CA1073402A - Electrolytic manufacture of chlorates using a plurality of electrolytic cells - Google Patents
Electrolytic manufacture of chlorates using a plurality of electrolytic cellsInfo
- Publication number
- CA1073402A CA1073402A CA211,588A CA211588A CA1073402A CA 1073402 A CA1073402 A CA 1073402A CA 211588 A CA211588 A CA 211588A CA 1073402 A CA1073402 A CA 1073402A
- Authority
- CA
- Canada
- Prior art keywords
- chlorate
- cell
- chloride
- chlorine
- anode
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical class [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 title claims abstract description 153
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 21
- 239000012528 membrane Substances 0.000 claims abstract description 76
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 62
- 239000000460 chlorine Substances 0.000 claims abstract description 62
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 62
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims abstract description 39
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims abstract description 36
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 claims abstract description 36
- 239000003518 caustics Substances 0.000 claims abstract description 29
- 229920001577 copolymer Polymers 0.000 claims abstract description 24
- 239000011780 sodium chloride Substances 0.000 claims abstract description 18
- 229920001155 polypropylene Polymers 0.000 claims abstract description 17
- RRZIJNVZMJUGTK-UHFFFAOYSA-N 1,1,2-trifluoro-2-(1,2,2-trifluoroethenoxy)ethene Chemical class FC(F)=C(F)OC(F)=C(F)F RRZIJNVZMJUGTK-UHFFFAOYSA-N 0.000 claims abstract description 11
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 claims abstract description 10
- 229930195733 hydrocarbon Natural products 0.000 claims abstract description 10
- 150000002430 hydrocarbons Chemical class 0.000 claims abstract description 10
- 239000004215 Carbon black (E152) Substances 0.000 claims abstract description 9
- 238000000034 method Methods 0.000 claims description 44
- 239000000243 solution Substances 0.000 claims description 28
- -1 polytetrafluoroethylene Polymers 0.000 claims description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 18
- 239000000463 material Substances 0.000 claims description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 229910000510 noble metal Inorganic materials 0.000 claims description 11
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 claims description 10
- 239000003792 electrolyte Substances 0.000 claims description 9
- 229910000831 Steel Inorganic materials 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 8
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 8
- 239000010959 steel Substances 0.000 claims description 8
- 239000010936 titanium Substances 0.000 claims description 8
- 229910052719 titanium Inorganic materials 0.000 claims description 8
- 239000004743 Polypropylene Substances 0.000 claims description 7
- 239000004744 fabric Substances 0.000 claims description 7
- 239000007864 aqueous solution Substances 0.000 claims description 6
- 238000005868 electrolysis reaction Methods 0.000 claims description 6
- 150000004706 metal oxides Chemical class 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 239000012452 mother liquor Substances 0.000 claims description 5
- 229920001343 polytetrafluoroethylene Polymers 0.000 claims description 5
- 239000004810 polytetrafluoroethylene Substances 0.000 claims description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 239000010425 asbestos Substances 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 229910002804 graphite Inorganic materials 0.000 claims description 4
- 239000010439 graphite Substances 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 229910052697 platinum Inorganic materials 0.000 claims description 4
- 229910052895 riebeckite Inorganic materials 0.000 claims description 4
- 229910052715 tantalum Inorganic materials 0.000 claims description 4
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 4
- 229910052741 iridium Inorganic materials 0.000 claims description 3
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052758 niobium Inorganic materials 0.000 claims description 3
- 239000010955 niobium Substances 0.000 claims description 3
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 3
- 229910001925 ruthenium oxide Inorganic materials 0.000 claims description 3
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 claims description 3
- 229910045601 alloy Inorganic materials 0.000 claims description 2
- 239000000956 alloy Substances 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 229910044991 metal oxide Inorganic materials 0.000 claims description 2
- 238000004064 recycling Methods 0.000 claims description 2
- 229910052703 rhodium Inorganic materials 0.000 claims description 2
- 239000010948 rhodium Substances 0.000 claims description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 2
- 229910052707 ruthenium Inorganic materials 0.000 claims description 2
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 abstract description 24
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 abstract description 5
- 238000000926 separation method Methods 0.000 abstract 1
- 210000004027 cell Anatomy 0.000 description 87
- 230000008569 process Effects 0.000 description 29
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000004812 Fluorinated ethylene propylene Substances 0.000 description 9
- 229920009441 perflouroethylene propylene Polymers 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 8
- 229920000642 polymer Polymers 0.000 description 8
- 235000011121 sodium hydroxide Nutrition 0.000 description 7
- 238000011282 treatment Methods 0.000 description 7
- 229940083608 sodium hydroxide Drugs 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 230000006835 compression Effects 0.000 description 3
- 238000007906 compression Methods 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 239000005033 polyvinylidene chloride Substances 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 230000003134 recirculating effect Effects 0.000 description 3
- 230000001105 regulatory effect Effects 0.000 description 3
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- 229910001209 Low-carbon steel Inorganic materials 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000004809 Teflon Substances 0.000 description 2
- 229920006362 Teflon® Polymers 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000007844 bleaching agent Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 238000010924 continuous production Methods 0.000 description 2
- 230000001276 controlling effect Effects 0.000 description 2
- OSVXSBDYLRYLIG-UHFFFAOYSA-N dioxidochlorine(.) Chemical compound O=Cl=O OSVXSBDYLRYLIG-UHFFFAOYSA-N 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 230000005012 migration Effects 0.000 description 2
- 238000013508 migration Methods 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- HWLDNSXPUQTBOD-UHFFFAOYSA-N platinum-iridium alloy Chemical group [Ir].[Pt] HWLDNSXPUQTBOD-UHFFFAOYSA-N 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229940058401 polytetrafluoroethylene Drugs 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 238000004537 pulping Methods 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- DJKGDNKYTKCJKD-BPOCMEKLSA-N (1s,4r,5s,6r)-1,2,3,4,7,7-hexachlorobicyclo[2.2.1]hept-2-ene-5,6-dicarboxylic acid Chemical compound ClC1=C(Cl)[C@]2(Cl)[C@H](C(=O)O)[C@H](C(O)=O)[C@@]1(Cl)C2(Cl)Cl DJKGDNKYTKCJKD-BPOCMEKLSA-N 0.000 description 1
- 239000004801 Chlorinated PVC Substances 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 239000004155 Chlorine dioxide Substances 0.000 description 1
- GUTLYIVDDKVIGB-OUBTZVSYSA-N Cobalt-60 Chemical compound [60Co] GUTLYIVDDKVIGB-OUBTZVSYSA-N 0.000 description 1
- 241001397173 Kali <angiosperm> Species 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 229920001774 Perfluoroether Polymers 0.000 description 1
- 240000005428 Pistacia lentiscus Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- LVPZCFZGMKGEKV-UHFFFAOYSA-N [Ru]=O.[Pt] Chemical compound [Ru]=O.[Pt] LVPZCFZGMKGEKV-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000010953 base metal Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 210000005056 cell body Anatomy 0.000 description 1
- 210000002421 cell wall Anatomy 0.000 description 1
- 229920000457 chlorinated polyvinyl chloride Polymers 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 235000019398 chlorine dioxide Nutrition 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 230000003467 diminishing effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000003487 electrochemical reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 238000007499 fusion processing Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- HCDGVLDPFQMKDK-UHFFFAOYSA-N hexafluoropropylene Chemical group FC(F)=C(F)C(F)(F)F HCDGVLDPFQMKDK-UHFFFAOYSA-N 0.000 description 1
- ATADHKWKHYVBTJ-UHFFFAOYSA-N hydron;4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;chloride Chemical compound Cl.CNCC(O)C1=CC=C(O)C(O)=C1 ATADHKWKHYVBTJ-UHFFFAOYSA-N 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- UJMWVICAENGCRF-UHFFFAOYSA-N oxygen difluoride Chemical compound FOF UJMWVICAENGCRF-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 239000011087 paperboard Substances 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- UUWCBFKLGFQDME-UHFFFAOYSA-N platinum titanium Chemical compound [Ti].[Pt] UUWCBFKLGFQDME-UHFFFAOYSA-N 0.000 description 1
- 230000010287 polarization Effects 0.000 description 1
- 229920001084 poly(chloroprene) Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000004076 pulp bleaching Methods 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000005057 refrigeration Methods 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 150000003388 sodium compounds Chemical class 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 1
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 1
- 238000004381 surface treatment Methods 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/34—Simultaneous production of alkali metal hydroxides and chlorine, oxyacids or salts of chlorine, e.g. by chlor-alkali electrolysis
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
- Manufacture Of Macromolecular Shaped Articles (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US411622A US3897320A (en) | 1973-11-01 | 1973-11-01 | Electrolytic manufacture of chlorates, using a plurality of electrolytic cells |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1073402A true CA1073402A (en) | 1980-03-11 |
Family
ID=23629673
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA211,588A Expired CA1073402A (en) | 1973-11-01 | 1974-10-17 | Electrolytic manufacture of chlorates using a plurality of electrolytic cells |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3897320A (show.php) |
| JP (1) | JPS5321400B2 (show.php) |
| BR (1) | BR7409140D0 (show.php) |
| CA (1) | CA1073402A (show.php) |
| DE (1) | DE2451845C3 (show.php) |
| FI (1) | FI59816C (show.php) |
| FR (1) | FR2249973B1 (show.php) |
| GB (1) | GB1482937A (show.php) |
| IT (1) | IT1025404B (show.php) |
| NL (1) | NL7414202A (show.php) |
| NO (1) | NO743913L (show.php) |
| SE (1) | SE7413729L (show.php) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR205953A1 (es) * | 1975-01-22 | 1976-06-15 | Diamond Shamrock Corp | Produccion de carbonatos de metales a calinos en una celula de membrana |
| JPS5227098A (en) * | 1975-08-27 | 1977-03-01 | Osaka Soda Co Ltd | Method of simultaneous process of chlorine dioxide,chlorine gas,and ca ustic alkali. |
| JPS5230295A (en) * | 1975-09-02 | 1977-03-07 | Osaka Soda Co Ltd | Electrolytic production of alkali chlorate, caustic alkali, chlorine a nd hydrogen |
| JPS5819750B2 (ja) * | 1975-11-25 | 1983-04-19 | 株式会社トクヤマ | 電解方法 |
| US4062743A (en) * | 1975-12-22 | 1977-12-13 | Ahn Byung K | Electrolytic process for potassium hydroxide |
| US4115218A (en) * | 1976-10-22 | 1978-09-19 | Basf Wyandotte Corporation | Method of electrolyzing brine |
| US4159929A (en) * | 1978-05-17 | 1979-07-03 | Hooker Chemicals & Plastics Corp. | Chemical and electro-chemical process for production of alkali metal chlorates |
| IT1113412B (it) * | 1979-02-15 | 1986-01-20 | Oronzio De Nora Impianti | Procedimento eletttrolitico ed apparecchiatura per la preparazione di ipoalogenito di metallo alcalino |
| JPS56108887A (en) * | 1980-01-30 | 1981-08-28 | Asahi Chem Ind Co Ltd | Electrolyzing method for common salt by simultaneous use of cation exchange membrane and diaphragm |
| FI71354C (fi) * | 1980-03-03 | 1986-12-19 | Asahi Chemical Ind | Foerfarande foer framstaellning av natriumklorat |
| FR2655061B1 (fr) * | 1989-11-29 | 1993-12-10 | Atochem | Fabrication de chlorate ou de perchlorate de metal alcalin. |
| SE9100365L (sv) * | 1991-02-05 | 1992-08-06 | Eka Nobel Ab | Foerfarande foer elektrolytisk framstaellning av alkalimetallklorat och hjaelpkemikalier |
| SE512388C2 (sv) * | 1993-04-26 | 2000-03-13 | Eka Chemicals Ab | Förfarande för framställning av alkalimetallklorat genom elektrolys |
| US8216443B2 (en) * | 2002-07-05 | 2012-07-10 | Akzo Nobel N.V. | Process for producing alkali metal chlorate |
| EP1802536B1 (en) * | 2004-09-20 | 2010-01-06 | Corsa Beheer B.V. | Combination and method for the preparation of a drink |
| DE102005038970A1 (de) * | 2005-05-11 | 2006-11-16 | Over-Eloxal Gmbh | Vorrichtung zum Behandeln eines Metalls in einem Elektrolytbad und Verfahren zum Verringern einer Aerosolabgabe |
| US8025786B2 (en) * | 2006-02-10 | 2011-09-27 | Tennant Company | Method of generating sparged, electrochemically activated liquid |
| US8007654B2 (en) * | 2006-02-10 | 2011-08-30 | Tennant Company | Electrochemically activated anolyte and catholyte liquid |
| US8025787B2 (en) | 2006-02-10 | 2011-09-27 | Tennant Company | Method and apparatus for generating, applying and neutralizing an electrochemically activated liquid |
| US8156608B2 (en) * | 2006-02-10 | 2012-04-17 | Tennant Company | Cleaning apparatus having a functional generator for producing electrochemically activated cleaning liquid |
| US8012340B2 (en) * | 2006-02-10 | 2011-09-06 | Tennant Company | Method for generating electrochemically activated cleaning liquid |
| US7891046B2 (en) * | 2006-02-10 | 2011-02-22 | Tennant Company | Apparatus for generating sparged, electrochemically activated liquid |
| US8046867B2 (en) | 2006-02-10 | 2011-11-01 | Tennant Company | Mobile surface cleaner having a sparging device |
| US8016996B2 (en) * | 2006-02-10 | 2011-09-13 | Tennant Company | Method of producing a sparged cleaning liquid onboard a mobile surface cleaner |
| US20080308427A1 (en) * | 2007-06-18 | 2008-12-18 | Tennant Company | System and process for producing alcohol |
| US8337690B2 (en) * | 2007-10-04 | 2012-12-25 | Tennant Company | Method and apparatus for neutralizing electrochemically activated liquids |
| WO2009149327A2 (en) * | 2008-06-05 | 2009-12-10 | Global Opportunities Investment Group, Llc | Fuel combustion method and system |
| EP2291246A2 (en) * | 2008-06-10 | 2011-03-09 | Tennant Company | Steam cleaner using electrolyzed liquid and method therefor |
| US20090311137A1 (en) * | 2008-06-11 | 2009-12-17 | Tennant Company | Atomizer using electrolyzed liquid and method therefor |
| EP2321228A1 (en) * | 2008-06-19 | 2011-05-18 | Tennant Company | Tubular electrolysis cell comprising concentric electrodes and corresponding method |
| WO2009155545A2 (en) * | 2008-06-19 | 2009-12-23 | Tennant Company | Hand-held spray bottle electrolysis cell and dc-dc converter |
| US20100089419A1 (en) * | 2008-09-02 | 2010-04-15 | Tennant Company | Electrochemically-activated liquid for cosmetic removal |
| EP2376127A1 (en) * | 2008-12-17 | 2011-10-19 | Tennant Company | Method and apparatus for applying electrical charge through a liquid having enhanced suspension properties |
| WO2011026075A1 (en) * | 2009-08-31 | 2011-03-03 | Tennant Company | Electrochemically-activated liquids containing fragrant compounds |
| US20110219555A1 (en) * | 2010-03-10 | 2011-09-15 | Tennant Company | Cleaning head and mobile floor cleaner |
| US9546427B2 (en) * | 2011-06-10 | 2017-01-17 | Michael Lumetta | System and method for generating a chlorine-containing compound |
| WO2016090259A1 (en) | 2014-12-05 | 2016-06-09 | Westlake Vinyl Corporation | System and method for purifying depleted brine |
| CN105821436B (zh) * | 2016-05-09 | 2018-07-24 | 复旦大学 | 一种基于三电极体系的双电解槽两步法氯碱电解方法及装置 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US665426A (en) * | 1895-09-09 | 1901-01-08 | Nat Electrolytic Company | Art of obtaining chlorates by electrolysis. |
| BE466741A (fr) * | 1946-01-31 | Solvay | Procédé et dispositif pour la fabrication de chlorites alcalins. | |
| NL122179C (show.php) * | 1959-02-06 | 1966-12-15 | ||
| US3438879A (en) * | 1967-07-31 | 1969-04-15 | Hooker Chemical Corp | Protection of permselective diaphragm during electrolysis |
| US3535215A (en) * | 1967-12-04 | 1970-10-20 | Hooker Chemical Corp | Method for operating electrolytic cells |
| US3654121A (en) * | 1968-12-23 | 1972-04-04 | Engelhard Min & Chem | Electrolytic anode |
| US3784399A (en) * | 1971-09-08 | 1974-01-08 | Du Pont | Films of fluorinated polymer containing sulfonyl groups with one surface in the sulfonamide or sulfonamide salt form and a process for preparing such |
-
1973
- 1973-11-01 US US411622A patent/US3897320A/en not_active Expired - Lifetime
-
1974
- 1974-10-17 CA CA211,588A patent/CA1073402A/en not_active Expired
- 1974-10-30 NO NO743913A patent/NO743913L/no unknown
- 1974-10-30 FR FR7436302A patent/FR2249973B1/fr not_active Expired
- 1974-10-30 NL NL7414202A patent/NL7414202A/xx unknown
- 1974-10-30 JP JP12607674A patent/JPS5321400B2/ja not_active Expired
- 1974-10-31 FI FI3194/74A patent/FI59816C/fi active
- 1974-10-31 GB GB47168/74A patent/GB1482937A/en not_active Expired
- 1974-10-31 DE DE2451845A patent/DE2451845C3/de not_active Expired
- 1974-10-31 BR BR9140/74A patent/BR7409140D0/pt unknown
- 1974-10-31 SE SE7413729A patent/SE7413729L/xx unknown
- 1974-10-31 IT IT29064/74A patent/IT1025404B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| DE2451845B2 (de) | 1978-08-31 |
| NO743913L (show.php) | 1975-05-26 |
| JPS5089300A (show.php) | 1975-07-17 |
| NL7414202A (nl) | 1975-05-06 |
| IT1025404B (it) | 1978-08-10 |
| DE2451845C3 (de) | 1979-04-26 |
| SE7413729L (show.php) | 1975-05-02 |
| FR2249973B1 (show.php) | 1978-12-22 |
| FI59816C (fi) | 1983-05-30 |
| US3897320A (en) | 1975-07-29 |
| BR7409140D0 (pt) | 1975-08-26 |
| JPS5321400B2 (show.php) | 1978-07-03 |
| FR2249973A1 (show.php) | 1975-05-30 |
| FI319474A7 (show.php) | 1975-05-02 |
| DE2451845A1 (de) | 1975-05-07 |
| GB1482937A (en) | 1977-08-17 |
| FI59816B (fi) | 1981-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1073402A (en) | Electrolytic manufacture of chlorates using a plurality of electrolytic cells | |
| CA1056768A (en) | Coating metal anodes to decrease consumption rates | |
| US3899403A (en) | Electrolytic method of making concentrated hydroxide solutions by sequential use of 3-compartment and 2-compartment electrolytic cells having separating compartment walls of particular cation-active permselective membranes | |
| CA1073401A (en) | Electrolytic production of chlorine dioxide, chlorine, alkali metal hydroxide and hydrogen | |
| CA1043736A (en) | Electrolytic process for manufacturing chlorine dioxide, hydrogen peroxide, chlorine, alkali metal hydroxide and hydrogen | |
| US4272338A (en) | Process for the treatment of anolyte brine | |
| US4062753A (en) | Electrolysis method and apparatus | |
| US4124477A (en) | Electrolytic cell utilizing pretreated semi-permeable membranes | |
| US5064514A (en) | Apparatus for the production of chloric acid | |
| US3878072A (en) | Electrolytic method for the manufacture of chlorates | |
| CA1068640A (en) | Electrolytic production of hydrogen peroxide and alkali metal hydroxide | |
| US4053376A (en) | Electrolytic production of hydrogen iodide | |
| US3904495A (en) | Electrolytic-electrodialytic and chemical manufacture of chlorine dioxide, chlorine and chloride-free alkali metal hydroxide | |
| US3954579A (en) | Electrolytic method for the simultaneous manufacture of concentrated and dilute aqueous hydroxide solutions | |
| US3925174A (en) | Electrolytic method for the manufacture of hypochlorites | |
| US3920551A (en) | Electrolytic method for the manufacture of dithionites | |
| JPH0573834B2 (show.php) | ||
| US3905879A (en) | Electrolytic manufacture of dithionites | |
| US4062743A (en) | Electrolytic process for potassium hydroxide | |
| US4147600A (en) | Electrolytic method of producing concentrated hydroxide solutions | |
| US4242184A (en) | Membrane cell chlor-alkali process having improved overall efficiency | |
| US4061550A (en) | Process for electrolysis | |
| US4285795A (en) | Electrolysis apparatus | |
| CA1145708A (en) | Electrolytic cells | |
| US4147601A (en) | Electrolytic production of hydrobromic acid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |