CA1081226A - Uracil derivatives and production thereof - Google Patents
Uracil derivatives and production thereofInfo
- Publication number
- CA1081226A CA1081226A CA274,676A CA274676A CA1081226A CA 1081226 A CA1081226 A CA 1081226A CA 274676 A CA274676 A CA 274676A CA 1081226 A CA1081226 A CA 1081226A
- Authority
- CA
- Canada
- Prior art keywords
- fluoro
- carboxylate
- hexahydro
- dioxopyrimidine
- ethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical class O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 title abstract description 8
- 238000004519 manufacturing process Methods 0.000 title description 15
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 25
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 17
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 5
- 238000000034 method Methods 0.000 claims description 212
- 150000001875 compounds Chemical class 0.000 claims description 109
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 98
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 90
- 239000000126 substance Substances 0.000 claims description 89
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 84
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 83
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 67
- -1 nitrogen-containing heterocyclic amine Chemical class 0.000 claims description 66
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 61
- LKVICQBNKHTHLL-UHFFFAOYSA-N ethyl 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCOC(=O)C1(F)C(O)NC(=O)NC1=O LKVICQBNKHTHLL-UHFFFAOYSA-N 0.000 claims description 43
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 42
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 38
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 36
- 125000004432 carbon atom Chemical group C* 0.000 claims description 23
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 22
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 21
- JUUPPQURHPYPOI-UHFFFAOYSA-N methyl 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound COC(=O)C1(F)C(O)NC(=O)NC1=O JUUPPQURHPYPOI-UHFFFAOYSA-N 0.000 claims description 20
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical compound CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 claims description 17
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 claims description 12
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 12
- 239000003795 chemical substances by application Substances 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 10
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 9
- CMZYDQKKDNXWKW-UHFFFAOYSA-N methyl 5-fluoro-4-methoxy-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound COC1NC(=O)NC(=O)C1(F)C(=O)OC CMZYDQKKDNXWKW-UHFFFAOYSA-N 0.000 claims description 9
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 8
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 claims description 8
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 claims description 8
- HAUXRJCZDHHADG-UHFFFAOYSA-N 2,4-dioxo-1h-pyrimidine-5-carbonitrile Chemical compound O=C1NC=C(C#N)C(=O)N1 HAUXRJCZDHHADG-UHFFFAOYSA-N 0.000 claims description 7
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 7
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 7
- ZMORFPWKNBKXDK-UHFFFAOYSA-N ethyl 4-ethoxy-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCOC1NC(=O)NC(=O)C1(F)C(=O)OCC ZMORFPWKNBKXDK-UHFFFAOYSA-N 0.000 claims description 7
- LNFWHIMRFZBBFO-UHFFFAOYSA-N methyl 2,4-dioxo-1h-pyrimidine-5-carboxylate Chemical compound COC(=O)C1=CNC(=O)NC1=O LNFWHIMRFZBBFO-UHFFFAOYSA-N 0.000 claims description 7
- UDZQLSVHLCDXBG-UHFFFAOYSA-N methyl 4-acetyloxy-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound COC(=O)C1(F)C(OC(C)=O)NC(=O)NC1=O UDZQLSVHLCDXBG-UHFFFAOYSA-N 0.000 claims description 7
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 claims description 6
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 claims description 6
- WPICHSHYZZLJMY-UHFFFAOYSA-N 2,4-dioxo-1,3-diazinane-5-carboxylic acid Chemical compound OC(=O)C1CNC(=O)NC1=O WPICHSHYZZLJMY-UHFFFAOYSA-N 0.000 claims description 5
- JZMIWYJRKUBQCS-UHFFFAOYSA-N 2,4-dioxo-1h-pyrimidine-5-carboxamide Chemical compound NC(=O)C1=CNC(=O)NC1=O JZMIWYJRKUBQCS-UHFFFAOYSA-N 0.000 claims description 5
- TXDAAMARMYNDQO-UHFFFAOYSA-N 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carbonitrile Chemical compound OC1NC(=O)NC(=O)C1(F)C#N TXDAAMARMYNDQO-UHFFFAOYSA-N 0.000 claims description 5
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- SLYSXMKRDKOISA-UHFFFAOYSA-N octyl 4-acetyloxy-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCCCCCCCOC(=O)C1(F)C(OC(C)=O)NC(=O)NC1=O SLYSXMKRDKOISA-UHFFFAOYSA-N 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 claims description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 4
- RHQDFWAXVIIEBN-UHFFFAOYSA-N Trifluoroethanol Chemical compound OCC(F)(F)F RHQDFWAXVIIEBN-UHFFFAOYSA-N 0.000 claims description 4
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 claims description 4
- 235000019445 benzyl alcohol Nutrition 0.000 claims description 4
- HIHTYLUACNLTTQ-UHFFFAOYSA-N butan-2-yl 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCC(C)OC(=O)C1(F)C(O)NC(=O)NC1=O HIHTYLUACNLTTQ-UHFFFAOYSA-N 0.000 claims description 4
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 claims description 4
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 claims description 4
- QYIJQWZDUJULHZ-UHFFFAOYSA-N ethyl 4-butoxy-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCCCOC1NC(=O)NC(=O)C1(F)C(=O)OCC QYIJQWZDUJULHZ-UHFFFAOYSA-N 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 claims description 4
- KPSSIOMAKSHJJG-UHFFFAOYSA-N neopentyl alcohol Chemical compound CC(C)(C)CO KPSSIOMAKSHJJG-UHFFFAOYSA-N 0.000 claims description 4
- AJUCOZCPWRGIFR-UHFFFAOYSA-N propan-2-yl 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CC(C)OC(=O)C1(F)C(O)NC(=O)NC1=O AJUCOZCPWRGIFR-UHFFFAOYSA-N 0.000 claims description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 4
- 150000003573 thiols Chemical class 0.000 claims description 4
- ZXYAAVBXHKCJJB-UHFFFAOYSA-N uracil-5-carboxylic acid Chemical compound OC(=O)C1=CNC(=O)NC1=O ZXYAAVBXHKCJJB-UHFFFAOYSA-N 0.000 claims description 4
- BRCRVHATMNEMGU-UHFFFAOYSA-N 1,5-difluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carbonitrile Chemical compound OC1NC(=O)N(F)C(=O)C1(F)C#N BRCRVHATMNEMGU-UHFFFAOYSA-N 0.000 claims description 3
- IFHZJMXHALLKJR-UHFFFAOYSA-N 4-ethoxy-5-fluoro-2,6-dioxo-1,3-diazinane-5-carbonitrile Chemical compound CCOC1NC(=O)NC(=O)C1(F)C#N IFHZJMXHALLKJR-UHFFFAOYSA-N 0.000 claims description 3
- FRKGVMPQSQNPCA-UHFFFAOYSA-N 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide Chemical compound NC(=O)C1(F)C(O)NC(=O)NC1=O FRKGVMPQSQNPCA-UHFFFAOYSA-N 0.000 claims description 3
- 150000002170 ethers Chemical class 0.000 claims description 3
- LCIFCESYFWZYHS-UHFFFAOYSA-N ethyl 4-(benzylamino)-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound N1C(=O)NC(=O)C(C(=O)OCC)(F)C1NCC1=CC=CC=C1 LCIFCESYFWZYHS-UHFFFAOYSA-N 0.000 claims description 3
- DAKGVCCXFKOHQB-UHFFFAOYSA-N ethyl 4-butan-2-yloxy-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCOC(=O)C1(F)C(OC(C)CC)NC(=O)NC1=O DAKGVCCXFKOHQB-UHFFFAOYSA-N 0.000 claims description 3
- YZRYUEOPVFCWAZ-UHFFFAOYSA-N ethyl 4-ethylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCOC(=O)C1(F)C(SCC)NC(=O)NC1=O YZRYUEOPVFCWAZ-UHFFFAOYSA-N 0.000 claims description 3
- KYXOFENPRAATBD-UHFFFAOYSA-N ethyl 5-fluoro-2,4-dioxo-6-phenoxy-1,3-diazinane-5-carboxylate Chemical compound N1C(=O)NC(=O)C(C(=O)OCC)(F)C1OC1=CC=CC=C1 KYXOFENPRAATBD-UHFFFAOYSA-N 0.000 claims description 3
- ZLCLFHUVRLJSNZ-UHFFFAOYSA-N ethyl 5-fluoro-4-octadecoxy-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCCCCCCCCCCCCCCCCCOC1NC(=O)NC(=O)C1(F)C(=O)OCC ZLCLFHUVRLJSNZ-UHFFFAOYSA-N 0.000 claims description 3
- 150000002367 halogens Chemical group 0.000 claims description 3
- ZCWVHOWKQQGEPP-UHFFFAOYSA-N methyl 2,4-dioxo-1-(oxolan-2-yl)pyrimidine-5-carboxylate Chemical compound O=C1NC(=O)C(C(=O)OC)=CN1C1OCCC1 ZCWVHOWKQQGEPP-UHFFFAOYSA-N 0.000 claims description 3
- STTPGIRVAZQZPE-UHFFFAOYSA-N methyl 4-butylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCCCSC1NC(=O)NC(=O)C1(F)C(=O)OC STTPGIRVAZQZPE-UHFFFAOYSA-N 0.000 claims description 3
- IOJAMWBDIXBKQY-UHFFFAOYSA-N methyl 5-fluoro-2,4-dioxo-6-phenylmethoxy-1,3-diazinane-5-carboxylate Chemical compound N1C(=O)NC(=O)C(C(=O)OC)(F)C1OCC1=CC=CC=C1 IOJAMWBDIXBKQY-UHFFFAOYSA-N 0.000 claims description 3
- WCXREEXHVQXJKH-UHFFFAOYSA-N methyl 5-fluoro-4-octoxy-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCCCCCCCOC1NC(=O)NC(=O)C1(F)C(=O)OC WCXREEXHVQXJKH-UHFFFAOYSA-N 0.000 claims description 3
- MUJVMVJSXYNXOE-UHFFFAOYSA-N methyl 5-fluoro-6-hydroxy-2,4-dioxo-1-(oxolan-2-yl)-1,3-diazinane-5-carboxylate Chemical compound O=C1NC(=O)C(C(=O)OC)(F)C(O)N1C1OCCC1 MUJVMVJSXYNXOE-UHFFFAOYSA-N 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- TVDSBUOJIPERQY-UHFFFAOYSA-N prop-2-yn-1-ol Chemical compound OCC#C TVDSBUOJIPERQY-UHFFFAOYSA-N 0.000 claims description 3
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- RFCQDOVPMUSZMN-UHFFFAOYSA-N 2-Naphthalenethiol Chemical compound C1=CC=CC2=CC(S)=CC=C21 RFCQDOVPMUSZMN-UHFFFAOYSA-N 0.000 claims description 2
- ULIKDJVNUXNQHS-UHFFFAOYSA-N 2-Propene-1-thiol Chemical compound SCC=C ULIKDJVNUXNQHS-UHFFFAOYSA-N 0.000 claims description 2
- HKVCEKWBCRHBFX-UHFFFAOYSA-N 2-chloroethyl 2,4-dioxo-1h-pyrimidine-5-carboxylate Chemical compound ClCCOC(=O)C1=CNC(=O)NC1=O HKVCEKWBCRHBFX-UHFFFAOYSA-N 0.000 claims description 2
- WEQVSIAEGGWBSL-UHFFFAOYSA-N 5-(morpholine-4-carbonyl)-1h-pyrimidine-2,4-dione Chemical compound C=1NC(=O)NC(=O)C=1C(=O)N1CCOCC1 WEQVSIAEGGWBSL-UHFFFAOYSA-N 0.000 claims description 2
- 125000002015 acyclic group Chemical group 0.000 claims description 2
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 2
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 2
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- UENWRTRMUIOCKN-UHFFFAOYSA-N benzyl thiol Chemical compound SCC1=CC=CC=C1 UENWRTRMUIOCKN-UHFFFAOYSA-N 0.000 claims description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 claims description 2
- MFJSWSRNZKXJAS-UHFFFAOYSA-N butan-2-yl 2,4-dioxo-1h-pyrimidine-5-carboxylate Chemical compound CCC(C)OC(=O)C1=CNC(=O)NC1=O MFJSWSRNZKXJAS-UHFFFAOYSA-N 0.000 claims description 2
- ZDLHWPASWYGIFB-UHFFFAOYSA-N butyl 2,4-dioxo-1h-pyrimidine-5-carboxylate Chemical compound CCCCOC(=O)C1=CNC(=O)NC1=O ZDLHWPASWYGIFB-UHFFFAOYSA-N 0.000 claims description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 2
- VTXVGVNLYGSIAR-UHFFFAOYSA-N decane-1-thiol Chemical compound CCCCCCCCCCS VTXVGVNLYGSIAR-UHFFFAOYSA-N 0.000 claims description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 claims description 2
- MKNYHTGOVKPZMU-UHFFFAOYSA-N ethyl 2,4-dioxo-1h-pyrimidine-5-carboxylate Chemical compound CCOC(=O)C1=CNC(=O)NC1=O MKNYHTGOVKPZMU-UHFFFAOYSA-N 0.000 claims description 2
- 229940035429 isobutyl alcohol Drugs 0.000 claims description 2
- OHCKNLHJUAXTID-UHFFFAOYSA-N methyl 4-benzoyloxy-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound N1C(=O)NC(=O)C(C(=O)OC)(F)C1OC(=O)C1=CC=CC=C1 OHCKNLHJUAXTID-UHFFFAOYSA-N 0.000 claims description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 claims description 2
- QJAOYSPHSNGHNC-UHFFFAOYSA-N octadecane-1-thiol Chemical compound CCCCCCCCCCCCCCCCCCS QJAOYSPHSNGHNC-UHFFFAOYSA-N 0.000 claims description 2
- WMXCDAVJEZZYLT-UHFFFAOYSA-N tert-butylthiol Chemical compound CC(C)(C)S WMXCDAVJEZZYLT-UHFFFAOYSA-N 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims 6
- 150000003857 carboxamides Chemical class 0.000 claims 5
- HPFMOBVEJFCFAP-UHFFFAOYSA-N ethyl 4-acetyloxy-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCOC(=O)C1(F)C(OC(C)=O)NC(=O)NC1=O HPFMOBVEJFCFAP-UHFFFAOYSA-N 0.000 claims 3
- XILNUOANEDXMSN-UHFFFAOYSA-N (5-carbamoyl-5-fluoro-2,6-dioxo-1,3-diazinan-4-yl) acetate Chemical compound CC(=O)OC1NC(=O)NC(=O)C1(F)C(N)=O XILNUOANEDXMSN-UHFFFAOYSA-N 0.000 claims 2
- JIEWFGXFAADPJW-UHFFFAOYSA-N (5-cyano-5-fluoro-2,6-dioxo-1,3-diazinan-4-yl) acetate Chemical compound CC(=O)OC1NC(=O)NC(=O)C1(F)C#N JIEWFGXFAADPJW-UHFFFAOYSA-N 0.000 claims 2
- RSNNXYLNQRDWQY-UHFFFAOYSA-N 2-chloroethyl 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound OC1NC(=O)NC(=O)C1(F)C(=O)OCCCl RSNNXYLNQRDWQY-UHFFFAOYSA-N 0.000 claims 2
- GKXFZYYVJZKXHK-UHFFFAOYSA-N 4-ethoxy-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxamide Chemical compound CCOC1NC(=O)NC(=O)C1(F)C(N)=O GKXFZYYVJZKXHK-UHFFFAOYSA-N 0.000 claims 2
- ZCLRQMCXLRSHGJ-UHFFFAOYSA-N 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxylic acid Chemical compound OC1NC(=O)NC(=O)C1(F)C(O)=O ZCLRQMCXLRSHGJ-UHFFFAOYSA-N 0.000 claims 2
- FFNTYTZQPNPDOX-UHFFFAOYSA-N butan-2-yl 4-butan-2-yloxy-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCC(C)OC1NC(=O)NC(=O)C1(F)C(=O)OC(C)CC FFNTYTZQPNPDOX-UHFFFAOYSA-N 0.000 claims 2
- WQAQPCDUOCURKW-UHFFFAOYSA-N butanethiol Chemical compound CCCCS WQAQPCDUOCURKW-UHFFFAOYSA-N 0.000 claims 2
- OWCXQWMIPWWOPH-UHFFFAOYSA-N butyl 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCCCOC(=O)C1(F)C(O)NC(=O)NC1=O OWCXQWMIPWWOPH-UHFFFAOYSA-N 0.000 claims 2
- 125000001033 ether group Chemical group 0.000 claims 2
- UYIWQSSEOZIULH-UHFFFAOYSA-N ethyl 4-(2,2-dimethylpropoxy)-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCOC(=O)C1(F)C(OCC(C)(C)C)NC(=O)NC1=O UYIWQSSEOZIULH-UHFFFAOYSA-N 0.000 claims 2
- MFRHIPNZBVHNHI-UHFFFAOYSA-N ethyl 4-(butylamino)-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCCCNC1NC(=O)NC(=O)C1(F)C(=O)OCC MFRHIPNZBVHNHI-UHFFFAOYSA-N 0.000 claims 2
- LAVPXHZXBLGZOM-UHFFFAOYSA-N ethyl 4-(diethylamino)-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCOC(=O)C1(F)C(N(CC)CC)NC(=O)NC1=O LAVPXHZXBLGZOM-UHFFFAOYSA-N 0.000 claims 2
- UHWWOURBQRAETC-UHFFFAOYSA-N ethyl 4-anilino-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound N1C(=O)NC(=O)C(C(=O)OCC)(F)C1NC1=CC=CC=C1 UHWWOURBQRAETC-UHFFFAOYSA-N 0.000 claims 2
- JJKOQXPGWQIXGK-UHFFFAOYSA-N ethyl 4-benzylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound N1C(=O)NC(=O)C(C(=O)OCC)(F)C1SCC1=CC=CC=C1 JJKOQXPGWQIXGK-UHFFFAOYSA-N 0.000 claims 2
- SIVQWATWCHERSB-UHFFFAOYSA-N ethyl 4-cyclohexylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound N1C(=O)NC(=O)C(C(=O)OCC)(F)C1SC1CCCCC1 SIVQWATWCHERSB-UHFFFAOYSA-N 0.000 claims 2
- AFBFSJRKJTWIDB-UHFFFAOYSA-N ethyl 4-decylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCCCCCCCCCSC1NC(=O)NC(=O)C1(F)C(=O)OCC AFBFSJRKJTWIDB-UHFFFAOYSA-N 0.000 claims 2
- XLVATWFNLODVDQ-UHFFFAOYSA-N ethyl 4-tert-butylsulfanyl-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCOC(=O)C1(F)C(SC(C)(C)C)NC(=O)NC1=O XLVATWFNLODVDQ-UHFFFAOYSA-N 0.000 claims 2
- MEWACMSHTGXDBO-UHFFFAOYSA-N ethyl 5-fluoro-2,4-dioxo-6-phenylmethoxy-1,3-diazinane-5-carboxylate Chemical compound N1C(=O)NC(=O)C(C(=O)OCC)(F)C1OCC1=CC=CC=C1 MEWACMSHTGXDBO-UHFFFAOYSA-N 0.000 claims 2
- JXUOHPWXGULPOD-UHFFFAOYSA-N ethyl 5-fluoro-2,4-dioxo-6-piperidin-1-yl-1,3-diazinane-5-carboxylate Chemical compound N1C(=O)NC(=O)C(C(=O)OCC)(F)C1N1CCCCC1 JXUOHPWXGULPOD-UHFFFAOYSA-N 0.000 claims 2
- FXTMNPPVWUWLGS-UHFFFAOYSA-N ethyl 5-fluoro-2,4-dioxo-6-prop-2-ynoxy-1,3-diazinane-5-carboxylate Chemical compound CCOC(=O)C1(F)C(OCC#C)NC(=O)NC1=O FXTMNPPVWUWLGS-UHFFFAOYSA-N 0.000 claims 2
- PFAYNMDOJHRHFA-UHFFFAOYSA-N ethyl 5-fluoro-4-methoxy-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCOC(=O)C1(F)C(OC)NC(=O)NC1=O PFAYNMDOJHRHFA-UHFFFAOYSA-N 0.000 claims 2
- FBIACOBKZSNFHX-UHFFFAOYSA-N ethyl 5-fluoro-4-octadecylsulfanyl-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCCCCCCCCCCCCCCCCCSC1NC(=O)NC(=O)C1(F)C(=O)OCC FBIACOBKZSNFHX-UHFFFAOYSA-N 0.000 claims 2
- LWJBHTCHFVBTLM-UHFFFAOYSA-N ethyl 5-fluoro-4-octoxy-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCCCCCCCOC1NC(=O)NC(=O)C1(F)C(=O)OCC LWJBHTCHFVBTLM-UHFFFAOYSA-N 0.000 claims 2
- RZIASUFBLIFPTB-UHFFFAOYSA-N methyl 4-butoxy-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCCCOC1NC(=O)NC(=O)C1(F)C(=O)OC RZIASUFBLIFPTB-UHFFFAOYSA-N 0.000 claims 2
- KBDIKZDVJZHVNS-UHFFFAOYSA-N methyl 4-cyclohexyloxy-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound N1C(=O)NC(=O)C(C(=O)OC)(F)C1OC1CCCCC1 KBDIKZDVJZHVNS-UHFFFAOYSA-N 0.000 claims 2
- LWHNMXJILHLHHJ-UHFFFAOYSA-N methyl 4-ethoxy-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCOC1NC(=O)NC(=O)C1(F)C(=O)OC LWHNMXJILHLHHJ-UHFFFAOYSA-N 0.000 claims 2
- ATPVHJAUAKINHW-UHFFFAOYSA-N methyl 5-fluoro-2,4-dioxo-6-phenylsulfanyl-1,3-diazinane-5-carboxylate Chemical compound N1C(=O)NC(=O)C(C(=O)OC)(F)C1SC1=CC=CC=C1 ATPVHJAUAKINHW-UHFFFAOYSA-N 0.000 claims 2
- LIESVEXYQBSERF-UHFFFAOYSA-N methyl 5-fluoro-4-hydroxy-1-methyl-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound COC(=O)C1(F)C(O)NC(=O)N(C)C1=O LIESVEXYQBSERF-UHFFFAOYSA-N 0.000 claims 2
- VPNPBNCDECUBAK-UHFFFAOYSA-N octyl 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCCCCCCCOC(=O)C1(F)C(O)NC(=O)NC1=O VPNPBNCDECUBAK-UHFFFAOYSA-N 0.000 claims 2
- CAJJLUCGAUXMTD-UHFFFAOYSA-N octyl 5-fluoro-4-octoxy-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCCCCCCCOC1NC(=O)NC(=O)C1(F)C(=O)OCCCCCCCC CAJJLUCGAUXMTD-UHFFFAOYSA-N 0.000 claims 2
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims 1
- XABIAHJPIBXQGW-UHFFFAOYSA-N 5-fluoro-6-hydroxy-5-(morpholine-4-carbonyl)-1,3-diazinane-2,4-dione Chemical compound OC1NC(=O)NC(=O)C1(F)C(=O)N1CCOCC1 XABIAHJPIBXQGW-UHFFFAOYSA-N 0.000 claims 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 claims 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims 1
- 125000005037 alkyl phenyl group Chemical group 0.000 claims 1
- BXLKWCBPTMCWIN-UHFFFAOYSA-N butyl 4-butoxy-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCCCOC1NC(=O)NC(=O)C1(F)C(=O)OCCCC BXLKWCBPTMCWIN-UHFFFAOYSA-N 0.000 claims 1
- CMKBCTPCXZNQKX-UHFFFAOYSA-N cyclohexanethiol Chemical compound SC1CCCCC1 CMKBCTPCXZNQKX-UHFFFAOYSA-N 0.000 claims 1
- YXVLNOQVYQPWGT-UHFFFAOYSA-N ethyl 5-fluoro-2,4-dioxo-6-phenylsulfanyl-1,3-diazinane-5-carboxylate Chemical compound N1C(=O)NC(=O)C(C(=O)OCC)(F)C1SC1=CC=CC=C1 YXVLNOQVYQPWGT-UHFFFAOYSA-N 0.000 claims 1
- OXWAQXFQXQOWAZ-UHFFFAOYSA-N ethyl 5-fluoro-2,4-dioxo-6-propan-2-yloxy-1,3-diazinane-5-carboxylate Chemical compound CCOC(=O)C1(F)C(OC(C)C)NC(=O)NC1=O OXWAQXFQXQOWAZ-UHFFFAOYSA-N 0.000 claims 1
- WKAHUIZPKIPDJV-UHFFFAOYSA-N ethyl 5-fluoro-4-[(2-methylpropan-2-yl)oxy]-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCOC(=O)C1(F)C(OC(C)(C)C)NC(=O)NC1=O WKAHUIZPKIPDJV-UHFFFAOYSA-N 0.000 claims 1
- 125000004438 haloalkoxy group Chemical group 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 125000005113 hydroxyalkoxy group Chemical group 0.000 claims 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 claims 1
- DZPVSYRDDPOTGO-UHFFFAOYSA-N methyl 2,4-dioxo-1h-pyrimidine-5-carboxylate;hydrate Chemical compound O.COC(=O)C1=CNC(=O)NC1=O DZPVSYRDDPOTGO-UHFFFAOYSA-N 0.000 claims 1
- DQXQVJIEYOFCFQ-UHFFFAOYSA-N methyl 3-methyl-2,4-dioxo-1h-pyrimidine-5-carboxylate Chemical compound COC(=O)C1=CNC(=O)N(C)C1=O DQXQVJIEYOFCFQ-UHFFFAOYSA-N 0.000 claims 1
- BGBKBZNBXQWOHZ-UHFFFAOYSA-N methyl 5-fluoro-2,4-dioxo-6-piperidin-1-yl-1,3-diazinane-5-carboxylate Chemical compound N1C(=O)NC(=O)C(C(=O)OC)(F)C1N1CCCCC1 BGBKBZNBXQWOHZ-UHFFFAOYSA-N 0.000 claims 1
- ZIKMUFBULPEOTD-UHFFFAOYSA-N methyl 6-acetyloxy-5-fluoro-2,4-dioxo-1-(oxolan-2-yl)-1,3-diazinane-5-carboxylate Chemical compound O=C1NC(=O)C(C(=O)OC)(F)C(OC(C)=O)N1C1OCCC1 ZIKMUFBULPEOTD-UHFFFAOYSA-N 0.000 claims 1
- UFZZSDNLEJADAN-UHFFFAOYSA-N octadecyl 2,4-dioxo-1h-pyrimidine-5-carboxylate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)C1=CNC(=O)NC1=O UFZZSDNLEJADAN-UHFFFAOYSA-N 0.000 claims 1
- XDJVPQDRNIXAEX-UHFFFAOYSA-N octadecyl 4-ethoxy-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)C1(F)C(OCC)NC(=O)NC1=O XDJVPQDRNIXAEX-UHFFFAOYSA-N 0.000 claims 1
- XEFSYBJBSHAHPU-UHFFFAOYSA-N octyl 2,4-dioxo-1h-pyrimidine-5-carboxylate Chemical compound CCCCCCCCOC(=O)C1=CNC(=O)NC1=O XEFSYBJBSHAHPU-UHFFFAOYSA-N 0.000 claims 1
- QLKJYRLGNKZENN-UHFFFAOYSA-N octyl 4-ethoxy-5-fluoro-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCCCCCCCOC(=O)C1(F)C(OCC)NC(=O)NC1=O QLKJYRLGNKZENN-UHFFFAOYSA-N 0.000 claims 1
- AITJVHNPNLILEG-UHFFFAOYSA-N propan-2-yl 2,4-dioxo-1h-pyrimidine-5-carboxylate Chemical compound CC(C)OC(=O)C1=CNC(=O)NC1=O AITJVHNPNLILEG-UHFFFAOYSA-N 0.000 claims 1
- YLVFGDYYISETNH-UHFFFAOYSA-N propan-2-yl 5-fluoro-2,4-dioxo-6-propan-2-yloxy-1,3-diazinane-5-carboxylate Chemical compound CC(C)OC1NC(=O)NC(=O)C1(F)C(=O)OC(C)C YLVFGDYYISETNH-UHFFFAOYSA-N 0.000 claims 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 claims 1
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical class FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 abstract description 11
- 238000003682 fluorination reaction Methods 0.000 abstract description 8
- 230000003301 hydrolyzing effect Effects 0.000 abstract description 4
- 201000009030 Carcinoma Diseases 0.000 abstract description 2
- 241001465754 Metazoa Species 0.000 abstract description 2
- 230000000840 anti-viral effect Effects 0.000 abstract description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 146
- 239000011541 reaction mixture Substances 0.000 description 98
- 238000007792 addition Methods 0.000 description 95
- XLYOFNOQVPJJNP-ZSJDYOACSA-N Heavy water Chemical compound [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 90
- 239000000243 solution Substances 0.000 description 80
- 238000002844 melting Methods 0.000 description 76
- 230000008018 melting Effects 0.000 description 75
- 239000000203 mixture Substances 0.000 description 72
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 67
- 239000007787 solid Substances 0.000 description 67
- 239000002904 solvent Substances 0.000 description 65
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 64
- 239000000741 silica gel Substances 0.000 description 61
- 229910002027 silica gel Inorganic materials 0.000 description 61
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 56
- 238000006243 chemical reaction Methods 0.000 description 53
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 49
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 48
- 229940022682 acetone Drugs 0.000 description 48
- 238000000921 elemental analysis Methods 0.000 description 48
- 229910052731 fluorine Inorganic materials 0.000 description 42
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 41
- 239000011737 fluorine Substances 0.000 description 41
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 40
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 35
- 239000000047 product Substances 0.000 description 35
- 238000001228 spectrum Methods 0.000 description 34
- 239000007789 gas Substances 0.000 description 32
- 238000010992 reflux Methods 0.000 description 32
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 31
- 239000000843 powder Substances 0.000 description 30
- 229960001701 chloroform Drugs 0.000 description 27
- 238000003756 stirring Methods 0.000 description 26
- 210000004027 cell Anatomy 0.000 description 25
- 239000000725 suspension Substances 0.000 description 24
- 238000001816 cooling Methods 0.000 description 23
- 229910052757 nitrogen Inorganic materials 0.000 description 22
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 21
- 239000007858 starting material Substances 0.000 description 21
- 239000002253 acid Substances 0.000 description 20
- 238000001914 filtration Methods 0.000 description 20
- 229940098779 methanesulfonic acid Drugs 0.000 description 20
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 238000004458 analytical method Methods 0.000 description 18
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 18
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 18
- 238000004440 column chromatography Methods 0.000 description 17
- 239000000706 filtrate Substances 0.000 description 17
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 16
- 230000003197 catalytic effect Effects 0.000 description 16
- 239000008246 gaseous mixture Substances 0.000 description 16
- 239000011521 glass Substances 0.000 description 16
- 239000006188 syrup Substances 0.000 description 16
- 235000020357 syrup Nutrition 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Natural products CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- PBQWMVZQUIWTIL-UHFFFAOYSA-N chloroform;hexane;propan-2-one Chemical compound CC(C)=O.ClC(Cl)Cl.CCCCCC PBQWMVZQUIWTIL-UHFFFAOYSA-N 0.000 description 15
- SMBZJSVIKJMSFP-UHFFFAOYSA-N trifluoromethyl hypofluorite Chemical compound FOC(F)(F)F SMBZJSVIKJMSFP-UHFFFAOYSA-N 0.000 description 15
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 14
- 229960000583 acetic acid Drugs 0.000 description 14
- 239000013078 crystal Substances 0.000 description 14
- 239000002244 precipitate Substances 0.000 description 14
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical group OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 13
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 12
- 238000005481 NMR spectroscopy Methods 0.000 description 12
- TXHIDIHEXDFONW-UHFFFAOYSA-N benzene;propan-2-one Chemical compound CC(C)=O.C1=CC=CC=C1 TXHIDIHEXDFONW-UHFFFAOYSA-N 0.000 description 12
- 238000001953 recrystallisation Methods 0.000 description 11
- 229960002949 fluorouracil Drugs 0.000 description 10
- 239000012456 homogeneous solution Substances 0.000 description 10
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 10
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 9
- JKTCBAGSMQIFNL-UHFFFAOYSA-N 2,3-dihydrofuran Chemical compound C1CC=CO1 JKTCBAGSMQIFNL-UHFFFAOYSA-N 0.000 description 8
- 238000000862 absorption spectrum Methods 0.000 description 8
- 230000002378 acidificating effect Effects 0.000 description 8
- OQIQSTLJSLGHID-WNWIJWBNSA-N aflatoxin B1 Chemical compound C=1([C@@H]2C=CO[C@@H]2OC=1C=C(C1=2)OC)C=2OC(=O)C2=C1CCC2=O OQIQSTLJSLGHID-WNWIJWBNSA-N 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 8
- OSQPUMRCKZAIOZ-UHFFFAOYSA-N carbon dioxide;ethanol Chemical compound CCO.O=C=O OSQPUMRCKZAIOZ-UHFFFAOYSA-N 0.000 description 8
- OSASVXMJTNOKOY-UHFFFAOYSA-N chlorobutanol Chemical compound CC(C)(O)C(Cl)(Cl)Cl OSASVXMJTNOKOY-UHFFFAOYSA-N 0.000 description 8
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 8
- 238000004587 chromatography analysis Methods 0.000 description 8
- 239000002609 medium Substances 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 235000017557 sodium bicarbonate Nutrition 0.000 description 8
- 239000000758 substrate Substances 0.000 description 8
- 239000003039 volatile agent Substances 0.000 description 8
- 229910000019 calcium carbonate Inorganic materials 0.000 description 7
- OQNGCCWBHLEQFN-UHFFFAOYSA-N chloroform;hexane Chemical compound ClC(Cl)Cl.CCCCCC OQNGCCWBHLEQFN-UHFFFAOYSA-N 0.000 description 7
- 238000005732 thioetherification reaction Methods 0.000 description 7
- 125000003396 thiol group Chemical group [H]S* 0.000 description 7
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 7
- HTYAAGMCFICFRV-UHFFFAOYSA-N 4,6-dioxo-1H-pyrimidine-5-carboxylic acid Chemical compound O=C1C(C(N=CN1)=O)C(=O)O HTYAAGMCFICFRV-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- 229910001873 dinitrogen Inorganic materials 0.000 description 6
- 238000006266 etherification reaction Methods 0.000 description 6
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 6
- 238000004809 thin layer chromatography Methods 0.000 description 6
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 238000005576 amination reaction Methods 0.000 description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 150000007942 carboxylates Chemical class 0.000 description 5
- 235000008504 concentrate Nutrition 0.000 description 5
- 239000012141 concentrate Substances 0.000 description 5
- 239000012025 fluorinating agent Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 229940079827 sodium hydrogen sulfite Drugs 0.000 description 5
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 5
- 238000002211 ultraviolet spectrum Methods 0.000 description 5
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 4
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- WFWLQNSHRPWKFK-UHFFFAOYSA-N Tegafur Chemical compound O=C1NC(=O)C(F)=CN1C1OCCC1 WFWLQNSHRPWKFK-UHFFFAOYSA-N 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 229960004926 chlorobutanol Drugs 0.000 description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 4
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- 229910052740 iodine Inorganic materials 0.000 description 4
- 239000012452 mother liquor Substances 0.000 description 4
- 238000010899 nucleation Methods 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- ZVAKZVDJIUFFFP-UHFFFAOYSA-N 2-chlorooxolane Chemical compound ClC1CCCO1 ZVAKZVDJIUFFFP-UHFFFAOYSA-N 0.000 description 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 3
- XGEGHDBEHXKFPX-UHFFFAOYSA-N N-methylthiourea Natural products CNC(N)=O XGEGHDBEHXKFPX-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- 125000004423 acyloxy group Chemical group 0.000 description 3
- MJBWDEQAUQTVKK-IAGOWNOFSA-N aflatoxin M1 Chemical compound C=1([C@]2(O)C=CO[C@@H]2OC=1C=C(C1=2)OC)C=2OC(=O)C2=C1CCC2=O MJBWDEQAUQTVKK-IAGOWNOFSA-N 0.000 description 3
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- SKCNIGRBPJIUBQ-UHFFFAOYSA-N chloroform;ethyl acetate Chemical compound ClC(Cl)Cl.CCOC(C)=O SKCNIGRBPJIUBQ-UHFFFAOYSA-N 0.000 description 3
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 3
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000011368 organic material Substances 0.000 description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 230000036647 reaction Effects 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 3
- 239000008279 sol Substances 0.000 description 3
- 239000012265 solid product Substances 0.000 description 3
- 229940086542 triethylamine Drugs 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- 229940035893 uracil Drugs 0.000 description 3
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- ZFTBZKVVGZNMJR-UHFFFAOYSA-N 5-chlorouracil Chemical compound ClC1=CNC(=O)NC1=O ZFTBZKVVGZNMJR-UHFFFAOYSA-N 0.000 description 2
- YPBBFSHXQAJCFB-UHFFFAOYSA-N 5-fluoro-6-methoxy-1-methyl-1,3-diazinane-2,4-dione Chemical compound COC1C(F)C(=O)NC(=O)N1C YPBBFSHXQAJCFB-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 2
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000004809 Teflon Substances 0.000 description 2
- 229920006362 Teflon® Polymers 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- OWAQXCQNWNJICI-UHFFFAOYSA-N benzene;chloroform Chemical compound ClC(Cl)Cl.C1=CC=CC=C1 OWAQXCQNWNJICI-UHFFFAOYSA-N 0.000 description 2
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 239000012320 chlorinating reagent Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- UXTMROKLAAOEQO-UHFFFAOYSA-N chloroform;ethanol Chemical compound CCO.ClC(Cl)Cl UXTMROKLAAOEQO-UHFFFAOYSA-N 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- MWKFXSUHUHTGQN-UHFFFAOYSA-N decan-1-ol Chemical compound CCCCCCCCCCO MWKFXSUHUHTGQN-UHFFFAOYSA-N 0.000 description 2
- 229910052805 deuterium Inorganic materials 0.000 description 2
- GFMJUEPZNNZMLE-UHFFFAOYSA-N dimethyl 2-[(methylcarbamoylamino)methylidene]propanedioate Chemical compound CNC(=O)NC=C(C(=O)OC)C(=O)OC GFMJUEPZNNZMLE-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000012894 fetal calf serum Substances 0.000 description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 2
- 239000000727 fraction Substances 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 230000012010 growth Effects 0.000 description 2
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- 208000032839 leukemia Diseases 0.000 description 2
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 230000000630 rising effect Effects 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- TWVSJSJIEJKNCO-UHFFFAOYSA-N (1,2-difluoro-2-fluorooxyethyl) hypofluorite Chemical compound FOC(F)C(F)OF TWVSJSJIEJKNCO-UHFFFAOYSA-N 0.000 description 1
- PNVPNXKRAUBJGW-UHFFFAOYSA-N (2-chloroacetyl) 2-chloroacetate Chemical compound ClCC(=O)OC(=O)CCl PNVPNXKRAUBJGW-UHFFFAOYSA-N 0.000 description 1
- OGNVQLDIPUXYDH-ZPKKHLQPSA-N (2R,3R,4S)-3-(2-methylpropanoylamino)-4-(4-phenyltriazol-1-yl)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid Chemical compound CC(C)C(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(O)=O)=C[C@@H]1N1N=NC(C=2C=CC=CC=2)=C1 OGNVQLDIPUXYDH-ZPKKHLQPSA-N 0.000 description 1
- BMXBZXPSTWYZSL-UHFFFAOYSA-N (3z)-1-methyl-3-[(methylcarbamoylamino)methylidene]urea Chemical compound CNC(=O)NC=NC(=O)NC BMXBZXPSTWYZSL-UHFFFAOYSA-N 0.000 description 1
- PTHGDVCPCZKZKR-UHFFFAOYSA-N (4-chlorophenyl)methanol Chemical compound OCC1=CC=C(Cl)C=C1 PTHGDVCPCZKZKR-UHFFFAOYSA-N 0.000 description 1
- DGQBNDRZRZYTER-UHFFFAOYSA-N (pentafluoro-$l^{6}-sulfanyl) hypofluorite Chemical compound FOS(F)(F)(F)(F)F DGQBNDRZRZYTER-UHFFFAOYSA-N 0.000 description 1
- ZHFHWCJQSWNMOE-UHFFFAOYSA-N 1,1,1,2-tetrachloroethane trichloro(fluoro)methane Chemical compound ClC(F)(Cl)Cl.ClCC(Cl)(Cl)Cl ZHFHWCJQSWNMOE-UHFFFAOYSA-N 0.000 description 1
- UMKWCCVQQCRXTM-UHFFFAOYSA-N 1,1,2,2,3,3,3-heptafluoropropyl hypofluorite Chemical compound FOC(F)(F)C(F)(F)C(F)(F)F UMKWCCVQQCRXTM-UHFFFAOYSA-N 0.000 description 1
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 1
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- LYUPJHVGLFETDG-UHFFFAOYSA-N 1-phenylbutan-2-ol Chemical compound CCC(O)CC1=CC=CC=C1 LYUPJHVGLFETDG-UHFFFAOYSA-N 0.000 description 1
- KPWDGTGXUYRARH-UHFFFAOYSA-N 2,2,2-trichloroethanol Chemical compound OCC(Cl)(Cl)Cl KPWDGTGXUYRARH-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- LRMSQVBRUNSOJL-UHFFFAOYSA-N 2,2,3,3,3-pentafluoropropanoic acid Chemical compound OC(=O)C(F)(F)C(F)(F)F LRMSQVBRUNSOJL-UHFFFAOYSA-N 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- HUMYNECKRWOZGW-UHFFFAOYSA-N 2,4-dioxo-1h-pyrimidine-5-carboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(O)N=C1O HUMYNECKRWOZGW-UHFFFAOYSA-N 0.000 description 1
- VCUXVXLUOHDHKK-UHFFFAOYSA-N 2-(2-aminopyrimidin-4-yl)-4-(2-chloro-4-methoxyphenyl)-1,3-thiazole-5-carboxamide Chemical compound ClC1=CC(OC)=CC=C1C1=C(C(N)=O)SC(C=2N=C(N)N=CC=2)=N1 VCUXVXLUOHDHKK-UHFFFAOYSA-N 0.000 description 1
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- HDECRAPHCDXMIJ-UHFFFAOYSA-N 2-methylbenzenesulfonyl chloride Chemical compound CC1=CC=CC=C1S(Cl)(=O)=O HDECRAPHCDXMIJ-UHFFFAOYSA-N 0.000 description 1
- NOFHGTFVUKJZTK-UHFFFAOYSA-N 2-octyl-1,4-dioxane Chemical compound CCCCCCCCC1COCCO1 NOFHGTFVUKJZTK-UHFFFAOYSA-N 0.000 description 1
- 125000006325 2-propenyl amino group Chemical group [H]C([H])=C([H])C([H])([H])N([H])* 0.000 description 1
- MCWHLZDKYXZLHO-UHFFFAOYSA-N 2-tert-butyl-6-fluoronaphthalene Chemical compound C1=C(F)C=CC2=CC(C(C)(C)C)=CC=C21 MCWHLZDKYXZLHO-UHFFFAOYSA-N 0.000 description 1
- HUEHCDQZTHOZAN-UHFFFAOYSA-N 3-methyl-2,4-dioxo-1h-pyrimidine-5-carboxylic acid Chemical compound CN1C(=O)NC=C(C(O)=O)C1=O HUEHCDQZTHOZAN-UHFFFAOYSA-N 0.000 description 1
- RXXCIBALSKQCAE-UHFFFAOYSA-N 3-methylbutoxymethylbenzene Chemical compound CC(C)CCOCC1=CC=CC=C1 RXXCIBALSKQCAE-UHFFFAOYSA-N 0.000 description 1
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 150000005718 5-chloropyrimidines Chemical class 0.000 description 1
- AWONXBGDFDRWRH-UHFFFAOYSA-N 5-fluoro-6-hydroxy-1,3-diazinane-2,4-dione Chemical compound OC1NC(=O)NC(=O)C1F AWONXBGDFDRWRH-UHFFFAOYSA-N 0.000 description 1
- 150000005727 5-fluoropyrimidines Chemical class 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 206010003571 Astrocytoma Diseases 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- YGHAUSBDRXIFHX-UHFFFAOYSA-N C(C)N1C(NC(C(C1O)F)=O)=O Chemical compound C(C)N1C(NC(C(C1O)F)=O)=O YGHAUSBDRXIFHX-UHFFFAOYSA-N 0.000 description 1
- KMDGWEJQACVQTC-UHFFFAOYSA-N C(CCCCCCCCCCCCCCCCC)N1C(NC(C=C1)=O)=O Chemical compound C(CCCCCCCCCCCCCCCCC)N1C(NC(C=C1)=O)=O KMDGWEJQACVQTC-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 101100536354 Drosophila melanogaster tant gene Proteins 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 241001058146 Erium Species 0.000 description 1
- 208000008342 Leukemia P388 Diseases 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-Chlorosuccinimide Substances ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 1
- 208000002454 Nasopharyngeal Carcinoma Diseases 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- LEHOTFFKMJEONL-UHFFFAOYSA-N Uric Acid Chemical compound N1C(=O)NC(=O)C2=C1NC(=O)N2 LEHOTFFKMJEONL-UHFFFAOYSA-N 0.000 description 1
- TVWHNULVHGKJHS-UHFFFAOYSA-N Uric acid Natural products N1C(=O)NC(=O)C2NC(=O)NC21 TVWHNULVHGKJHS-UHFFFAOYSA-N 0.000 description 1
- GMLJCMXFMUEABC-UHFFFAOYSA-N [difluoro(fluorooxy)methyl] hypofluorite Chemical compound FOC(F)(F)OF GMLJCMXFMUEABC-UHFFFAOYSA-N 0.000 description 1
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 210000003567 ascitic fluid Anatomy 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- YHASWHZGWUONAO-UHFFFAOYSA-N butanoyl butanoate Chemical compound CCCC(=O)OC(=O)CCC YHASWHZGWUONAO-UHFFFAOYSA-N 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 230000003327 cancerostatic effect Effects 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- ONPSRCNNSZSSMH-UHFFFAOYSA-N chloroform;hexane;methanol Chemical compound OC.ClC(Cl)Cl.CCCCCC ONPSRCNNSZSSMH-UHFFFAOYSA-N 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 210000004748 cultured cell Anatomy 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000006165 cyclic alkyl group Chemical group 0.000 description 1
- JFWMYCVMQSLLOO-UHFFFAOYSA-N cyclobutanecarbonyl chloride Chemical compound ClC(=O)C1CCC1 JFWMYCVMQSLLOO-UHFFFAOYSA-N 0.000 description 1
- TXWOGHSRPAYOML-UHFFFAOYSA-N cyclobutanecarboxylic acid Chemical compound OC(=O)C1CCC1 TXWOGHSRPAYOML-UHFFFAOYSA-N 0.000 description 1
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 1
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical compound OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 125000006612 decyloxy group Chemical group 0.000 description 1
- XXJWXESWEXIICW-UHFFFAOYSA-N diethylene glycol monoethyl ether Chemical compound CCOCCOCCO XXJWXESWEXIICW-UHFFFAOYSA-N 0.000 description 1
- 229940075557 diethylene glycol monoethyl ether Drugs 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000001891 dimethoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- QYFIQVSQJNVSEB-UHFFFAOYSA-N ethyl 5-fluoro-4-(2-methylpropoxy)-2,6-dioxo-1,3-diazinane-5-carboxylate Chemical compound CCOC(=O)C1(F)C(OCC(C)C)NC(=O)NC1=O QYFIQVSQJNVSEB-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 210000002950 fibroblast Anatomy 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- XJUJXVATKIRSAM-UHFFFAOYSA-N fluoro(phenyl)methanol Chemical compound OC(F)C1=CC=CC=C1 XJUJXVATKIRSAM-UHFFFAOYSA-N 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 235000019256 formaldehyde Nutrition 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N hydrogen peroxide Substances OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- VMUWIFNDNXXSQA-UHFFFAOYSA-N hypofluorite Chemical compound F[O-] VMUWIFNDNXXSQA-UHFFFAOYSA-N 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- XGEGHDBEHXKFPX-NJFSPNSNSA-N methylurea Chemical compound [14CH3]NC(N)=O XGEGHDBEHXKFPX-NJFSPNSNSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 239000012434 nucleophilic reagent Substances 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- JYEWTTRXGBYSRW-UHFFFAOYSA-N octyl 4-acetyloxy-5-fluoro-1,3-diazinane-5-carboxylate Chemical compound CCCCCCCCOC(=O)C1(F)CNCNC1OC(C)=O JYEWTTRXGBYSRW-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- UJMWVICAENGCRF-UHFFFAOYSA-N oxygen difluoride Chemical group FOF UJMWVICAENGCRF-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000552 p-cresyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1O*)C([H])([H])[H] 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- XVIAPHVAGFEFFN-UHFFFAOYSA-N pyrimidine-5-carbonitrile Chemical compound N#CC1=CN=CN=C1 XVIAPHVAGFEFFN-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000011369 resultant mixture Substances 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 238000006884 silylation reaction Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical compound [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- IXZDIALLLMRYOU-UHFFFAOYSA-N tert-butyl hypochlorite Chemical compound CC(C)(C)OCl IXZDIALLLMRYOU-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 1
- 229940116269 uric acid Drugs 0.000 description 1
- 230000009385 viral infection Effects 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
- C07D239/54—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals
- C07D239/545—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/557—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms, e.g. orotic acid
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C273/00—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C273/18—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas
- C07C273/1854—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas by reactions not involving the formation of the N-C(O)-N- moiety
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/20—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D239/22—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
- C07D239/54—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals
- C07D239/545—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/553—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms with halogen atoms or nitro radicals directly attached to ring carbon atoms, e.g. fluorouracil
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/18—Compounds having one or more C—Si linkages as well as one or more C—O—Si linkages
- C07F7/1804—Compounds having Si-O-C linkages
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- General Chemical & Material Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP3665376A JPS52118480A (en) | 1976-03-31 | 1976-03-31 | Synthesis of uracil derivatives |
| JP12993276A JPS5353672A (en) | 1976-10-27 | 1976-10-27 | Fluoropyrimidine deivatives |
| JP14679576A JPS5371086A (en) | 1976-12-06 | 1976-12-06 | Preparation of uracil derivs. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1081226A true CA1081226A (en) | 1980-07-08 |
Family
ID=27289176
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA274,676A Expired CA1081226A (en) | 1976-03-31 | 1977-03-24 | Uracil derivatives and production thereof |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4329460A (enExample) |
| CA (1) | CA1081226A (enExample) |
| CH (1) | CH632748A5 (enExample) |
| DD (2) | DD137353A5 (enExample) |
| DE (1) | DE2714392A1 (enExample) |
| DK (1) | DK142029B (enExample) |
| ES (1) | ES469098A1 (enExample) |
| FI (1) | FI770904A7 (enExample) |
| FR (1) | FR2346337A1 (enExample) |
| GB (1) | GB1546346A (enExample) |
| GR (1) | GR68935B (enExample) |
| NL (1) | NL7703541A (enExample) |
| NO (1) | NO771124L (enExample) |
| PH (1) | PH14553A (enExample) |
| PL (1) | PL106917B1 (enExample) |
| PT (1) | PT66374B (enExample) |
| SE (1) | SE7703721L (enExample) |
| SU (1) | SU795467A3 (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS57179188A (en) * | 1981-04-28 | 1982-11-04 | Shionogi & Co Ltd | 5-fluorouracil derivative |
| DK167280B1 (da) * | 1985-03-20 | 1993-10-04 | Ciba Geigy Ag | 3-aryluracilderivater, fremgangsmaade til fremstilling deraf, ukrudtsbekaempelsesmidler indeholdende disse derivater samt anvendelsen af derivaterne til ukrudtsbekaempelse |
| US4669081A (en) * | 1986-02-04 | 1987-05-26 | Raytheon Company | LSI fault insertion |
| US4816585A (en) * | 1987-03-05 | 1989-03-28 | Olin Corporation | Tetraalkylpiperidinyl substituted uracil derivatives and their use as ultraviolet light stabilizers |
| US4904714A (en) * | 1987-10-02 | 1990-02-27 | Olin Corporation | Synthetic resin composition and its method of use |
| US4920126A (en) * | 1988-05-10 | 1990-04-24 | Uniroyal Chemical Ltd/Uniroyal Chemical Ltee | Barbituric acid derivative and treatment of leukemia and tumors therewith |
| US5312919A (en) * | 1992-06-12 | 1994-05-17 | Baylor Research Institute | Photooxidation products and derivatives thereof of merocyanine-540, their preparation and uses |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3277092A (en) * | 1963-05-02 | 1966-10-04 | Hoffmann La Roche | 5, 6-substituted dihydro-5-fluoropyrimidines |
| US3221010A (en) * | 1963-05-02 | 1965-11-30 | Hoffmann La Roche | 5,6-substituted dihydro-5-fluoropyrimidine nucleosides |
| US3201387A (en) * | 1963-09-18 | 1965-08-17 | Heidelberger Charles | 5-trifluoromethyluracil, derivatives thereof, and processes for preparing the same |
| US3360523A (en) * | 1964-06-17 | 1967-12-26 | Du Pont | 3, 5, 6-substituted hydrouracils |
| US3406023A (en) * | 1966-10-31 | 1968-10-15 | Du Pont | Herbicidal method |
| US3954758A (en) * | 1970-05-27 | 1976-05-04 | Pcr, Inc. | Process for fluorinating uracil and derivatives thereof |
| CH553195A (de) * | 1971-03-19 | 1974-08-30 | Sandoz Ag | Verfahren zur herstellung neuer 2,6-dichlor-benzaldoximo-(s-triazinyl-(6))-aether. |
| US3987045A (en) * | 1971-05-03 | 1976-10-19 | Basf Aktiengesellschaft | Disperse dyes based on isoindolene derivatives |
| US3954759A (en) * | 1972-07-13 | 1976-05-04 | Pcr, Inc. | Process for preparation of 6-substituted 5-fluorouracil derivatives |
| DE2401619C2 (de) * | 1974-01-14 | 1986-04-03 | Kailash Kumar Prof. Dr. 2359 Lentföhrden Gauri | Fungistatisch wirksame Uracilderivate und Verfahren zu ihrer Herstellung |
| DE2602175B2 (de) * | 1975-01-22 | 1978-05-03 | Asahi Kasei Kogyo K.K., Osaka (Japan) | 1 -Alkanoyl-5-fluor-uracilderivate und ihre Verwendung |
| US4071519A (en) * | 1975-11-05 | 1978-01-31 | Mitsui Toatsu Chemicals, Incorporated | 1-Carbamoyl-5-fluorouracil derivatives |
| US4080455A (en) * | 1975-12-16 | 1978-03-21 | Taisho Pharmaceutical Company Limited | 5-Fluoropyrimidin-4-one compositions |
-
1977
- 1977-03-17 GR GR53014A patent/GR68935B/el unknown
- 1977-03-22 FI FI770904A patent/FI770904A7/fi not_active Application Discontinuation
- 1977-03-24 CA CA274,676A patent/CA1081226A/en not_active Expired
- 1977-03-24 CH CH373577A patent/CH632748A5/de not_active IP Right Cessation
- 1977-03-25 GB GB12789/77A patent/GB1546346A/en not_active Expired
- 1977-03-29 FR FR7709280A patent/FR2346337A1/fr active Granted
- 1977-03-30 SE SE7703721A patent/SE7703721L/xx unknown
- 1977-03-30 DK DK141177AA patent/DK142029B/da not_active IP Right Cessation
- 1977-03-30 PL PL1977197045A patent/PL106917B1/pl unknown
- 1977-03-30 PT PT66374A patent/PT66374B/pt unknown
- 1977-03-30 NO NO771124A patent/NO771124L/no unknown
- 1977-03-31 NL NL7703541A patent/NL7703541A/xx not_active Application Discontinuation
- 1977-03-31 DE DE19772714392 patent/DE2714392A1/de not_active Withdrawn
- 1977-03-31 DD DD77206212A patent/DD137353A5/xx unknown
- 1977-03-31 DD DD7700198177A patent/DD132790A5/xx unknown
- 1977-03-31 PH PH19603A patent/PH14553A/en unknown
- 1977-03-31 SU SU772466666A patent/SU795467A3/ru active
-
1978
- 1978-04-01 ES ES469098A patent/ES469098A1/es not_active Expired
-
1979
- 1979-06-13 US US06/048,169 patent/US4329460A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| PH14553A (en) | 1981-09-24 |
| ES469098A1 (es) | 1979-09-16 |
| US4329460A (en) | 1982-05-11 |
| GR68935B (enExample) | 1982-03-29 |
| DK141177A (enExample) | 1977-10-01 |
| DD132790A5 (de) | 1978-11-01 |
| SE7703721L (sv) | 1977-10-01 |
| DK142029C (enExample) | 1981-01-05 |
| NO771124L (no) | 1977-10-03 |
| PT66374B (en) | 1978-08-25 |
| PL106917B1 (pl) | 1980-01-31 |
| PT66374A (en) | 1977-04-01 |
| GB1546346A (en) | 1979-05-23 |
| NL7703541A (nl) | 1977-10-04 |
| FR2346337B1 (enExample) | 1983-05-13 |
| FI770904A7 (enExample) | 1977-10-01 |
| CH632748A5 (de) | 1982-10-29 |
| FR2346337A1 (fr) | 1977-10-28 |
| DK142029B (da) | 1980-08-11 |
| DE2714392A1 (de) | 1977-12-22 |
| PL197045A1 (pl) | 1978-02-13 |
| SU795467A3 (ru) | 1981-01-07 |
| DD137353A5 (de) | 1979-08-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4323570A (en) | Substituted aminopyrimidines | |
| US4923872A (en) | Analogues of pyrrolo[3,2d]pyrimidin-4-ones | |
| NZ242396A (en) | 6-hydroxyalkoxy-pyrimidin-4-yl benzenesulphonamide derivatives; pharmaceutical compositions and preparatory processes | |
| CA1081226A (en) | Uracil derivatives and production thereof | |
| EP3566749A1 (en) | Thiazole derivative and applications thereof | |
| EP0260491B1 (en) | 9-deazaguanines | |
| FI85143B (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva purinderivat. | |
| EP0004793B1 (en) | 2-nitro aminopyrimidone derivatives, a process for their preparation and their use to prepare 2-aminopyrimidone derivatives which have histamine h2-antagonist activity | |
| CA1294960C (en) | 7-deazaguanines as immunomodulators | |
| EP0219838A2 (en) | Carbocyclic purine nucleosides, their production and use | |
| EP0032131B1 (en) | 5-halo-pyrimidin-2-ones, the salts thereof, processes for their preparation and pharmaceutical compositions containing them | |
| Marshall | Lithium Aluminum Hydride Reduction of Some Hydantoins, Barbiturates and Thiouracils | |
| Braker et al. | Substituted Sulfanilamidopyrimidines1 | |
| US4060616A (en) | Purine derivatives with repeating unit | |
| US4988702A (en) | Novel 9-deazaguanines | |
| US4039546A (en) | Method of preparing N1 -(2'-furanidyl)-5-substituted uracils | |
| US5061707A (en) | 9-deazaguanines to treat psoriasis | |
| US4256885A (en) | Process for the preparation of 1-(2-tetrahydrofuryl)-5-fluorouracil | |
| SU1641191A3 (ru) | Способ получени 1,3,4-тиадиазол-2-цианамида или его фармацевтически приемлемых солей | |
| CA1152074A (en) | Pyrimidyl thioureas | |
| US4159378A (en) | Method for the preparation of derivatives of uracil | |
| EP0504868B1 (en) | Method of manufacturing 2'-3'-dideoxy-2',3'.didehydronucleosides | |
| EP0066440B1 (en) | Chemical process | |
| US3317532A (en) | Derivatives of pyrimidine | |
| US5102879A (en) | Method of treating gout with novel 9-deazaguanines |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |