CA1099486A - Stabilized red phosphorus - Google Patents
Stabilized red phosphorusInfo
- Publication number
- CA1099486A CA1099486A CA322,904A CA322904A CA1099486A CA 1099486 A CA1099486 A CA 1099486A CA 322904 A CA322904 A CA 322904A CA 1099486 A CA1099486 A CA 1099486A
- Authority
- CA
- Canada
- Prior art keywords
- hydroxide
- red phosphorus
- weight
- lead
- phosphorus
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 title claims abstract description 59
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 claims abstract description 25
- 229910021514 lead(II) hydroxide Inorganic materials 0.000 claims abstract description 17
- 239000000203 mixture Substances 0.000 claims abstract description 17
- 230000003647 oxidation Effects 0.000 claims abstract description 12
- 238000007254 oxidation reaction Methods 0.000 claims abstract description 12
- 239000003381 stabilizer Substances 0.000 claims abstract description 12
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims abstract description 10
- 229910052593 corundum Inorganic materials 0.000 claims abstract description 10
- 229910001845 yogo sapphire Inorganic materials 0.000 claims abstract description 10
- 229910000000 metal hydroxide Inorganic materials 0.000 claims abstract description 8
- 150000004692 metal hydroxides Chemical class 0.000 claims abstract description 8
- 239000002245 particle Substances 0.000 claims abstract description 7
- 229910052698 phosphorus Inorganic materials 0.000 claims description 9
- 239000011574 phosphorus Substances 0.000 claims description 9
- 235000014786 phosphorus Nutrition 0.000 claims description 9
- 229910021502 aluminium hydroxide Inorganic materials 0.000 claims 1
- 229940024545 aluminum hydroxide Drugs 0.000 abstract 3
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 22
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 16
- 238000000034 method Methods 0.000 description 13
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 12
- 239000007864 aqueous solution Substances 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- 229910001629 magnesium chloride Inorganic materials 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- 230000000052 comparative effect Effects 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000007900 aqueous suspension Substances 0.000 description 5
- 239000012065 filter cake Substances 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 4
- 230000000087 stabilizing effect Effects 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical class OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 3
- 230000002411 adverse Effects 0.000 description 3
- 229910000329 aluminium sulfate Inorganic materials 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 150000004679 hydroxides Chemical class 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- JJLJMEJHUUYSSY-UHFFFAOYSA-L Copper hydroxide Chemical compound [OH-].[OH-].[Cu+2] JJLJMEJHUUYSSY-UHFFFAOYSA-L 0.000 description 2
- 239000005750 Copper hydroxide Substances 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910001956 copper hydroxide Inorganic materials 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 2
- 239000000347 magnesium hydroxide Substances 0.000 description 2
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 2
- KJFMBFZCATUALV-UHFFFAOYSA-N phenolphthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2C(=O)O1 KJFMBFZCATUALV-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000005749 Copper compound Substances 0.000 description 1
- 239000005751 Copper oxide Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 150000001880 copper compounds Chemical class 0.000 description 1
- 229910000431 copper oxide Inorganic materials 0.000 description 1
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 1
- VURFVHCLMJOLKN-UHFFFAOYSA-N diphosphane Chemical compound PP VURFVHCLMJOLKN-UHFFFAOYSA-N 0.000 description 1
- 238000007323 disproportionation reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 230000000266 injurious effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- YFDLHELOZYVNJE-UHFFFAOYSA-L mercury diiodide Chemical compound I[Hg]I YFDLHELOZYVNJE-UHFFFAOYSA-L 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006557 surface reaction Methods 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- AALQBIFJJJPDHJ-UHFFFAOYSA-K trisodium;thiophosphate;dodecahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[Na+].[O-]P([O-])([O-])=S AALQBIFJJJPDHJ-UHFFFAOYSA-K 0.000 description 1
- 229910021511 zinc hydroxide Inorganic materials 0.000 description 1
- 229940007718 zinc hydroxide Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B25/00—Phosphorus; Compounds thereof
- C01B25/003—Phosphorus
- C01B25/006—Stabilisation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
- Compounds Of Alkaline-Earth Elements, Aluminum Or Rare-Earth Metals (AREA)
- Cosmetics (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782813151 DE2813151A1 (de) | 1978-03-25 | 1978-03-25 | Stabilisierter roter phosphor |
| DEP2813151.3 | 1978-03-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1099486A true CA1099486A (en) | 1981-04-21 |
Family
ID=6035474
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA322,904A Expired CA1099486A (en) | 1978-03-25 | 1979-03-07 | Stabilized red phosphorus |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4210630A (enExample) |
| EP (1) | EP0004305B1 (enExample) |
| JP (1) | JPS54133496A (enExample) |
| CA (1) | CA1099486A (enExample) |
| DE (2) | DE2813151A1 (enExample) |
| IN (1) | IN150967B (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2945118C2 (de) * | 1979-11-08 | 1981-12-03 | Hoechst Ag, 6000 Frankfurt | Stabilisierter roter Phosphor sowie Verfahren zu seiner Herstellung |
| US4356282A (en) * | 1981-07-06 | 1982-10-26 | Allied Corporation | Phosphine suppressants for polymeric compositions including red phosphorus as a flame retardant |
| CA1178788A (en) * | 1982-06-29 | 1984-12-04 | Erco Industries Limited | Stabilization of red phosphorus |
| US4421728A (en) * | 1982-07-07 | 1983-12-20 | Erco Industries Limited | Stabilization of red phosphorus |
| US4403052A (en) * | 1982-08-30 | 1983-09-06 | Allied Corporation | Injection moldable poly(ethylene terephthalate) |
| CA1214314A (en) * | 1983-12-08 | 1986-11-25 | Helena Twardowska | Stabilization of red phosphorus |
| US4489183A (en) * | 1983-12-13 | 1984-12-18 | Erco Industries Limited | Stabilization of red phosphorus |
| DE3436159A1 (de) * | 1984-10-03 | 1986-04-10 | Hoechst Ag, 6230 Frankfurt | Stabilisierter und phlegmatisierter rieselfaehiger roter phosphor |
| IT1200424B (it) * | 1985-03-19 | 1989-01-18 | Saffa Spa | Fosforo rosso stabilizzato per uso come ritardante di fiamma,particolarmente per composizioni a base di polimeri |
| DE3710170A1 (de) * | 1987-03-27 | 1988-10-13 | Hoechst Ag | Stabilisierter roter phosphor sowie verfahren zu seiner herstellung |
| JP2877821B2 (ja) * | 1988-10-13 | 1999-04-05 | 日本化学工業株式会社 | 安定化赤リンおよびその製造法 |
| DE3900965C1 (enExample) * | 1989-01-14 | 1989-10-19 | Hoechst Ag, 6230 Frankfurt, De | |
| JP3043810U (ja) * | 1997-05-27 | 1997-12-02 | 君代 堀内 | 消音尿瓶器 |
| US20070173572A1 (en) * | 2006-01-20 | 2007-07-26 | General Electric Company | Flame retardant resin composition |
| CN101842416B (zh) | 2007-09-04 | 2013-05-15 | 巴斯夫欧洲公司 | 作为阻燃剂的环状膦 |
| RU2378190C1 (ru) * | 2008-04-21 | 2010-01-10 | Артем Валерианович Баринов | Состав флегматизированного красного фосфора и способ его изготовления |
| CN102471535B (zh) | 2009-07-24 | 2013-12-11 | 巴斯夫欧洲公司 | 在芳族和/或杂芳族环氧树脂中作为阻燃剂的二膦衍生物 |
| US8759411B2 (en) * | 2010-02-01 | 2014-06-24 | Basf Se | Derivatives of diphosphines as flame retardants for polyurethanes |
| ES2502544T3 (es) | 2010-02-01 | 2014-10-03 | Basf Se | Derivados de difosfinas como agentes retardadores de llama para poliuretanos |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2200742A (en) * | 1938-11-21 | 1940-05-14 | Hardy Metallurg Company | Treatment of phosphorus |
| US2645571A (en) * | 1944-01-27 | 1953-07-14 | Martin S Silverstein | Inflammable composition containing red phosphorus |
| US2664344A (en) * | 1944-01-27 | 1953-12-29 | George F Nordblom | Process for stabilizing red phosphorus against oxidation |
| US2635953A (en) * | 1947-10-08 | 1953-04-21 | Martin S Silverstein | Inflammable compositions including red phosphorus |
| US2559684A (en) * | 1949-04-27 | 1951-07-10 | Tennessee Valley Authority | Stabilizing red phosphorus |
| US3218192A (en) * | 1962-03-08 | 1965-11-16 | Sherritt Gordon Mines Ltd | Process of coating phosphorus particles with nickel and/or cobalt |
| DE2622296C2 (de) * | 1976-05-19 | 1984-12-06 | Hoechst Ag, 6230 Frankfurt | Stabilisierter roter Phosphor sowie Verfahren zu seiner Herstellung |
| DE2631532C2 (de) * | 1976-07-14 | 1984-09-13 | Hoechst Ag, 6230 Frankfurt | Stabilisierter pulverförmiger roter Phosphor sowie Verfahren zu seiner Herstellung |
| DE2632296C2 (de) * | 1976-07-17 | 1979-02-01 | Hoechst Ag, 6000 Frankfurt | Stabilisierter roter Phosphor sowie Verfahren zu seiner Herstellung |
-
1978
- 1978-03-25 DE DE19782813151 patent/DE2813151A1/de not_active Withdrawn
-
1979
- 1979-03-05 EP EP79100637A patent/EP0004305B1/de not_active Expired
- 1979-03-05 DE DE7979100637T patent/DE2961295D1/de not_active Expired
- 1979-03-07 CA CA322,904A patent/CA1099486A/en not_active Expired
- 1979-03-17 IN IN262/CAL/79A patent/IN150967B/en unknown
- 1979-03-21 US US06/022,446 patent/US4210630A/en not_active Expired - Lifetime
- 1979-03-23 JP JP3344079A patent/JPS54133496A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE2813151A1 (de) | 1979-09-27 |
| JPS54133496A (en) | 1979-10-17 |
| JPS624323B2 (enExample) | 1987-01-29 |
| IN150967B (enExample) | 1983-01-29 |
| EP0004305B1 (de) | 1981-11-11 |
| US4210630A (en) | 1980-07-01 |
| EP0004305A1 (de) | 1979-10-03 |
| DE2961295D1 (en) | 1982-01-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1099486A (en) | Stabilized red phosphorus | |
| US20150017256A1 (en) | Condensed iron (iii) phosphate | |
| FI73402C (fi) | Foerfarande foer framstaellning av basiskt aluminium(iii)sulfat. | |
| US4931272A (en) | Tooth pastes, cleaning agent for tooth pastes based on dicalcium phosphate-dihydrate, and process for making such cleaning agent | |
| EP0113153B1 (en) | A process for the manufacture of highly pure trimagnesium phosphate octahydrate | |
| US4136154A (en) | Stabilized red phosphorus and process for making it | |
| US4814106A (en) | Manufacture of a basic metal hydroxysulfate complex in solid form | |
| CA1074980A (en) | Stabilized red phosphorus and process for making it | |
| SU999962A3 (ru) | Способ стабилизации порошкообразного красного фосфора | |
| US2271499A (en) | Water-treating compound | |
| EP0339452B1 (de) | Polymere Titanphosphate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Aktivierung von Metalloberflächen vor einer Zinkphosphatierung | |
| US3433586A (en) | Process for the manufacture of magnesium hydrogen-phosphate trihydrate | |
| US4098872A (en) | Stabilized red phosphorus and process for making it | |
| Cate et al. | Effect of impurities on density and viscosity of simulated wet-process phosphoric acid | |
| US5427756A (en) | Process for the preparation of a dicalcium phosphate dihydrate suitable for use in toothpastes | |
| EP0237775A2 (en) | Stable ammonium Polyphosphate liquid fertilizer from merchant grade phosphoric acid | |
| US3554728A (en) | Process for making non-hygroscopic ammonium phosphate | |
| Sullivan et al. | Solubility of. alpha.-calcium sulfate hemihydrate in 40, 45, 50, and 55% P2O5 phosphoric acid solutions at 80, 90, 100, and 110. degree. C | |
| DE2108042A1 (de) | Sequestriermittel | |
| US4521392A (en) | Process for blending phosphoric acids of differing impurity content | |
| DE2831095A1 (de) | Verfahren zur herstellung von kristallinem kryolith | |
| Eberly et al. | The System Zinc Oxide, Phosphorus Pentoxide and Water at 25° and 37°. | |
| US3544298A (en) | Low magnesium ammonium polyphosphate solutions | |
| US3041160A (en) | Stabilized plant nutrient composition | |
| DE3004825A1 (de) | Faellmittel, verfahren zu dessen herstellung und dessen verwendung zur entphosphatisierung von abwasser |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |