CA1090794A - Acylamino derivatives - Google Patents
Acylamino derivativesInfo
- Publication number
- CA1090794A CA1090794A CA253,730A CA253730A CA1090794A CA 1090794 A CA1090794 A CA 1090794A CA 253730 A CA253730 A CA 253730A CA 1090794 A CA1090794 A CA 1090794A
- Authority
- CA
- Canada
- Prior art keywords
- alkyl
- phenyl
- nucleus
- optionally substituted
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000004442 acylamino group Chemical group 0.000 title claims description 12
- 150000001875 compounds Chemical class 0.000 claims abstract description 100
- 238000000034 method Methods 0.000 claims abstract description 54
- 125000001072 heteroaryl group Chemical group 0.000 claims abstract description 28
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 4
- 239000001301 oxygen Substances 0.000 claims abstract description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 52
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 38
- -1 heteroaryl compound Chemical class 0.000 claims description 22
- 229910052736 halogen Inorganic materials 0.000 claims description 21
- 125000003342 alkenyl group Chemical group 0.000 claims description 18
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 18
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 14
- 125000005843 halogen group Chemical group 0.000 claims description 12
- 150000002367 halogens Chemical class 0.000 claims description 12
- 125000006376 (C3-C10) cycloalkyl group Chemical group 0.000 claims description 11
- 239000000126 substance Substances 0.000 claims description 11
- 150000001408 amides Chemical class 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 10
- 125000001424 substituent group Chemical group 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 125000000304 alkynyl group Chemical group 0.000 claims description 7
- 150000003577 thiophenes Chemical class 0.000 claims description 7
- 125000006555 (C3-C5) cycloalkyl group Chemical group 0.000 claims description 6
- 125000005041 acyloxyalkyl group Chemical group 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 6
- 150000003951 lactams Chemical class 0.000 claims description 6
- 150000003233 pyrroles Chemical class 0.000 claims description 6
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 5
- 125000002252 acyl group Chemical group 0.000 claims description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 5
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 125000006413 ring segment Chemical group 0.000 claims description 4
- 230000002152 alkylating effect Effects 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 3
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 230000000269 nucleophilic effect Effects 0.000 claims description 3
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- 125000006255 cyclopropyl carbonyl group Chemical group [H]C1([H])C([H])([H])C1([H])C(*)=O 0.000 claims description 2
- 230000000911 decarboxylating effect Effects 0.000 claims description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 22
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 5
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 claims 3
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims 2
- 125000002853 C1-C4 hydroxyalkyl group Chemical group 0.000 claims 2
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims 1
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 1
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims 1
- 125000000204 (C2-C4) acyl group Chemical group 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 abstract description 14
- 229910052757 nitrogen Inorganic materials 0.000 abstract description 10
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 5
- 239000005864 Sulphur Substances 0.000 abstract description 2
- 230000003266 anti-allergic effect Effects 0.000 abstract description 2
- 125000005842 heteroatom Chemical group 0.000 abstract 1
- 238000004458 analytical method Methods 0.000 description 63
- 239000000460 chlorine Chemical group 0.000 description 39
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 32
- 239000000243 solution Substances 0.000 description 30
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 29
- 239000003921 oil Substances 0.000 description 27
- 235000019198 oils Nutrition 0.000 description 27
- 239000000047 product Substances 0.000 description 25
- 239000000203 mixture Substances 0.000 description 22
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000007787 solid Substances 0.000 description 11
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 229910000104 sodium hydride Inorganic materials 0.000 description 10
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 9
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 8
- 239000012312 sodium hydride Substances 0.000 description 8
- 239000007832 Na2SO4 Substances 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 239000013078 crystal Substances 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- UPZGJLYTRBYTLM-UHFFFAOYSA-M lithium;iodide;dihydrate Chemical compound [Li+].O.O.[I-] UPZGJLYTRBYTLM-UHFFFAOYSA-M 0.000 description 6
- 239000003208 petroleum Substances 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 229940086542 triethylamine Drugs 0.000 description 6
- 230000010933 acylation Effects 0.000 description 5
- 238000005917 acylation reaction Methods 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 235000019439 ethyl acetate Nutrition 0.000 description 5
- 229940093499 ethyl acetate Drugs 0.000 description 5
- 239000007903 gelatin capsule Substances 0.000 description 5
- 239000004615 ingredient Substances 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 description 4
- SMNDYUVBFMFKNZ-UHFFFAOYSA-N 2-furoic acid Chemical compound OC(=O)C1=CC=CO1 SMNDYUVBFMFKNZ-UHFFFAOYSA-N 0.000 description 4
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000006071 cream Substances 0.000 description 4
- OJEYDZBIAYMFFD-UHFFFAOYSA-N cyclopentanecarboxamide Chemical compound NC(=O)C1C[CH]CC1 OJEYDZBIAYMFFD-UHFFFAOYSA-N 0.000 description 4
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 238000011049 filling Methods 0.000 description 4
- 150000002240 furans Chemical class 0.000 description 4
- 125000001188 haloalkyl group Chemical group 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N tert-butyl alcohol Substances CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- 230000001225 therapeutic effect Effects 0.000 description 4
- 229930192474 thiophene Natural products 0.000 description 4
- SMUKODJVMQOSAB-UHFFFAOYSA-N 2-ethylbutanoyl chloride Chemical compound CCC(CC)C(Cl)=O SMUKODJVMQOSAB-UHFFFAOYSA-N 0.000 description 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 239000004255 Butylated hydroxyanisole Substances 0.000 description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Divinylene sulfide Natural products C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 3
- 229940043253 butylated hydroxyanisole Drugs 0.000 description 3
- 235000019282 butylated hydroxyanisole Nutrition 0.000 description 3
- CZBZUDVBLSSABA-UHFFFAOYSA-N butylated hydroxyanisole Chemical compound COC1=CC=C(O)C(C(C)(C)C)=C1.COC1=CC=C(O)C=C1C(C)(C)C CZBZUDVBLSSABA-UHFFFAOYSA-N 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 3
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
- 150000002431 hydrogen Chemical group 0.000 description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 3
- 238000004949 mass spectrometry Methods 0.000 description 3
- 239000008108 microcrystalline cellulose Substances 0.000 description 3
- 229940016286 microcrystalline cellulose Drugs 0.000 description 3
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 3
- 229910003446 platinum oxide Inorganic materials 0.000 description 3
- 239000003380 propellant Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 229960001866 silicon dioxide Drugs 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- WZZBNLYBHUDSHF-DHLKQENFSA-N 1-[(3s,4s)-4-[8-(2-chloro-4-pyrimidin-2-yloxyphenyl)-7-fluoro-2-methylimidazo[4,5-c]quinolin-1-yl]-3-fluoropiperidin-1-yl]-2-hydroxyethanone Chemical compound CC1=NC2=CN=C3C=C(F)C(C=4C(=CC(OC=5N=CC=CN=5)=CC=4)Cl)=CC3=C2N1[C@H]1CCN(C(=O)CO)C[C@@H]1F WZZBNLYBHUDSHF-DHLKQENFSA-N 0.000 description 2
- QLSWIGRIBOSFMV-UHFFFAOYSA-N 1h-pyrrol-2-amine Chemical class NC1=CC=CN1 QLSWIGRIBOSFMV-UHFFFAOYSA-N 0.000 description 2
- RWHMERFQXIXANG-UHFFFAOYSA-N 2-[2-(cyclohexanecarbonylamino)-5-phenylthiophen-3-yl]acetic acid Chemical compound OC(=O)CC=1C=C(C=2C=CC=CC=2)SC=1NC(=O)C1CCCCC1 RWHMERFQXIXANG-UHFFFAOYSA-N 0.000 description 2
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 2
- LSBDFXRDZJMBSC-UHFFFAOYSA-N 2-phenylacetamide Chemical compound NC(=O)CC1=CC=CC=C1 LSBDFXRDZJMBSC-UHFFFAOYSA-N 0.000 description 2
- IHCCAYCGZOLTEU-UHFFFAOYSA-N 3-furoic acid Chemical compound OC(=O)C=1C=COC=1 IHCCAYCGZOLTEU-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 208000001718 Immediate Hypersensitivity Diseases 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- ZTHYODDOHIVTJV-UHFFFAOYSA-N Propyl gallate Chemical compound CCCOC(=O)C1=CC(O)=C(O)C(O)=C1 ZTHYODDOHIVTJV-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- 206010045240 Type I hypersensitivity Diseases 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 208000010216 atopic IgE responsiveness Diseases 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 2
- WEPUZBYKXNKSDH-UHFFFAOYSA-N cyclopentanecarbonyl chloride Chemical compound ClC(=O)C1CCCC1 WEPUZBYKXNKSDH-UHFFFAOYSA-N 0.000 description 2
- AIMMVWOEOZMVMS-UHFFFAOYSA-N cyclopropanecarboxamide Chemical compound NC(=O)C1CC1 AIMMVWOEOZMVMS-UHFFFAOYSA-N 0.000 description 2
- 238000006114 decarboxylation reaction Methods 0.000 description 2
- 229940087091 dichlorotetrafluoroethane Drugs 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- LZCLXQDLBQLTDK-UHFFFAOYSA-N ethyl 2-hydroxypropanoate Chemical compound CCOC(=O)C(C)O LZCLXQDLBQLTDK-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- UTVVREMVDJTZAC-UHFFFAOYSA-N furan-2-amine Chemical class NC1=CC=CO1 UTVVREMVDJTZAC-UHFFFAOYSA-N 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229940014259 gelatin Drugs 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- AEDIXYWIVPYNBI-UHFFFAOYSA-N heptanamide Chemical compound CCCCCCC(N)=O AEDIXYWIVPYNBI-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- GHPDMFBHITXJAZ-UHFFFAOYSA-N methyl 2-amino-5-methylthiophene-3-carboxylate Chemical compound COC(=O)C=1C=C(C)SC=1N GHPDMFBHITXJAZ-UHFFFAOYSA-N 0.000 description 2
- OEGTUIAPKPUIOI-UHFFFAOYSA-N n-(1-methylpyrrol-2-yl)acetamide Chemical compound CC(=O)NC1=CC=CN1C OEGTUIAPKPUIOI-UHFFFAOYSA-N 0.000 description 2
- FWGLBLBVJQPUOD-UHFFFAOYSA-N n-(5-methylthiophen-2-yl)-2-phenylacetamide Chemical compound S1C(C)=CC=C1NC(=O)CC1=CC=CC=C1 FWGLBLBVJQPUOD-UHFFFAOYSA-N 0.000 description 2
- IPPVOGCPVWDIKK-UHFFFAOYSA-N n-[(3,5-dimethoxyphenyl)methyl]-n-ethylethanamine Chemical compound CCN(CC)CC1=CC(OC)=CC(OC)=C1 IPPVOGCPVWDIKK-UHFFFAOYSA-N 0.000 description 2
- XESOFFCUZUTHQC-UHFFFAOYSA-N n-butyl-n-(5-phenylthiophen-2-yl)benzamide Chemical compound C=1C=C(C=2C=CC=CC=2)SC=1N(CCCC)C(=O)C1=CC=CC=C1 XESOFFCUZUTHQC-UHFFFAOYSA-N 0.000 description 2
- 239000004533 oil dispersion Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 2
- 235000013772 propylene glycol Nutrition 0.000 description 2
- 229960004063 propylene glycol Drugs 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- GLGNXYJARSMNGJ-VKTIVEEGSA-N (1s,2s,3r,4r)-3-[[5-chloro-2-[(1-ethyl-6-methoxy-2-oxo-4,5-dihydro-3h-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide Chemical compound CCN1C(=O)CCCC2=C(OC)C(NC=3N=C(C(=CN=3)Cl)N[C@H]3[C@H]([C@@]4([H])C[C@@]3(C=C4)[H])C(N)=O)=CC=C21 GLGNXYJARSMNGJ-VKTIVEEGSA-N 0.000 description 1
- CUNWUEBNSZSNRX-RKGWDQTMSA-N (2r,3r,4r,5s)-hexane-1,2,3,4,5,6-hexol;(z)-octadec-9-enoic acid Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.CCCCCCCC\C=C/CCCCCCCC(O)=O.CCCCCCCC\C=C/CCCCCCCC(O)=O.CCCCCCCC\C=C/CCCCCCCC(O)=O CUNWUEBNSZSNRX-RKGWDQTMSA-N 0.000 description 1
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 1
- ANOOTOPTCJRUPK-UHFFFAOYSA-N 1-iodohexane Chemical compound CCCCCCI ANOOTOPTCJRUPK-UHFFFAOYSA-N 0.000 description 1
- HAFXVSYMJSHNQG-UHFFFAOYSA-N 1-methyl-3-nitropyrrole Chemical compound CN1C=CC([N+]([O-])=O)=C1 HAFXVSYMJSHNQG-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- YSLICDQRFIJANK-UHFFFAOYSA-N 2-ethyl-n-(furan-2-yl)butanamide Chemical compound CCC(CC)C(=O)NC1=CC=CO1 YSLICDQRFIJANK-UHFFFAOYSA-N 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- BTYXCSUWTDGXLL-UHFFFAOYSA-N 2-methyl-n-(1-methylpyrrol-3-yl)-n-prop-2-enylpropanamide Chemical compound CC(C)C(=O)N(CC=C)C=1C=CN(C)C=1 BTYXCSUWTDGXLL-UHFFFAOYSA-N 0.000 description 1
- NVSGQPDFZXBUKR-UHFFFAOYSA-N 2-methyl-n-(5-methylthiophen-2-yl)propanamide Chemical compound CC(C)C(=O)NC1=CC=C(C)S1 NVSGQPDFZXBUKR-UHFFFAOYSA-N 0.000 description 1
- ZETBDNNBXMTTLZ-UHFFFAOYSA-N 2-methylpropanamide Chemical compound CC(C)C(N)=O.CC(C)C(N)=O ZETBDNNBXMTTLZ-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- IFLKEBSJTZGCJG-UHFFFAOYSA-N 5-methyl-2-thiophenecarboxylic acid Natural products CC=1C=CSC=1C(O)=O IFLKEBSJTZGCJG-UHFFFAOYSA-N 0.000 description 1
- OVOCLWJUABOAPL-UHFFFAOYSA-N 5-methylfuran-2-carboxylic acid Chemical compound CC1=CC=C(C(O)=O)O1 OVOCLWJUABOAPL-UHFFFAOYSA-N 0.000 description 1
- VCNGNQLPFHVODE-UHFFFAOYSA-N 5-methylthiophene-2-carboxylic acid Chemical compound CC1=CC=C(C(O)=O)S1 VCNGNQLPFHVODE-UHFFFAOYSA-N 0.000 description 1
- GUOMINFEASCICM-UHFFFAOYSA-N 5-phenylfuran-2-carboxylic acid Chemical compound O1C(C(=O)O)=CC=C1C1=CC=CC=C1 GUOMINFEASCICM-UHFFFAOYSA-N 0.000 description 1
- PJJRNKYPVOONED-UHFFFAOYSA-N 5-phenylthiophen-2-amine;hydrochloride Chemical compound Cl.S1C(N)=CC=C1C1=CC=CC=C1 PJJRNKYPVOONED-UHFFFAOYSA-N 0.000 description 1
- JWZMCIVGRRFEEX-UHFFFAOYSA-N 5-tert-butylfuran-2-carboxylic acid Chemical compound CC(C)(C)C1=CC=C(C(O)=O)O1 JWZMCIVGRRFEEX-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 235000006491 Acacia senegal Nutrition 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 235000003911 Arachis Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 1
- 101100440696 Caenorhabditis elegans cor-1 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 101000582254 Homo sapiens Nuclear receptor corepressor 2 Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- MADRVGBADLFHMO-UHFFFAOYSA-N Indeloxazine Chemical compound C=1C=CC=2C=CCC=2C=1OCC1CNCCO1 MADRVGBADLFHMO-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 229920000881 Modified starch Polymers 0.000 description 1
- 102100030569 Nuclear receptor corepressor 2 Human genes 0.000 description 1
- HKGWIWYOTQGNIN-UHFFFAOYSA-N P(=O)(N=[N+]=[N-])N=[N+]=[N-] Chemical compound P(=O)(N=[N+]=[N-])N=[N+]=[N-] HKGWIWYOTQGNIN-UHFFFAOYSA-N 0.000 description 1
- 241001315609 Pittosporum crassifolium Species 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- 239000004147 Sorbitan trioleate Substances 0.000 description 1
- PRXRUNOAOLTIEF-ADSICKODSA-N Sorbitan trioleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@H]1OC[C@H](O)[C@H]1OC(=O)CCCCCCC\C=C/CCCCCCCC PRXRUNOAOLTIEF-ADSICKODSA-N 0.000 description 1
- 208000005279 Status Asthmaticus Diseases 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 240000006474 Theobroma bicolor Species 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- SORGEQQSQGNZFI-UHFFFAOYSA-N [azido(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(N=[N+]=[N-])OC1=CC=CC=C1 SORGEQQSQGNZFI-UHFFFAOYSA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- CKBZJTAMRPPVSR-UHFFFAOYSA-N adamantane-1-carboxamide Chemical compound C1C(C2)CC3CC2CC1(C(=O)N)C3 CKBZJTAMRPPVSR-UHFFFAOYSA-N 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 235000010210 aluminium Nutrition 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- WFKAJVHLWXSISD-UHFFFAOYSA-N anhydrous dimethyl-acetamide Natural products CC(C)C(N)=O WFKAJVHLWXSISD-UHFFFAOYSA-N 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- KXDAEFPNCMNJSK-UHFFFAOYSA-N benzene carboxamide Natural products NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 235000012241 calcium silicate Nutrition 0.000 description 1
- 229960003340 calcium silicate Drugs 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical class [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 229940082500 cetostearyl alcohol Drugs 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 229940125758 compound 15 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- VZFUCHSFHOYXIS-UHFFFAOYSA-N cycloheptane carboxylic acid Natural products OC(=O)C1CCCCCC1 VZFUCHSFHOYXIS-UHFFFAOYSA-N 0.000 description 1
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- XOVJAYNMQDTIJD-UHFFFAOYSA-N cyclopentobarbital Chemical compound C1CC=CC1C1(CC=C)C(=O)NC(=O)NC1=O XOVJAYNMQDTIJD-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- AFQJGIVHAURZIY-UHFFFAOYSA-N ethyl 5-ethyl-2-(2-methylpropanoylamino)thiophene-3-carboxylate Chemical compound CCOC(=O)C=1C=C(CC)SC=1NC(=O)C(C)C AFQJGIVHAURZIY-UHFFFAOYSA-N 0.000 description 1
- 229940116333 ethyl lactate Drugs 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 238000001361 intraarterial administration Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- LSACYLWPPQLVSM-UHFFFAOYSA-N isobutyric acid anhydride Chemical compound CC(C)C(=O)OC(=O)C(C)C LSACYLWPPQLVSM-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000011344 liquid material Substances 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QKYRXLPXSJZIQM-UHFFFAOYSA-N methyl 2-amino-5-phenylthiophene-3-carboxylate Chemical compound S1C(N)=C(C(=O)OC)C=C1C1=CC=CC=C1 QKYRXLPXSJZIQM-UHFFFAOYSA-N 0.000 description 1
- ZSAQPDNLUCZNEF-UHFFFAOYSA-N methyl 5-methyl-2-(2-methylpropanoylamino)thiophene-3-carboxylate Chemical compound COC(=O)C=1C=C(C)SC=1NC(=O)C(C)C ZSAQPDNLUCZNEF-UHFFFAOYSA-N 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- ANGDWNBGPBMQHW-UHFFFAOYSA-N methyl cyanoacetate Chemical compound COC(=O)CC#N ANGDWNBGPBMQHW-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 235000019426 modified starch Nutrition 0.000 description 1
- CMPQSNPRGISBPA-UHFFFAOYSA-N n-(1-methylpyrrol-3-yl)-n-prop-2-enylacetamide Chemical compound C=CCN(C(=O)C)C=1C=CN(C)C=1 CMPQSNPRGISBPA-UHFFFAOYSA-N 0.000 description 1
- VCDFKWYFXDYJKQ-UHFFFAOYSA-N n-(1-methylpyrrol-3-yl)acetamide Chemical compound CC(=O)NC=1C=CN(C)C=1 VCDFKWYFXDYJKQ-UHFFFAOYSA-N 0.000 description 1
- PEQLLOCOYQFENY-UHFFFAOYSA-N n-(3-bromophenyl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide Chemical compound C1C(C)CCC2=C1SC=C2C(=O)NC1=CC=CC(Br)=C1 PEQLLOCOYQFENY-UHFFFAOYSA-N 0.000 description 1
- GRWCXXKTTGPCDH-UHFFFAOYSA-N n-(5-ethylthiophen-2-yl)-n-hexyl-2-methylpropanamide Chemical compound CCCCCCN(C(=O)C(C)C)C1=CC=C(CC)S1 GRWCXXKTTGPCDH-UHFFFAOYSA-N 0.000 description 1
- AMPZEECRYAUDMZ-UHFFFAOYSA-N n-(5-phenylthiophen-2-yl)benzamide Chemical compound C=1C=CC=CC=1C(=O)NC(S1)=CC=C1C1=CC=CC=C1 AMPZEECRYAUDMZ-UHFFFAOYSA-N 0.000 description 1
- QCFAYMQDKHATMF-UHFFFAOYSA-N n-(5-phenylthiophen-2-yl)cyclohexanecarboxamide Chemical compound C1CCCCC1C(=O)NC(S1)=CC=C1C1=CC=CC=C1 QCFAYMQDKHATMF-UHFFFAOYSA-N 0.000 description 1
- AMLJWLYRONUCKO-UHFFFAOYSA-N n-(6-amino-5-iodopyridin-2-yl)acetamide Chemical compound CC(=O)NC1=CC=C(I)C(N)=N1 AMLJWLYRONUCKO-UHFFFAOYSA-N 0.000 description 1
- UMMWIAMZNHBLDB-UHFFFAOYSA-N n-(furan-2-yl)-n-methylacetamide Chemical compound CC(=O)N(C)C1=CC=CO1 UMMWIAMZNHBLDB-UHFFFAOYSA-N 0.000 description 1
- HFJSZWFSWUAZPZ-UHFFFAOYSA-N n-(furan-2-yl)-n-prop-2-ynylcyclohexanecarboxamide Chemical compound C=1C=COC=1N(CC#C)C(=O)C1CCCCC1 HFJSZWFSWUAZPZ-UHFFFAOYSA-N 0.000 description 1
- PDXJWIAJGWPYKU-UHFFFAOYSA-N n-(furan-2-yl)cyclohexanecarboxamide Chemical compound C1CCCCC1C(=O)NC1=CC=CO1 PDXJWIAJGWPYKU-UHFFFAOYSA-N 0.000 description 1
- CSQRKKPQWGPDLM-UHFFFAOYSA-N n-[(4-bromophenyl)methyl]-2-methyl-n-(1-methylpyrrol-3-yl)propanamide Chemical compound C1=CN(C)C=C1N(C(=O)C(C)C)CC1=CC=C(Br)C=C1 CSQRKKPQWGPDLM-UHFFFAOYSA-N 0.000 description 1
- DWAUBQHHANGTSC-UHFFFAOYSA-N n-[(4-chlorophenyl)methyl]-n-(5-phenylthiophen-2-yl)benzamide Chemical compound C1=CC(Cl)=CC=C1CN(C=1SC(=CC=1)C=1C=CC=CC=1)C(=O)C1=CC=CC=C1 DWAUBQHHANGTSC-UHFFFAOYSA-N 0.000 description 1
- AGGPCFIIUUDENX-UHFFFAOYSA-N n-benzyl-2-methyl-n-(1-methylpyrrol-3-yl)propanamide Chemical compound C1=CN(C)C=C1N(C(=O)C(C)C)CC1=CC=CC=C1 AGGPCFIIUUDENX-UHFFFAOYSA-N 0.000 description 1
- LOHYQGNKDNEHCD-UHFFFAOYSA-N n-benzyl-2-methyl-n-(5-methylthiophen-2-yl)propanamide Chemical compound C=1C=C(C)SC=1N(C(=O)C(C)C)CC1=CC=CC=C1 LOHYQGNKDNEHCD-UHFFFAOYSA-N 0.000 description 1
- PWYWXUNJWDKRFD-UHFFFAOYSA-N n-benzyl-n-(1-methylpyrrol-3-yl)acetamide Chemical compound C1=CN(C)C=C1N(C(=O)C)CC1=CC=CC=C1 PWYWXUNJWDKRFD-UHFFFAOYSA-N 0.000 description 1
- NOWSJSMKOZTJHV-UHFFFAOYSA-N n-benzyl-n-(5-phenylfuran-2-yl)cyclopentanecarboxamide Chemical compound C=1C=CC=CC=1CN(C=1OC(=CC=1)C=1C=CC=CC=1)C(=O)C1CCCC1 NOWSJSMKOZTJHV-UHFFFAOYSA-N 0.000 description 1
- ONUHXCKLRUKXMZ-UHFFFAOYSA-N n-benzyl-n-(furan-2-yl)acetamide Chemical compound C=1C=COC=1N(C(=O)C)CC1=CC=CC=C1 ONUHXCKLRUKXMZ-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PADVRWWZMIARLT-UHFFFAOYSA-N n-butyl-2-methyl-n-(1-methylpyrrol-2-yl)propanamide Chemical compound CCCCN(C(=O)C(C)C)C1=CC=CN1C PADVRWWZMIARLT-UHFFFAOYSA-N 0.000 description 1
- LFBIOZWGZLARJG-UHFFFAOYSA-N n-butyl-2-methyl-n-(1-methylpyrrol-3-yl)propanamide Chemical compound CCCCN(C(=O)C(C)C)C=1C=CN(C)C=1 LFBIOZWGZLARJG-UHFFFAOYSA-N 0.000 description 1
- CKNRDPBZHWNMIT-UHFFFAOYSA-N n-butyl-2-methyl-n-(5-methylfuran-2-yl)propanamide Chemical compound CCCCN(C(=O)C(C)C)C1=CC=C(C)O1 CKNRDPBZHWNMIT-UHFFFAOYSA-N 0.000 description 1
- KSJYUZFDNWZTGA-UHFFFAOYSA-N n-butyl-2-methyl-n-(5-phenylfuran-2-yl)propanamide Chemical compound O1C(N(C(=O)C(C)C)CCCC)=CC=C1C1=CC=CC=C1 KSJYUZFDNWZTGA-UHFFFAOYSA-N 0.000 description 1
- DGGGASCQTTZMQR-UHFFFAOYSA-N n-butyl-n-(1-methylpyrrol-3-yl)acetamide Chemical compound CCCCN(C(C)=O)C=1C=CN(C)C=1 DGGGASCQTTZMQR-UHFFFAOYSA-N 0.000 description 1
- YWNQDEPOXZMKBF-UHFFFAOYSA-N n-butyl-n-(5-methylfuran-2-yl)cyclopentanecarboxamide Chemical compound C=1C=C(C)OC=1N(CCCC)C(=O)C1CCCC1 YWNQDEPOXZMKBF-UHFFFAOYSA-N 0.000 description 1
- JFLFTXBRZFCCMR-UHFFFAOYSA-N n-butyl-n-(5-phenylfuran-2-yl)heptanamide Chemical compound O1C(N(CCCC)C(=O)CCCCCC)=CC=C1C1=CC=CC=C1 JFLFTXBRZFCCMR-UHFFFAOYSA-N 0.000 description 1
- YKRLUZZJHIXCJW-UHFFFAOYSA-N n-butyl-n-(5-tert-butylfuran-2-yl)-2-methylpropanamide Chemical compound CCCCN(C(=O)C(C)C)C1=CC=C(C(C)(C)C)O1 YKRLUZZJHIXCJW-UHFFFAOYSA-N 0.000 description 1
- HLVUGVCFQJBLAL-UHFFFAOYSA-N n-butyl-n-(furan-2-yl)acetamide Chemical compound CCCCN(C(C)=O)C1=CC=CO1 HLVUGVCFQJBLAL-UHFFFAOYSA-N 0.000 description 1
- OBQRDMRSVZAVDT-UHFFFAOYSA-N n-butyl-n-(furan-2-yl)cyclohexanecarboxamide Chemical compound C=1C=COC=1N(CCCC)C(=O)C1CCCCC1 OBQRDMRSVZAVDT-UHFFFAOYSA-N 0.000 description 1
- CYJJHZOVGCUPAU-UHFFFAOYSA-N n-butyl-n-(furan-3-yl)cyclopentanecarboxamide Chemical compound C1=COC=C1N(CCCC)C(=O)C1CCCC1 CYJJHZOVGCUPAU-UHFFFAOYSA-N 0.000 description 1
- VZCYVYRBWOTHCI-UHFFFAOYSA-N n-butyl-n-(furan-3-yl)heptanamide Chemical compound CCCCCCC(=O)N(CCCC)C=1C=COC=1 VZCYVYRBWOTHCI-UHFFFAOYSA-N 0.000 description 1
- JUADBRJHOBMMMJ-UHFFFAOYSA-N n-butyl-n-[5-(4-chlorophenyl)furan-2-yl]-2-methylpropanamide Chemical compound O1C(N(C(=O)C(C)C)CCCC)=CC=C1C1=CC=C(Cl)C=C1 JUADBRJHOBMMMJ-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- ZMNXLCXXGBMKTN-UHFFFAOYSA-N n-hexyl-2-methyl-n-(1-methylpyrrol-3-yl)propanamide Chemical compound CCCCCCN(C(=O)C(C)C)C=1C=CN(C)C=1 ZMNXLCXXGBMKTN-UHFFFAOYSA-N 0.000 description 1
- JVXGZCUWGCGJST-UHFFFAOYSA-N n-hexyl-2-methyl-n-(5-methylthiophen-2-yl)propanamide Chemical compound CCCCCCN(C(=O)C(C)C)C1=CC=C(C)S1 JVXGZCUWGCGJST-UHFFFAOYSA-N 0.000 description 1
- IMSLYUUYTMUMID-UHFFFAOYSA-N n-methyl-n-(5-methylfuran-2-yl)benzamide Chemical compound C=1C=C(C)OC=1N(C)C(=O)C1=CC=CC=C1 IMSLYUUYTMUMID-UHFFFAOYSA-N 0.000 description 1
- MDXBSZGZDCHXIX-UHFFFAOYSA-N n-methyl-n-(5-methylfuran-2-yl)cyclopentanecarboxamide Chemical compound C=1C=C(C)OC=1N(C)C(=O)C1CCCC1 MDXBSZGZDCHXIX-UHFFFAOYSA-N 0.000 description 1
- HWHBYHCLPJRBOM-UHFFFAOYSA-N n-methyl-n-(5-methylfuran-2-yl)heptanamide Chemical compound CCCCCCC(=O)N(C)C1=CC=C(C)O1 HWHBYHCLPJRBOM-UHFFFAOYSA-N 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- XBXCNNQPRYLIDE-UHFFFAOYSA-M n-tert-butylcarbamate Chemical compound CC(C)(C)NC([O-])=O XBXCNNQPRYLIDE-UHFFFAOYSA-M 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- KPADFPAILITQBG-UHFFFAOYSA-N non-4-ene Chemical compound CCCCC=CCCC KPADFPAILITQBG-UHFFFAOYSA-N 0.000 description 1
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 229920006316 polyvinylpyrrolidine Polymers 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical class [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 239000000473 propyl gallate Substances 0.000 description 1
- 235000010388 propyl gallate Nutrition 0.000 description 1
- 229940075579 propyl gallate Drugs 0.000 description 1
- 229940095050 propylene Drugs 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000012056 semi-solid material Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 229960005078 sorbitan sesquioleate Drugs 0.000 description 1
- 235000019337 sorbitan trioleate Nutrition 0.000 description 1
- 229960000391 sorbitan trioleate Drugs 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000010356 sorbitol Nutrition 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000012058 sterile packaged powder Substances 0.000 description 1
- 239000006190 sub-lingual tablet Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L sulfate group Chemical group S(=O)(=O)([O-])[O-] QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- MRPLSXXSBGWVRM-UHFFFAOYSA-N tert-butyl n-(5-methylthiophen-2-yl)carbamate Chemical compound CC1=CC=C(NC(=O)OC(C)(C)C)S1 MRPLSXXSBGWVRM-UHFFFAOYSA-N 0.000 description 1
- SLFXZJQCKKOIHO-UHFFFAOYSA-N tert-butyl n-(5-phenylfuran-2-yl)carbamate Chemical compound O1C(NC(=O)OC(C)(C)C)=CC=C1C1=CC=CC=C1 SLFXZJQCKKOIHO-UHFFFAOYSA-N 0.000 description 1
- SBFLPNJYWRKWFT-UHFFFAOYSA-N tert-butyl n-(furan-3-yl)carbamate Chemical compound CC(C)(C)OC(=O)NC=1C=COC=1 SBFLPNJYWRKWFT-UHFFFAOYSA-N 0.000 description 1
- OULAJFUGPPVRBK-UHFFFAOYSA-N tetratriacontyl alcohol Natural products CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCO OULAJFUGPPVRBK-UHFFFAOYSA-N 0.000 description 1
- GLQWRXYOTXRDNH-UHFFFAOYSA-N thiophen-2-amine Chemical class NC1=CC=CS1 GLQWRXYOTXRDNH-UHFFFAOYSA-N 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical class Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/66—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/30—Hetero atoms other than halogen
- C07D333/36—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB24223/75A GB1548398A (en) | 1975-06-05 | 1975-06-05 | Acylamino pyrroles furans and thiophenes |
| GB24223/75 | 1975-06-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1090794A true CA1090794A (en) | 1980-12-02 |
Family
ID=10208332
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA253,730A Expired CA1090794A (en) | 1975-06-05 | 1976-05-31 | Acylamino derivatives |
Country Status (31)
| Country | Link |
|---|---|
| US (3) | US4082771A (OSRAM) |
| JP (1) | JPS51149264A (OSRAM) |
| AR (1) | AR214974A1 (OSRAM) |
| AT (1) | AT355011B (OSRAM) |
| AU (1) | AU505603B2 (OSRAM) |
| BE (1) | BE842577A (OSRAM) |
| BG (1) | BG27358A3 (OSRAM) |
| CA (1) | CA1090794A (OSRAM) |
| CH (1) | CH616660A5 (OSRAM) |
| CS (1) | CS189771B2 (OSRAM) |
| DD (1) | DD125076A5 (OSRAM) |
| DE (1) | DE2625242A1 (OSRAM) |
| DK (1) | DK243476A (OSRAM) |
| ES (1) | ES448588A1 (OSRAM) |
| FR (1) | FR2313032A1 (OSRAM) |
| GB (1) | GB1548398A (OSRAM) |
| GR (1) | GR60435B (OSRAM) |
| HU (1) | HU177338B (OSRAM) |
| IE (1) | IE43473B1 (OSRAM) |
| IL (1) | IL49690A (OSRAM) |
| MX (1) | MX3637E (OSRAM) |
| NL (1) | NL7606120A (OSRAM) |
| NZ (1) | NZ181009A (OSRAM) |
| PH (3) | PH14688A (OSRAM) |
| PL (1) | PL103100B1 (OSRAM) |
| PT (1) | PT65181B (OSRAM) |
| RO (1) | RO70686A (OSRAM) |
| SE (1) | SE426591B (OSRAM) |
| SU (1) | SU655313A3 (OSRAM) |
| YU (1) | YU137076A (OSRAM) |
| ZA (1) | ZA762363B (OSRAM) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4269849A (en) * | 1979-02-22 | 1981-05-26 | Chevron Research Company | Fungicidal 3-(N-cycloalkylcarbonyl-N-arylamino)-gamma-butyrolactones and gamma-butyrothiolactones |
| FR2502153A1 (fr) * | 1981-03-19 | 1982-09-24 | Rech Pharmaceutiq Medicale | Acides (2-oxo-3-tetrahydrothienylcarbamoyl)-alkylthio) acetiques, leurs sels et leurs esters, leur procede de preparation et les compositions pharmaceutiques en contenant |
| EP0078860A1 (en) * | 1981-11-07 | 1983-05-18 | A. Nattermann & Cie. GmbH | New 5-(N-alkyl-N-acyl-amino)-thiophen-2-carboxylic acid derivatives, process for producing the same and pharmaceutical compounds containing the same |
| US4349686A (en) * | 1981-11-12 | 1982-09-14 | A. Nattermann & Cie Gmbh | 5-(N-Alkyl-N-acyl-amino)-thiophen-2-carboxylic acid derivatives |
| CH655312A5 (de) * | 1982-02-09 | 1986-04-15 | Sandoz Ag | Chloracetamide. |
| US4666502A (en) * | 1982-02-09 | 1987-05-19 | Sandoz Ltd. | Herbicidal N-thienyl-chloroacetamides |
| DE3348463C2 (de) * | 1982-02-09 | 1995-03-30 | Sandoz Ag | Thiophenverbindungen |
| DE3331874A1 (de) * | 1982-09-13 | 1984-04-05 | Sandoz-Patent-GmbH, 7850 Lörrach | Neue thiophenderivate |
| US4643758A (en) * | 1982-09-30 | 1987-02-17 | Eli Lilly And Company | Herbicidal furyl-, thienyl- and pyrrolyl-2-pyrrolidinones |
| US5047555A (en) * | 1988-12-13 | 1991-09-10 | Tanabe Seiyaku Co., Ltd. | 4-aminophenol derivatives and processes for preparing the same |
| US5155152A (en) * | 1989-03-28 | 1992-10-13 | Ciba-Geigy Corporation | Substitute aminopyrroles as stabilizers for chlorine-containing polymers |
| US6906069B1 (en) | 1999-01-08 | 2005-06-14 | Amgen Inc. | LXR modulators |
| AU2000235960A1 (en) * | 2000-02-14 | 2001-08-27 | Tularik, Inc. | Lxr modulators |
| EP1476425A4 (en) | 2002-01-30 | 2010-05-05 | Amgen Inc | Heterocyclic Aryl Sulphonamidocyclic Compounds |
| US8802721B2 (en) * | 2005-01-25 | 2014-08-12 | Synta Pharmaceuticals Corp. | Thiophene compounds for inflammation and immune-related uses |
| KR101257550B1 (ko) * | 2007-09-10 | 2013-04-24 | 칼시메디카, 인크 | 세포내 칼슘을 조절하는 화합물 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2437465A (en) * | 1942-07-13 | 1948-03-09 | Ici Ltd | Manufacture of new coloring matters |
| US2785181A (en) * | 1954-04-19 | 1957-03-12 | American Cyanamid Co | Substituted aminopyrrolecarboxylic acids and esters |
| US2797228A (en) * | 1955-08-02 | 1957-06-25 | American Cyanamid Co | Alkylpyrrole carboxylic acids and derivatives thereof |
| FR1186904A (fr) * | 1956-03-28 | 1959-09-03 | Geigy Ag J R | Amines tertiaires de la série du tétrahydrofurane et leur procédé de préparation |
| US2901489A (en) * | 1956-12-04 | 1959-08-25 | American Cyanamid Co | Substituted pyrroles |
| US3152136A (en) * | 1958-10-30 | 1964-10-06 | Dow Chemical Co | Dinitroaroyl-nu-pyridyl amides |
| FR86210E (OSRAM) * | 1963-04-04 | 1966-03-23 | ||
| US3506678A (en) * | 1967-02-21 | 1970-04-14 | Merck & Co Inc | Certain 2-substituted thieno(2,3-d) imidazoles |
| US3577440A (en) * | 1968-12-23 | 1971-05-04 | Robins Co Inc A H | 1-substituted-3-amido-pyrrolidines |
| US3966957A (en) * | 1972-04-03 | 1976-06-29 | A. H. Robins Company, Incorporated | Method for controlling emesis with N-(1-substituted-3-pyrrolidinyl)benzamides and thiobenzamides |
| GB1427945A (en) * | 1973-08-22 | 1976-03-10 | Lepetit Spa | Aminopyrrole derivatives |
-
1975
- 1975-06-05 GB GB24223/75A patent/GB1548398A/en not_active Expired
-
1976
- 1976-04-21 ZA ZA762363A patent/ZA762363B/xx unknown
- 1976-05-31 NZ NZ181009A patent/NZ181009A/xx unknown
- 1976-05-31 IE IE1146/76A patent/IE43473B1/en unknown
- 1976-05-31 CA CA253,730A patent/CA1090794A/en not_active Expired
- 1976-05-31 IL IL49690A patent/IL49690A/xx unknown
- 1976-06-01 US US05/691,961 patent/US4082771A/en not_active Expired - Lifetime
- 1976-06-01 US US05/691,964 patent/US4088773A/en not_active Expired - Lifetime
- 1976-06-01 RO RO7686317A patent/RO70686A/ro unknown
- 1976-06-01 AR AR263473A patent/AR214974A1/es active
- 1976-06-01 GR GR50866A patent/GR60435B/el unknown
- 1976-06-02 DK DK243476A patent/DK243476A/da not_active Application Discontinuation
- 1976-06-02 SE SE7606224A patent/SE426591B/xx unknown
- 1976-06-03 AU AU14620/76A patent/AU505603B2/en not_active Expired
- 1976-06-03 HU HU76LI294A patent/HU177338B/hu unknown
- 1976-06-03 CH CH699076A patent/CH616660A5/fr not_active IP Right Cessation
- 1976-06-03 PT PT65181A patent/PT65181B/pt unknown
- 1976-06-03 BE BE6045537A patent/BE842577A/xx not_active IP Right Cessation
- 1976-06-04 AT AT412476A patent/AT355011B/de not_active IP Right Cessation
- 1976-06-04 FR FR7616974A patent/FR2313032A1/fr active Granted
- 1976-06-04 NL NL7606120A patent/NL7606120A/xx not_active Application Discontinuation
- 1976-06-04 MX MX76266U patent/MX3637E/es unknown
- 1976-06-04 JP JP51066025A patent/JPS51149264A/ja active Pending
- 1976-06-04 PH PH18536A patent/PH14688A/en unknown
- 1976-06-04 DE DE19762625242 patent/DE2625242A1/de not_active Withdrawn
- 1976-06-04 ES ES448588A patent/ES448588A1/es not_active Expired
- 1976-06-04 DD DD193204A patent/DD125076A5/xx unknown
- 1976-06-04 SU SU762365996A patent/SU655313A3/ru active
- 1976-06-04 BG BG033365A patent/BG27358A3/xx unknown
- 1976-06-04 PL PL1976190131A patent/PL103100B1/pl unknown
- 1976-06-04 CS CS763713A patent/CS189771B2/cs unknown
- 1976-06-13 YU YU01370/76A patent/YU137076A/xx unknown
-
1979
- 1979-01-12 US US06/002,835 patent/US4222946A/en not_active Expired - Lifetime
-
1981
- 1981-01-29 PH PH25151A patent/PH15711A/en unknown
- 1981-01-29 PH PH25152A patent/PH16022A/en unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1090794A (en) | Acylamino derivatives | |
| US5240923A (en) | Sulfonamides useful as carbonic anhydrase inhibitors | |
| US5464872A (en) | Arylalkyl (thio) amides | |
| EP1858872A1 (fr) | Dérivés de n-[(4,5-diphenyl-3-alkyl-2-thienyl)methyl]amine (amide, thiourée et urée) comme antagonistes des récepteurs cb1 des cannabinoïdes | |
| JP2008543923A (ja) | ヒスタミン−3受容体アンタゴニスト | |
| EP1853557A2 (fr) | Derives de 1,5-diarylpyrrole, leur preparation et leur application en therapeutique | |
| FR2864958A1 (fr) | Derive de n-[(1,5-diphenyl-1h-pyrazol-3-yl)methyl] sulfonamide, leur preparation et leur application en therapeutique. | |
| CS252480B2 (en) | Method of 1,3-disubstituted 2-oxindoles production | |
| CN1732163B (zh) | 作为抗炎和免疫调节及抗增殖试剂的芳香化合物 | |
| US4122183A (en) | Oxazole derivatives | |
| HU211296A9 (en) | Lignan analogues, methods of preparation thereof and anti-hyperlipemic agents | |
| FR2880023A1 (fr) | Derives de n-[(4,5-diphenyl-3-alkyl-2-thienyl) methyl] amine leur preparation et leur application en therapeutique | |
| NO177995B (no) | Analogifremgangsmåte for fremstilling av terapeutisk aktive 1,3-dioksanderivater | |
| CA1338419C (en) | Substituted thienopyrans as antihypertensive agents | |
| US5607959A (en) | Oxindole 1-[N-(alkoxycarbonyl) ] carboxamides and 1-(N-carboxamido) carboxamides as antiinflammatory agents | |
| US4187232A (en) | Acylamino derivatives | |
| WO2002098839A1 (en) | Biphenylcarboxamides and process for preparation thereof | |
| CA1314562C (en) | Antiarthritic beta-cyclo-alkyl-beta-oxopropionitriles | |
| FI67851B (fi) | Foerfarande foer framstaellning av nya dopaminagonistiskt verkande benso(4,5)pyrano(2,3c)pyrrolderivat | |
| FR2887548A1 (fr) | Derives de 4,5-diarylpyrrole, leur preparation et leur application en therapeutique | |
| KR20070063008A (ko) | 피리딘 유도체 및 이의 제조법 및 치료학적 용도 | |
| CA2065086A1 (en) | Cycloalkylurea compounds | |
| CA2035431A1 (en) | Oxazole compounds, their production and use | |
| CA2111460C (en) | Tetrahydrobenzazepine derivatives which inhibit lipoxygenase | |
| US4083997A (en) | 10-(2-Substituted-amino-ethyl)-10,11-dihydro-5-methylene-5H-dibenzo[a,d]cycloheptenes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |