CA1074491A - Branched block copolymers and their manufacture - Google Patents
Branched block copolymers and their manufactureInfo
- Publication number
- CA1074491A CA1074491A CA264,017A CA264017A CA1074491A CA 1074491 A CA1074491 A CA 1074491A CA 264017 A CA264017 A CA 264017A CA 1074491 A CA1074491 A CA 1074491A
- Authority
- CA
- Canada
- Prior art keywords
- monovinyl
- weight
- percent
- block copolymers
- branched block
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001400 block copolymer Polymers 0.000 title claims abstract description 49
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 8
- 229920000642 polymer Polymers 0.000 claims abstract description 50
- 150000001993 dienes Chemical class 0.000 claims abstract description 19
- 239000007822 coupling agent Substances 0.000 claims abstract description 11
- 238000000034 method Methods 0.000 claims description 20
- 238000006243 chemical reaction Methods 0.000 claims description 17
- 238000006116 polymerization reaction Methods 0.000 claims description 15
- 239000000178 monomer Substances 0.000 claims description 14
- 238000005859 coupling reaction Methods 0.000 claims description 12
- 239000003999 initiator Substances 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 10
- 239000004215 Carbon black (E152) Substances 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 230000007704 transition Effects 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 2
- 230000036647 reaction Effects 0.000 claims 1
- 229920001577 copolymer Polymers 0.000 abstract description 10
- 239000005022 packaging material Substances 0.000 abstract 1
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 36
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 16
- 150000001875 compounds Chemical class 0.000 description 12
- 239000000047 product Substances 0.000 description 11
- 230000008878 coupling Effects 0.000 description 9
- 238000010168 coupling process Methods 0.000 description 9
- 150000001491 aromatic compounds Chemical class 0.000 description 8
- 229930195733 hydrocarbon Natural products 0.000 description 8
- 150000002430 hydrocarbons Chemical class 0.000 description 8
- 241000905957 Channa melasoma Species 0.000 description 6
- 239000004793 Polystyrene Substances 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 5
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 5
- 238000005984 hydrogenation reaction Methods 0.000 description 5
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 5
- 229920002223 polystyrene Polymers 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 229910052744 lithium Inorganic materials 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 101100387923 Caenorhabditis elegans dos-1 gene Proteins 0.000 description 3
- 101100087530 Caenorhabditis elegans rom-1 gene Proteins 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 101100305983 Mus musculus Rom1 gene Proteins 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 229920005605 branched copolymer Polymers 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 230000007717 exclusion Effects 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 2
- -1 lsooctane Chemical compound 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 239000010703 silicon Substances 0.000 description 2
- 229920003048 styrene butadiene rubber Polymers 0.000 description 2
- 150000003440 styrenes Chemical class 0.000 description 2
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 1
- XUKUURHRXDUEBC-KAYWLYCHSA-N Atorvastatin Chemical compound C=1C=CC=CC=1C1=C(C=2C=CC(F)=CC=2)N(CC[C@@H](O)C[C@@H](O)CC(O)=O)C(C(C)C)=C1C(=O)NC1=CC=CC=C1 XUKUURHRXDUEBC-KAYWLYCHSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- OPFTUNCRGUEPRZ-QLFBSQMISA-N Cyclohexane Natural products CC(=C)[C@@H]1CC[C@@](C)(C=C)[C@H](C(C)=C)C1 OPFTUNCRGUEPRZ-QLFBSQMISA-N 0.000 description 1
- VIZORQUEIQEFRT-UHFFFAOYSA-N Diethyl adipate Chemical compound CCOC(=O)CCCCC(=O)OCC VIZORQUEIQEFRT-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 235000008247 Echinochloa frumentacea Nutrition 0.000 description 1
- 240000004072 Panicum sumatrense Species 0.000 description 1
- 229920002732 Polyanhydride Polymers 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 239000002174 Styrene-butadiene Substances 0.000 description 1
- GTDPSWPPOUPBNX-UHFFFAOYSA-N ac1mqpva Chemical compound CC12C(=O)OC(=O)C1(C)C1(C)C2(C)C(=O)OC1=O GTDPSWPPOUPBNX-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 125000001145 hydrido group Chemical group *[H] 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000001282 iso-butane Substances 0.000 description 1
- WGOPGODQLGJZGL-UHFFFAOYSA-N lithium;butane Chemical compound [Li+].CC[CH-]C WGOPGODQLGJZGL-UHFFFAOYSA-N 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 101150066242 outO gene Proteins 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical group [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 229920002587 poly(1,3-butadiene) polymer Polymers 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920001228 polyisocyanate Polymers 0.000 description 1
- 239000005056 polyisocyanate Substances 0.000 description 1
- 229920001470 polyketone Polymers 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000005049 silicon tetrachloride Substances 0.000 description 1
- 239000011115 styrene butadiene Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- ZOYFEXPFPVDYIS-UHFFFAOYSA-N trichloro(ethyl)silane Chemical compound CC[Si](Cl)(Cl)Cl ZOYFEXPFPVDYIS-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G81/00—Macromolecular compounds obtained by interreacting polymers in the absence of monomers, e.g. block polymers
- C08G81/02—Macromolecular compounds obtained by interreacting polymers in the absence of monomers, e.g. block polymers at least one of the polymers being obtained by reactions involving only carbon-to-carbon unsaturated bonds
- C08G81/021—Block or graft polymers containing only sequences of polymers of C08C or C08F
- C08G81/022—Block or graft polymers containing only sequences of polymers of C08C or C08F containing sequences of polymers of conjugated dienes and of polymers of alkenyl aromatic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Graft Or Block Polymers (AREA)
- Polymerisation Methods In General (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2550226A DE2550226C2 (de) | 1975-11-08 | 1975-11-08 | Verzweigte Blockcopolymerisate und Verfahren zu ihrer Herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1074491A true CA1074491A (en) | 1980-03-25 |
Family
ID=5961263
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA264,017A Expired CA1074491A (en) | 1975-11-08 | 1976-10-21 | Branched block copolymers and their manufacture |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4086298A (en:Method) |
| JP (1) | JPS6035923B2 (en:Method) |
| BE (1) | BE848106A (en:Method) |
| CA (1) | CA1074491A (en:Method) |
| DE (1) | DE2550226C2 (en:Method) |
| FR (1) | FR2330705A1 (en:Method) |
| GB (1) | GB1556233A (en:Method) |
| IT (1) | IT1071467B (en:Method) |
| NL (1) | NL183519C (en:Method) |
Families Citing this family (68)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4152370A (en) * | 1978-02-09 | 1979-05-01 | Phillips Petroleum Company | Preparation, composition, and use of block polymers |
| US4180530A (en) * | 1979-02-05 | 1979-12-25 | Arco Polymers, Inc. | Clear impact resistant thermoplastic star-block copolymers |
| US4248983A (en) * | 1979-02-05 | 1981-02-03 | Arco Polymers, Inc. | Clear impact resistant thermoplastic star-block copolymers |
| US4248980A (en) * | 1979-04-30 | 1981-02-03 | Arco Polymers, Inc. | Clear impact resistant thermoplastic star-block copolymers |
| US4248982A (en) * | 1979-04-30 | 1981-02-03 | Arco Polymers, Inc. | Clear impact resistant thermoplastic star-block copolymers |
| US4248984A (en) * | 1979-05-11 | 1981-02-03 | Arco Polymers, Inc. | Clear impact resistant thermoplastic star-block copolymers |
| US4221884A (en) * | 1979-05-14 | 1980-09-09 | Arco Polymers, Inc. | Clear impact resistant thermoplastic star-block copolymers |
| US4250270A (en) * | 1979-10-04 | 1981-02-10 | Phillips Petroleum Company | Solution polymerization with molecular sieve purification of recycled solvent |
| DE3032832A1 (de) * | 1980-08-30 | 1982-04-22 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von verzweigten blockcopolymerisaten, verwendung derselben und formteile aus diesen |
| US4390663A (en) * | 1981-02-17 | 1983-06-28 | Atlantic Richfield Company | Semi-continuous process for making star-block copolymers |
| JPS57192447A (en) * | 1981-05-23 | 1982-11-26 | Nippon Steel Chem Co Ltd | Production of pearlescent thermoplastic resin product |
| US4371661A (en) * | 1982-02-17 | 1983-02-01 | Atlantic Richfield Company | Semi-continuous process for making star-block copolymers |
| JPS60179412A (ja) * | 1984-02-24 | 1985-09-13 | Sumitomo Chem Co Ltd | ビニル芳香族化合物―ブタジエンゴム状共重合体を用いたタイヤ |
| US4584346A (en) * | 1984-02-29 | 1986-04-22 | Phillips Petroleum Company | Craze-resistant transparent resinous polymodal block copolymers |
| DE3520103A1 (de) * | 1985-06-05 | 1986-12-11 | Basf Ag, 6700 Ludwigshafen | Verfahren zur behandlung von katalysatoren und/oder rueckstaende von initiatoren enthaltenden polymerisaten oder deren loesungen |
| US4704435A (en) * | 1986-03-24 | 1987-11-03 | Phillips Petroleum Company | Craze-resistant polymodal linear block copolymers with resinous terminal blocks |
| US4704434A (en) * | 1986-03-24 | 1987-11-03 | Phillips Petroleum Company | Craze-resistant polymodal linear block copolymers with terminal tapered blocks |
| LU86698A1 (fr) * | 1986-12-04 | 1988-07-14 | Labofina Sa | Procede pour fabriquer des copolymeres blocs transparents |
| US5079090A (en) * | 1987-10-09 | 1992-01-07 | Minnesota Mining And Manufacturing Company | Adhesive compositions made with condensed phase polymers and sheet materials coated therewith |
| US4857615A (en) * | 1987-10-09 | 1989-08-15 | Minnesota Mining And Manufacturing Company | Method of making condensed phase polymers |
| US4857618A (en) * | 1987-10-09 | 1989-08-15 | Minnesota Mining And Manufacturing Company | Condensed phase polymers |
| US5210143A (en) * | 1987-10-09 | 1993-05-11 | Minnesota Mining And Manufacturing Company | Condensed phase polymers |
| US5115034A (en) * | 1987-10-09 | 1992-05-19 | Minnesota Mining And Manufacturing Company | Condensed phase polymers |
| US4906691A (en) * | 1987-10-09 | 1990-03-06 | Minnesota Mining And Manufacturing Company | Adhesive compositions made with condensed phase polymers and sheet materials coated therewith |
| US4996266A (en) * | 1987-10-09 | 1991-02-26 | Minnesota Mining And Manufacturing Company | Method of making condensed phase polymers |
| DE68909999T2 (de) * | 1988-05-02 | 1994-04-14 | Sumitomo Chemical Co | Modifizierte Kautschuk-Dienpolymere. |
| DE3816294A1 (de) * | 1988-05-13 | 1989-11-23 | Basf Ag | Transparente, thermoplastische formmasse, verfahren zu ihrer herstellung und ihre verwendung |
| IT1227901B (it) * | 1988-12-23 | 1991-05-14 | Enichem Elastomers | Composizioni polimeriche e loro metodo di preparazione |
| US5284915A (en) * | 1988-12-23 | 1994-02-08 | Enichem Elastomeri S.P.A. | Styrene-isoprene block copolymers |
| DE3904111A1 (de) * | 1989-02-11 | 1990-08-16 | Battelle Institut E V | Verfahren und vorrichtung zur umweltfreundlichen massenentsaeuerung von buechern und anderen papiererzeugnissen |
| US5399626A (en) * | 1991-04-29 | 1995-03-21 | Shell Oil Company | Viscous conjugated diene block copolymers |
| US5229464A (en) * | 1991-04-29 | 1993-07-20 | Shell Oil Company | Epoxidized viscous conjugated diene block copolymers |
| US5256736A (en) * | 1991-05-08 | 1993-10-26 | Phillips Petroleum Company | Tapered block copolymers of conjugated dienes and monovinylarenes |
| US5487951A (en) * | 1991-07-08 | 1996-01-30 | Minnesota Mining And Manufacturing Company | Magnetic recording medium with a binder resin of a starblock copolymer having at least six arms |
| US5296547A (en) * | 1993-01-28 | 1994-03-22 | Minnesota Mining And Manufacturing Company | Block copolymer having mixed molecular weight endblocks |
| BE1006727A3 (fr) * | 1993-02-15 | 1994-11-29 | Fina Research | Procede de preparation de copolymeres sequences. |
| US5536772A (en) * | 1993-06-18 | 1996-07-16 | Shell Oil Company | Radiation cured conjugated diene block copolymer compositions |
| USH1517H (en) * | 1993-07-12 | 1996-02-06 | Shell Oil Company | Radiation curable printing ink composition |
| US5360875A (en) * | 1993-09-10 | 1994-11-01 | Shell Oil Company | Method for producing coupled asymmetric polymers |
| US5369175A (en) * | 1993-11-09 | 1994-11-29 | Shell Oil Company | Method for preparing asymmetric radial copolymers having four first arms and two second arms |
| USH1464H (en) * | 1993-11-09 | 1995-07-04 | Shell Oil Company | Method for preparing asymmetric radial copolymers having two first arms and two second arms |
| DE4420769A1 (de) * | 1994-06-15 | 1995-12-21 | Basf Ag | Mit alpha-Tocopherol stabilisierte Styrol/Butadien-Blockcopolymere |
| DE4420952A1 (de) * | 1994-06-17 | 1995-12-21 | Basf Ag | Thermoplastisches Elastomer |
| US6162874A (en) | 1994-11-07 | 2000-12-19 | Bridgestone/Firestone, Inc. | Block copolymers interpolymerized with in situ polystyrene and process for preparation thereof |
| US5550196A (en) * | 1994-11-09 | 1996-08-27 | Shell Oil Company | Low viscosity adhesive compositions containing asymmetric radial polymers |
| DE19615533A1 (de) | 1996-04-19 | 1997-10-23 | Basf Ag | Thermoplastische Formmasse |
| US6630531B1 (en) | 2000-02-02 | 2003-10-07 | 3M Innovative Properties Company | Adhesive for bonding to low surface energy surfaces |
| US20030211308A1 (en) * | 2001-02-02 | 2003-11-13 | Khandpur Ashish K | Adhesive for bonding to low surface energy surfaces |
| DE602004021570D1 (de) * | 2003-03-19 | 2009-07-30 | Denki Kagaku Kogyo Kk | Sternförmig verzweigtes blockcopolymer enthaltende blockcopolymermischung |
| PL1625178T3 (pl) | 2003-05-14 | 2007-11-30 | Trimurti Holding Corp | Kompozycja kopolimeru blokowego i wytwarzane z niej przezroczyste wyroby elastomerowe |
| US7351767B2 (en) * | 2004-02-20 | 2008-04-01 | Chevron Phillips Chemical Company, Lp | Composition for monovinylrenic-based shrink label films |
| US7737216B2 (en) * | 2006-01-26 | 2010-06-15 | Chevron Phillips Chemical Company Lp | Monovinylarene conjugated diene block copolymer compositions for shrinkable films |
| US8415429B2 (en) * | 2006-12-11 | 2013-04-09 | Chervron Phillips Chemical Company LP | Styrene butadiene block copolymers for film applications |
| KR101934127B1 (ko) * | 2010-10-27 | 2018-12-31 | 이네오스 스티롤루션 유럽 게엠베하 | 적어도 2개의 상이한 별 아암을 갖는 별형 분자 구조를 갖는 엘라스토머 블록 공중합체 |
| US8835560B2 (en) | 2010-10-27 | 2014-09-16 | Styrolution GmbH | Elastomeric block copolymers having star-shaped molecular architecture, where the star-shaped molecular architecture has at least two different arms in the star |
| EP2681258B1 (de) * | 2011-03-02 | 2015-05-13 | Basf Se | Verwendung von vinylaromat-dien-copolymeren in lactam-zusammensetzungen |
| US9540475B2 (en) | 2015-03-12 | 2017-01-10 | Chevron Phillips Chemical Company Lp | Styrene-butadiene block copolymers for tubing applications |
| US9441090B1 (en) | 2015-03-12 | 2016-09-13 | Chevron Phillips Chemical Company Lp | Methods for controlling hardness of styrene-butadiene block copolymers |
| US9598524B1 (en) | 2015-09-18 | 2017-03-21 | Chevron Phillips Chemical Company Lp | Styrene-butadiene block copolymers with a terminal butadiene block for tubing applications |
| US9738781B2 (en) | 2015-09-03 | 2017-08-22 | Ineos Styrolution Group Gmbh | Blends of styrene-butadiene block copolymer with styrenic thermoplastic elastomers for tubing applications |
| PL3408325T3 (pl) | 2016-01-26 | 2023-07-24 | Dynasol Elastómeros, S.A.De C.V. | Elastomery termoplastyczne o przeciwnym gradiencie |
| US10023676B2 (en) | 2016-02-24 | 2018-07-17 | Ineos Styrolution Group Gmbh | Styrene-butadiene block copolymers with an internal butadiene block for tubing applications |
| US9828455B2 (en) | 2016-02-24 | 2017-11-28 | Ineos Styrolution Group Gmbh | Styrene-butadiene block copolymers with an internal butadiene block for tubing applications |
| WO2018001943A1 (en) | 2016-06-29 | 2018-01-04 | Ineos Styrolution Group Gmbh | Polymer composition comprising at least one vinyl aromatic diene block copolymer and specific amounts of oil |
| US12460082B2 (en) | 2017-01-26 | 2025-11-04 | Dynasol Elastómeros, S.A. De C.V. | Counter tapered thermoplastic elastomers |
| CN117801292A (zh) * | 2022-09-26 | 2024-04-02 | 中国石油天然气集团有限公司 | 多元共聚物及其制备方法和应用、卤化支化丁基橡胶及其制备方法和应用 |
| CN117487102B (zh) * | 2023-12-29 | 2024-03-19 | 新疆独山子石油化工有限公司 | 一种sbs改性剂及其制备方法和应用 |
| WO2025176772A1 (en) | 2024-02-22 | 2025-08-28 | Ineos Styrolution Group Gmbh | Recovery of metal compounds from polymers obtained by anionic polymerization |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3281383A (en) * | 1962-08-09 | 1966-10-25 | Phillips Petroleum Co | Branched polymers prepared from monolithium-terminated polymers and compounds having at least three reactive sites |
| NL133447C (en:Method) * | 1966-11-07 | |||
| US3778490A (en) * | 1969-04-23 | 1973-12-11 | Phillips Petroleum Co | Polar compound adjuvants for improved block polymers prepared with primary hydrocarbyllithium initiators |
| US3639521A (en) * | 1969-04-23 | 1972-02-01 | Phillips Petroleum Co | Polar compound adjuvants for improved block polymers prepared with primary hydrocarbyllithium initiators |
| BE756177A (fr) * | 1969-09-17 | 1971-03-15 | Shell Int Research | Procede de preparation de copolymeres a blocs hydrogenes |
| US3639517A (en) * | 1969-09-22 | 1972-02-01 | Phillips Petroleum Co | Resinous branched block copolymers |
| US3947536A (en) * | 1971-10-04 | 1976-03-30 | Denki Kagaku Kogyo K.K. | Process for preparing a film of a tapered copolymer of styrene-butadiene or mixtures thereof |
| US3985830B1 (en) * | 1974-07-15 | 1998-03-03 | Univ Akron | Star polymers and process for the preparation thereof |
| GB1527226A (en) * | 1974-12-06 | 1978-10-04 | Shell Int Research | Preparation of a non-linear elastomeric copolymer |
-
1975
- 1975-11-08 DE DE2550226A patent/DE2550226C2/de not_active Expired
-
1976
- 1976-10-15 IT IT28404/76A patent/IT1071467B/it active
- 1976-10-15 US US05/732,890 patent/US4086298A/en not_active Expired - Lifetime
- 1976-10-21 CA CA264,017A patent/CA1074491A/en not_active Expired
- 1976-11-04 FR FR7633301A patent/FR2330705A1/fr active Granted
- 1976-11-05 NL NLAANVRAGE7612329,A patent/NL183519C/xx not_active IP Right Cessation
- 1976-11-05 GB GB46134/76A patent/GB1556233A/en not_active Expired
- 1976-11-08 BE BE172165A patent/BE848106A/xx not_active IP Right Cessation
- 1976-11-08 JP JP51133310A patent/JPS6035923B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL183519C (nl) | 1988-11-16 |
| GB1556233A (en) | 1979-11-21 |
| NL183519B (nl) | 1988-06-16 |
| BE848106A (fr) | 1977-05-09 |
| FR2330705B1 (en:Method) | 1980-08-29 |
| US4086298A (en) | 1978-04-25 |
| JPS5259698A (en) | 1977-05-17 |
| IT1071467B (it) | 1985-04-10 |
| NL7612329A (nl) | 1977-05-10 |
| DE2550226A1 (de) | 1977-05-18 |
| DE2550226C2 (de) | 1984-12-13 |
| JPS6035923B2 (ja) | 1985-08-17 |
| FR2330705A1 (fr) | 1977-06-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1074491A (en) | Branched block copolymers and their manufacture | |
| US4167545A (en) | Branched block copolymers and their manufacture | |
| US4039633A (en) | Coupling of alkali metal-terminated polymers | |
| CA1050691A (en) | Thermoplastic black polymers | |
| US4108945A (en) | Star polymers and process for the preparation thereof | |
| CA1335614C (en) | Method for preparing asymmetric radial copolymers | |
| EP0255001A2 (en) | Bimodal star-block copolymers showing excellent optical properties and resilience, and process for their manufacture | |
| US4088813A (en) | Promoters in the polymerization of monovinyl-aromatic compounds with primary lithium initiators | |
| CA1087339A (en) | Branched block copolymers of a monovinyl-aromatic compound and a conjugated diene | |
| US4405754A (en) | Haze-free, clear, impact-resistant resinous polymers | |
| KR100626442B1 (ko) | 커플링된 스티렌 블록 공중합체 및 이의 제조방법 | |
| US5276095A (en) | Star block copolymers of vinyl aromatic hydrocarbons and polydimethylsiloxane and method of synthesis | |
| CA1283995C (en) | Anionic polymerization process | |
| US5281666A (en) | Process for making block copolymers of vinyl aromatic hydrocarbons and/or conjugated dienes and polydimethylsiloxane | |
| JPH01141906A (ja) | 分枝共重合体及びその製造方法 | |
| US4105714A (en) | Coupling of alkali metal-terminated polymers | |
| EP0653452A1 (en) | Method for preparing asymmetric radial copolymers | |
| US3801554A (en) | Lithium alkenoxides as modifiers in organolithium initiated polymerization | |
| US3872068A (en) | Process for preparing block copolymer resin | |
| US4539136A (en) | Process for the preparation of branched polymers | |
| EP0002012A1 (en) | Coupled hydrocarbon polymers and process for their preparation | |
| EP1082354A1 (en) | Process for making anionic polymeric di- and polyfunctional polymers using protected functional initiators | |
| US4163765A (en) | Polymeric compositions | |
| JPH06298881A (ja) | ブロツクコポリマー類の製造方法 | |
| US4049753A (en) | Coupling of alkali metal-terminated polymers |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |