolines | |
| PL147855B1 (en) | Method of obtaining aromatic 1,4-oxazepinones and thiones | |
| CS202069B2 (en) | Method of preparing 2-/4-substituted piperazine-1-yl/-4-amino-6,7-dimethoxyquinazolines | |
| GB2159149A (en) | 1 2 4-thiadiazines | |
| SU999967A3 (ru) | Способ получени 6-N-замещенных 6-амино-3-пиридазинилгидразинов или их солей | |
| EP0135079B1 (en) | Process for preparing 1-substituted-1,4-benzodiazepine derivatives | |
| CA1051887A (en) | Triazolo (4,3-d) (1,4) benzodiazepine-3,6-diones | |
| US3894011A (en) | Triazolo{8 4,3-d{9 {8 1,4{9 benzodiazepine-3,6-diones | |
| CA1049513A (en) | Triazolo(4,3-d) (1,4) benzodiazepine-6-ones | |
| IE45587B1 (en) | Biologically active tetracyclic compounds and pharmaceutical compositions containing them | |
| US4020064A (en) | 3-[Substituted-2-(methylamino) phenyl]-4-[2-oxo-2-(hetero-cyclic) ethyl]-5-substituted-1,2,4-triazoles |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |