CA1095898A - Preparation of azo dyestuffs - Google Patents
Preparation of azo dyestuffsInfo
- Publication number
- CA1095898A CA1095898A CA270,828A CA270828A CA1095898A CA 1095898 A CA1095898 A CA 1095898A CA 270828 A CA270828 A CA 270828A CA 1095898 A CA1095898 A CA 1095898A
- Authority
- CA
- Canada
- Prior art keywords
- atoms
- acid
- halogen
- amino
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000008878 coupling Effects 0.000 claims abstract description 49
- 238000010168 coupling process Methods 0.000 claims abstract description 49
- 238000005859 coupling reaction Methods 0.000 claims abstract description 49
- 238000000034 method Methods 0.000 claims abstract description 49
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 39
- 239000000203 mixture Substances 0.000 claims abstract description 17
- 150000001989 diazonium salts Chemical class 0.000 claims abstract description 16
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 74
- 230000008569 process Effects 0.000 claims description 48
- 125000004432 carbon atom Chemical group C* 0.000 claims description 45
- -1 phenalkoxy Chemical group 0.000 claims description 43
- 239000002904 solvent Substances 0.000 claims description 43
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 claims description 36
- 239000002253 acid Substances 0.000 claims description 25
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 23
- 229910052739 hydrogen Inorganic materials 0.000 claims description 22
- 239000001257 hydrogen Substances 0.000 claims description 22
- 125000003545 alkoxy group Chemical group 0.000 claims description 21
- 229910052736 halogen Inorganic materials 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 19
- 150000002367 halogens Chemical class 0.000 claims description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 16
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 claims description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 11
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 10
- 238000004519 manufacturing process Methods 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 9
- 239000003795 chemical substances by application Substances 0.000 claims description 9
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 8
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 8
- 150000001412 amines Chemical class 0.000 claims description 8
- 150000004982 aromatic amines Chemical class 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 229940124530 sulfonamide Drugs 0.000 claims description 8
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 7
- 235000010288 sodium nitrite Nutrition 0.000 claims description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 6
- 239000000975 dye Substances 0.000 claims description 6
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 6
- 239000011707 mineral Substances 0.000 claims description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- 150000007524 organic acids Chemical class 0.000 claims description 6
- 239000001117 sulphuric acid Substances 0.000 claims description 6
- 235000011149 sulphuric acid Nutrition 0.000 claims description 6
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 claims description 5
- 150000007522 mineralic acids Chemical class 0.000 claims description 5
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 claims description 5
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 4
- 125000005521 carbonamide group Chemical group 0.000 claims description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 4
- 238000011065 in-situ storage Methods 0.000 claims description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 4
- VQTGUFBGYOIUFS-UHFFFAOYSA-N nitrosylsulfuric acid Chemical compound OS(=O)(=O)ON=O VQTGUFBGYOIUFS-UHFFFAOYSA-N 0.000 claims description 4
- 125000004442 acylamino group Chemical group 0.000 claims description 3
- 125000004423 acyloxy group Chemical group 0.000 claims description 3
- 150000008049 diazo compounds Chemical class 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- 125000006678 phenoxycarbonyl group Chemical group 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 2
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 claims description 2
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 claims description 2
- 229940106681 chloroacetic acid Drugs 0.000 claims description 2
- 235000019253 formic acid Nutrition 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 235000019260 propionic acid Nutrition 0.000 claims description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims 2
- AZFNGPAYDKGCRB-XCPIVNJJSA-M [(1s,2s)-2-amino-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide;chlororuthenium(1+);1-methyl-4-propan-2-ylbenzene Chemical compound [Ru+]Cl.CC(C)C1=CC=C(C)C=C1.C1=CC(C)=CC=C1S(=O)(=O)[N-][C@@H](C=1C=CC=CC=1)[C@@H](N)C1=CC=CC=C1 AZFNGPAYDKGCRB-XCPIVNJJSA-M 0.000 claims 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 239000004304 potassium nitrite Substances 0.000 claims 1
- 235000010289 potassium nitrite Nutrition 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 3
- 239000000987 azo dye Substances 0.000 abstract 1
- 239000000306 component Substances 0.000 description 50
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 45
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 27
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 14
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 14
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 11
- 125000005843 halogen group Chemical group 0.000 description 10
- 239000000725 suspension Substances 0.000 description 9
- AJHPGXZOIAYYDW-UHFFFAOYSA-N 3-(2-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)NC(C(O)=O)CC1=CC=CC=C1C#N AJHPGXZOIAYYDW-UHFFFAOYSA-N 0.000 description 8
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 8
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 8
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 8
- 229960000443 hydrochloric acid Drugs 0.000 description 7
- 235000011167 hydrochloric acid Nutrition 0.000 description 7
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical compound NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 6
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 6
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 6
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 5
- 235000010755 mineral Nutrition 0.000 description 5
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 229960004050 aminobenzoic acid Drugs 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 238000000053 physical method Methods 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000001632 sodium acetate Substances 0.000 description 4
- 235000017281 sodium acetate Nutrition 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- MGCGMYPNXAFGFA-UHFFFAOYSA-N 2-amino-5-nitrobenzonitrile Chemical compound NC1=CC=C([N+]([O-])=O)C=C1C#N MGCGMYPNXAFGFA-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- QKIUAMUSENSFQQ-UHFFFAOYSA-N dimethylazanide Chemical compound C[N-]C QKIUAMUSENSFQQ-UHFFFAOYSA-N 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000011592 zinc chloride Substances 0.000 description 3
- 235000005074 zinc chloride Nutrition 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- KBJGBAOGDZOYIZ-UHFFFAOYSA-N 2,5-dimethoxy-4-[(4-nitrophenyl)diazenyl]aniline Chemical compound C1=C(N)C(OC)=CC(N=NC=2C=CC(=CC=2)[N+]([O-])=O)=C1OC KBJGBAOGDZOYIZ-UHFFFAOYSA-N 0.000 description 2
- NAZDVUBIEPVUKE-UHFFFAOYSA-N 2,5-dimethoxyaniline Chemical compound COC1=CC=C(OC)C(N)=C1 NAZDVUBIEPVUKE-UHFFFAOYSA-N 0.000 description 2
- LOCWBQIWHWIRGN-UHFFFAOYSA-N 2-chloro-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1Cl LOCWBQIWHWIRGN-UHFFFAOYSA-N 0.000 description 2
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 2
- PCWGTDULNUVNBN-UHFFFAOYSA-N 4-methylpentan-1-ol Chemical compound CC(C)CCCO PCWGTDULNUVNBN-UHFFFAOYSA-N 0.000 description 2
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- CWOMTHDOJCARBY-UHFFFAOYSA-N n,n,3-trimethylaniline Chemical compound CN(C)C1=CC=CC(C)=C1 CWOMTHDOJCARBY-UHFFFAOYSA-N 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- AQIXEPGDORPWBJ-UHFFFAOYSA-N pentan-3-ol Chemical compound CCC(O)CC AQIXEPGDORPWBJ-UHFFFAOYSA-N 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 238000001256 steam distillation Methods 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical group OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 2
- MXCCUJSCFMFTNY-UHFFFAOYSA-N (2-amino-4,5-dichlorophenyl)-phenylmethanone Chemical compound NC1=CC(Cl)=C(Cl)C=C1C(=O)C1=CC=CC=C1 MXCCUJSCFMFTNY-UHFFFAOYSA-N 0.000 description 1
- WNMYELHTHAILAM-UHFFFAOYSA-N (2-amino-4,5-dimethoxyphenyl)-phenylmethanone Chemical compound C1=C(OC)C(OC)=CC(N)=C1C(=O)C1=CC=CC=C1 WNMYELHTHAILAM-UHFFFAOYSA-N 0.000 description 1
- MYVQLRNSRCNCJY-UHFFFAOYSA-N (2-amino-4,5-dimethylphenyl)-phenylmethanone Chemical compound C1=C(C)C(C)=CC(N)=C1C(=O)C1=CC=CC=C1 MYVQLRNSRCNCJY-UHFFFAOYSA-N 0.000 description 1
- GFHWOKUXKUUKQJ-UHFFFAOYSA-N (2-amino-4-methoxyphenyl)-phenylmethanone Chemical compound NC1=CC(OC)=CC=C1C(=O)C1=CC=CC=C1 GFHWOKUXKUUKQJ-UHFFFAOYSA-N 0.000 description 1
- MZPDVYDLHYUTQS-UHFFFAOYSA-N (2-amino-5-methylphenyl)-phenylmethanone Chemical compound CC1=CC=C(N)C(C(=O)C=2C=CC=CC=2)=C1 MZPDVYDLHYUTQS-UHFFFAOYSA-N 0.000 description 1
- WIISOMGJWLLMDG-UHFFFAOYSA-N (2-aminophenyl)-(4-bromophenyl)methanone Chemical compound NC1=CC=CC=C1C(=O)C1=CC=C(Br)C=C1 WIISOMGJWLLMDG-UHFFFAOYSA-N 0.000 description 1
- FFFXIQFESQNINT-UHFFFAOYSA-N (2-aminophenyl)-(4-fluorophenyl)methanone Chemical compound NC1=CC=CC=C1C(=O)C1=CC=C(F)C=C1 FFFXIQFESQNINT-UHFFFAOYSA-N 0.000 description 1
- MAOBFOXLCJIFLV-UHFFFAOYSA-N (2-aminophenyl)-phenylmethanone Chemical compound NC1=CC=CC=C1C(=O)C1=CC=CC=C1 MAOBFOXLCJIFLV-UHFFFAOYSA-N 0.000 description 1
- HFZPYPRRAVDPBX-UHFFFAOYSA-N (3-aminophenyl)-(3,4-dimethoxyphenyl)methanone Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)C1=CC=CC(N)=C1 HFZPYPRRAVDPBX-UHFFFAOYSA-N 0.000 description 1
- GHHYIYWROJLOLU-UHFFFAOYSA-N (3-aminophenyl)-(4-methoxyphenyl)methanone Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC=CC(N)=C1 GHHYIYWROJLOLU-UHFFFAOYSA-N 0.000 description 1
- FUADXEJBHCKVBN-UHFFFAOYSA-N (3-aminophenyl)-phenylmethanone Chemical compound NC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 FUADXEJBHCKVBN-UHFFFAOYSA-N 0.000 description 1
- RMFTYYHNIRHQGJ-UHFFFAOYSA-N (4-amino-2-methylphenyl)-phenylmethanone Chemical compound CC1=CC(N)=CC=C1C(=O)C1=CC=CC=C1 RMFTYYHNIRHQGJ-UHFFFAOYSA-N 0.000 description 1
- ROOYXYKMLWEXIU-UHFFFAOYSA-N (4-amino-3,5-dibromophenyl)-phenylmethanone Chemical compound C1=C(Br)C(N)=C(Br)C=C1C(=O)C1=CC=CC=C1 ROOYXYKMLWEXIU-UHFFFAOYSA-N 0.000 description 1
- LMYUWPOFHRFDHX-UHFFFAOYSA-N (4-amino-3-chlorophenyl)-phenylmethanone Chemical compound C1=C(Cl)C(N)=CC=C1C(=O)C1=CC=CC=C1 LMYUWPOFHRFDHX-UHFFFAOYSA-N 0.000 description 1
- HHFUALNALCAZLO-UHFFFAOYSA-N (4-aminophenyl)-(2,4-dichlorophenyl)methanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=C(Cl)C=C1Cl HHFUALNALCAZLO-UHFFFAOYSA-N 0.000 description 1
- BBUQOIDPQZFKKY-UHFFFAOYSA-N (4-aminophenyl)-(4-chlorophenyl)methanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=C(Cl)C=C1 BBUQOIDPQZFKKY-UHFFFAOYSA-N 0.000 description 1
- IZSRTZLNLWGKMS-UHFFFAOYSA-N (4-aminophenyl)-(4-methoxyphenyl)methanone Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC=C(N)C=C1 IZSRTZLNLWGKMS-UHFFFAOYSA-N 0.000 description 1
- LOWKEYACSTXUQV-UHFFFAOYSA-N (4-aminophenyl)-(4-propan-2-ylphenyl)methanone Chemical compound C1=CC(C(C)C)=CC=C1C(=O)C1=CC=C(N)C=C1 LOWKEYACSTXUQV-UHFFFAOYSA-N 0.000 description 1
- RBKHNGHPZZZJCI-UHFFFAOYSA-N (4-aminophenyl)-phenylmethanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=CC=C1 RBKHNGHPZZZJCI-UHFFFAOYSA-N 0.000 description 1
- TZTDJBMGPQLSLI-UHFFFAOYSA-N (4-nitrophenyl)-phenyldiazene Chemical compound C1=CC([N+](=O)[O-])=CC=C1N=NC1=CC=CC=C1 TZTDJBMGPQLSLI-UHFFFAOYSA-N 0.000 description 1
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 1
- GPRYKVSEZCQIHD-UHFFFAOYSA-N 1-(4-aminophenyl)ethanone Chemical compound CC(=O)C1=CC=C(N)C=C1 GPRYKVSEZCQIHD-UHFFFAOYSA-N 0.000 description 1
- QXPVPQPEPUBASJ-UHFFFAOYSA-N 1-[3-amino-5-(diethylamino)-4-methoxyphenyl]ethanone Chemical compound CCN(CC)C1=CC(C(C)=O)=CC(N)=C1OC QXPVPQPEPUBASJ-UHFFFAOYSA-N 0.000 description 1
- GVPODVKBTHCGFU-UHFFFAOYSA-N 2,4,6-tribromoaniline Chemical compound NC1=C(Br)C=C(Br)C=C1Br GVPODVKBTHCGFU-UHFFFAOYSA-N 0.000 description 1
- NATVSFWWYVJTAZ-UHFFFAOYSA-N 2,4,6-trichloroaniline Chemical compound NC1=C(Cl)C=C(Cl)C=C1Cl NATVSFWWYVJTAZ-UHFFFAOYSA-N 0.000 description 1
- LXQOQPGNCGEELI-UHFFFAOYSA-N 2,4-dinitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O LXQOQPGNCGEELI-UHFFFAOYSA-N 0.000 description 1
- JBXZCPXEYAEMJS-UHFFFAOYSA-N 2,5-dichloro-4-nitroaniline Chemical compound NC1=CC(Cl)=C([N+]([O-])=O)C=C1Cl JBXZCPXEYAEMJS-UHFFFAOYSA-N 0.000 description 1
- XPKFTIYOZUJAGA-UHFFFAOYSA-N 2,5-diethoxyaniline Chemical compound CCOC1=CC=C(OCC)C(N)=C1 XPKFTIYOZUJAGA-UHFFFAOYSA-N 0.000 description 1
- LJGRUIQJXXLZIP-UHFFFAOYSA-N 2,5-dimethoxy-4-[(3-nitrophenyl)diazenyl]aniline Chemical compound C1=C(N)C(OC)=CC(N=NC=2C=C(C=CC=2)[N+]([O-])=O)=C1OC LJGRUIQJXXLZIP-UHFFFAOYSA-N 0.000 description 1
- DWXNXVYTEOEXNP-UHFFFAOYSA-N 2,5-dimethoxy-n,n-dimethylaniline Chemical compound COC1=CC=C(OC)C(N(C)C)=C1 DWXNXVYTEOEXNP-UHFFFAOYSA-N 0.000 description 1
- BLMYFSKNJCEZSF-UHFFFAOYSA-N 2,5-dimethyl-4-[(4-methylsulfonylphenyl)diazenyl]aniline Chemical compound C1=C(N)C(C)=CC(N=NC=2C=CC(=CC=2)S(C)(=O)=O)=C1C BLMYFSKNJCEZSF-UHFFFAOYSA-N 0.000 description 1
- YMZIFDLWYUSZCC-UHFFFAOYSA-N 2,6-dibromo-4-nitroaniline Chemical compound NC1=C(Br)C=C([N+]([O-])=O)C=C1Br YMZIFDLWYUSZCC-UHFFFAOYSA-N 0.000 description 1
- CSFKBRKMUJANAJ-UHFFFAOYSA-N 2-(4-methoxyphenyl)sulfonylaniline Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)C1=CC=CC=C1N CSFKBRKMUJANAJ-UHFFFAOYSA-N 0.000 description 1
- DPPWGBLTMPTMLU-UHFFFAOYSA-N 2-(benzenesulfonyl)-4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1S(=O)(=O)C1=CC=CC=C1 DPPWGBLTMPTMLU-UHFFFAOYSA-N 0.000 description 1
- RVDMVLINQHMAGO-UHFFFAOYSA-N 2-(benzenesulfonyl)-5-chloroaniline Chemical compound NC1=CC(Cl)=CC=C1S(=O)(=O)C1=CC=CC=C1 RVDMVLINQHMAGO-UHFFFAOYSA-N 0.000 description 1
- JBCUKQQIWSWEOK-UHFFFAOYSA-N 2-(benzenesulfonyl)aniline Chemical compound NC1=CC=CC=C1S(=O)(=O)C1=CC=CC=C1 JBCUKQQIWSWEOK-UHFFFAOYSA-N 0.000 description 1
- BUHDOMOJOMCPRZ-UHFFFAOYSA-N 2-[(2-chloro-4-nitrophenyl)diazenyl]-5-methoxy-4-methylaniline Chemical compound C1=C(C)C(OC)=CC(N)=C1N=NC1=CC=C([N+]([O-])=O)C=C1Cl BUHDOMOJOMCPRZ-UHFFFAOYSA-N 0.000 description 1
- BPUKIHNFTCELIR-UHFFFAOYSA-N 2-[(4-amino-2,5-dimethylphenyl)diazenyl]-5-nitrobenzonitrile Chemical compound C1=C(N)C(C)=CC(N=NC=2C(=CC(=CC=2)[N+]([O-])=O)C#N)=C1C BPUKIHNFTCELIR-UHFFFAOYSA-N 0.000 description 1
- QYNPSKMCWDQPCD-UHFFFAOYSA-N 2-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-5-nitrobenzonitrile Chemical compound C1=C(N)C(OC)=CC(N=NC=2C(=CC(=CC=2)[N+]([O-])=O)C#N)=C1C QYNPSKMCWDQPCD-UHFFFAOYSA-N 0.000 description 1
- HEQOJEGTZCTHCF-UHFFFAOYSA-N 2-amino-1-phenylethanone Chemical compound NCC(=O)C1=CC=CC=C1 HEQOJEGTZCTHCF-UHFFFAOYSA-N 0.000 description 1
- RIYSFSQPHCAGLS-UHFFFAOYSA-N 2-amino-3,5-dinitrobenzonitrile Chemical compound NC1=C(C#N)C=C([N+]([O-])=O)C=C1[N+]([O-])=O RIYSFSQPHCAGLS-UHFFFAOYSA-N 0.000 description 1
- HWQDHHCUOZZFIG-UHFFFAOYSA-N 2-amino-4-chlorobenzenesulfonamide Chemical compound NC1=CC(Cl)=CC=C1S(N)(=O)=O HWQDHHCUOZZFIG-UHFFFAOYSA-N 0.000 description 1
- HLCPWBZNUKCSBN-UHFFFAOYSA-N 2-aminobenzonitrile Chemical compound NC1=CC=CC=C1C#N HLCPWBZNUKCSBN-UHFFFAOYSA-N 0.000 description 1
- KWMDHCLJYMVBNS-UHFFFAOYSA-N 2-bromo-4,6-dinitroaniline Chemical compound NC1=C(Br)C=C([N+]([O-])=O)C=C1[N+]([O-])=O KWMDHCLJYMVBNS-UHFFFAOYSA-N 0.000 description 1
- CGPPWNTVTNCHDO-UHFFFAOYSA-N 2-bromo-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1Br CGPPWNTVTNCHDO-UHFFFAOYSA-N 0.000 description 1
- LHRIICYSGQGXSX-UHFFFAOYSA-N 2-chloro-4,6-dinitroaniline Chemical compound NC1=C(Cl)C=C([N+]([O-])=O)C=C1[N+]([O-])=O LHRIICYSGQGXSX-UHFFFAOYSA-N 0.000 description 1
- GQIYMZXIGRQTBM-UHFFFAOYSA-N 2-chloro-4-[(3-nitrophenyl)diazenyl]aniline Chemical compound C1=C(Cl)C(N)=CC=C1N=NC1=CC=CC([N+]([O-])=O)=C1 GQIYMZXIGRQTBM-UHFFFAOYSA-N 0.000 description 1
- XZFHJSGCLMJCJL-UHFFFAOYSA-N 2-chloro-4-[(4-nitrophenyl)diazenyl]aniline Chemical compound C1=C(Cl)C(N)=CC=C1N=NC1=CC=C([N+]([O-])=O)C=C1 XZFHJSGCLMJCJL-UHFFFAOYSA-N 0.000 description 1
- VLMRGLCBIFWPGL-UHFFFAOYSA-N 2-chloro-4-methylsulfonylaniline Chemical compound CS(=O)(=O)C1=CC=C(N)C(Cl)=C1 VLMRGLCBIFWPGL-UHFFFAOYSA-N 0.000 description 1
- QDCPXCIPVQJVDD-UHFFFAOYSA-N 2-chloro-n,n-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1Cl QDCPXCIPVQJVDD-UHFFFAOYSA-N 0.000 description 1
- QTKYFMUIBYIHNH-UHFFFAOYSA-N 2-ethoxy-4-[(4-nitrophenyl)diazenyl]aniline Chemical compound C1=C(N)C(OCC)=CC(N=NC=2C=CC(=CC=2)[N+]([O-])=O)=C1 QTKYFMUIBYIHNH-UHFFFAOYSA-N 0.000 description 1
- OWRHDQKCCXTFFE-UHFFFAOYSA-N 2-ethoxy-4-nitroaniline Chemical compound CCOC1=CC([N+]([O-])=O)=CC=C1N OWRHDQKCCXTFFE-UHFFFAOYSA-N 0.000 description 1
- GVBHRNIWBGTNQA-UHFFFAOYSA-N 2-methoxy-4-nitroaniline Chemical compound COC1=CC([N+]([O-])=O)=CC=C1N GVBHRNIWBGTNQA-UHFFFAOYSA-N 0.000 description 1
- FSCJXIVMGQIARL-UHFFFAOYSA-N 2-methoxy-n,n,5-trimethylaniline Chemical compound COC1=CC=C(C)C=C1N(C)C FSCJXIVMGQIARL-UHFFFAOYSA-N 0.000 description 1
- XTTIQGSLJBWVIV-UHFFFAOYSA-N 2-methyl-4-nitroaniline Chemical compound CC1=CC([N+]([O-])=O)=CC=C1N XTTIQGSLJBWVIV-UHFFFAOYSA-N 0.000 description 1
- AUSRSVRJOXYXMI-UHFFFAOYSA-N 2-methylsulfonylaniline Chemical compound CS(=O)(=O)C1=CC=CC=C1N AUSRSVRJOXYXMI-UHFFFAOYSA-N 0.000 description 1
- DLURHXYXQYMPLT-UHFFFAOYSA-N 2-nitro-p-toluidine Chemical compound CC1=CC=C(N)C([N+]([O-])=O)=C1 DLURHXYXQYMPLT-UHFFFAOYSA-N 0.000 description 1
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 1
- NMFFUUFPJJOWHK-UHFFFAOYSA-N 2-phenoxyaniline Chemical compound NC1=CC=CC=C1OC1=CC=CC=C1 NMFFUUFPJJOWHK-UHFFFAOYSA-N 0.000 description 1
- CKQHAYFOPRIUOM-UHFFFAOYSA-N 3'-Aminoacetophenone Chemical compound CC(=O)C1=CC=CC(N)=C1 CKQHAYFOPRIUOM-UHFFFAOYSA-N 0.000 description 1
- CDIDGWDGQGVCIB-UHFFFAOYSA-N 3,5-bis(trifluoromethyl)aniline Chemical compound NC1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 CDIDGWDGQGVCIB-UHFFFAOYSA-N 0.000 description 1
- XMTQQYYKAHVGBJ-UHFFFAOYSA-N 3-(3,4-DICHLOROPHENYL)-1,1-DIMETHYLUREA Chemical compound CN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XMTQQYYKAHVGBJ-UHFFFAOYSA-N 0.000 description 1
- BVBNVJODBSVTMQ-UHFFFAOYSA-N 3-(benzenesulfonyl)-4-chloroaniline Chemical compound NC1=CC=C(Cl)C(S(=O)(=O)C=2C=CC=CC=2)=C1 BVBNVJODBSVTMQ-UHFFFAOYSA-N 0.000 description 1
- RNDWVSUBNRMXMN-UHFFFAOYSA-N 3-(benzenesulfonyl)aniline Chemical compound NC1=CC=CC(S(=O)(=O)C=2C=CC=CC=2)=C1 RNDWVSUBNRMXMN-UHFFFAOYSA-N 0.000 description 1
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 1
- HCZDHXMDYWZPPN-UHFFFAOYSA-N 3-amino-4-methylbenzenesulfonamide Chemical compound CC1=CC=C(S(N)(=O)=O)C=C1N HCZDHXMDYWZPPN-UHFFFAOYSA-N 0.000 description 1
- DTNODBHGOLWROS-UHFFFAOYSA-N 3-amino-4-methylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1N DTNODBHGOLWROS-UHFFFAOYSA-N 0.000 description 1
- NJXPYZHXZZCTNI-UHFFFAOYSA-N 3-aminobenzonitrile Chemical compound NC1=CC=CC(C#N)=C1 NJXPYZHXZZCTNI-UHFFFAOYSA-N 0.000 description 1
- LCQJHMPLVSBWDG-UHFFFAOYSA-N 3-chloro-4-[(4-nitrophenyl)diazenyl]aniline Chemical compound ClC1=CC(N)=CC=C1N=NC1=CC=C([N+]([O-])=O)C=C1 LCQJHMPLVSBWDG-UHFFFAOYSA-N 0.000 description 1
- USPVTJCHQHJFBQ-UHFFFAOYSA-N 3-chloro-n,n-diethylaniline Chemical compound CCN(CC)C1=CC=CC(Cl)=C1 USPVTJCHQHJFBQ-UHFFFAOYSA-N 0.000 description 1
- CHHCCYVOJBBCIY-UHFFFAOYSA-N 3-chloro-n,n-dimethylaniline Chemical compound CN(C)C1=CC=CC(Cl)=C1 CHHCCYVOJBBCIY-UHFFFAOYSA-N 0.000 description 1
- FRKPCXYPIHAOFI-UHFFFAOYSA-N 3-methylaniline Chemical compound [CH2]C1=CC=CC(N)=C1 FRKPCXYPIHAOFI-UHFFFAOYSA-N 0.000 description 1
- MBNPJRQKQLLRIS-UHFFFAOYSA-N 3-methylsulfonylaniline Chemical compound CS(=O)(=O)C1=CC=CC(N)=C1 MBNPJRQKQLLRIS-UHFFFAOYSA-N 0.000 description 1
- XJCVRTZCHMZPBD-UHFFFAOYSA-N 3-nitroaniline Chemical compound NC1=CC=CC([N+]([O-])=O)=C1 XJCVRTZCHMZPBD-UHFFFAOYSA-N 0.000 description 1
- CHFQGCGWPRNPEV-UHFFFAOYSA-N 4-(2,4-dichlorophenyl)sulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(Cl)C=C1Cl CHFQGCGWPRNPEV-UHFFFAOYSA-N 0.000 description 1
- YTPKVTAYQVPKRC-UHFFFAOYSA-N 4-(2,4-dimethylphenyl)sulfonylaniline Chemical compound CC1=CC(C)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 YTPKVTAYQVPKRC-UHFFFAOYSA-N 0.000 description 1
- VFLNKDLFYDLRAN-UHFFFAOYSA-N 4-(2-methoxyphenyl)morpholine Chemical compound COC1=CC=CC=C1N1CCOCC1 VFLNKDLFYDLRAN-UHFFFAOYSA-N 0.000 description 1
- BOAGUMGJQAXAEN-UHFFFAOYSA-N 4-(2-methylphenyl)morpholine Chemical compound CC1=CC=CC=C1N1CCOCC1 BOAGUMGJQAXAEN-UHFFFAOYSA-N 0.000 description 1
- SBIYLJBIZZNZJV-UHFFFAOYSA-N 4-(3,5-dimethoxyphenyl)sulfonylaniline Chemical compound COC1=CC(OC)=CC(S(=O)(=O)C=2C=CC(N)=CC=2)=C1 SBIYLJBIZZNZJV-UHFFFAOYSA-N 0.000 description 1
- SLLROKBZDFNQKS-UHFFFAOYSA-N 4-(3-chloro-4-methoxyphenyl)sulfonylaniline Chemical compound C1=C(Cl)C(OC)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 SLLROKBZDFNQKS-UHFFFAOYSA-N 0.000 description 1
- NQFSNUDQTQPXEH-UHFFFAOYSA-N 4-(4-bromophenyl)sulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(Br)C=C1 NQFSNUDQTQPXEH-UHFFFAOYSA-N 0.000 description 1
- ORNBLDOMRJHPEJ-UHFFFAOYSA-N 4-(4-ethoxyphenyl)sulfonylaniline Chemical compound C1=CC(OCC)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 ORNBLDOMRJHPEJ-UHFFFAOYSA-N 0.000 description 1
- YKLGSFACDTUTPG-UHFFFAOYSA-N 4-(4-fluorophenyl)sulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(F)C=C1 YKLGSFACDTUTPG-UHFFFAOYSA-N 0.000 description 1
- YYLYFXLKPZKSKS-UHFFFAOYSA-N 4-(4-methoxyphenyl)sulfonylaniline Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 YYLYFXLKPZKSKS-UHFFFAOYSA-N 0.000 description 1
- UNBOSJFEZZJZLR-UHFFFAOYSA-N 4-(4-nitrophenylazo)aniline Chemical compound C1=CC(N)=CC=C1N=NC1=CC=C([N+]([O-])=O)C=C1 UNBOSJFEZZJZLR-UHFFFAOYSA-N 0.000 description 1
- DWWGJHXZOJHWGD-UHFFFAOYSA-N 4-(4-propan-2-ylphenyl)sulfonylaniline Chemical compound C1=CC(C(C)C)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 DWWGJHXZOJHWGD-UHFFFAOYSA-N 0.000 description 1
- ZTRAJLSKTRODJV-UHFFFAOYSA-N 4-(benzenesulfonyl)-2-bromoaniline Chemical compound C1=C(Br)C(N)=CC=C1S(=O)(=O)C1=CC=CC=C1 ZTRAJLSKTRODJV-UHFFFAOYSA-N 0.000 description 1
- GSAJEKJYZRJZJB-UHFFFAOYSA-N 4-(benzenesulfonyl)-2-chloroaniline Chemical compound C1=C(Cl)C(N)=CC=C1S(=O)(=O)C1=CC=CC=C1 GSAJEKJYZRJZJB-UHFFFAOYSA-N 0.000 description 1
- GDYFDXDATVPPDR-UHFFFAOYSA-N 4-(benzenesulfonyl)aniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=CC=C1 GDYFDXDATVPPDR-UHFFFAOYSA-N 0.000 description 1
- QPQKUYVSJWQSDY-CCEZHUSRSA-N 4-(phenylazo)aniline Chemical compound C1=CC(N)=CC=C1\N=N\C1=CC=CC=C1 QPQKUYVSJWQSDY-CCEZHUSRSA-N 0.000 description 1
- QIKYZXDTTPVVAC-UHFFFAOYSA-N 4-Aminobenzamide Chemical compound NC(=O)C1=CC=C(N)C=C1 QIKYZXDTTPVVAC-UHFFFAOYSA-N 0.000 description 1
- JVLGUIWROBTYCW-UHFFFAOYSA-N 4-[(2,4-dinitrophenyl)diazenyl]-2,5-dimethylaniline Chemical compound C1=C(N)C(C)=CC(N=NC=2C(=CC(=CC=2)[N+]([O-])=O)[N+]([O-])=O)=C1C JVLGUIWROBTYCW-UHFFFAOYSA-N 0.000 description 1
- BYEHWCITIPHVND-UHFFFAOYSA-N 4-[(2,4-dinitrophenyl)diazenyl]-2-methoxy-5-methylaniline Chemical compound C1=C(N)C(OC)=CC(N=NC=2C(=CC(=CC=2)[N+]([O-])=O)[N+]([O-])=O)=C1C BYEHWCITIPHVND-UHFFFAOYSA-N 0.000 description 1
- MBSQWEZGKMQQHH-UHFFFAOYSA-N 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-2,5-dimethoxyaniline Chemical compound C1=C(N)C(OC)=CC(N=NC=2C(=CC(=CC=2Cl)[N+]([O-])=O)Cl)=C1OC MBSQWEZGKMQQHH-UHFFFAOYSA-N 0.000 description 1
- GABKNLFBDMSYAA-UHFFFAOYSA-N 4-[(2-chloro-4-nitrophenyl)diazenyl]-3-methylaniline Chemical compound CC1=CC(N)=CC=C1N=NC1=CC=C([N+]([O-])=O)C=C1Cl GABKNLFBDMSYAA-UHFFFAOYSA-N 0.000 description 1
- BWLJQKMBEKOWBH-UHFFFAOYSA-N 4-[(4-nitrophenyl)diazenyl]-3-propan-2-ylaniline Chemical compound CC(C)C1=CC(N)=CC=C1N=NC1=CC=C([N+]([O-])=O)C=C1 BWLJQKMBEKOWBH-UHFFFAOYSA-N 0.000 description 1
- VRURJMIKPGODDI-UHFFFAOYSA-N 4-[[4-(2-methylpropyl)phenyl]diazenyl]aniline Chemical compound C1=CC(CC(C)C)=CC=C1N=NC1=CC=C(N)C=C1 VRURJMIKPGODDI-UHFFFAOYSA-N 0.000 description 1
- YJPKSWNLIDWGNJ-UHFFFAOYSA-N 4-[[4-(trifluoromethyl)phenyl]diazenyl]aniline Chemical compound C1=CC(N)=CC=C1N=NC1=CC=C(C(F)(F)F)C=C1 YJPKSWNLIDWGNJ-UHFFFAOYSA-N 0.000 description 1
- QDNOBTKJPANVQD-UHFFFAOYSA-N 4-amino-2-chloro-5-nitrobenzonitrile Chemical compound NC1=CC(Cl)=C(C#N)C=C1[N+]([O-])=O QDNOBTKJPANVQD-UHFFFAOYSA-N 0.000 description 1
- COFNCCWGWXFACE-UHFFFAOYSA-N 4-amino-3,5-dichlorobenzonitrile Chemical compound NC1=C(Cl)C=C(C#N)C=C1Cl COFNCCWGWXFACE-UHFFFAOYSA-N 0.000 description 1
- MBZDCUMFFPWLTJ-UHFFFAOYSA-N 4-amino-3-methylbenzonitrile Chemical compound CC1=CC(C#N)=CC=C1N MBZDCUMFFPWLTJ-UHFFFAOYSA-N 0.000 description 1
- LTFVELCIFWEGGA-UHFFFAOYSA-N 4-amino-n,n-diethylbenzenesulfonamide Chemical compound CCN(CC)S(=O)(=O)C1=CC=C(N)C=C1 LTFVELCIFWEGGA-UHFFFAOYSA-N 0.000 description 1
- QEPGWLBMAAEBCP-UHFFFAOYSA-N 4-amino-n,n-dimethylbenzamide Chemical compound CN(C)C(=O)C1=CC=C(N)C=C1 QEPGWLBMAAEBCP-UHFFFAOYSA-N 0.000 description 1
- BABGMPQXLCJMSK-UHFFFAOYSA-N 4-amino-n,n-dimethylbenzenesulfonamide Chemical compound CN(C)S(=O)(=O)C1=CC=C(N)C=C1 BABGMPQXLCJMSK-UHFFFAOYSA-N 0.000 description 1
- XAGFYNSCWICYPA-UHFFFAOYSA-N 4-amino-n-methylbenzamide Chemical compound CNC(=O)C1=CC=C(N)C=C1 XAGFYNSCWICYPA-UHFFFAOYSA-N 0.000 description 1
- OISQSDKFWKJEBA-UHFFFAOYSA-N 4-amino-n-methylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC=C(N)C=C1 OISQSDKFWKJEBA-UHFFFAOYSA-N 0.000 description 1
- MTCRMEXPYUBMTJ-UHFFFAOYSA-N 4-amino-n-propan-2-ylbenzamide Chemical compound CC(C)NC(=O)C1=CC=C(N)C=C1 MTCRMEXPYUBMTJ-UHFFFAOYSA-N 0.000 description 1
- IPMNLGOBXWTQRV-UHFFFAOYSA-N 4-aminobenzene-1,3-dicarbonitrile Chemical compound NC1=CC=C(C#N)C=C1C#N IPMNLGOBXWTQRV-UHFFFAOYSA-N 0.000 description 1
- YBAZINRZQSAIAY-UHFFFAOYSA-N 4-aminobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1 YBAZINRZQSAIAY-UHFFFAOYSA-N 0.000 description 1
- WDTRNCFZFQIWLM-UHFFFAOYSA-N 4-benzylaniline Chemical compound C1=CC(N)=CC=C1CC1=CC=CC=C1 WDTRNCFZFQIWLM-UHFFFAOYSA-N 0.000 description 1
- YGUFQYGSBVXPMC-UHFFFAOYSA-N 4-chloro-2,5-dimethoxyaniline Chemical compound COC1=CC(Cl)=C(OC)C=C1N YGUFQYGSBVXPMC-UHFFFAOYSA-N 0.000 description 1
- UYEVWAMADSKING-UHFFFAOYSA-N 4-chloro-2-(4-chlorophenyl)sulfonylaniline Chemical compound NC1=CC=C(Cl)C=C1S(=O)(=O)C1=CC=C(Cl)C=C1 UYEVWAMADSKING-UHFFFAOYSA-N 0.000 description 1
- CVINWVPRKDIGLL-UHFFFAOYSA-N 4-chloro-2-(trifluoromethyl)aniline Chemical compound NC1=CC=C(Cl)C=C1C(F)(F)F CVINWVPRKDIGLL-UHFFFAOYSA-N 0.000 description 1
- FGQDFMQIRCHBHY-UHFFFAOYSA-N 4-chloro-2-methylsulfonylaniline Chemical compound CS(=O)(=O)C1=CC(Cl)=CC=C1N FGQDFMQIRCHBHY-UHFFFAOYSA-N 0.000 description 1
- ISFYBUAVOZFROB-UHFFFAOYSA-N 4-ethoxy-2-nitroaniline Chemical compound CCOC1=CC=C(N)C([N+]([O-])=O)=C1 ISFYBUAVOZFROB-UHFFFAOYSA-N 0.000 description 1
- QFMJFXFXQAFGBO-UHFFFAOYSA-N 4-methoxy-2-nitroaniline Chemical compound COC1=CC=C(N)C([N+]([O-])=O)=C1 QFMJFXFXQAFGBO-UHFFFAOYSA-N 0.000 description 1
- XJEVFFNOMKXBLU-UHFFFAOYSA-N 4-methylsulfonylaniline Chemical compound CS(=O)(=O)C1=CC=C(N)C=C1 XJEVFFNOMKXBLU-UHFFFAOYSA-N 0.000 description 1
- WOYZXEVUWXQVNV-UHFFFAOYSA-N 4-phenoxyaniline Chemical compound C1=CC(N)=CC=C1OC1=CC=CC=C1 WOYZXEVUWXQVNV-UHFFFAOYSA-N 0.000 description 1
- FHQRDEDZJIFJAL-UHFFFAOYSA-N 4-phenylmorpholine Chemical compound C1COCCN1C1=CC=CC=C1 FHQRDEDZJIFJAL-UHFFFAOYSA-N 0.000 description 1
- GXMFVMMXHKXSBI-UHFFFAOYSA-N 5-chloro-2-(trifluoromethyl)aniline Chemical compound NC1=CC(Cl)=CC=C1C(F)(F)F GXMFVMMXHKXSBI-UHFFFAOYSA-N 0.000 description 1
- UZEGGYTUIIXOIX-UHFFFAOYSA-N 5-chloro-2-ethoxyaniline Chemical compound CCOC1=CC=C(Cl)C=C1N UZEGGYTUIIXOIX-UHFFFAOYSA-N 0.000 description 1
- WBSMIPLNPSCJFS-UHFFFAOYSA-N 5-chloro-2-methoxyaniline Chemical compound COC1=CC=C(Cl)C=C1N WBSMIPLNPSCJFS-UHFFFAOYSA-N 0.000 description 1
- SXEBHIMOUHBBOS-UHFFFAOYSA-N 5-chloro-2-phenoxyaniline Chemical compound NC1=CC(Cl)=CC=C1OC1=CC=CC=C1 SXEBHIMOUHBBOS-UHFFFAOYSA-N 0.000 description 1
- UVPIFLCYTJSUAG-UHFFFAOYSA-N 5-methoxy-2-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]aniline Chemical compound COC1=CC(N)=C(C)C=C1N=NC1=CC=C(C)C=C1[N+]([O-])=O UVPIFLCYTJSUAG-UHFFFAOYSA-N 0.000 description 1
- ZUJCVBCKDAFTBW-UHFFFAOYSA-N 9-butan-2-ylcarbazole Chemical compound C1=CC=C2N(C(C)CC)C3=CC=CC=C3C2=C1 ZUJCVBCKDAFTBW-UHFFFAOYSA-N 0.000 description 1
- PLAZXGNBGZYJSA-UHFFFAOYSA-N 9-ethylcarbazole Chemical compound C1=CC=C2N(CC)C3=CC=CC=C3C2=C1 PLAZXGNBGZYJSA-UHFFFAOYSA-N 0.000 description 1
- SDFLTYHTFPTIGX-UHFFFAOYSA-N 9-methylcarbazole Chemical compound C1=CC=C2N(C)C3=CC=CC=C3C2=C1 SDFLTYHTFPTIGX-UHFFFAOYSA-N 0.000 description 1
- 101000654316 Centruroides limpidus Beta-toxin Cll2 Proteins 0.000 description 1
- TWLLPUMZVVGILS-UHFFFAOYSA-N Ethyl 2-aminobenzoate Chemical compound CCOC(=O)C1=CC=CC=C1N TWLLPUMZVVGILS-UHFFFAOYSA-N 0.000 description 1
- 101000913968 Ipomoea purpurea Chalcone synthase C Proteins 0.000 description 1
- 101000907988 Petunia hybrida Chalcone-flavanone isomerase C Proteins 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- BLFLLBZGZJTVJG-UHFFFAOYSA-N benzocaine Chemical compound CCOC(=O)C1=CC=C(N)C=C1 BLFLLBZGZJTVJG-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 230000003139 buffering effect Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- BIXZHMJUSMUDOQ-UHFFFAOYSA-N dichloran Chemical compound NC1=C(Cl)C=C([N+]([O-])=O)C=C1Cl BIXZHMJUSMUDOQ-UHFFFAOYSA-N 0.000 description 1
- UZBQIPPOMKBLAS-UHFFFAOYSA-N diethylazanide Chemical compound CC[N-]CC UZBQIPPOMKBLAS-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- WXYUSEKPTVLYDI-UHFFFAOYSA-N ethyl 4-[(4-aminophenyl)diazenyl]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1N=NC1=CC=C(N)C=C1 WXYUSEKPTVLYDI-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229940013688 formic acid Drugs 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- PHTQWCKDNZKARW-UHFFFAOYSA-N isoamylol Chemical compound CC(C)CCO PHTQWCKDNZKARW-UHFFFAOYSA-N 0.000 description 1
- 229940035429 isobutyl alcohol Drugs 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- JJYPMNFTHPTTDI-UHFFFAOYSA-N meta-toluidine Natural products CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 1
- FODZNORQIATQIP-UHFFFAOYSA-N methyl 2-amino-3,5-dichlorobenzoate Chemical compound COC(=O)C1=CC(Cl)=CC(Cl)=C1N FODZNORQIATQIP-UHFFFAOYSA-N 0.000 description 1
- JAVRNIFMYIJXIE-UHFFFAOYSA-N methyl 2-chlorobenzoate Chemical compound COC(=O)C1=CC=CC=C1Cl JAVRNIFMYIJXIE-UHFFFAOYSA-N 0.000 description 1
- LOCJPOYKBUUVKU-UHFFFAOYSA-N methyl 3-amino-4-chlorobenzoate Chemical compound COC(=O)C1=CC=C(Cl)C(N)=C1 LOCJPOYKBUUVKU-UHFFFAOYSA-N 0.000 description 1
- AIUWAOALZYWQBX-UHFFFAOYSA-N methyl 4-amino-3-bromobenzoate Chemical compound COC(=O)C1=CC=C(N)C(Br)=C1 AIUWAOALZYWQBX-UHFFFAOYSA-N 0.000 description 1
- YQYUUNRAPYPAPC-UHFFFAOYSA-N n,n-diethyl-2-methylaniline Chemical compound CCN(CC)C1=CC=CC=C1C YQYUUNRAPYPAPC-UHFFFAOYSA-N 0.000 description 1
- KGFAREHEJGDILZ-UHFFFAOYSA-N n,n-diethyl-3-methoxyaniline Chemical compound CCN(CC)C1=CC=CC(OC)=C1 KGFAREHEJGDILZ-UHFFFAOYSA-N 0.000 description 1
- AFABFCARSKKBAV-UHFFFAOYSA-N n-[3-(dibenzylamino)-4-methoxyphenyl]acetamide Chemical compound COC1=CC=C(NC(C)=O)C=C1N(CC=1C=CC=CC=1)CC1=CC=CC=C1 AFABFCARSKKBAV-UHFFFAOYSA-N 0.000 description 1
- FPUKYOSOAAPHTN-UHFFFAOYSA-N n-[3-(diethylamino)phenyl]acetamide Chemical compound CCN(CC)C1=CC=CC(NC(C)=O)=C1 FPUKYOSOAAPHTN-UHFFFAOYSA-N 0.000 description 1
- IYLBXMXKNUPJAU-UHFFFAOYSA-N n-[3-[benzyl(ethyl)amino]-4-methoxyphenyl]acetamide Chemical compound C=1C(NC(C)=O)=CC=C(OC)C=1N(CC)CC1=CC=CC=C1 IYLBXMXKNUPJAU-UHFFFAOYSA-N 0.000 description 1
- VJRJZSNBEQJSRB-UHFFFAOYSA-N n-[5-amino-2-[(2-cyano-4-nitrophenyl)diazenyl]-4-methoxyphenyl]acetamide Chemical compound C1=C(N)C(OC)=CC(N=NC=2C(=CC(=CC=2)[N+]([O-])=O)C#N)=C1NC(C)=O VJRJZSNBEQJSRB-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 1
- 150000004010 onium ions Chemical class 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- GAHFQFKNJAXQIP-UHFFFAOYSA-N phenyl 4-carbazol-9-ylbenzoate Chemical compound C=1C=C(N2C3=CC=CC=C3C3=CC=CC=C32)C=CC=1C(=O)OC1=CC=CC=C1 GAHFQFKNJAXQIP-UHFFFAOYSA-N 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229940095574 propionic acid Drugs 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- ZMCBYSBVJIMENC-UHFFFAOYSA-N tricaine Chemical compound CCOC(=O)C1=CC=CC(N)=C1 ZMCBYSBVJIMENC-UHFFFAOYSA-N 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/06—Monoazo dyes prepared by diazotising and coupling from coupling components containing amino as the only directing group
- C09B29/08—Amino benzenes
- C09B29/0805—Amino benzenes free of acid groups
- C09B29/0807—Amino benzenes free of acid groups characterised by the amino group
- C09B29/0809—Amino benzenes free of acid groups characterised by the amino group substituted amino group
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/06—Monoazo dyes prepared by diazotising and coupling from coupling components containing amino as the only directing group
- C09B29/08—Amino benzenes
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/34—Monoazo dyes prepared by diazotising and coupling from other coupling components
- C09B29/36—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds
- C09B29/3604—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom
- C09B29/3608—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a five-membered heterocyclic ring with only one nitrogen as heteroatom
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B31/00—Disazo and polyazo dyes of the type A->B->C, A->B->C->D, or the like, prepared by diazotising and coupling
- C09B31/02—Disazo dyes
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B41/00—Special methods of performing the coupling reaction
- C09B41/001—Special methods of performing the coupling reaction characterised by the coupling medium
- C09B41/002—Special methods of performing the coupling reaction characterised by the coupling medium containing a solvent
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2603836A DE2603836C3 (de) | 1976-02-02 | 1976-02-02 | Verfahren zur Herstellung von Azofarbstoffen |
| DEP2603836.8 | 1976-02-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1095898A true CA1095898A (en) | 1981-02-17 |
Family
ID=5968818
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA270,828A Expired CA1095898A (en) | 1976-02-02 | 1977-02-01 | Preparation of azo dyestuffs |
Country Status (11)
| Country | Link |
|---|---|
| JP (1) | JPS5294324A (instruction) |
| BE (1) | BE850983A (instruction) |
| BR (1) | BR7700625A (instruction) |
| CA (1) | CA1095898A (instruction) |
| CH (1) | CH625541A5 (instruction) |
| DE (1) | DE2603836C3 (instruction) |
| FR (1) | FR2339653A1 (instruction) |
| GB (1) | GB1535894A (instruction) |
| IN (1) | IN144273B (instruction) |
| IT (1) | IT1113508B (instruction) |
| NL (1) | NL7700788A (instruction) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2834054A1 (de) * | 1978-08-03 | 1980-02-21 | Cassella Ag | Wasserunloesliche disazofarbstoffe, ihre herstellung und verwendung |
| EP0028464B1 (en) * | 1979-10-26 | 1983-05-25 | Imperial Chemical Industries Plc | Azo dyestuff preparation by phase transfer catalysed coupling in a two-phase medium |
| DE3710176A1 (de) * | 1987-03-27 | 1988-10-13 | Hoechst Ag | Verfahren zur herstellung des lithiumsalzes eines faserreaktiven azofarbstoffes |
| PL169333B1 (pl) * | 1992-05-26 | 1996-07-31 | Inst Chemii Przemyslowej Im Pr | Sposób wytwarzania nowych reaktywnych barwników karbazolowych PL |
| CN103497533A (zh) * | 2013-09-10 | 2014-01-08 | 江苏亚邦染料股份有限公司 | 一类杂环偶氮型分散染料及其应用 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE471540A (instruction) * | 1946-03-01 | |||
| DE1927453U (de) | 1965-07-30 | 1965-11-18 | Fritz Zeller | Abferkelbucht. |
| FR1537367A (fr) * | 1966-09-22 | 1968-08-23 | Ciba Geigy | Procédé de fabrication de colorants azoïques pigmentaires |
| BE759438A (fr) | 1969-11-27 | 1971-05-26 | Geigy Ag J R | Procede de preparation de composes azoiques |
| US3793305A (en) | 1970-09-14 | 1974-02-19 | Du Pont | One-step process of preparing azo dyes by simultaneous diazotization |
| AR206142A1 (es) | 1974-03-08 | 1976-06-30 | Ciba Geigy Ag | Procedimiento para la obtencion de compuestos azoicos |
-
1976
- 1976-02-02 DE DE2603836A patent/DE2603836C3/de not_active Expired
-
1977
- 1977-01-26 NL NL7700788A patent/NL7700788A/xx not_active Application Discontinuation
- 1977-01-31 JP JP886777A patent/JPS5294324A/ja active Pending
- 1977-01-31 IT IT19816/77A patent/IT1113508B/it active
- 1977-01-31 FR FR7702573A patent/FR2339653A1/fr active Granted
- 1977-02-01 GB GB4023/77A patent/GB1535894A/en not_active Expired
- 1977-02-01 CH CH119577A patent/CH625541A5/de not_active IP Right Cessation
- 1977-02-01 BE BE174572A patent/BE850983A/xx unknown
- 1977-02-01 CA CA270,828A patent/CA1095898A/en not_active Expired
- 1977-02-01 IN IN145/CAL/77A patent/IN144273B/en unknown
- 1977-02-01 BR BR7700625A patent/BR7700625A/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2339653A1 (fr) | 1977-08-26 |
| NL7700788A (nl) | 1977-08-04 |
| DE2603836B2 (de) | 1980-01-03 |
| BR7700625A (pt) | 1977-10-04 |
| IT1113508B (it) | 1986-01-20 |
| BE850983A (fr) | 1977-08-01 |
| DE2603836A1 (de) | 1977-08-04 |
| DE2603836C3 (de) | 1980-09-04 |
| GB1535894A (en) | 1978-12-13 |
| CH625541A5 (en) | 1981-09-30 |
| IN144273B (instruction) | 1978-04-22 |
| FR2339653B1 (instruction) | 1979-08-24 |
| JPS5294324A (en) | 1977-08-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2659719A (en) | 2-amino-5-nitrothiazole azo dye compounds | |
| KR100472978B1 (ko) | 아조화합물과그의제조방법 | |
| US3097198A (en) | Azo dyestuffs | |
| CA1095898A (en) | Preparation of azo dyestuffs | |
| US2516303A (en) | Azo compounds containing fluorine | |
| GB1569246A (en) | Process for the preparation of azo reactive dyestuffs | |
| US4124581A (en) | Disazo dyestuffs containing a thiazole central component | |
| US2516302A (en) | Fluorine-containing azo compounds | |
| CA1072085A (en) | Monoazo dyes | |
| US2457823A (en) | Production of pyrazolone azo dyes | |
| US1975160A (en) | Azo dyes and method for their preparation | |
| CA1060000A (en) | Azo pigments | |
| US4250089A (en) | Process for diazotizing aromatic amines | |
| GB1563661A (en) | Process for the preparation of azo dyestuffs | |
| JP2641107B2 (ja) | アゾ顔料の製造方法 | |
| US4063881A (en) | Synthetic polyamide fibres colored with acid azobenzene dyestuffs, containing a N-alkyl (or substituted alkyl)-n-sulphophenoxyalkylamino radical in the para position to the azo linkage | |
| GB1589927A (en) | Disazo-thiazole dyestuffs | |
| US2777855A (en) | Amides of hydroxybenzotriazole carboxylic acids | |
| EP0429614B1 (en) | Azophenyl compounds | |
| US2553261A (en) | Hydroxy-acylamino azo dyestuffs of the naphthalene series and a process of making same | |
| US3158595A (en) | Process of diazotizing, coupling and hydrolyzing | |
| GB1587179A (en) | Preparation of azo dyestuffs | |
| US2024368A (en) | Monoazo dyes and their production | |
| US2384750A (en) | Monoazo acid dyestuffs | |
| GB2024836A (en) | Azo dyes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |