CA1092129A - 1-azolyl-4-hydroxy-butane derivatives and their use as fungicides and bactericides - Google Patents
1-azolyl-4-hydroxy-butane derivatives and their use as fungicides and bactericidesInfo
- Publication number
- CA1092129A CA1092129A CA284,206A CA284206A CA1092129A CA 1092129 A CA1092129 A CA 1092129A CA 284206 A CA284206 A CA 284206A CA 1092129 A CA1092129 A CA 1092129A
- Authority
- CA
- Canada
- Prior art keywords
- butan
- dimethyl
- carbon atoms
- triazol
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- SQDROHRXKNLDLP-UHFFFAOYSA-N 4-(1h-pyrrol-2-yl)butan-1-ol Chemical class OCCCCC1=CC=CN1 SQDROHRXKNLDLP-UHFFFAOYSA-N 0.000 title claims abstract description 6
- 230000000844 anti-bacterial effect Effects 0.000 title abstract description 7
- 239000000417 fungicide Substances 0.000 title abstract description 5
- 239000003899 bactericide agent Substances 0.000 title abstract description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 77
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 41
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 25
- 150000002367 halogens Chemical class 0.000 claims abstract description 20
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 20
- 241000894006 Bacteria Species 0.000 claims abstract description 19
- 241000233866 Fungi Species 0.000 claims abstract description 18
- 238000000034 method Methods 0.000 claims abstract description 17
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 16
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 16
- 239000002253 acid Substances 0.000 claims abstract description 15
- 239000003085 diluting agent Substances 0.000 claims abstract description 15
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims abstract description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 11
- 150000003839 salts Chemical class 0.000 claims abstract description 11
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 10
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 9
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 9
- 239000001257 hydrogen Substances 0.000 claims abstract description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 9
- 125000003884 phenylalkyl group Chemical group 0.000 claims abstract description 8
- 238000002360 preparation method Methods 0.000 claims abstract description 8
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims abstract description 7
- 239000011230 binding agent Substances 0.000 claims abstract description 6
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 4
- 125000003282 alkyl amino group Chemical group 0.000 claims abstract description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 4
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 4
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims abstract description 4
- 125000004663 dialkyl amino group Chemical group 0.000 claims abstract description 4
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims abstract description 4
- 125000005359 phenoxyalkyl group Chemical group 0.000 claims abstract description 4
- DKEKURXRUXRNES-UHFFFAOYSA-N bis(1h-pyrrol-2-yl)methanone Chemical compound C=1C=CNC=1C(=O)C1=CC=CN1 DKEKURXRUXRNES-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000000468 ketone group Chemical group 0.000 claims abstract description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 63
- -1 amino, acetylamino Chemical group 0.000 claims description 23
- 239000000203 mixture Substances 0.000 claims description 20
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 239000004480 active ingredient Substances 0.000 claims description 3
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- IPNJMLBABSYBOU-UHFFFAOYSA-N [4-(2,4-dichlorophenoxy)-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] acetate Chemical compound C1=NC=NN1C(C(=O)C(C)(C)COC(=O)C)OC1=CC=C(Cl)C=C1Cl IPNJMLBABSYBOU-UHFFFAOYSA-N 0.000 claims 1
- NEXSKKJSRRKNFE-UHFFFAOYSA-N [4-(4-chlorophenoxy)-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] acetate Chemical compound C1=NC=NN1C(C(=O)C(C)(C)COC(=O)C)OC1=CC=C(Cl)C=C1 NEXSKKJSRRKNFE-UHFFFAOYSA-N 0.000 claims 1
- MXSQXFMDCNLLFL-UHFFFAOYSA-N [4-(4-chlorophenoxy)-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] acetate;naphthalene-1,5-disulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1S(O)(=O)=O.C1=NC=NN1C(C(=O)C(C)(C)COC(=O)C)OC1=CC=C(Cl)C=C1 MXSQXFMDCNLLFL-UHFFFAOYSA-N 0.000 claims 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 abstract description 13
- 230000003071 parasitic effect Effects 0.000 abstract description 3
- 125000000547 substituted alkyl group Chemical group 0.000 abstract 1
- YXXPNGIZHZHBTQ-UHFFFAOYSA-N butan-2-ol Chemical compound CC[C](C)O YXXPNGIZHZHBTQ-UHFFFAOYSA-N 0.000 description 49
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 33
- 241000196324 Embryophyta Species 0.000 description 17
- 208000015181 infectious disease Diseases 0.000 description 17
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- 239000002904 solvent Substances 0.000 description 15
- 239000000460 chlorine Substances 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- 125000003626 1,2,4-triazol-1-yl group Chemical group [*]N1N=C([H])N=C1[H] 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 241000209219 Hordeum Species 0.000 description 8
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 8
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- XTXIOQSXTHUASF-UHFFFAOYSA-N 3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ol Chemical compound CC(C)(C)C(O)CN1C=NC=N1 XTXIOQSXTHUASF-UHFFFAOYSA-N 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 235000013339 cereals Nutrition 0.000 description 7
- 239000002689 soil Substances 0.000 description 7
- QQJIRQMOCFESJB-UHFFFAOYSA-N 1-(1,2,4-triazol-1-yl)butan-2-ol Chemical compound CCC(O)CN1C=NC=N1 QQJIRQMOCFESJB-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 6
- 229910052794 bromium Inorganic materials 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 241000221785 Erysiphales Species 0.000 description 5
- 235000007340 Hordeum vulgare Nutrition 0.000 description 5
- 230000000855 fungicidal effect Effects 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 241000894007 species Species 0.000 description 5
- 239000007921 spray Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 150000002170 ethers Chemical class 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 229940093956 potassium carbonate Drugs 0.000 description 4
- 235000011181 potassium carbonates Nutrition 0.000 description 4
- 230000001681 protective effect Effects 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 239000004606 Fillers/Extenders Substances 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- BAZVSMNPJJMILC-UHFFFAOYSA-N triadimenol Chemical compound C1=NC=NN1C(C(O)C(C)(C)C)OC1=CC=C(Cl)C=C1 BAZVSMNPJJMILC-UHFFFAOYSA-N 0.000 description 3
- SONDDAUABBDQGR-UHFFFAOYSA-N 3-methyl-1-(1,2,4-triazol-1-yl)butan-2-ol Chemical compound CC(C)C(O)CN1C=NC=N1 SONDDAUABBDQGR-UHFFFAOYSA-N 0.000 description 2
- 241001480061 Blumeria graminis Species 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 206010037888 Rash pustular Diseases 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 241000589652 Xanthomonas oryzae Species 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 229920001577 copolymer Chemical group 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 230000002464 fungitoxic effect Effects 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 238000011081 inoculation Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 244000052769 pathogen Species 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000011814 protection agent Substances 0.000 description 2
- 208000029561 pustule Diseases 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical class ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 230000009885 systemic effect Effects 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- GRIVKQQQLYWJJJ-UHFFFAOYSA-N (4-bromo-2,2-dimethyl-3-oxobutyl) acetate Chemical compound CC(=O)OCC(C)(C)C(=O)CBr GRIVKQQQLYWJJJ-UHFFFAOYSA-N 0.000 description 1
- SJHPCNCNNSSLPL-CSKARUKUSA-N (4e)-4-(ethoxymethylidene)-2-phenyl-1,3-oxazol-5-one Chemical compound O1C(=O)C(=C/OCC)\N=C1C1=CC=CC=C1 SJHPCNCNNSSLPL-CSKARUKUSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ZLQRTRWUURHJJM-UHFFFAOYSA-N 1-(2,5-dichlorophenoxy)-1-imidazol-1-yl-3,3-dimethylbutan-2-one Chemical compound C1=CN=CN1C(C(=O)C(C)(C)C)OC1=CC(Cl)=CC=C1Cl ZLQRTRWUURHJJM-UHFFFAOYSA-N 0.000 description 1
- JRGUJQIBKGUMHR-UHFFFAOYSA-N 1-(4-chlorophenoxy)-1-imidazol-1-yl-3,3-dimethylbutan-2-ol Chemical compound C1=CN=CN1C(C(O)C(C)(C)C)OC1=CC=C(Cl)C=C1 JRGUJQIBKGUMHR-UHFFFAOYSA-N 0.000 description 1
- NFDXQGNDWIPXQL-UHFFFAOYSA-N 1-cyclooctyldiazocane Chemical compound C1CCCCCCC1N1NCCCCCC1 NFDXQGNDWIPXQL-UHFFFAOYSA-N 0.000 description 1
- XNGVVUOZABBKFX-UHFFFAOYSA-N 1-imidazol-1-yl-3,3-dimethyl-1-phenoxybutan-2-one Chemical group C1=CN=CN1C(C(=O)C(C)(C)C)OC1=CC=CC=C1 XNGVVUOZABBKFX-UHFFFAOYSA-N 0.000 description 1
- HAGYXNVNFOULKK-UHFFFAOYSA-N 1-trityl-1,2,4-triazole Chemical compound N1=CN=CN1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 HAGYXNVNFOULKK-UHFFFAOYSA-N 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- LVOIEMWQUNHLRX-UHFFFAOYSA-N 3,3-dimethylbutan-2-one Chemical compound [CH2]C(=O)C(C)(C)C LVOIEMWQUNHLRX-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- 241000235349 Ascomycota Species 0.000 description 1
- 241000221198 Basidiomycota Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000760356 Chytridiomycetes Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 241000221787 Erysiphe Species 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- SVYKKECYCPFKGB-UHFFFAOYSA-N N,N-dimethylcyclohexylamine Chemical compound CN(C)C1CCCCC1 SVYKKECYCPFKGB-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000233654 Oomycetes Species 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 241001503460 Plasmodiophorida Species 0.000 description 1
- 241000896242 Podosphaera Species 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000231139 Pyricularia Species 0.000 description 1
- 239000006004 Quartz sand Substances 0.000 description 1
- 206010039509 Scab Diseases 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241000287436 Turdus merula Species 0.000 description 1
- 241000317942 Venturia <ichneumonid wasp> Species 0.000 description 1
- 241000228452 Venturia inaequalis Species 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 241000589634 Xanthomonas Species 0.000 description 1
- ATKNVCACDFQELJ-UHFFFAOYSA-N [2-(acetyloxymethyl)-4-(4-chlorophenoxy)-2-(4-chlorophenyl)-3-oxo-4-(1,2,4-triazol-1-yl)butyl] acetate Chemical compound C=1C=C(Cl)C=CC=1C(COC(C)=O)(COC(=O)C)C(=O)C(N1N=CN=C1)OC1=CC=C(Cl)C=C1 ATKNVCACDFQELJ-UHFFFAOYSA-N 0.000 description 1
- XJGDGMSHABXLQV-UHFFFAOYSA-N [3-oxo-4-phenoxy-4-(1h-pyrrol-2-yl)butyl] acetate Chemical class C=1C=CNC=1C(C(=O)CCOC(=O)C)OC1=CC=CC=C1 XJGDGMSHABXLQV-UHFFFAOYSA-N 0.000 description 1
- RQFKDIAMKSLDIC-UHFFFAOYSA-N [4-(4-chlorophenoxy)-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] 2,2-dichloroacetate Chemical compound C1=NC=NN1C(C(=O)C(C)(COC(=O)C(Cl)Cl)C)OC1=CC=C(Cl)C=C1 RQFKDIAMKSLDIC-UHFFFAOYSA-N 0.000 description 1
- UKOFEGOWEDZADE-UHFFFAOYSA-N [4-(4-chlorophenoxy)-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] 2-chloroacetate Chemical compound C1=NC=NN1C(C(=O)C(C)(COC(=O)CCl)C)OC1=CC=C(Cl)C=C1 UKOFEGOWEDZADE-UHFFFAOYSA-N 0.000 description 1
- JDGIHZMHXHFQLX-UHFFFAOYSA-N [4-(4-chlorophenoxy)-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] 2-cyanoacetate Chemical compound C1=NC=NN1C(C(=O)C(C)(COC(=O)CC#N)C)OC1=CC=C(Cl)C=C1 JDGIHZMHXHFQLX-UHFFFAOYSA-N 0.000 description 1
- FACIACBCEZLRJA-UHFFFAOYSA-N [4-(4-chlorophenoxy)-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] 2-methylbutanoate Chemical compound C1=NC=NN1C(C(=O)C(C)(C)COC(=O)C(C)CC)OC1=CC=C(Cl)C=C1 FACIACBCEZLRJA-UHFFFAOYSA-N 0.000 description 1
- KFGJFPRSMYPUGJ-UHFFFAOYSA-N [4-(4-chlorophenoxy)-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] 2-phenylacetate Chemical compound C=1C=C(Cl)C=CC=1OC(N1N=CN=C1)C(=O)C(C)(C)COC(=O)CC1=CC=CC=C1 KFGJFPRSMYPUGJ-UHFFFAOYSA-N 0.000 description 1
- WWLGWUXDAAMTGY-UHFFFAOYSA-N [4-(4-chlorophenoxy)-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] 4-chlorobenzoate Chemical compound C=1C=C(Cl)C=CC=1OC(N1N=CN=C1)C(=O)C(C)(C)COC(=O)C1=CC=C(Cl)C=C1 WWLGWUXDAAMTGY-UHFFFAOYSA-N 0.000 description 1
- ZCBGUTFHIJHRHF-UHFFFAOYSA-N [4-(4-chlorophenoxy)-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] cyclohexanecarboxylate Chemical compound C=1C=C(Cl)C=CC=1OC(N1N=CN=C1)C(=O)C(C)(C)COC(=O)C1CCCCC1 ZCBGUTFHIJHRHF-UHFFFAOYSA-N 0.000 description 1
- OAVIDYICAKUBSF-UHFFFAOYSA-N [4-(4-chlorophenoxy)-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] heptadecanoate Chemical compound C1=NC=NN1C(C(=O)C(C)(C)COC(=O)CCCCCCCCCCCCCCCC)OC1=CC=C(Cl)C=C1 OAVIDYICAKUBSF-UHFFFAOYSA-N 0.000 description 1
- XFNALTDYCRPBIR-UHFFFAOYSA-N [4-(4-chlorophenoxy)-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] methylsulfonylformate Chemical compound C1=NC=NN1C(C(=O)C(C)(COC(=O)S(C)(=O)=O)C)OC1=CC=C(Cl)C=C1 XFNALTDYCRPBIR-UHFFFAOYSA-N 0.000 description 1
- WZCORCSXSQTUHE-UHFFFAOYSA-N [4-(4-chlorophenoxy)-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] n-phenylcarbamate Chemical compound C=1C=C(Cl)C=CC=1OC(N1N=CN=C1)C(=O)C(C)(C)COC(=O)NC1=CC=CC=C1 WZCORCSXSQTUHE-UHFFFAOYSA-N 0.000 description 1
- QXJDUMSSPDPWKE-UHFFFAOYSA-N [4-(4-chlorophenoxy)-2,2-dimethyl-3-oxo-4-(1,2,4-triazol-1-yl)butyl] pentanoate Chemical compound C1=NC=NN1C(C(=O)C(C)(C)COC(=O)CCCC)OC1=CC=C(Cl)C=C1 QXJDUMSSPDPWKE-UHFFFAOYSA-N 0.000 description 1
- AZHVXAMBCMPQAS-UHFFFAOYSA-N [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] 2,2-dichloroacetate Chemical compound C1=CN=CN1C(C(=O)C(C)(COC(=O)C(Cl)Cl)C)OC1=CC=C(Cl)C=C1 AZHVXAMBCMPQAS-UHFFFAOYSA-N 0.000 description 1
- AUOHUZVCMWSXKH-UHFFFAOYSA-N [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] 2-chloroacetate Chemical compound C1=CN=CN1C(C(=O)C(C)(COC(=O)CCl)C)OC1=CC=C(Cl)C=C1 AUOHUZVCMWSXKH-UHFFFAOYSA-N 0.000 description 1
- HWZNMVCAWUJGRZ-UHFFFAOYSA-N [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] 4-chlorobenzoate Chemical compound C=1C=C(Cl)C=CC=1OC(N1C=NC=C1)C(=O)C(C)(C)COC(=O)C1=CC=C(Cl)C=C1 HWZNMVCAWUJGRZ-UHFFFAOYSA-N 0.000 description 1
- MVSJGGDHQLNPCQ-UHFFFAOYSA-N [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] decanoate Chemical compound C1=CN=CN1C(C(=O)C(C)(C)COC(=O)CCCCCCCCC)OC1=CC=C(Cl)C=C1 MVSJGGDHQLNPCQ-UHFFFAOYSA-N 0.000 description 1
- PCLZSFXMXMUHPX-UHFFFAOYSA-N [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] n-methylcarbamate Chemical compound C1=CN=CN1C(C(=O)C(C)(C)COC(=O)NC)OC1=CC=C(Cl)C=C1 PCLZSFXMXMUHPX-UHFFFAOYSA-N 0.000 description 1
- RROIGOCONALWHT-UHFFFAOYSA-N [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] n-phenylcarbamate Chemical compound C=1C=C(Cl)C=CC=1OC(N1C=NC=C1)C(=O)C(C)(C)COC(=O)NC1=CC=CC=C1 RROIGOCONALWHT-UHFFFAOYSA-N 0.000 description 1
- UDJYJOYZEUXJAZ-UHFFFAOYSA-N [4-bromo-2,2-dimethyl-4-(2-methyl-5-nitrophenoxy)-3-oxobutyl] acetate Chemical compound CC(=O)OCC(C)(C)C(=O)C(Br)OC1=CC([N+]([O-])=O)=CC=C1C UDJYJOYZEUXJAZ-UHFFFAOYSA-N 0.000 description 1
- WMTKIRIZYKBESJ-UHFFFAOYSA-N [4-bromo-2,2-dimethyl-4-(4-nitrophenoxy)-3-oxobutyl] acetate Chemical compound CC(=O)OCC(C)(C)C(=O)C(Br)OC1=CC=C([N+]([O-])=O)C=C1 WMTKIRIZYKBESJ-UHFFFAOYSA-N 0.000 description 1
- XIYVXQIIPSAFBA-UHFFFAOYSA-N [4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] 2-chloroacetate Chemical compound ClCC(=O)OCC(C)(C)C(=O)C(Br)OC1=CC=C(Cl)C=C1 XIYVXQIIPSAFBA-UHFFFAOYSA-N 0.000 description 1
- SIFUIFJGJRKNSG-UHFFFAOYSA-N [4-bromo-4-(4-cyanophenoxy)-2,2-dimethyl-3-oxobutyl] acetate Chemical compound CC(=O)OCC(C)(C)C(=O)C(Br)OC1=CC=C(C#N)C=C1 SIFUIFJGJRKNSG-UHFFFAOYSA-N 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 150000003974 aralkylamines Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 150000003851 azoles Chemical class 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000010504 bond cleavage reaction Methods 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- MOIPGXQKZSZOQX-UHFFFAOYSA-N carbonyl bromide Chemical class BrC(Br)=O MOIPGXQKZSZOQX-UHFFFAOYSA-N 0.000 description 1
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 229960004106 citric acid Drugs 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 239000012973 diazabicyclooctane Substances 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- QVQGTNFYPJQJNM-UHFFFAOYSA-N dicyclohexylmethanamine Chemical compound C1CCCCC1C(N)C1CCCCC1 QVQGTNFYPJQJNM-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 150000003948 formamides Chemical class 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229960002598 fumaric acid Drugs 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 208000024386 fungal infectious disease Diseases 0.000 description 1
- 231100000162 fungitoxic Toxicity 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000003102 growth factor Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229960000448 lactic acid Drugs 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229940098895 maleic acid Drugs 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- XTEGVFVZDVNBPF-UHFFFAOYSA-N naphthalene-1,5-disulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1S(O)(=O)=O XTEGVFVZDVNBPF-UHFFFAOYSA-N 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 150000004689 octahydrates Chemical class 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 230000004224 protection Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 229960001367 tartaric acid Drugs 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- GIZSHQYTTBQKOQ-UHFFFAOYSA-N threo-Syringoylglycerol Chemical compound COC1=CC(C(O)C(O)CO)=CC(OC)=C1O GIZSHQYTTBQKOQ-UHFFFAOYSA-N 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000004260 weight control Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/64—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with three nitrogen atoms as the only ring hetero atoms
- A01N43/647—Triazoles; Hydrogenated triazoles
- A01N43/653—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Wood Science & Technology (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762635666 DE2635666A1 (de) | 1976-08-07 | 1976-08-07 | 1-azolyl-4-hydroxy-butan-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide und bakterizide |
| DEP2635666.1 | 1977-02-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1092129A true CA1092129A (en) | 1980-12-23 |
Family
ID=5984993
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA284,206A Expired CA1092129A (en) | 1976-08-07 | 1977-08-05 | 1-azolyl-4-hydroxy-butane derivatives and their use as fungicides and bactericides |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US4154842A (enExample) |
| JP (1) | JPS6026111B2 (enExample) |
| AT (1) | AT358873B (enExample) |
| AU (1) | AU512573B2 (enExample) |
| BE (1) | BE857522A (enExample) |
| BR (1) | BR7705204A (enExample) |
| CA (1) | CA1092129A (enExample) |
| CH (1) | CH633276A5 (enExample) |
| CS (1) | CS193492B2 (enExample) |
| DD (1) | DD133390A5 (enExample) |
| DE (1) | DE2635666A1 (enExample) |
| DK (1) | DK352477A (enExample) |
| EG (1) | EG12717A (enExample) |
| FR (1) | FR2360584A1 (enExample) |
| GB (1) | GB1530568A (enExample) |
| HU (1) | HU177286B (enExample) |
| IL (1) | IL52662A (enExample) |
| IT (1) | IT1085360B (enExample) |
| NL (1) | NL7708659A (enExample) |
| PL (1) | PL103506B1 (enExample) |
| PT (1) | PT66887B (enExample) |
| SE (1) | SE7708896L (enExample) |
| TR (1) | TR19208A (enExample) |
| ZA (1) | ZA774736B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2635665A1 (de) * | 1976-08-07 | 1978-02-09 | Bayer Ag | Antimikrobielle mittel |
| DE2713777C3 (de) * | 1977-03-29 | 1979-10-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von l-Azolyl-33-dimethyl-l-phenoxy-butan-2-onen |
| DE2811919A1 (de) * | 1978-03-18 | 1979-09-27 | Bayer Ag | Acylierte 1-azolyl-2-hydroxy-butan- derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| DE2816817A1 (de) * | 1978-04-18 | 1979-10-31 | Bayer Ag | Oximino-triazolyl-aethane, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| DE2832234A1 (de) * | 1978-07-21 | 1980-01-31 | Bayer Ag | Alpha -azolyl-keto-derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| US4215127A (en) * | 1978-11-02 | 1980-07-29 | The Dow Chemical Company | Substituted 1-phenoxy-1-triazolyl-2-butanone compounds and their use as fungicides |
| DE3021516A1 (de) * | 1980-06-07 | 1981-12-24 | Bayer Ag, 5090 Leverkusen | 4-substituierte 3,3-dimethyl-butan-2-one, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukte |
| DE3021551A1 (de) * | 1980-06-07 | 1981-12-24 | Bayer Ag, 5090 Leverkusen | 4-substituierte 1-azolyl-1-phenoxy-3,3-dimethyl-butan-2-one und -ole, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| JPS5758671A (en) * | 1980-09-25 | 1982-04-08 | Ishihara Sangyo Kaisha Ltd | Phenoxyalkylazole type compound and agricultural and gardening fungicide comprising it |
| DE3119390A1 (de) * | 1981-05-15 | 1982-12-09 | Bayer Ag, 5090 Leverkusen | 3-substituierte 1-azolyl-3-methyl-1-phenoxy-butan-2-one und -ole, verfahren zu iher herstellung und ihre verwendung als fungizide |
| EP0086304B1 (en) * | 1982-02-03 | 1986-07-02 | Imperial Chemical Industries Plc | Heterocyclic compounds useful as pesticides and processes for making them |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2041771C3 (de) * | 1970-08-22 | 1979-07-26 | Bayer Ag, 5090 Leverkusen | derivate |
| DE2105490C3 (de) * | 1971-02-05 | 1979-06-13 | Bayer Ag, 5090 Leverkusen | 1 -Imidazolylketonderivate |
| US4038404A (en) * | 1972-09-26 | 1977-07-26 | Bayer Aktiengesellschaft | 1,2,4-triazole antimycotic compositions and use thereof |
| DE2324010C3 (de) * | 1973-05-12 | 1981-10-08 | Bayer Ag, 5090 Leverkusen | 1-Substituierte 2-Triazolyl-2-phenoxyäthanol-Verbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung von Pilzen |
| DE2325156A1 (de) * | 1973-05-18 | 1974-12-05 | Bayer Ag | Fungizide und mikrobizide mittel |
| DE2333354C2 (de) * | 1973-06-30 | 1983-12-15 | Bayer Ag, 5090 Leverkusen | 2-Aryloxy-2-(imidazol-1-yl)-äthanole sowie deren Salze, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide |
| DE2423987C2 (de) * | 1974-05-17 | 1986-01-16 | Bayer Ag, 5090 Leverkusen | Metallkomplexe von Azolyläthern, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
| DE2455955A1 (de) * | 1974-11-27 | 1976-08-12 | Bayer Ag | Fungizide mittel |
| DE2455953A1 (de) * | 1974-11-27 | 1976-08-12 | Bayer Ag | Fungizide mittel |
-
1976
- 1976-08-07 DE DE19762635666 patent/DE2635666A1/de not_active Withdrawn
-
1977
- 1977-07-27 US US05/819,534 patent/US4154842A/en not_active Expired - Lifetime
- 1977-08-02 GB GB32387/77A patent/GB1530568A/en not_active Expired
- 1977-08-02 CH CH951177A patent/CH633276A5/de not_active IP Right Cessation
- 1977-08-03 DD DD77200419A patent/DD133390A5/xx unknown
- 1977-08-03 EG EG458/77A patent/EG12717A/xx active
- 1977-08-04 PT PT66887A patent/PT66887B/pt unknown
- 1977-08-04 IL IL7752662A patent/IL52662A/xx unknown
- 1977-08-04 SE SE7708896A patent/SE7708896L/xx unknown
- 1977-08-04 NL NL7708659A patent/NL7708659A/xx not_active Application Discontinuation
- 1977-08-05 HU HU77BA3565A patent/HU177286B/hu unknown
- 1977-08-05 CA CA284,206A patent/CA1092129A/en not_active Expired
- 1977-08-05 CS CS775200A patent/CS193492B2/cs unknown
- 1977-08-05 ZA ZA00774736A patent/ZA774736B/xx unknown
- 1977-08-05 BR BR7705204A patent/BR7705204A/pt unknown
- 1977-08-05 FR FR7724265A patent/FR2360584A1/fr active Granted
- 1977-08-05 AU AU27650/77A patent/AU512573B2/en not_active Expired
- 1977-08-05 PL PL1977200088A patent/PL103506B1/pl unknown
- 1977-08-05 DK DK352477A patent/DK352477A/da not_active Application Discontinuation
- 1977-08-05 JP JP52093449A patent/JPS6026111B2/ja not_active Expired
- 1977-08-05 IT IT26564/77A patent/IT1085360B/it active
- 1977-08-05 TR TR19208A patent/TR19208A/xx unknown
- 1977-08-05 AT AT576577A patent/AT358873B/de not_active IP Right Cessation
- 1977-08-05 BE BE179935A patent/BE857522A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IT1085360B (it) | 1985-05-28 |
| FR2360584A1 (fr) | 1978-03-03 |
| TR19208A (tr) | 1978-06-23 |
| ZA774736B (en) | 1978-10-25 |
| BE857522A (fr) | 1978-02-06 |
| AU2765077A (en) | 1979-02-08 |
| NL7708659A (nl) | 1978-02-09 |
| JPS5321164A (en) | 1978-02-27 |
| DE2635666A1 (de) | 1978-02-09 |
| EG12717A (en) | 1979-09-30 |
| BR7705204A (pt) | 1978-05-16 |
| CS193492B2 (en) | 1979-10-31 |
| PL200088A1 (pl) | 1978-04-10 |
| ATA576577A (de) | 1980-02-15 |
| PL103506B1 (pl) | 1979-06-30 |
| DK352477A (da) | 1978-02-08 |
| AU512573B2 (en) | 1980-10-16 |
| GB1530568A (en) | 1978-11-01 |
| DD133390A5 (de) | 1979-01-03 |
| JPS6026111B2 (ja) | 1985-06-21 |
| US4154842A (en) | 1979-05-15 |
| SE7708896L (sv) | 1978-02-08 |
| PT66887B (en) | 1979-01-25 |
| AT358873B (de) | 1980-10-10 |
| PT66887A (en) | 1977-09-01 |
| HU177286B (en) | 1981-09-28 |
| CH633276A5 (de) | 1982-11-30 |
| IL52662A (en) | 1981-07-31 |
| FR2360584B1 (enExample) | 1981-01-09 |
| IL52662A0 (en) | 1977-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4548945A (en) | Fungicidally active substituted 1-hydroxyethyl-triazolyl derivatives | |
| CA1092130A (en) | Azolyl-carboxylic acid derivatives and their use as fungicides | |
| US4255434A (en) | Combatting fungi with 1-(azol-1-yl)-4-halo-(1)-phenoxy-butan-2-ones and -ols | |
| IL45133A (en) | 1-phenoxy-1-imidazolyl-alkanol derivatives and their salts process for their preparation and their use as fungicide | |
| US4364955A (en) | Combating fungi with 1-(substituted phenyl)-1-oximino-2-(1,2,4-triazol-1-yl)-ethane | |
| US4945101A (en) | Fungicidal novel hydroxyalkynyl-azolyl derivatives | |
| CA1178587A (en) | Substituted 1-azolyl-butan-2-ones, processes for their preparation and their use as fungicides and as intermediate products | |
| CA1092129A (en) | 1-azolyl-4-hydroxy-butane derivatives and their use as fungicides and bactericides | |
| CA1100975A (en) | Azolyl ether derivatives and their use as fungicides | |
| CA1131233A (en) | Acylated 1-azolyl-2-hydroxy-butane derivatives, processes for their preparation and their use as fungicides | |
| US4587239A (en) | 1-azolyl-3-pyrazolyl-2-propanol fungicides | |
| US4505922A (en) | Triazolealkynol fungicidal agents | |
| US4251540A (en) | Combating crop damaging fungi with α-(4-biphenylyl)-benzyl-azolium salts | |
| CA1185981A (en) | Substituted azolyl-phenoxy derivatives, processes for their preparation, and their use as fungicides | |
| CA1132579A (en) | Halogenated 1-azolyl-1-fluorophenoxy- butane derivatives, a process for their preparation and their use as fungicides | |
| US4622333A (en) | Fungicidal hydroxyalkynyl-azolyl derivatives | |
| US4396624A (en) | Combating fungi with 1-(azol-1-yl)-2-hydroxy-or-keto-1-pyridinyloxy-alkanes | |
| US4559355A (en) | 2-Aryl-2-azolylmethyl-1,3-dioxepine fungicides | |
| CA1189515A (en) | Azolyl-alkenols, a process for their preparation and their use as fungicides | |
| US4500537A (en) | Combating fungi with triazolyl-vinyl ketones and carbinols | |
| CA1088549A (en) | 1-acyloxy-1-phenyl-2-azolyl-ethanes, and their use as fungicides or nematocides | |
| US4428949A (en) | Combating fungi with fluorinated 1-azolylbutane derivatives | |
| CA1214469A (en) | 2-azolylmethyl-1,3-dioxolane and -dioxane derivatives, processes for their preparation, and their use as fungicides | |
| US4360529A (en) | Combating fungi with trisubstituted benzyl oxime ethers | |
| US4596815A (en) | Antifungal azolylmethyl-thienyl-carbinol derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |