CA1111317A - Regularising device for the depth of a furrow - Google Patents
Regularising device for the depth of a furrowInfo
- Publication number
- CA1111317A CA1111317A CA320,210A CA320210A CA1111317A CA 1111317 A CA1111317 A CA 1111317A CA 320210 A CA320210 A CA 320210A CA 1111317 A CA1111317 A CA 1111317A
- Authority
- CA
- Canada
- Prior art keywords
- chassis
- wheels
- wheel
- machine
- support arms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000033001 locomotion Effects 0.000 claims description 21
- 239000002689 soil Substances 0.000 description 9
- 230000035515 penetration Effects 0.000 description 8
- 230000000694 effects Effects 0.000 description 6
- 230000000875 corresponding effect Effects 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000000284 resting effect Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000004575 stone Substances 0.000 description 2
- 244000228957 Ferula foetida Species 0.000 description 1
- 230000000712 assembly Effects 0.000 description 1
- 238000000429 assembly Methods 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 230000006854 communication Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- KRTSDMXIXPKRQR-AATRIKPKSA-N monocrotophos Chemical compound CNC(=O)\C=C(/C)OP(=O)(OC)OC KRTSDMXIXPKRQR-AATRIKPKSA-N 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01C—PLANTING; SOWING; FERTILISING
- A01C5/00—Making or covering furrows or holes for sowing, planting or manuring
- A01C5/06—Machines for making or covering drills or furrows for sowing or planting
- A01C5/062—Devices for making drills or furrows
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01B—SOIL WORKING IN AGRICULTURE OR FORESTRY; PARTS, DETAILS, OR ACCESSORIES OF AGRICULTURAL MACHINES OR IMPLEMENTS, IN GENERAL
- A01B15/00—Elements, tools, or details of ploughs
- A01B15/20—Special adjusting means for tools of ploughs drawn by, or mounted on tractors working on hillsides or slopes
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01C—PLANTING; SOWING; FERTILISING
- A01C5/00—Making or covering furrows or holes for sowing, planting or manuring
- A01C5/06—Machines for making or covering drills or furrows for sowing or planting
- A01C5/062—Devices for making drills or furrows
- A01C5/064—Devices for making drills or furrows with rotating tools
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Soil Sciences (AREA)
- Environmental Sciences (AREA)
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Agricultural Machines (AREA)
- Sowing (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7802081 | 1978-01-25 | ||
| FR7802081A FR2415421A1 (fr) | 1978-01-25 | 1978-01-25 | Dispositif de regularisation de la profondeur d'un sillon |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1111317A true CA1111317A (en) | 1981-10-27 |
Family
ID=9203807
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA320,210A Expired CA1111317A (en) | 1978-01-25 | 1979-01-24 | Regularising device for the depth of a furrow |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4594951A (OSRAM) |
| AR (1) | AR219368A1 (OSRAM) |
| AU (1) | AU525359B2 (OSRAM) |
| BR (1) | BR7900335A (OSRAM) |
| CA (1) | CA1111317A (OSRAM) |
| DE (1) | DE2902280A1 (OSRAM) |
| FR (1) | FR2415421A1 (OSRAM) |
| GB (1) | GB2013071B (OSRAM) |
| IT (1) | IT1110832B (OSRAM) |
| YU (1) | YU41611B (OSRAM) |
| ZA (1) | ZA79160B (OSRAM) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5235922A (en) * | 1979-01-15 | 1993-08-17 | Allied Products Corporation | Planter with equalizer between gauge wheels |
| US4356780A (en) * | 1980-05-28 | 1982-11-02 | International Harvester Co. | Equalized furrow forming apparatus for a seed planter |
| FR2501956A1 (fr) * | 1981-03-19 | 1982-09-24 | Fabre Sarl Fonderie | Perfectionnement aux chassis de semoir |
| US4373456A (en) * | 1981-05-20 | 1983-02-15 | International Harvester Co. | Agricultural furrow forming apparatus depth control |
| US4423788A (en) | 1981-05-20 | 1984-01-03 | International Harvester Co. | Agricultural furrow forming apparatus depth control |
| DE4022156C2 (de) * | 1990-05-31 | 1999-01-07 | Otto Gruebl | Gerät zur Vorbereitung des Bodens für eine Reihensaat |
| AT399080B (de) * | 1990-07-12 | 1995-03-27 | Grabl Otto | Gerät zum vorbereiten des bodens für die reihensaat |
| US6148747A (en) * | 1998-01-20 | 2000-11-21 | Kinze Manufacturing Inc. | Equalizing gauge wheel mechanism for row crop planter unit |
| RU2206972C1 (ru) * | 2002-01-03 | 2003-06-27 | Орловский государственный аграрный университет | Сошник для подпочвенного разбросного посева |
| US7549383B2 (en) * | 2005-01-07 | 2009-06-23 | Precision Planting, Inc. | Planter meter suspension system and method of improving seed spacing |
| RU2316929C1 (ru) * | 2006-04-24 | 2008-02-20 | Александр Николаевич Золотухин | Комбинированный посевной агрегат (варианты) |
| WO2008086283A2 (en) | 2007-01-08 | 2008-07-17 | Precision Planting Inc. | Load sensing pin |
| US8047301B2 (en) | 2008-10-17 | 2011-11-01 | Cnh Canada, Ltd. | Disc gang assembly for an agricultural implement |
| US7946232B2 (en) * | 2009-07-13 | 2011-05-24 | Agco Corporation | Planter with depth adjustment mechanism |
| US8186449B2 (en) * | 2009-10-01 | 2012-05-29 | Deere & Company | Agricultural implement walking beam assembly |
| US8393407B2 (en) | 2010-04-12 | 2013-03-12 | Brian E. Freed | Crop residue clearing device |
| BR102014025337B1 (pt) * | 2014-10-10 | 2020-09-15 | José Roberto do Amaral Assy | Implemento agrícola para semeadura |
| US10130025B2 (en) * | 2014-11-18 | 2018-11-20 | Great Plains Manufacturing, Inc. | Rotary cutter with parallel pivot wheels |
| JP6248922B2 (ja) * | 2014-12-24 | 2017-12-20 | 井関農機株式会社 | 移植機 |
| CA2876627A1 (en) * | 2015-01-02 | 2016-07-02 | Rite Way Mfg. Co. Ltd. | Ground-engaging farm implement with axle suspension to enhance field surface contact |
| BR102015008244A2 (pt) * | 2015-04-13 | 2018-04-10 | Cnh Ind Latin America Ltda | conjunto e kit de suspensão para um implemento agrícola |
| US9826675B2 (en) | 2015-06-24 | 2017-11-28 | Cnh Industrial America Llc | Gauge wheel assembly with hinge |
| BR102016008945B1 (pt) | 2016-04-20 | 2021-07-13 | Jose Roberto Do Amaral Assy | Conjunto seletor de sementes para dosador pneumático, dosador pneumático e plantadora |
| US10172275B2 (en) | 2016-12-29 | 2019-01-08 | Cnh Industrial America Llc | Pivotable lift assist assembly for an agricultural implement |
| US11419255B2 (en) | 2019-11-04 | 2022-08-23 | Cnh Industrial America Llc | Wheel carrier system |
| US12185660B2 (en) * | 2020-03-17 | 2025-01-07 | Harvest International, Inc. | Adjustable depth control system for row unit planters |
| RU204417U1 (ru) * | 2021-01-28 | 2021-05-24 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Ульяновский государственный аграрный университет имени П.А. Столыпина" | Комбинированный посевной агрегат |
| RU204410U1 (ru) * | 2021-01-28 | 2021-05-24 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Ульяновский государственный аграрный университет имени П.А. Столыпина" | Комбинированный посевной агрегат |
| RU204856U1 (ru) * | 2021-01-28 | 2021-06-16 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Ульяновский государственный аграрный университет имени П.А. Столыпина" | Комбинированный посевной агрегат |
| RU204409U1 (ru) * | 2021-01-28 | 2021-05-24 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Ульяновский государственный аграрный университет имени П.А. Столыпина" | Комбинированный посевной агрегат |
| RU206238U1 (ru) * | 2021-06-10 | 2021-09-01 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Ульяновский государственный аграрный университет имени П.А. Столыпина" | Комбинированный посевной агрегат |
| RU208890U1 (ru) * | 2021-06-18 | 2022-01-19 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Ульяновский государственный аграрный университет имени П.А. Столыпина" | Комбинированный посевной аппарат |
| RU208889U1 (ru) * | 2021-07-14 | 2022-01-19 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Ульяновский государственный аграрный университет имени П.А. Столыпина" | Комбинированный посевной агрегат |
| RU207493U1 (ru) * | 2021-07-15 | 2021-10-29 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Ульяновский государственный аграрный университет имени П.А. Столыпина" | Комбинированный посевной агрегат |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1070867B (OSRAM) * | 1959-12-10 | |||
| US821070A (en) * | 1906-02-01 | 1906-05-22 | George W Rabb | Plow and planter. |
| FR482774A (fr) * | 1916-08-17 | 1917-04-26 | Cockburns Ltd | Système de valves à vapeur |
| US1604897A (en) * | 1925-09-16 | 1926-10-26 | Futter Alfred | Harrow seat |
| FR669695A (fr) * | 1929-02-15 | 1929-11-19 | Perfectionnements apportés aux véhicules et machines agricoles à roues | |
| US1875778A (en) * | 1929-08-15 | 1932-09-06 | William M Taylor | Road grading machine or other vehicle |
| FR823186A (fr) * | 1937-09-17 | 1938-01-15 | Essieu articulé pour charrue brabant | |
| US2191929A (en) * | 1938-05-21 | 1940-02-27 | Deere & Co | Plow |
| US2599065A (en) * | 1945-03-13 | 1952-06-03 | Clarence E Newkirk | Wheeled disk harrow |
| FR970455A (fr) * | 1948-08-09 | 1951-01-04 | Scarificateur-semoir | |
| US2685243A (en) * | 1950-02-15 | 1954-08-03 | Ford Motor Co | Depth wheel for seed planters |
| GB784185A (en) * | 1954-11-01 | 1957-10-02 | Int Harvester Co | Improvements in or relating to combine harvesters |
| FR1245855A (fr) * | 1959-09-23 | 1960-11-10 | Same Soc Acc Motori Endotermic | Perfectionnement aux dispositifs de commande automatique des instruments portés, semi-portés ou traînés par un tracteur |
| FR1261393A (fr) * | 1960-04-08 | 1961-05-19 | Dispositif de transmission hydraulique d'un mouvement rectiligne applicable notamment aux tracteurs agricoles | |
| FR1261431A (fr) * | 1960-04-09 | 1961-05-19 | Dispositif d'équilibrage utilisable notamment sur les tracteurs agricoles | |
| SU143608A1 (ru) * | 1961-04-17 | 1961-11-30 | А.Л. Мелашвили | Навесна система дл горных тракторов |
| US3115853A (en) * | 1961-11-15 | 1963-12-31 | Walter E Gellner | Lifting and transporting mechanism for agricultural implements |
| SE308256B (OSRAM) * | 1963-06-28 | 1969-02-03 | Oestbergs Fabriks Ab | |
| US3558148A (en) * | 1969-03-26 | 1971-01-26 | Hagie Mfg Co | Front wheel suspension system for a vehicle high clearance frame |
| US3570605A (en) * | 1969-04-14 | 1971-03-16 | Eldon L Rikli | Compensating linkage |
| GB1524343A (en) * | 1977-01-12 | 1978-09-13 | Hestair Stanhay Ltd | Seed drilling units |
| IT984994B (it) * | 1973-05-18 | 1974-11-20 | Bruni M | Dispositivo autolivellatore per grosse macchine agricole |
| SU572238A1 (ru) * | 1973-10-15 | 1977-09-15 | Всесоюзный Ордена Трудового Красного Знамени Научно-Исследовательский Институт Механизации Сельского Хозяйства | Высевающее устройство |
| US4009668A (en) * | 1975-07-07 | 1977-03-01 | Deere & Company | Planter apparatus and method for planting |
-
1978
- 1978-01-25 FR FR7802081A patent/FR2415421A1/fr active Granted
-
1979
- 1979-01-15 US US06/003,642 patent/US4594951A/en not_active Expired - Lifetime
- 1979-01-15 ZA ZA00790160A patent/ZA79160B/xx unknown
- 1979-01-17 GB GB7901669A patent/GB2013071B/en not_active Expired
- 1979-01-18 BR BR7900335A patent/BR7900335A/pt unknown
- 1979-01-22 DE DE19792902280 patent/DE2902280A1/de not_active Ceased
- 1979-01-23 AR AR275264A patent/AR219368A1/es active
- 1979-01-24 CA CA320,210A patent/CA1111317A/en not_active Expired
- 1979-01-24 IT IT19566/79A patent/IT1110832B/it active
- 1979-01-24 AU AU43625/79A patent/AU525359B2/en not_active Ceased
- 1979-01-25 YU YU167/79A patent/YU41611B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU525359B2 (en) | 1982-11-04 |
| IT7919566A0 (it) | 1979-01-24 |
| AU4362579A (en) | 1979-08-02 |
| DE2902280A1 (de) | 1979-08-02 |
| FR2415421A1 (fr) | 1979-08-24 |
| ZA79160B (en) | 1979-12-27 |
| GB2013071B (en) | 1982-04-21 |
| YU41611B (en) | 1987-12-31 |
| IT1110832B (it) | 1986-01-06 |
| AR219368A1 (es) | 1980-08-15 |
| FR2415421B1 (OSRAM) | 1980-07-18 |
| BR7900335A (pt) | 1979-08-14 |
| US4594951A (en) | 1986-06-17 |
| YU16779A (en) | 1982-08-31 |
| GB2013071A (en) | 1979-08-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1111317A (en) | Regularising device for the depth of a furrow | |
| US4430952A (en) | Planter gauge wheels with adjustable equalizer mechanism | |
| US4311104A (en) | Press grain drill | |
| US4423788A (en) | Agricultural furrow forming apparatus depth control | |
| US4149475A (en) | Seed and fertilizer drill with spring loaded coulters counter-mounted on vertically adjustable beam | |
| US4317489A (en) | Ground-working implement and lift linkage therefor | |
| US4356780A (en) | Equalized furrow forming apparatus for a seed planter | |
| US4479549A (en) | Ground working implement | |
| EP0218585A1 (en) | Apparatus in dispensing machines for agriculture | |
| US2968356A (en) | Telescopic beaming device | |
| US3845825A (en) | Multiple-gang disc-type ground tillage implement | |
| US4214537A (en) | Grain drill furrow opening assembly | |
| US4595064A (en) | Drag attachment for a disk | |
| US2907394A (en) | Agricultural implements having resilient draft connections | |
| US4809786A (en) | Remotely adjustable disk leveling system | |
| US4236587A (en) | Ground-working apparatus and hitch assembly therefor | |
| US3570605A (en) | Compensating linkage | |
| US4253528A (en) | Pivoting dual land wheel for a plow | |
| US3155168A (en) | Chisel and sweep plow | |
| EP3818795B1 (en) | Planter | |
| US2771043A (en) | Tractor parallel row producing guide means | |
| CN111567160A (zh) | 一种耕播机械用轮辙处理机构 | |
| US3747422A (en) | Compensating linkage | |
| US5809915A (en) | Contouring dry land seed drill | |
| US2679791A (en) | Disk plow and mounting therefor |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |