CA1073402A - Electrolytic manufacture of chlorates using a plurality of electrolytic cells - Google Patents
Electrolytic manufacture of chlorates using a plurality of electrolytic cellsInfo
- Publication number
- CA1073402A CA1073402A CA211,588A CA211588A CA1073402A CA 1073402 A CA1073402 A CA 1073402A CA 211588 A CA211588 A CA 211588A CA 1073402 A CA1073402 A CA 1073402A
- Authority
- CA
- Canada
- Prior art keywords
- chlorate
- cell
- chloride
- chlorine
- anode
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical class [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 title claims abstract description 153
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 21
- 239000012528 membrane Substances 0.000 claims abstract description 76
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 62
- 239000000460 chlorine Substances 0.000 claims abstract description 62
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 62
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims abstract description 39
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims abstract description 36
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 claims abstract description 36
- 239000003518 caustics Substances 0.000 claims abstract description 29
- 229920001577 copolymer Polymers 0.000 claims abstract description 24
- 239000011780 sodium chloride Substances 0.000 claims abstract description 18
- 229920001155 polypropylene Polymers 0.000 claims abstract description 17
- RRZIJNVZMJUGTK-UHFFFAOYSA-N 1,1,2-trifluoro-2-(1,2,2-trifluoroethenoxy)ethene Chemical class FC(F)=C(F)OC(F)=C(F)F RRZIJNVZMJUGTK-UHFFFAOYSA-N 0.000 claims abstract description 11
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 claims abstract description 10
- 229930195733 hydrocarbon Natural products 0.000 claims abstract description 10
- 150000002430 hydrocarbons Chemical class 0.000 claims abstract description 10
- 239000004215 Carbon black (E152) Substances 0.000 claims abstract description 9
- 238000000034 method Methods 0.000 claims description 44
- 239000000243 solution Substances 0.000 claims description 28
- -1 polytetrafluoroethylene Polymers 0.000 claims description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 18
- 239000000463 material Substances 0.000 claims description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 229910000510 noble metal Inorganic materials 0.000 claims description 11
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 claims description 10
- 239000003792 electrolyte Substances 0.000 claims description 9
- 229910000831 Steel Inorganic materials 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 8
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 8
- 239000010959 steel Substances 0.000 claims description 8
- 239000010936 titanium Substances 0.000 claims description 8
- 229910052719 titanium Inorganic materials 0.000 claims description 8
- 239000004743 Polypropylene Substances 0.000 claims description 7
- 239000004744 fabric Substances 0.000 claims description 7
- 239000007864 aqueous solution Substances 0.000 claims description 6
- 238000005868 electrolysis reaction Methods 0.000 claims description 6
- 150000004706 metal oxides Chemical class 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 239000012452 mother liquor Substances 0.000 claims description 5
- 229920001343 polytetrafluoroethylene Polymers 0.000 claims description 5
- 239000004810 polytetrafluoroethylene Substances 0.000 claims description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 239000010425 asbestos Substances 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 229910002804 graphite Inorganic materials 0.000 claims description 4
- 239000010439 graphite Substances 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 229910052697 platinum Inorganic materials 0.000 claims description 4
- 229910052895 riebeckite Inorganic materials 0.000 claims description 4
- 229910052715 tantalum Inorganic materials 0.000 claims description 4
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 4
- 229910052741 iridium Inorganic materials 0.000 claims description 3
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052758 niobium Inorganic materials 0.000 claims description 3
- 239000010955 niobium Substances 0.000 claims description 3
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 3
- 229910001925 ruthenium oxide Inorganic materials 0.000 claims description 3
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 claims description 3
- 229910045601 alloy Inorganic materials 0.000 claims description 2
- 239000000956 alloy Substances 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 229910044991 metal oxide Inorganic materials 0.000 claims description 2
- 238000004064 recycling Methods 0.000 claims description 2
- 229910052703 rhodium Inorganic materials 0.000 claims description 2
- 239000010948 rhodium Substances 0.000 claims description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 2
- 229910052707 ruthenium Inorganic materials 0.000 claims description 2
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 abstract description 24
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 abstract description 5
- 238000000926 separation method Methods 0.000 abstract 1
- 210000004027 cell Anatomy 0.000 description 87
- 230000008569 process Effects 0.000 description 29
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000004812 Fluorinated ethylene propylene Substances 0.000 description 9
- 229920009441 perflouroethylene propylene Polymers 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 8
- 229920000642 polymer Polymers 0.000 description 8
- 235000011121 sodium hydroxide Nutrition 0.000 description 7
- 238000011282 treatment Methods 0.000 description 7
- 229940083608 sodium hydroxide Drugs 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 230000006835 compression Effects 0.000 description 3
- 238000007906 compression Methods 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 239000005033 polyvinylidene chloride Substances 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 230000003134 recirculating effect Effects 0.000 description 3
- 230000001105 regulatory effect Effects 0.000 description 3
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- 229910001209 Low-carbon steel Inorganic materials 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000004809 Teflon Substances 0.000 description 2
- 229920006362 Teflon® Polymers 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000007844 bleaching agent Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 238000010924 continuous production Methods 0.000 description 2
- 230000001276 controlling effect Effects 0.000 description 2
- OSVXSBDYLRYLIG-UHFFFAOYSA-N dioxidochlorine(.) Chemical compound O=Cl=O OSVXSBDYLRYLIG-UHFFFAOYSA-N 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 230000005012 migration Effects 0.000 description 2
- 238000013508 migration Methods 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- HWLDNSXPUQTBOD-UHFFFAOYSA-N platinum-iridium alloy Chemical group [Ir].[Pt] HWLDNSXPUQTBOD-UHFFFAOYSA-N 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229940058401 polytetrafluoroethylene Drugs 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 238000004537 pulping Methods 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- DJKGDNKYTKCJKD-BPOCMEKLSA-N (1s,4r,5s,6r)-1,2,3,4,7,7-hexachlorobicyclo[2.2.1]hept-2-ene-5,6-dicarboxylic acid Chemical compound ClC1=C(Cl)[C@]2(Cl)[C@H](C(=O)O)[C@H](C(O)=O)[C@@]1(Cl)C2(Cl)Cl DJKGDNKYTKCJKD-BPOCMEKLSA-N 0.000 description 1
- 239000004801 Chlorinated PVC Substances 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 239000004155 Chlorine dioxide Substances 0.000 description 1
- GUTLYIVDDKVIGB-OUBTZVSYSA-N Cobalt-60 Chemical compound [60Co] GUTLYIVDDKVIGB-OUBTZVSYSA-N 0.000 description 1
- 241001397173 Kali <angiosperm> Species 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 229920001774 Perfluoroether Polymers 0.000 description 1
- 240000005428 Pistacia lentiscus Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- LVPZCFZGMKGEKV-UHFFFAOYSA-N [Ru]=O.[Pt] Chemical compound [Ru]=O.[Pt] LVPZCFZGMKGEKV-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000010953 base metal Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 210000005056 cell body Anatomy 0.000 description 1
- 210000002421 cell wall Anatomy 0.000 description 1
- 229920000457 chlorinated polyvinyl chloride Polymers 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 235000019398 chlorine dioxide Nutrition 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 230000003467 diminishing effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000003487 electrochemical reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 238000007499 fusion processing Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- HCDGVLDPFQMKDK-UHFFFAOYSA-N hexafluoropropylene Chemical group FC(F)=C(F)C(F)(F)F HCDGVLDPFQMKDK-UHFFFAOYSA-N 0.000 description 1
- ATADHKWKHYVBTJ-UHFFFAOYSA-N hydron;4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;chloride Chemical compound Cl.CNCC(O)C1=CC=C(O)C(O)=C1 ATADHKWKHYVBTJ-UHFFFAOYSA-N 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- UJMWVICAENGCRF-UHFFFAOYSA-N oxygen difluoride Chemical compound FOF UJMWVICAENGCRF-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 239000011087 paperboard Substances 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- UUWCBFKLGFQDME-UHFFFAOYSA-N platinum titanium Chemical compound [Ti].[Pt] UUWCBFKLGFQDME-UHFFFAOYSA-N 0.000 description 1
- 230000010287 polarization Effects 0.000 description 1
- 229920001084 poly(chloroprene) Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000004076 pulp bleaching Methods 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000005057 refrigeration Methods 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 150000003388 sodium compounds Chemical class 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 1
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 1
- 238000004381 surface treatment Methods 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/34—Simultaneous production of alkali metal hydroxides and chlorine, oxyacids or salts of chlorine, e.g. by chlor-alkali electrolysis
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
- Manufacture Of Macromolecular Shaped Articles (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US411622A US3897320A (en) | 1973-11-01 | 1973-11-01 | Electrolytic manufacture of chlorates, using a plurality of electrolytic cells |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1073402A true CA1073402A (en) | 1980-03-11 |
Family
ID=23629673
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA211,588A Expired CA1073402A (en) | 1973-11-01 | 1974-10-17 | Electrolytic manufacture of chlorates using a plurality of electrolytic cells |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3897320A (Direct) |
| JP (1) | JPS5321400B2 (Direct) |
| BR (1) | BR7409140D0 (Direct) |
| CA (1) | CA1073402A (Direct) |
| DE (1) | DE2451845C3 (Direct) |
| FI (1) | FI59816C (Direct) |
| FR (1) | FR2249973B1 (Direct) |
| GB (1) | GB1482937A (Direct) |
| IT (1) | IT1025404B (Direct) |
| NL (1) | NL7414202A (Direct) |
| NO (1) | NO743913L (Direct) |
| SE (1) | SE7413729L (Direct) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR205953A1 (es) * | 1975-01-22 | 1976-06-15 | Diamond Shamrock Corp | Produccion de carbonatos de metales a calinos en una celula de membrana |
| JPS5227098A (en) * | 1975-08-27 | 1977-03-01 | Osaka Soda Co Ltd | Method of simultaneous process of chlorine dioxide,chlorine gas,and ca ustic alkali. |
| JPS5230295A (en) * | 1975-09-02 | 1977-03-07 | Osaka Soda Co Ltd | Electrolytic production of alkali chlorate, caustic alkali, chlorine a nd hydrogen |
| JPS5819750B2 (ja) * | 1975-11-25 | 1983-04-19 | 株式会社トクヤマ | 電解方法 |
| US4062743A (en) * | 1975-12-22 | 1977-12-13 | Ahn Byung K | Electrolytic process for potassium hydroxide |
| US4115218A (en) * | 1976-10-22 | 1978-09-19 | Basf Wyandotte Corporation | Method of electrolyzing brine |
| US4159929A (en) * | 1978-05-17 | 1979-07-03 | Hooker Chemicals & Plastics Corp. | Chemical and electro-chemical process for production of alkali metal chlorates |
| IT1113412B (it) * | 1979-02-15 | 1986-01-20 | Oronzio De Nora Impianti | Procedimento eletttrolitico ed apparecchiatura per la preparazione di ipoalogenito di metallo alcalino |
| JPS56108887A (en) * | 1980-01-30 | 1981-08-28 | Asahi Chem Ind Co Ltd | Electrolyzing method for common salt by simultaneous use of cation exchange membrane and diaphragm |
| FI71354C (fi) * | 1980-03-03 | 1986-12-19 | Asahi Chemical Ind | Foerfarande foer framstaellning av natriumklorat |
| FR2655061B1 (fr) * | 1989-11-29 | 1993-12-10 | Atochem | Fabrication de chlorate ou de perchlorate de metal alcalin. |
| SE9100365L (sv) * | 1991-02-05 | 1992-08-06 | Eka Nobel Ab | Foerfarande foer elektrolytisk framstaellning av alkalimetallklorat och hjaelpkemikalier |
| SE512388C2 (sv) * | 1993-04-26 | 2000-03-13 | Eka Chemicals Ab | Förfarande för framställning av alkalimetallklorat genom elektrolys |
| US8216443B2 (en) * | 2002-07-05 | 2012-07-10 | Akzo Nobel N.V. | Process for producing alkali metal chlorate |
| DE602004025053D1 (de) * | 2004-09-20 | 2010-02-25 | Corsa Beheer Bv | Kombination und verfahren zur zubereitung eines getränks |
| DE102005038970A1 (de) * | 2005-05-11 | 2006-11-16 | Over-Eloxal Gmbh | Vorrichtung zum Behandeln eines Metalls in einem Elektrolytbad und Verfahren zum Verringern einer Aerosolabgabe |
| US8025786B2 (en) * | 2006-02-10 | 2011-09-27 | Tennant Company | Method of generating sparged, electrochemically activated liquid |
| US8012340B2 (en) * | 2006-02-10 | 2011-09-06 | Tennant Company | Method for generating electrochemically activated cleaning liquid |
| US8046867B2 (en) | 2006-02-10 | 2011-11-01 | Tennant Company | Mobile surface cleaner having a sparging device |
| US8016996B2 (en) * | 2006-02-10 | 2011-09-13 | Tennant Company | Method of producing a sparged cleaning liquid onboard a mobile surface cleaner |
| US8025787B2 (en) | 2006-02-10 | 2011-09-27 | Tennant Company | Method and apparatus for generating, applying and neutralizing an electrochemically activated liquid |
| US7891046B2 (en) * | 2006-02-10 | 2011-02-22 | Tennant Company | Apparatus for generating sparged, electrochemically activated liquid |
| US8156608B2 (en) * | 2006-02-10 | 2012-04-17 | Tennant Company | Cleaning apparatus having a functional generator for producing electrochemically activated cleaning liquid |
| US8007654B2 (en) * | 2006-02-10 | 2011-08-30 | Tennant Company | Electrochemically activated anolyte and catholyte liquid |
| US20080308427A1 (en) * | 2007-06-18 | 2008-12-18 | Tennant Company | System and process for producing alcohol |
| WO2009046279A2 (en) * | 2007-10-04 | 2009-04-09 | Tennant Company | Method and apparatus for neutralizing electrochemically activated liquids |
| US8485140B2 (en) * | 2008-06-05 | 2013-07-16 | Global Patent Investment Group, LLC | Fuel combustion method and system |
| US20090301521A1 (en) * | 2008-06-10 | 2009-12-10 | Tennant Company | Steam cleaner using electrolyzed liquid and method therefor |
| US20090311137A1 (en) * | 2008-06-11 | 2009-12-17 | Tennant Company | Atomizer using electrolyzed liquid and method therefor |
| WO2009155543A1 (en) * | 2008-06-19 | 2009-12-23 | Tennant Company | Electrolysis cell having conductive polymer electrodes and method of electrolysis |
| BRPI0914208A2 (pt) * | 2008-06-19 | 2015-11-03 | Tennant Co | célula de eletrólise, e, método |
| US20100089419A1 (en) * | 2008-09-02 | 2010-04-15 | Tennant Company | Electrochemically-activated liquid for cosmetic removal |
| JP2012512007A (ja) * | 2008-12-17 | 2012-05-31 | テナント カンパニー | 強化された浮遊特性を有する液体を通じて電荷を印加する方法および装置 |
| WO2011026075A1 (en) * | 2009-08-31 | 2011-03-03 | Tennant Company | Electrochemically-activated liquids containing fragrant compounds |
| US20110219555A1 (en) * | 2010-03-10 | 2011-09-15 | Tennant Company | Cleaning head and mobile floor cleaner |
| WO2012170774A1 (en) * | 2011-06-10 | 2012-12-13 | Lumetta Michael | System and method for generating a chlorine-containing compound |
| US10227702B2 (en) | 2014-12-05 | 2019-03-12 | Westlake Vinyl Corporation | System and method for purifying depleted brine |
| CN105821436B (zh) * | 2016-05-09 | 2018-07-24 | 复旦大学 | 一种基于三电极体系的双电解槽两步法氯碱电解方法及装置 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US665426A (en) * | 1895-09-09 | 1901-01-08 | Nat Electrolytic Company | Art of obtaining chlorates by electrolysis. |
| BE466741A (fr) * | 1946-01-31 | Solvay | Procédé et dispositif pour la fabrication de chlorites alcalins. | |
| NL235848A (Direct) * | 1959-02-06 | |||
| US3438879A (en) * | 1967-07-31 | 1969-04-15 | Hooker Chemical Corp | Protection of permselective diaphragm during electrolysis |
| US3535215A (en) * | 1967-12-04 | 1970-10-20 | Hooker Chemical Corp | Method for operating electrolytic cells |
| US3654121A (en) * | 1968-12-23 | 1972-04-04 | Engelhard Min & Chem | Electrolytic anode |
| US3784399A (en) * | 1971-09-08 | 1974-01-08 | Du Pont | Films of fluorinated polymer containing sulfonyl groups with one surface in the sulfonamide or sulfonamide salt form and a process for preparing such |
-
1973
- 1973-11-01 US US411622A patent/US3897320A/en not_active Expired - Lifetime
-
1974
- 1974-10-17 CA CA211,588A patent/CA1073402A/en not_active Expired
- 1974-10-30 NO NO743913A patent/NO743913L/no unknown
- 1974-10-30 NL NL7414202A patent/NL7414202A/xx unknown
- 1974-10-30 JP JP12607674A patent/JPS5321400B2/ja not_active Expired
- 1974-10-30 FR FR7436302A patent/FR2249973B1/fr not_active Expired
- 1974-10-31 BR BR9140/74A patent/BR7409140D0/pt unknown
- 1974-10-31 SE SE7413729A patent/SE7413729L/xx unknown
- 1974-10-31 GB GB47168/74A patent/GB1482937A/en not_active Expired
- 1974-10-31 FI FI3194/74A patent/FI59816C/fi active
- 1974-10-31 DE DE2451845A patent/DE2451845C3/de not_active Expired
- 1974-10-31 IT IT29064/74A patent/IT1025404B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| DE2451845C3 (de) | 1979-04-26 |
| FR2249973A1 (Direct) | 1975-05-30 |
| NL7414202A (nl) | 1975-05-06 |
| SE7413729L (Direct) | 1975-05-02 |
| DE2451845A1 (de) | 1975-05-07 |
| NO743913L (Direct) | 1975-05-26 |
| FI59816C (fi) | 1983-05-30 |
| FR2249973B1 (Direct) | 1978-12-22 |
| FI59816B (fi) | 1981-06-30 |
| JPS5089300A (Direct) | 1975-07-17 |
| JPS5321400B2 (Direct) | 1978-07-03 |
| IT1025404B (it) | 1978-08-10 |
| DE2451845B2 (de) | 1978-08-31 |
| BR7409140D0 (pt) | 1975-08-26 |
| GB1482937A (en) | 1977-08-17 |
| US3897320A (en) | 1975-07-29 |
| FI319474A7 (Direct) | 1975-05-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1073402A (en) | Electrolytic manufacture of chlorates using a plurality of electrolytic cells | |
| CA1056768A (en) | Coating metal anodes to decrease consumption rates | |
| US3899403A (en) | Electrolytic method of making concentrated hydroxide solutions by sequential use of 3-compartment and 2-compartment electrolytic cells having separating compartment walls of particular cation-active permselective membranes | |
| CA1073401A (en) | Electrolytic production of chlorine dioxide, chlorine, alkali metal hydroxide and hydrogen | |
| CA1043736A (en) | Electrolytic process for manufacturing chlorine dioxide, hydrogen peroxide, chlorine, alkali metal hydroxide and hydrogen | |
| US4272338A (en) | Process for the treatment of anolyte brine | |
| US4062753A (en) | Electrolysis method and apparatus | |
| US4124477A (en) | Electrolytic cell utilizing pretreated semi-permeable membranes | |
| US5064514A (en) | Apparatus for the production of chloric acid | |
| US3878072A (en) | Electrolytic method for the manufacture of chlorates | |
| CA1068640A (en) | Electrolytic production of hydrogen peroxide and alkali metal hydroxide | |
| US4053376A (en) | Electrolytic production of hydrogen iodide | |
| US3904495A (en) | Electrolytic-electrodialytic and chemical manufacture of chlorine dioxide, chlorine and chloride-free alkali metal hydroxide | |
| US3954579A (en) | Electrolytic method for the simultaneous manufacture of concentrated and dilute aqueous hydroxide solutions | |
| US3925174A (en) | Electrolytic method for the manufacture of hypochlorites | |
| US3920551A (en) | Electrolytic method for the manufacture of dithionites | |
| JPH0573834B2 (Direct) | ||
| US3905879A (en) | Electrolytic manufacture of dithionites | |
| US4062743A (en) | Electrolytic process for potassium hydroxide | |
| US4147600A (en) | Electrolytic method of producing concentrated hydroxide solutions | |
| US4242184A (en) | Membrane cell chlor-alkali process having improved overall efficiency | |
| US4061550A (en) | Process for electrolysis | |
| CA1145708A (en) | Electrolytic cells | |
| US4147601A (en) | Electrolytic production of hydrobromic acid | |
| IL45141A (en) | Process and apparatus for electrolysis |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |