CA1102477A - Thermoplastic rubber - Google Patents
Thermoplastic rubberInfo
- Publication number
- CA1102477A CA1102477A CA274,779A CA274779A CA1102477A CA 1102477 A CA1102477 A CA 1102477A CA 274779 A CA274779 A CA 274779A CA 1102477 A CA1102477 A CA 1102477A
- Authority
- CA
- Canada
- Prior art keywords
- weight
- segment
- mixture
- segments
- aromatic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920002725 thermoplastic elastomer Polymers 0.000 title abstract 2
- 239000000203 mixture Substances 0.000 claims abstract description 57
- 229920000642 polymer Polymers 0.000 claims abstract description 49
- 239000004417 polycarbonate Substances 0.000 claims abstract description 44
- 229920000515 polycarbonate Polymers 0.000 claims abstract description 33
- 229920001577 copolymer Polymers 0.000 claims abstract description 21
- 125000003118 aryl group Chemical group 0.000 claims abstract description 14
- 150000001993 dienes Chemical class 0.000 claims abstract description 7
- 125000001118 alkylidene group Chemical group 0.000 claims abstract description 3
- 125000006833 (C1-C5) alkylene group Chemical group 0.000 claims abstract 2
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 55
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 43
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 33
- 239000000243 solution Substances 0.000 description 33
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- 239000004793 Polystyrene Substances 0.000 description 18
- 229920002223 polystyrene Polymers 0.000 description 13
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 8
- 238000007792 addition Methods 0.000 description 8
- 229930185605 Bisphenol Natural products 0.000 description 7
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 7
- 229920001971 elastomer Polymers 0.000 description 7
- 235000019441 ethanol Nutrition 0.000 description 7
- 229910052744 lithium Inorganic materials 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 239000001294 propane Substances 0.000 description 7
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 239000005060 rubber Substances 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 5
- 229920002633 Kraton (polymer) Polymers 0.000 description 5
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 5
- 229920000402 bisphenol A polycarbonate polymer Polymers 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000003381 stabilizer Substances 0.000 description 5
- 229920003048 styrene butadiene rubber Polymers 0.000 description 5
- VESRBMGDECAMNH-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)propan-2-yl]-2,3,5,6-tetramethylphenol Chemical compound CC1=C(C(=C(C(=C1O)C)C)C(C)(C)C1=CC=C(C=C1)O)C VESRBMGDECAMNH-UHFFFAOYSA-N 0.000 description 4
- 239000002174 Styrene-butadiene Substances 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 238000001556 precipitation Methods 0.000 description 4
- 238000012545 processing Methods 0.000 description 4
- 239000011115 styrene butadiene Substances 0.000 description 4
- -1 sulfur halides Chemical class 0.000 description 4
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229920004939 Cariflex™ Polymers 0.000 description 3
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 3
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 3
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 3
- 229920013623 Solprene Polymers 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 229940116441 divinylbenzene Drugs 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 150000002642 lithium compounds Chemical class 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- 239000002530 phenolic antioxidant Substances 0.000 description 3
- 229920000098 polyolefin Polymers 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 229920006301 statistical copolymer Polymers 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- UIAFKZKHHVMJGS-UHFFFAOYSA-N 2,4-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1O UIAFKZKHHVMJGS-UHFFFAOYSA-N 0.000 description 2
- MCUFTLAXJMCWPZ-UHFFFAOYSA-N 3-butyl-2-methylphenol Chemical group CCCCC1=CC=CC(O)=C1C MCUFTLAXJMCWPZ-UHFFFAOYSA-N 0.000 description 2
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 238000005299 abrasion Methods 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 229920001400 block copolymer Polymers 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 229920002959 polymer blend Polymers 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 238000001256 steam distillation Methods 0.000 description 2
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical group C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 1
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 1
- YIYBRXKMQFDHSM-UHFFFAOYSA-N 2,2'-Dihydroxybenzophenone Chemical class OC1=CC=CC=C1C(=O)C1=CC=CC=C1O YIYBRXKMQFDHSM-UHFFFAOYSA-N 0.000 description 1
- SDJHPPZKZZWAKF-UHFFFAOYSA-N 2,3-dimethylbuta-1,3-diene Chemical compound CC(=C)C(C)=C SDJHPPZKZZWAKF-UHFFFAOYSA-N 0.000 description 1
- BLDLRWQLBOJPEB-UHFFFAOYSA-N 2-(2-hydroxyphenyl)sulfanylphenol Chemical class OC1=CC=CC=C1SC1=CC=CC=C1O BLDLRWQLBOJPEB-UHFFFAOYSA-N 0.000 description 1
- XSVZEASGNTZBRQ-UHFFFAOYSA-N 2-(2-hydroxyphenyl)sulfinylphenol Chemical class OC1=CC=CC=C1S(=O)C1=CC=CC=C1O XSVZEASGNTZBRQ-UHFFFAOYSA-N 0.000 description 1
- QUWAJPZDCZDTJS-UHFFFAOYSA-N 2-(2-hydroxyphenyl)sulfonylphenol Chemical class OC1=CC=CC=C1S(=O)(=O)C1=CC=CC=C1O QUWAJPZDCZDTJS-UHFFFAOYSA-N 0.000 description 1
- AZZWZMUXHALBCQ-UHFFFAOYSA-N 4-[(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(CC=2C=C(C)C(O)=C(C)C=2)=C1 AZZWZMUXHALBCQ-UHFFFAOYSA-N 0.000 description 1
- OBZFGWBLZXIBII-UHFFFAOYSA-N 4-[3-(4-hydroxy-3,5-dimethylphenyl)-3-methylbutyl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(CCC(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 OBZFGWBLZXIBII-UHFFFAOYSA-N 0.000 description 1
- CIEGINNQDIULCT-UHFFFAOYSA-N 4-[4,6-bis(4-hydroxyphenyl)-4,6-dimethylheptan-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)CC(C)(C=1C=CC(O)=CC=1)CC(C)(C)C1=CC=C(O)C=C1 CIEGINNQDIULCT-UHFFFAOYSA-N 0.000 description 1
- SDDLEVPIDBLVHC-UHFFFAOYSA-N Bisphenol Z Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)CCCCC1 SDDLEVPIDBLVHC-UHFFFAOYSA-N 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000004425 Makrolon Substances 0.000 description 1
- 101100345589 Mus musculus Mical1 gene Proteins 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- JPYHHZQJCSQRJY-UHFFFAOYSA-N Phloroglucinol Natural products CCC=CCC=CCC=CCC=CCCCCC(=O)C1=C(O)C=C(O)C=C1O JPYHHZQJCSQRJY-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 239000010692 aromatic oil Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229940114055 beta-resorcylic acid Drugs 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 229940106691 bisphenol a Drugs 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000013013 elastic material Substances 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- WGOPGODQLGJZGL-UHFFFAOYSA-N lithium;butane Chemical compound [Li+].CC[CH-]C WGOPGODQLGJZGL-UHFFFAOYSA-N 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002815 nickel Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 150000002896 organic halogen compounds Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 description 1
- 229960001553 phloroglucinol Drugs 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000003340 retarding agent Substances 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 230000002226 simultaneous effect Effects 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L53/00—Compositions of block copolymers containing at least one sequence of a polymer obtained by reactions only involving carbon-to-carbon unsaturated bonds; Compositions of derivatives of such polymers
- C08L53/02—Compositions of block copolymers containing at least one sequence of a polymer obtained by reactions only involving carbon-to-carbon unsaturated bonds; Compositions of derivatives of such polymers of vinyl-aromatic monomers and conjugated dienes
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Graft Or Block Polymers (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762613200 DE2613200C2 (de) | 1976-03-27 | 1976-03-27 | Thermoplastischer Kautschuk |
| DEP2613200.3 | 1976-03-27 | ||
| DEP2643757.0 | 1976-09-29 | ||
| DE19762643757 DE2643757C2 (de) | 1976-09-29 | 1976-09-29 | Mischungen von hydrierten Styrol- Butadienblockpolymeren mit Polycarbonaten, Verfahren zu ihrer Herstellung und ihre Verwendung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1102477A true CA1102477A (en) | 1981-06-02 |
Family
ID=25770258
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA274,779A Expired CA1102477A (en) | 1976-03-27 | 1977-03-25 | Thermoplastic rubber |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4218545A (enExample) |
| JP (1) | JPS5832176B2 (enExample) |
| AU (1) | AU505447B2 (enExample) |
| BR (1) | BR7701892A (enExample) |
| CA (1) | CA1102477A (enExample) |
| ES (1) | ES457198A1 (enExample) |
| FR (1) | FR2345486A1 (enExample) |
| GB (1) | GB1552266A (enExample) |
| IT (1) | IT1073247B (enExample) |
| NL (1) | NL184280C (enExample) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2004284B (en) * | 1977-09-14 | 1982-04-07 | Gen Electric | Composition of a polycarbonate resin and a selectively hydrogenated block copolymer of a vinyl aromatic compound and an olefinic elastomer |
| JPS54106563A (en) * | 1978-02-08 | 1979-08-21 | Denki Kagaku Kogyo Kk | Resin composition |
| JPS5648570U (enExample) * | 1979-09-19 | 1981-04-30 | ||
| DE3118697A1 (de) * | 1981-05-12 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | "thermoplastische formmassen auf basis von polycarbonat, polyalkylenterephthalat und gegebenenfalls einem oder mehreren polymerisaten" |
| US5272208A (en) * | 1981-08-13 | 1993-12-21 | Asahi Kasei Kogyo Kabushiki Kaisha | Modified block copolymer composition |
| US5272209A (en) * | 1981-08-13 | 1993-12-21 | Asahi Kasei Kogyo Kabushiki Kaisha | Modified block copolymer composition |
| JPS5827740A (ja) * | 1981-08-13 | 1983-02-18 | Asahi Chem Ind Co Ltd | 変性ブロツク共重合体組成物 |
| DE3280472T2 (de) * | 1981-08-13 | 1996-11-14 | Asahi Chemical Ind | Modifiziertes Blockcopolymer |
| US5278246A (en) * | 1981-08-13 | 1994-01-11 | Asahi Kasei Kogyo Kabushiki Kaisha | Modified block copolymer and a process for producing the same |
| US4820768A (en) * | 1981-08-13 | 1989-04-11 | Asahi Kasei Kogyo Kabushiki Kaisha | Modified block copolymer composition |
| US4584338A (en) * | 1982-01-29 | 1986-04-22 | General Electric Company | High impact strength polycarbonate resin composition |
| US4430476A (en) | 1982-01-29 | 1984-02-07 | General Electric Company | Resinous composition comprising a polycarbonate resin, a linear low density polyolefin and an alkenyl aromatic copolymer |
| JPS58176240A (ja) * | 1982-04-09 | 1983-10-15 | Denki Kagaku Kogyo Kk | 熱可塑性樹脂組成物 |
| US4532283A (en) * | 1982-09-23 | 1985-07-30 | General Electric Company | Aromatic carbonate polymer composition |
| US4562222A (en) * | 1982-09-23 | 1985-12-31 | General Electric Company | Polycarbonate resin mixtures |
| US4481331A (en) * | 1983-03-22 | 1984-11-06 | Gen Electric | Polycarbonate resin mixture |
| US4513119A (en) * | 1983-04-21 | 1985-04-23 | General Electric Company | Polycarbonate resin mixtures |
| NL9002379A (nl) * | 1990-11-01 | 1992-06-01 | Stamicarbon | Polymeermengsel bevattende een aromatisch polycarbonaat hars en een slagvastheid verhogend middel. |
| CA2121522C (en) * | 1993-04-23 | 2001-12-25 | Makoto Nishikawa | Thermoplastic polymer composition |
| EP0893476A1 (en) | 1997-07-23 | 1999-01-27 | Daicel Chemical Industries, Ltd. | Thermoplastic resin composition |
| US8841404B2 (en) | 2011-05-18 | 2014-09-23 | Sabic Global Technologies B.V. | Flame retardant bio-based polymer blends |
| US8933170B2 (en) * | 2011-05-18 | 2015-01-13 | Sabic Global Technologies B.V. | Bio-sourced transparent and ductile polycarbonate blends |
| JP6392506B2 (ja) * | 2013-07-17 | 2018-09-19 | 帝人株式会社 | ポリカーボネート樹脂組成物 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3879348A (en) * | 1970-12-22 | 1975-04-22 | Bayer Ag | Saponification-resistant polycarbonates |
| JPS5038130B2 (enExample) * | 1972-02-29 | 1975-12-08 | Asahi Chemical Ind | |
| DE2402177A1 (de) * | 1974-01-17 | 1975-08-14 | Bayer Ag | Polycarbonat-polyvinylchlorid-formmassen |
| US3966842A (en) * | 1974-07-18 | 1976-06-29 | The Dow Chemical Company | Thermoplastic molding compositions of rubber-reinforced styrene/maleic anhydride resins and polycarbonate resins |
| ZA764161B (en) * | 1975-08-26 | 1977-06-29 | Abbott Lab | Thermoelastic polymers including block radial polymers to be used as pharmaceutical sealing and resealing materials |
| US4048254A (en) * | 1975-08-26 | 1977-09-13 | Abbott Laboratories | Blend of thermoplastic polymers with block radial butadiene-styrene polymers |
| US4081424A (en) * | 1976-06-07 | 1978-03-28 | Shell Oil Company | Multicomponent polyolefin - block copolymer - polymer blends |
-
1977
- 1977-03-21 GB GB11830/77A patent/GB1552266A/en not_active Expired
- 1977-03-24 AU AU23599/77A patent/AU505447B2/en not_active Expired
- 1977-03-24 NL NLAANVRAGE7703201,A patent/NL184280C/xx not_active IP Right Cessation
- 1977-03-25 CA CA274,779A patent/CA1102477A/en not_active Expired
- 1977-03-25 JP JP52032340A patent/JPS5832176B2/ja not_active Expired
- 1977-03-25 IT IT48665/77A patent/IT1073247B/it active
- 1977-03-25 FR FR7709021A patent/FR2345486A1/fr active Granted
- 1977-03-25 BR BR7701892A patent/BR7701892A/pt unknown
- 1977-03-25 ES ES457198A patent/ES457198A1/es not_active Expired
- 1977-05-22 US US05/780,127 patent/US4218545A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| AU2359977A (en) | 1978-09-28 |
| NL184280B (nl) | 1989-01-02 |
| IT1073247B (it) | 1985-04-13 |
| NL184280C (nl) | 1989-06-01 |
| FR2345486B1 (enExample) | 1983-10-28 |
| GB1552266A (en) | 1979-09-12 |
| NL7703201A (nl) | 1977-09-29 |
| AU505447B2 (en) | 1979-11-22 |
| JPS5832176B2 (ja) | 1983-07-11 |
| FR2345486A1 (fr) | 1977-10-21 |
| JPS52117940A (en) | 1977-10-03 |
| BR7701892A (pt) | 1977-11-08 |
| US4218545A (en) | 1980-08-19 |
| ES457198A1 (es) | 1978-08-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1102477A (en) | Thermoplastic rubber | |
| US6235847B1 (en) | Linear block copolymer and resin composition containing the same | |
| US7064164B2 (en) | Transparent styrol-butadiene block copolymer mixtures | |
| US4122131A (en) | Polyblend composition comprising aromatic polycarbonate, polyolefin, selectively hydrogenated block copolymer and olefinic copolymer | |
| JP5448325B2 (ja) | スチレン系樹脂シート | |
| JP5046469B2 (ja) | ブロック共重合体組成物 | |
| EP1266935A1 (en) | Styrene copolymer composition | |
| EP0572667A1 (en) | Thermoplastic resin composition | |
| US4202949A (en) | Branched segment polymers | |
| JP4070865B2 (ja) | 線状ブロック共重合体及び樹脂組成物 | |
| US6660790B1 (en) | Styrene polymer composition | |
| EP0135169B1 (en) | Impact resistant alpha-methylstyrene-styrene copolymer blends | |
| US4146587A (en) | Segment polymers derived from aromatic vinyl-diene block polymer anion and aromatic polycarbonate | |
| KR20160110499A (ko) | 열가소성 수지 조성물, 및 성형체 및 그의 제조 방법 | |
| EP1916267B1 (en) | Block copolymer and method for producing same, composition for resin modification, and modified resin composition and method for producing same | |
| JP2779001B2 (ja) | 樹脂組成物 | |
| JP2008121002A (ja) | 光学成形体 | |
| JP4536226B2 (ja) | スチレン系樹脂組成物 | |
| JPH01163242A (ja) | 組成物 | |
| JPH06184400A (ja) | 樹脂組成物 | |
| JPH0812847A (ja) | 透明マガジンレール | |
| JPH0525360A (ja) | ブロツク共重合体樹脂組成物 | |
| US8153727B2 (en) | Block copolymer, resin composition comprising same, and process for producing the resin composition | |
| EP0126952A1 (en) | Improved polycarbonate blends | |
| JPH0259164B2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |