CA1071636A - N-(1-substituted-3-pyrrolidinyl)-1-naphthalene and 4-quinolinecarboxamides - Google Patents
N-(1-substituted-3-pyrrolidinyl)-1-naphthalene and 4-quinolinecarboxamidesInfo
- Publication number
- CA1071636A CA1071636A CA242,432A CA242432A CA1071636A CA 1071636 A CA1071636 A CA 1071636A CA 242432 A CA242432 A CA 242432A CA 1071636 A CA1071636 A CA 1071636A
- Authority
- CA
- Canada
- Prior art keywords
- hydrogen
- cyclohexyl
- pyrrolidinyl
- hydrochloride
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- LEWDKQKVAFOMPI-UHFFFAOYSA-N quinoline-4-carboxamide Chemical class C1=CC=C2C(C(=O)N)=CC=NC2=C1 LEWDKQKVAFOMPI-UHFFFAOYSA-N 0.000 title claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 24
- 239000001257 hydrogen Substances 0.000 claims abstract description 24
- -1 lower-alkyl Inorganic materials 0.000 claims abstract description 16
- 150000003839 salts Chemical class 0.000 claims abstract description 14
- 239000002253 acid Substances 0.000 claims abstract description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 6
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 5
- 150000002367 halogens Chemical class 0.000 claims abstract description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 3
- 150000002431 hydrogen Chemical group 0.000 claims abstract 15
- 238000000034 method Methods 0.000 claims description 32
- 150000001875 compounds Chemical class 0.000 claims description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 18
- 239000007858 starting material Substances 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 239000012458 free base Substances 0.000 claims description 5
- DPEPZAJVZHRORQ-UHFFFAOYSA-N 1-cyclohexylpyrrolidin-3-amine Chemical compound C1C(N)CCN1C1CCCCC1 DPEPZAJVZHRORQ-UHFFFAOYSA-N 0.000 claims description 4
- KTMXEEOPGLOPMJ-UHFFFAOYSA-N 2-chloroquinoline-4-carbonyl chloride Chemical compound C1=CC=C2C(C(=O)Cl)=CC(Cl)=NC2=C1 KTMXEEOPGLOPMJ-UHFFFAOYSA-N 0.000 claims description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 4
- NSNPSJGHTQIXDO-UHFFFAOYSA-N naphthalene-1-carbonyl chloride Chemical compound C1=CC=C2C(C(=O)Cl)=CC=CC2=C1 NSNPSJGHTQIXDO-UHFFFAOYSA-N 0.000 claims description 4
- LTCHMKYDMGFEKH-UHFFFAOYSA-N 1-cyclohexyl-n-methylpyrrolidin-3-amine Chemical compound C1C(NC)CCN1C1CCCCC1 LTCHMKYDMGFEKH-UHFFFAOYSA-N 0.000 claims description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 3
- NGXSWUFDCSEIOO-UHFFFAOYSA-N pyrrolidin-3-amine Chemical compound NC1CCNC1 NGXSWUFDCSEIOO-UHFFFAOYSA-N 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims 5
- 125000001246 bromo group Chemical group Br* 0.000 claims 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 3
- OHQRETGYTHWFBJ-UHFFFAOYSA-N 2-chloro-n-(1-cyclohexylpyrrolidin-3-yl)quinoline-4-carboxamide Chemical compound C=12C=CC=CC2=NC(Cl)=CC=1C(=O)NC(C1)CCN1C1CCCCC1 OHQRETGYTHWFBJ-UHFFFAOYSA-N 0.000 claims 2
- IOZFSRPRHQEEJI-UHFFFAOYSA-N n-(1-cyclohexylpyrrolidin-3-yl)-n-methylnaphthalene-1-carboxamide Chemical compound C=1C=CC2=CC=CC=C2C=1C(=O)N(C)C(C1)CCN1C1CCCCC1 IOZFSRPRHQEEJI-UHFFFAOYSA-N 0.000 claims 2
- OMUQQINXBOHPLC-UHFFFAOYSA-N n-(1-cyclohexylpyrrolidin-3-yl)naphthalene-1-carboxamide Chemical compound C=1C=CC2=CC=CC=C2C=1C(=O)NC(C1)CCN1C1CCCCC1 OMUQQINXBOHPLC-UHFFFAOYSA-N 0.000 claims 2
- BOMVCVFNBKZNNL-UHFFFAOYSA-N 2-chloro-n-(1-cyclohexylpyrrolidin-3-yl)-n-methylquinoline-4-carboxamide Chemical compound C=1C(Cl)=NC2=CC=CC=C2C=1C(=O)N(C)C(C1)CCN1C1CCCCC1 BOMVCVFNBKZNNL-UHFFFAOYSA-N 0.000 claims 1
- 230000003474 anti-emetic effect Effects 0.000 abstract description 5
- 125000003545 alkoxy group Chemical group 0.000 abstract description 2
- 125000000217 alkyl group Chemical group 0.000 abstract description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 2
- 125000003118 aryl group Chemical group 0.000 abstract 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 27
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- 239000000243 solution Substances 0.000 description 14
- 239000003814 drug Substances 0.000 description 12
- 241000282472 Canis lupus familiaris Species 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 206010047700 Vomiting Diseases 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 229940079593 drug Drugs 0.000 description 8
- 239000002111 antiemetic agent Substances 0.000 description 7
- 229940125683 antiemetic agent Drugs 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 241000906446 Theraps Species 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 231100000252 nontoxic Toxicity 0.000 description 4
- 230000003000 nontoxic effect Effects 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002895 emetic Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- OTENSAQNLUSKHN-UHFFFAOYSA-N quinoline-4-carbonyl chloride Chemical compound C1=CC=C2C(C(=O)Cl)=CC=NC2=C1 OTENSAQNLUSKHN-UHFFFAOYSA-N 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- SKYZYDSNJIOXRL-BTQNPOSSSA-N (6ar)-6-methyl-5,6,6a,7-tetrahydro-4h-dibenzo[de,g]quinoline-10,11-diol;hydrochloride Chemical compound Cl.C([C@H]1N(C)CC2)C3=CC=C(O)C(O)=C3C3=C1C2=CC=C3 SKYZYDSNJIOXRL-BTQNPOSSSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- IZHVBANLECCAGF-UHFFFAOYSA-N 2-hydroxy-3-(octadecanoyloxy)propyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCCCCC IZHVBANLECCAGF-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229960004046 apomorphine Drugs 0.000 description 2
- VMWNQDUVQKEIOC-CYBMUJFWSA-N apomorphine Chemical compound C([C@H]1N(C)CC2)C3=CC=C(O)C(O)=C3C3=C1C2=CC=C3 VMWNQDUVQKEIOC-CYBMUJFWSA-N 0.000 description 2
- 229960003990 apomorphine hydrochloride Drugs 0.000 description 2
- TXHIDIHEXDFONW-UHFFFAOYSA-N benzene;propan-2-one Chemical compound CC(C)=O.C1=CC=CC=C1 TXHIDIHEXDFONW-UHFFFAOYSA-N 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- QIVUCLWGARAQIO-OLIXTKCUSA-N (3s)-n-[(3s,5s,6r)-6-methyl-2-oxo-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]-2-oxospiro[1h-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-carboxamide Chemical compound C1([C@H]2[C@H](N(C(=O)[C@@H](NC(=O)C=3C=C4C[C@]5(CC4=NC=3)C3=CC=CN=C3NC5=O)C2)CC(F)(F)F)C)=C(F)C=CC(F)=C1F QIVUCLWGARAQIO-OLIXTKCUSA-N 0.000 description 1
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- 101150034533 ATIC gene Proteins 0.000 description 1
- 241000220479 Acacia Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical compound NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 241000212342 Sium Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 230000000857 drug effect Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- OYFJQPXVCSSHAI-QFPUQLAESA-N enalapril maleate Chemical compound OC(=O)\C=C/C(O)=O.C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)CC1=CC=CC=C1 OYFJQPXVCSSHAI-QFPUQLAESA-N 0.000 description 1
- WDCDAAMJNUHOIY-UHFFFAOYSA-N ethyl acetate;2-propan-2-yloxypropane Chemical compound CCOC(C)=O.CC(C)OC(C)C WDCDAAMJNUHOIY-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 210000003736 gastrointestinal content Anatomy 0.000 description 1
- 229940074045 glyceryl distearate Drugs 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- ADDUZNHUQRBPBR-UHFFFAOYSA-N n-(1-cyclohexylpyrrolidin-3-yl)-8-nitro-n-phenylquinoline-4-carboxamide Chemical compound C1=CN=C2C([N+](=O)[O-])=CC=CC2=C1C(=O)N(C=1C=CC=CC=1)C(C1)CCN1C1CCCCC1 ADDUZNHUQRBPBR-UHFFFAOYSA-N 0.000 description 1
- BFKPTSADOZTZGP-UHFFFAOYSA-N n-(1-cyclopentylpyrrolidin-3-yl)-4-ethoxy-n-methyl-3h-quinoline-4-carboxamide Chemical compound C1C=NC2=CC=CC=C2C1(OCC)C(=O)N(C)C(C1)CCN1C1CCCC1 BFKPTSADOZTZGP-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 238000011176 pooling Methods 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000000063 preceeding effect Effects 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000002250 progressing effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical compound C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/14—Nitrogen atoms not forming part of a nitro radical
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/08—Drugs for disorders of the alimentary tract or the digestive system for nausea, cinetosis or vertigo; Antiemetics
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Hospice & Palliative Care (AREA)
- Otolaryngology (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/536,514 US4002757A (en) | 1974-12-26 | 1974-12-26 | N-(1-substituted-3-pyrrolidinyl)-4-quinolinecarboxamides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1071636A true CA1071636A (en) | 1980-02-12 |
Family
ID=24138812
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA242,432A Expired CA1071636A (en) | 1974-12-26 | 1975-12-23 | N-(1-substituted-3-pyrrolidinyl)-1-naphthalene and 4-quinolinecarboxamides |
Country Status (18)
| Country | Link |
|---|---|
| US (3) | US4002757A (enExample) |
| JP (2) | JPS5191254A (enExample) |
| AU (1) | AU499075B2 (enExample) |
| BE (1) | BE836975A (enExample) |
| CA (1) | CA1071636A (enExample) |
| CH (1) | CH611603A5 (enExample) |
| DE (1) | DE2558348A1 (enExample) |
| DK (1) | DK138536B (enExample) |
| ES (1) | ES443845A1 (enExample) |
| FI (1) | FI61480C (enExample) |
| FR (1) | FR2295744A1 (enExample) |
| GB (1) | GB1537848A (enExample) |
| IE (1) | IE43819B1 (enExample) |
| NL (1) | NL7515084A (enExample) |
| NO (1) | NO144670C (enExample) |
| PH (1) | PH13883A (enExample) |
| SE (1) | SE408417B (enExample) |
| ZA (1) | ZA757972B (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4279822A (en) * | 1972-04-03 | 1981-07-21 | A. H. Robins Company, Inc. | N-(1-Substituted-3-pyrrolidinyl)benzamides |
| US4002757A (en) * | 1974-12-26 | 1977-01-11 | A. H. Robins Company, Incorporated | N-(1-substituted-3-pyrrolidinyl)-4-quinolinecarboxamides |
| US4143150A (en) * | 1977-08-19 | 1979-03-06 | A. H. Robins Company, Inc. | Derivatives of oxanilic acid |
| DE3473442D1 (de) * | 1983-01-21 | 1988-09-22 | Alkaloida Vegyeszeti Gyar | New alkyl diamine derivatives |
| US5210329A (en) * | 1992-02-18 | 1993-05-11 | General Electric Company | Process for preparing bisphenol-A |
| JP4619655B2 (ja) | 2001-09-14 | 2011-01-26 | ハイ・ポイント・ファーマスーティカルズ、エルエルシー | 新規アミノアゼチジン、−ピロリジンおよび−ピペリジン誘導体 |
| US6673829B2 (en) | 2001-09-14 | 2004-01-06 | Novo Nordisk A/S | Aminoazetidine,-pyrrolidine and -piperidine derivatives |
| JP4137159B2 (ja) | 2003-06-17 | 2008-08-20 | ファイザー・インク | セロトニン及びノルアドレナリン再取り込み阻害薬としてのn−ピロリジン−3−イル−アミド誘導体 |
| US7348434B2 (en) * | 2003-08-08 | 2008-03-25 | Antony Bigot | 4-substituted quinoline derivatives, method and intermediates for their preparation and pharmaceutical compositions containing them |
| WO2006064332A1 (en) * | 2004-12-14 | 2006-06-22 | Pfizer Limited | N-pyrrolidin-3yl-amide derivatives as serotonin and noradrenalin re-uptake inhibitors |
| EP1828121A2 (en) * | 2004-12-14 | 2007-09-05 | Pfizer Limited | N-pyrrolidin-3-yl-amide derivatives as serotonin and noradrenalin re-uptake inhibitors |
| JP2008524200A (ja) * | 2004-12-16 | 2008-07-10 | ファイザー・リミテッド | 新規化合物 |
| EP2481735A1 (en) * | 2007-05-09 | 2012-08-01 | Pfizer Inc. | Substituted heterocyclic derivatives and compositions and their pharmaceutical use as antibacterials |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1825623A (en) * | 1931-09-29 | Oonhohachzn | ||
| DE67123C (de) * | L. THOMAS in Montegnee-les-Siege, Belgien | Handdrehbohrmaschine für Gruben und Steinbrüche | ||
| US3133061A (en) * | 1962-11-13 | 1964-05-12 | Sterling Drug Inc | Piperidine carboxamides and derivatives thereof |
| US3342826A (en) * | 1964-01-13 | 1967-09-19 | Ile De France | Heterocyclic aminoalkyl benzamides |
| GB1364231A (en) * | 1968-12-23 | 1974-08-21 | Robins Co Inc A H | N-/1-substituted-3-pyrrolidinyl/benzamides and thiobenzamides |
| US3577440A (en) * | 1968-12-23 | 1971-05-04 | Robins Co Inc A H | 1-substituted-3-amido-pyrrolidines |
| US3829434A (en) * | 1972-11-10 | 1974-08-13 | Pfizer | Piperidinesulfonylurea derivatives |
| US4002757A (en) * | 1974-12-26 | 1977-01-11 | A. H. Robins Company, Incorporated | N-(1-substituted-3-pyrrolidinyl)-4-quinolinecarboxamides |
-
1974
- 1974-12-26 US US05/536,514 patent/US4002757A/en not_active Expired - Lifetime
-
1975
- 1975-12-15 AU AU87550/75A patent/AU499075B2/en not_active Expired
- 1975-12-18 SE SE7514374A patent/SE408417B/xx not_active IP Right Cessation
- 1975-12-19 FI FI753606A patent/FI61480C/fi not_active IP Right Cessation
- 1975-12-22 CH CH1660375A patent/CH611603A5/xx not_active IP Right Cessation
- 1975-12-22 BE BE163038A patent/BE836975A/xx not_active IP Right Cessation
- 1975-12-23 DK DK589075AA patent/DK138536B/da not_active IP Right Cessation
- 1975-12-23 ZA ZA00757972A patent/ZA757972B/xx unknown
- 1975-12-23 FR FR7539569A patent/FR2295744A1/fr active Granted
- 1975-12-23 CA CA242,432A patent/CA1071636A/en not_active Expired
- 1975-12-23 DE DE19752558348 patent/DE2558348A1/de not_active Ceased
- 1975-12-23 IE IE2822/75A patent/IE43819B1/en unknown
- 1975-12-23 NO NO754376A patent/NO144670C/no unknown
- 1975-12-23 GB GB52612/75A patent/GB1537848A/en not_active Expired
- 1975-12-24 NL NL7515084A patent/NL7515084A/xx active Search and Examination
- 1975-12-24 PH PH17926A patent/PH13883A/en unknown
- 1975-12-24 ES ES443845A patent/ES443845A1/es not_active Expired
- 1975-12-26 JP JP50159797A patent/JPS5191254A/ja active Granted
-
1976
- 1976-05-05 US US05/683,605 patent/US4073796A/en not_active Expired - Lifetime
- 1976-05-05 US US05/683,604 patent/US4087428A/en not_active Expired - Lifetime
-
1985
- 1985-04-25 JP JP60089861A patent/JPS60248684A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS60248684A (ja) | 1985-12-09 |
| JPS5191254A (en) | 1976-08-10 |
| PH13883A (en) | 1980-10-27 |
| FR2295744B1 (enExample) | 1978-07-28 |
| AU8755075A (en) | 1977-06-23 |
| CH611603A5 (enExample) | 1979-06-15 |
| JPS611426B2 (enExample) | 1986-01-17 |
| US4073796A (en) | 1978-02-14 |
| FR2295744A1 (fr) | 1976-07-23 |
| DK589075A (enExample) | 1976-06-27 |
| BE836975A (fr) | 1976-04-16 |
| FI61480B (fi) | 1982-04-30 |
| FI753606A7 (enExample) | 1976-06-27 |
| IE43819L (en) | 1976-06-26 |
| US4002757A (en) | 1977-01-11 |
| NO144670B (no) | 1981-07-06 |
| DE2558348A1 (de) | 1976-07-08 |
| ES443845A1 (es) | 1977-04-16 |
| SE7514374L (sv) | 1976-06-28 |
| NO754376L (enExample) | 1976-06-29 |
| DK138536C (enExample) | 1979-03-05 |
| JPS619314B2 (enExample) | 1986-03-22 |
| NO144670C (no) | 1981-10-14 |
| FI61480C (fi) | 1982-08-10 |
| DK138536B (da) | 1978-09-25 |
| AU499075B2 (en) | 1979-04-05 |
| NL7515084A (nl) | 1976-06-29 |
| GB1537848A (en) | 1979-01-04 |
| ZA757972B (en) | 1976-12-29 |
| SE408417B (sv) | 1979-06-11 |
| US4087428A (en) | 1978-05-02 |
| IE43819B1 (en) | 1981-06-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1071636A (en) | N-(1-substituted-3-pyrrolidinyl)-1-naphthalene and 4-quinolinecarboxamides | |
| DE69109125T2 (de) | Ringverknüpfte analoge von stickstoffenthaltenden nichtaromatischen heterocyclen. | |
| CA1101430A (en) | Derivatives of 4-amino 5-alkylsulphonyl ortho- anisamides, methods of preparing them | |
| GB1563090A (en) | Cyclobutene-diones | |
| GB2054588A (en) | Amino-ether oxides and pharmaceutical formulations thereof | |
| NZ194614A (en) | 4-(3-substitutedamino-2-hydroxypropoxy)indoles | |
| DE2819210A1 (de) | 4-aminomethyl-1-(3,3,3-triarylpropyl)-4-arylpiperidin und dessen derivate | |
| US4207327A (en) | N-(4-Pyrazolidinyl)benzamides and their amino precursors | |
| US3996214A (en) | 5-(1,1-Diphenyl-4-(cyclic amino) but-2-trans-en-1-yl)-2-alkyl-1,3,4-oxadiazoles and intermediates thereto | |
| US3966957A (en) | Method for controlling emesis with N-(1-substituted-3-pyrrolidinyl)benzamides and thiobenzamides | |
| US4123530A (en) | N-cyclohexyl-piperazino acetamides and propionamides | |
| US3657257A (en) | 3-aryl-8-carbamoyl nortropanes | |
| US4039678A (en) | N-(substituted-3-pyrrolidinyl)-1-naphthalene carboxamides | |
| US3452026A (en) | Substituted 1,2,3,4-tetrahydroquinolines | |
| US4163789A (en) | Anti-psychotic (cycloalkenylalkylpiperidino) benzamides | |
| CA1058208A (en) | Pharmaceutical n,n'(phenylphenylene) dioxamic acid derivatives | |
| US3347856A (en) | 1-lower-alkyl-3-pyrrolidyl nu-loweralkyl- and lower-cycloalkyl-nu-arylcarbamate antispasmodics and antidepressives | |
| US3878215A (en) | 2-Alkyl-3-substituted-4-aryl isoquinolines | |
| CA1094075A (en) | Piperidine derivatives | |
| US4044148A (en) | Compounds, compositions and methods of use | |
| US4101671A (en) | Aminobenzyl-amines and salts thereof | |
| US3300532A (en) | Nu-(beta-diethylamino ethyl)-nu-[beta-hydroxy-beta-(phenyl) ethyl] anilines and salts thereof | |
| CA1059519A (en) | Dibenzyl n, n' (2,6-pyridinediyl) dioxamate | |
| US3321523A (en) | N-(beta-diethylamino ethyl)-n-[beta-(p-methoxy phenyl) ethyl] anilines and salts thereof | |
| US2798072A (en) | Substituted benzamidopiperidinopropanes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |