CA1080206A - Olefin polymerization catalyst - Google Patents
Olefin polymerization catalystInfo
- Publication number
- CA1080206A CA1080206A CA246,434A CA246434A CA1080206A CA 1080206 A CA1080206 A CA 1080206A CA 246434 A CA246434 A CA 246434A CA 1080206 A CA1080206 A CA 1080206A
- Authority
- CA
- Canada
- Prior art keywords
- compound
- catalyst system
- aluminum
- aluminum compound
- chromium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001336 alkenes Chemical class 0.000 title claims abstract description 13
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 title claims abstract description 7
- 239000002685 polymerization catalyst Substances 0.000 title claims abstract description 5
- 239000003054 catalyst Substances 0.000 claims abstract description 85
- 239000011651 chromium Substances 0.000 claims abstract description 52
- -1 aluminum compound Chemical class 0.000 claims abstract description 46
- 229910052782 aluminium Inorganic materials 0.000 claims abstract description 45
- 229910052804 chromium Inorganic materials 0.000 claims abstract description 31
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims abstract description 30
- 238000006116 polymerization reaction Methods 0.000 claims abstract description 23
- 239000000463 material Substances 0.000 claims abstract description 21
- 239000003638 chemical reducing agent Substances 0.000 claims abstract description 15
- 150000001845 chromium compounds Chemical class 0.000 claims abstract description 9
- 238000010438 heat treatment Methods 0.000 claims abstract description 6
- 238000000354 decomposition reaction Methods 0.000 claims abstract description 5
- 238000000151 deposition Methods 0.000 claims abstract description 4
- 150000001875 compounds Chemical class 0.000 claims description 51
- 238000000034 method Methods 0.000 claims description 19
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 17
- 229910052739 hydrogen Chemical group 0.000 claims description 16
- 239000001257 hydrogen Chemical group 0.000 claims description 16
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 claims description 14
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 claims description 14
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 239000011148 porous material Substances 0.000 claims description 9
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 7
- 229910000085 borane Inorganic materials 0.000 claims description 7
- 150000002431 hydrogen Chemical group 0.000 claims description 7
- 229910052796 boron Inorganic materials 0.000 claims description 6
- 239000000741 silica gel Substances 0.000 claims description 6
- 229910002027 silica gel Inorganic materials 0.000 claims description 6
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical group [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 5
- LALRXNPLTWZJIJ-UHFFFAOYSA-N triethylborane Chemical compound CCB(CC)CC LALRXNPLTWZJIJ-UHFFFAOYSA-N 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 229910052698 phosphorus Inorganic materials 0.000 claims description 3
- 239000011574 phosphorus Substances 0.000 claims description 3
- WOZZOSDBXABUFO-UHFFFAOYSA-N tri(butan-2-yloxy)alumane Chemical compound [Al+3].CCC(C)[O-].CCC(C)[O-].CCC(C)[O-] WOZZOSDBXABUFO-UHFFFAOYSA-N 0.000 claims description 3
- 150000001639 boron compounds Chemical class 0.000 claims description 2
- 229940117975 chromium trioxide Drugs 0.000 claims 4
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 claims 4
- 239000007795 chemical reaction product Substances 0.000 claims 3
- 239000007787 solid Substances 0.000 claims 2
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical compound CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 claims 1
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 claims 1
- 235000010210 aluminium Nutrition 0.000 description 24
- 229920000642 polymer Polymers 0.000 description 10
- 239000003795 chemical substances by application Substances 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical group ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 229910052681 coesite Inorganic materials 0.000 description 5
- 229910052906 cristobalite Inorganic materials 0.000 description 5
- 239000000499 gel Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 229910052755 nonmetal Inorganic materials 0.000 description 5
- 229910052682 stishovite Inorganic materials 0.000 description 5
- 229910052905 tridymite Inorganic materials 0.000 description 5
- 150000004703 alkoxides Chemical class 0.000 description 4
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- MCULRUJILOGHCJ-UHFFFAOYSA-N triisobutylaluminium Chemical compound CC(C)C[Al](CC(C)C)CC(C)C MCULRUJILOGHCJ-UHFFFAOYSA-N 0.000 description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 3
- 239000005977 Ethylene Substances 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 3
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical class [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 3
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 3
- 125000002524 organometallic group Chemical group 0.000 description 3
- 235000021317 phosphate Nutrition 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 125000005234 alkyl aluminium group Chemical group 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 229910000423 chromium oxide Inorganic materials 0.000 description 2
- 229910052733 gallium Inorganic materials 0.000 description 2
- 239000001282 iso-butane Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 150000002903 organophosphorus compounds Chemical class 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 229920000098 polyolefin Polymers 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- OPSWAWSNPREEFQ-UHFFFAOYSA-K triphenoxyalumane Chemical compound [Al+3].[O-]C1=CC=CC=C1.[O-]C1=CC=CC=C1.[O-]C1=CC=CC=C1 OPSWAWSNPREEFQ-UHFFFAOYSA-K 0.000 description 2
- XAGFODPZIPBFFR-BJUDXGSMSA-N Aluminum-26 Chemical compound [26Al] XAGFODPZIPBFFR-BJUDXGSMSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CQBWEBXPMRPCSI-UHFFFAOYSA-M O[Cr](O[SiH3])(=O)=O Chemical compound O[Cr](O[SiH3])(=O)=O CQBWEBXPMRPCSI-UHFFFAOYSA-M 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000012967 coordination catalyst Substances 0.000 description 1
- YNLAOSYQHBDIKW-UHFFFAOYSA-M diethylaluminium chloride Chemical compound CC[Al](Cl)CC YNLAOSYQHBDIKW-UHFFFAOYSA-M 0.000 description 1
- CQYBWJYIKCZXCN-UHFFFAOYSA-N diethylaluminum Chemical compound CC[Al]CC CQYBWJYIKCZXCN-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- AIGRXSNSLVJMEA-FQEVSTJZSA-N ethoxy-(4-nitrophenoxy)-phenyl-sulfanylidene-$l^{5}-phosphane Chemical compound O([P@@](=S)(OCC)C=1C=CC=CC=1)C1=CC=C([N+]([O-])=O)C=C1 AIGRXSNSLVJMEA-FQEVSTJZSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052809 inorganic oxide Inorganic materials 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- NRQNMMBQPIGPTB-UHFFFAOYSA-N methylaluminum Chemical compound [CH3].[Al] NRQNMMBQPIGPTB-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- OGHBATFHNDZKSO-UHFFFAOYSA-N propan-2-olate Chemical compound CC(C)[O-] OGHBATFHNDZKSO-UHFFFAOYSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- WXRGABKACDFXMG-UHFFFAOYSA-N trimethylborane Chemical compound CB(C)C WXRGABKACDFXMG-UHFFFAOYSA-N 0.000 description 1
- JQPMDTQDAXRDGS-UHFFFAOYSA-N triphenylalumane Chemical compound C1=CC=CC=C1[Al](C=1C=CC=CC=1)C1=CC=CC=C1 JQPMDTQDAXRDGS-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F110/00—Homopolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Fats And Perfumes (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Production Of Liquid Hydrocarbon Mixture For Refining Petroleum (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/558,504 US3984351A (en) | 1975-03-14 | 1975-03-14 | Olefin polymerization catalyst |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1080206A true CA1080206A (en) | 1980-06-24 |
Family
ID=24229805
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA246,434A Expired CA1080206A (en) | 1975-03-14 | 1976-02-24 | Olefin polymerization catalyst |
Country Status (32)
| Country | Link |
|---|---|
| US (1) | US3984351A (enExample) |
| JP (1) | JPS5910363B2 (enExample) |
| AR (1) | AR216435A1 (enExample) |
| AT (1) | AT354078B (enExample) |
| BE (1) | BE839517A (enExample) |
| BG (1) | BG28833A3 (enExample) |
| BR (1) | BR7601513A (enExample) |
| CA (1) | CA1080206A (enExample) |
| CH (1) | CH613462A5 (enExample) |
| CS (1) | CS195724B2 (enExample) |
| DE (1) | DE2610422A1 (enExample) |
| DK (1) | DK109176A (enExample) |
| EG (1) | EG12801A (enExample) |
| ES (1) | ES446042A1 (enExample) |
| FI (1) | FI760644A7 (enExample) |
| FR (1) | FR2303812B1 (enExample) |
| GB (1) | GB1537892A (enExample) |
| GR (1) | GR59890B (enExample) |
| HU (1) | HU180912B (enExample) |
| IL (1) | IL49185A (enExample) |
| IT (1) | IT1065001B (enExample) |
| MX (1) | MX3191E (enExample) |
| MY (1) | MY8100053A (enExample) |
| NL (1) | NL182965C (enExample) |
| NO (1) | NO152300C (enExample) |
| PL (1) | PL110658B1 (enExample) |
| PT (1) | PT64876B (enExample) |
| RO (1) | RO69179A (enExample) |
| SE (1) | SE433853B (enExample) |
| SU (1) | SU1145915A3 (enExample) |
| YU (1) | YU60776A (enExample) |
| ZA (1) | ZA761105B (enExample) |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4184028A (en) * | 1975-03-14 | 1980-01-15 | National Petro Chemicals Corporation | Olefin Polymerization catalyst |
| US4192775A (en) * | 1975-03-14 | 1980-03-11 | National Petro Chemicals Corporation | Olefin polymerization catalyst |
| US4049896A (en) * | 1975-03-14 | 1977-09-20 | National Petro Chemicals Corporation | Olefin polymerization catalyst |
| US4234709A (en) * | 1976-05-07 | 1980-11-18 | National Petro Chemicals Corporation | Catalyst composition, method for producing same and method for polymerization of 1-olefins with same |
| NL171273C (nl) * | 1976-05-24 | 1983-03-01 | Stamicarbon | Werkwijze voor het polymeriseren van alkenen en werkwijze voor het bereiden van een chroomoxyde-op drager-katalysator. |
| US4118340A (en) * | 1976-06-07 | 1978-10-03 | National Distillers And Chemical Corporation | Novel polymerization catalyst |
| US4234453A (en) * | 1976-09-20 | 1980-11-18 | National Petro Chemicals Corporation | Olefin polymerization catalyst |
| US4290914A (en) * | 1977-01-13 | 1981-09-22 | National Petro Chemicals Corp. | Catalytic materials as for olefin polymerization |
| US4100104A (en) * | 1977-01-13 | 1978-07-11 | National Petro Chemicals Corporation | Catalytic materials as for olefin polymerization |
| US4100105A (en) * | 1977-01-21 | 1978-07-11 | Union Carbide Corporation | Titanium-modified silyl chromate catalysts for ethylene polymerization |
| AU3589578A (en) * | 1977-05-25 | 1979-11-15 | Nat Petro Chem | Supported heat activated chromium containing catalyst containing polymeric h/c aluminate |
| US4593079A (en) * | 1977-05-25 | 1986-06-03 | National Distillers And Chemical Corporation | Resin rheology control process and catalyst therefor |
| US4115318A (en) * | 1977-06-09 | 1978-09-19 | National Petro Chemicals Corporation | Olefin polymerization catalyst |
| US4119773A (en) * | 1977-06-22 | 1978-10-10 | National Distillers And Chemical Corporation | Olefin polymerization catalyst |
| DE2802763A1 (de) * | 1978-01-23 | 1979-07-26 | Hoechst Ag | Verfahren zur herstellung eines katalysators |
| DE2925987A1 (de) * | 1978-07-14 | 1980-01-24 | Nat Petro Chem | Katalysator fuer die polymerisation von olefinen und verfahren zu seiner herstellung |
| US4238353A (en) * | 1978-07-14 | 1980-12-09 | National Petro Chemicals Corp. | Olefin polymerization catalyst |
| US4252926A (en) * | 1978-08-07 | 1981-02-24 | National Petro Chemicals Corp. | Process for polymerizing olefins and polymerization catalysts used therefor |
| US4312786A (en) * | 1978-08-07 | 1982-01-26 | National Petro Chemicals Corp. | Process for polymerizing olefins and polymerization catalysts used therefor |
| US4297461A (en) * | 1979-06-08 | 1981-10-27 | National Petro Chemicals Corp. | Olefin polymerization catalyst |
| US4260706A (en) * | 1979-06-21 | 1981-04-07 | National Petro Chemicals Corp. | Olefin polymerization catalyst |
| US4404340A (en) * | 1981-01-26 | 1983-09-13 | National Petro Chemicals Corporation | Process for polymerizing olefins in the presence of a titanium-phosphorus-chromium catalyst |
| US4328124A (en) * | 1981-01-26 | 1982-05-04 | National Petro Chemicals Corp. | Olefin polymerization catalyst and process |
| US4496699A (en) * | 1981-03-13 | 1985-01-29 | National Distillers And Chemical Corporation | Process for polymerizing high melt index olefins and polymerization catalysts used therefore |
| US4376191A (en) * | 1981-10-01 | 1983-03-08 | Union Carbide Corporation | Use of dialkylzinc compounds to initiate polymerization of ethylene with chromium oxide catalysts |
| US4430252A (en) | 1982-12-10 | 1984-02-07 | Exxon Research & Engineering Co. | Process for synthesizing a multicomponent acidic catalyst composition by an organic solution method |
| US4444904A (en) * | 1983-05-26 | 1984-04-24 | Exxon Research & Engineering Co. | Process for synthesizing a multicomponent acidic catalyst composition containing zirconium by an organic solution method |
| US4681866A (en) * | 1985-04-01 | 1987-07-21 | Phillips Petroleum Company | Polymerization catalyst, method of making and use therefor |
| US4619980A (en) * | 1985-04-01 | 1986-10-28 | Phillips Petroleum Company | Polymerization catalyst, method of making and use therefor |
| DE3618259A1 (de) * | 1986-05-30 | 1987-12-03 | Basf Ag | Verfahren zum herstellen von homo- sowie copolymerisaten des ethens durch phillips-katalyse |
| DE3635710A1 (de) * | 1986-10-21 | 1988-04-28 | Basf Ag | Verfahren zum herstellen von homo- sowie copolymerisaten des ethens durch phillips-katalyse |
| CA1307619C (en) * | 1987-05-20 | 1992-09-15 | Louis J. Rekers | Chromium catalyst compositions and polymerization utilizing same |
| US5310834A (en) * | 1987-05-20 | 1994-05-10 | Quantum Chemical Corporation | Mixed chromium catalysts and polymerizations utilizing same |
| US5081089A (en) * | 1987-05-20 | 1992-01-14 | National Distillers And Chemical Corporation | Chromium catalyst compositions and polymerization utilizing same |
| US5198400A (en) * | 1987-05-20 | 1993-03-30 | Quantum Chemical Corporation | Mixed chromium catalysts and polymerizations utilizing same |
| FI85498C (fi) * | 1988-11-08 | 1992-04-27 | Neste Oy | Foerfarande foer polymerisering och kopolymerisering av alfa-olefiner och ett i foerfarandet anvaent katalysatorsystem. |
| DE3841436A1 (de) * | 1988-12-09 | 1990-06-13 | Basf Ag | Verfahren zum herstellen von homo- sowie copolymerisaten des ethens durch phillips-katalyse |
| DE4134146A1 (de) * | 1991-10-16 | 1993-04-22 | Basf Ag | Phillips-katalysator und seine verwendung zur herstellung von ethylenhomopolymerisaten und -copolymerisaten |
| GB9210265D0 (en) * | 1992-05-13 | 1992-07-01 | Unilever Plc | Catalysts and catalyst supports |
| CZ288056B6 (cs) * | 1999-04-08 | 2001-04-11 | Polymer Institute Brno, Spol. S R. O. | Způsob přípravy kopolymerů ethylenu vhodných pro výrobu fólií nebo trubek |
| GB0720983D0 (en) * | 2007-10-26 | 2007-12-05 | Ineos Silicas Ltd | Catalyst particles their preparation and use |
| CN102286123A (zh) * | 2010-06-18 | 2011-12-21 | 中国石油化工股份有限公司 | 一种用于乙烯聚合的催化剂组分及其制备方法 |
| CN102432711A (zh) * | 2010-09-29 | 2012-05-02 | 中国石油化工股份有限公司 | 一种用于乙烯聚合的催化剂组分及其制备方法 |
| CN103906771A (zh) | 2011-10-26 | 2014-07-02 | 沙特基础工业公司 | 催化剂前体和用于聚合乙烯的催化剂 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL135065C (enExample) * | 1965-05-14 | |||
| US3704287A (en) * | 1970-09-17 | 1972-11-28 | Union Carbide Corp | High temperature reduced catalyst and process |
| US3676417A (en) * | 1971-02-25 | 1972-07-11 | Phillips Petroleum Co | Polymerization using a supported chromia activated with a tin on gallium compound |
| US3775391A (en) * | 1971-08-04 | 1973-11-27 | Ici Ltd | Vinyl polymerisation |
| US3875132A (en) * | 1971-12-30 | 1975-04-01 | Hercules Inc | Tetraalkylchromium compounds and use as olefin polymerization catalysts |
| US3806500A (en) * | 1972-07-21 | 1974-04-23 | Union Carbide Corp | Polymerization with thermally aged catalyst |
-
1975
- 1975-03-14 US US05/558,504 patent/US3984351A/en not_active Expired - Lifetime
-
1976
- 1976-02-24 ZA ZA761105A patent/ZA761105B/xx unknown
- 1976-02-24 CA CA246,434A patent/CA1080206A/en not_active Expired
- 1976-02-26 GR GR50171A patent/GR59890B/el unknown
- 1976-02-27 SE SE7602824A patent/SE433853B/xx not_active IP Right Cessation
- 1976-03-04 NL NLAANVRAGE7602261,A patent/NL182965C/xx not_active IP Right Cessation
- 1976-03-05 FR FR7606446A patent/FR2303812B1/fr not_active Expired
- 1976-03-05 AT AT163976A patent/AT354078B/de not_active IP Right Cessation
- 1976-03-06 EG EG129/76A patent/EG12801A/xx active
- 1976-03-08 PT PT64876A patent/PT64876B/pt unknown
- 1976-03-09 YU YU00607/76A patent/YU60776A/xx unknown
- 1976-03-09 IL IL49185A patent/IL49185A/xx unknown
- 1976-03-09 CS CS761536A patent/CS195724B2/cs unknown
- 1976-03-11 CH CH305176A patent/CH613462A5/xx not_active IP Right Cessation
- 1976-03-11 NO NO760852A patent/NO152300C/no unknown
- 1976-03-12 BG BG032600A patent/BG28833A3/xx unknown
- 1976-03-12 MX MX000068U patent/MX3191E/es unknown
- 1976-03-12 DK DK109176A patent/DK109176A/da not_active Application Discontinuation
- 1976-03-12 BR BR7601513A patent/BR7601513A/pt unknown
- 1976-03-12 HU HU76PE974A patent/HU180912B/hu unknown
- 1976-03-12 AR AR262542A patent/AR216435A1/es active
- 1976-03-12 GB GB10031/76A patent/GB1537892A/en not_active Expired
- 1976-03-12 SU SU762331205A patent/SU1145915A3/ru active
- 1976-03-12 RO RO7685084A patent/RO69179A/ro unknown
- 1976-03-12 BE BE165122A patent/BE839517A/xx not_active IP Right Cessation
- 1976-03-12 IT IT21191/76A patent/IT1065001B/it active
- 1976-03-12 FI FI760644A patent/FI760644A7/fi not_active Application Discontinuation
- 1976-03-12 DE DE19762610422 patent/DE2610422A1/de active Granted
- 1976-03-13 PL PL1976187914A patent/PL110658B1/pl unknown
- 1976-03-13 ES ES76446042A patent/ES446042A1/es not_active Expired
- 1976-03-15 JP JP51027219A patent/JPS5910363B2/ja not_active Expired
-
1981
- 1981-12-30 MY MY53/81A patent/MY8100053A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1080206A (en) | Olefin polymerization catalyst | |
| CA1168218A (en) | Phosphate supported chromium catalyst | |
| US4444964A (en) | Polymerization process using phosphate supported chromium catalyst | |
| US4504638A (en) | Ethylene polymers made from phosphate supported chromium catalyst | |
| US3985676A (en) | Catalyst composition and method for the preparation thereof | |
| US4049896A (en) | Olefin polymerization catalyst | |
| CA1163617A (en) | Catalyst for polymerization of olefins and polymerization process employing such catalyst | |
| US4150209A (en) | Catalytic materials as for olefin polymerization | |
| US4118340A (en) | Novel polymerization catalyst | |
| US4119773A (en) | Olefin polymerization catalyst | |
| US4192775A (en) | Olefin polymerization catalyst | |
| CA1080207A (en) | Olefin polymerization catalyst | |
| US4540755A (en) | Inclusion of oxygen in the polymerization of olefins | |
| US5104950A (en) | Olefin polymerization | |
| US4496699A (en) | Process for polymerizing high melt index olefins and polymerization catalysts used therefore | |
| US4189402A (en) | Supported catalyst for olefin polymerization | |
| US4536489A (en) | High pore volume, high purity alumina gels containing a chromium catalyst | |
| US4404340A (en) | Process for polymerizing olefins in the presence of a titanium-phosphorus-chromium catalyst | |
| US4297461A (en) | Olefin polymerization catalyst | |
| US4184028A (en) | Olefin Polymerization catalyst | |
| CA1306239C (en) | Ethylene polymerization catalyst | |
| US4328124A (en) | Olefin polymerization catalyst and process | |
| US4650842A (en) | Olefin polymerization process employing catalyst prepared from high pore volume, high purity alumina gel | |
| US4260706A (en) | Olefin polymerization catalyst | |
| US4115318A (en) | Olefin polymerization catalyst |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |