CA1063612A - Process for the production of 3-hydroxy-1,2,4-triazole derivatives - Google Patents
Process for the production of 3-hydroxy-1,2,4-triazole derivativesInfo
- Publication number
- CA1063612A CA1063612A CA258,385A CA258385A CA1063612A CA 1063612 A CA1063612 A CA 1063612A CA 258385 A CA258385 A CA 258385A CA 1063612 A CA1063612 A CA 1063612A
- Authority
- CA
- Canada
- Prior art keywords
- formula
- reaction
- compound
- process according
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 19
- LZTSCEYDCZBRCJ-UHFFFAOYSA-N 1,2-dihydro-1,2,4-triazol-3-one Chemical class OC=1N=CNN=1 LZTSCEYDCZBRCJ-UHFFFAOYSA-N 0.000 title claims abstract description 8
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 8
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 3
- 239000005864 Sulphur Substances 0.000 claims abstract description 3
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 3
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 3
- 239000000460 chlorine Substances 0.000 claims abstract description 3
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims abstract description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract 2
- 229910052760 oxygen Inorganic materials 0.000 claims abstract 2
- 239000001301 oxygen Substances 0.000 claims abstract 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- 239000002585 base Substances 0.000 claims description 6
- 239000002904 solvent Substances 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- -1 alkali metal bicarbonate Chemical class 0.000 claims description 5
- 239000003960 organic solvent Substances 0.000 claims description 5
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 claims description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 4
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 4
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 3
- 150000001298 alcohols Chemical class 0.000 claims description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 150000002170 ethers Chemical class 0.000 claims description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 2
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims 3
- 239000003795 chemical substances by application Substances 0.000 abstract description 2
- 239000002917 insecticide Substances 0.000 abstract description 2
- 239000000543 intermediate Substances 0.000 abstract description 2
- 239000005645 nematicide Substances 0.000 abstract description 2
- 230000000361 pesticidal effect Effects 0.000 abstract description 2
- 150000003014 phosphoric acid esters Chemical class 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- NYRKTKSMKOYEOO-UHFFFAOYSA-N 1-hydroxy-1,2,4-triazole Chemical class ON1C=NC=N1 NYRKTKSMKOYEOO-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical compound OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- UCOHKZKRNWNULS-UHFFFAOYSA-N aminocyanamide Chemical compound NNC#N UCOHKZKRNWNULS-UHFFFAOYSA-N 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000004651 carbonic acid esters Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D249/12—Oxygen or sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1024175A CH601269A5 (en) | 1975-08-06 | 1975-08-06 | Prepn. of (3)-hydroxy-(1,2,4)-triazole derivs. |
| CH815276A CH605843A5 (en) | 1976-06-25 | 1976-06-25 | Prepn. of (3)-hydroxy-(1,2,4)-triazole derivs. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1063612A true CA1063612A (en) | 1979-10-02 |
Family
ID=25702888
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA258,385A Expired CA1063612A (en) | 1975-08-06 | 1976-08-04 | Process for the production of 3-hydroxy-1,2,4-triazole derivatives |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4055572A (enExample) |
| JP (1) | JPS6036428B2 (enExample) |
| CA (1) | CA1063612A (enExample) |
| DE (1) | DE2634854A1 (enExample) |
| FR (1) | FR2320296A1 (enExample) |
| GB (1) | GB1552982A (enExample) |
| IL (1) | IL50199A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES8301948A1 (es) * | 1981-04-09 | 1983-02-01 | Hoechst Ag | "procedimiento para la preparacion de 3-hidroxi-1,2,4-triazoles". |
| US4578463A (en) * | 1984-07-18 | 1986-03-25 | Mobay Chemical Corporation | Production of S-substituted isothioureas |
| US4616004A (en) * | 1984-09-27 | 1986-10-07 | Chevron Research Company | 1-iodopropargyl-3,4-disubstituted-Δ2 -1,2,4-triazolidin-5-one fungicides |
| DE3923540A1 (de) * | 1989-07-15 | 1991-01-24 | Dornier Gmbh Lindauer | Greiferkopf fuer webmaschinen |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3133933A (en) * | 1964-05-19 | Certain | ||
| DK94570C (da) | 1958-06-25 | 1962-10-22 | Abbott Lab | Fremgangsmåde til fremstilling af urazolderivater. |
| DE1153759B (de) * | 1960-07-20 | 1963-09-05 | Hoechst Ag | Verfahren zur Herstellung von blutdrucksenkenden Urazolen |
| US3666771A (en) * | 1970-07-06 | 1972-05-30 | Parke Davis & Co | M-(amino-s-triazolyl)benzene-sulfonamides and their production |
-
1976
- 1976-07-20 US US05/707,148 patent/US4055572A/en not_active Expired - Lifetime
- 1976-08-03 DE DE19762634854 patent/DE2634854A1/de active Granted
- 1976-08-04 IL IL50199A patent/IL50199A/xx unknown
- 1976-08-04 CA CA258,385A patent/CA1063612A/en not_active Expired
- 1976-08-05 FR FR7623927A patent/FR2320296A1/fr active Granted
- 1976-08-05 GB GB32706/76A patent/GB1552982A/en not_active Expired
- 1976-08-06 JP JP51093891A patent/JPS6036428B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2634854A1 (de) | 1977-02-17 |
| DE2634854C2 (enExample) | 1987-06-11 |
| IL50199A (en) | 1979-11-30 |
| GB1552982A (en) | 1979-09-19 |
| JPS5219668A (en) | 1977-02-15 |
| FR2320296B1 (enExample) | 1979-09-28 |
| IL50199A0 (en) | 1976-10-31 |
| JPS6036428B2 (ja) | 1985-08-20 |
| FR2320296A1 (fr) | 1977-03-04 |
| US4055572A (en) | 1977-10-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0749964A1 (en) | N-Heterocyclyl biphenyl sulfonamides | |
| US5336784A (en) | Synthesis of 1,3,3-trinitroazetidine | |
| CA1063612A (en) | Process for the production of 3-hydroxy-1,2,4-triazole derivatives | |
| JP3192783B2 (ja) | 6−トリフルオロメチル−1,3,5トリアジン誘導体の製造方法 | |
| CA1296022C (en) | Preparation of o-substituted hydroxylamine hydrochlorides | |
| US20180186753A1 (en) | Processes for the preparation of pesticidal compounds | |
| US4725680A (en) | Process for the preparation of carbamates, thiocarbamates and ureas | |
| RU2117007C1 (ru) | Способ получения 2-замещенных 4,6-диалкоксипиримидинов,2-n-бутиламино-4,6-диметоксипиримидин и способ получения галогенпроизводных пиримидина | |
| US3310560A (en) | Thiophosphoric acid esters | |
| KR0163599B1 (ko) | 2-알킬티오-1,3,4-티아디아졸의 제조방법 | |
| US5382674A (en) | Preparation of 5-amino-1,2,4-triazole-3-sulfonamides | |
| US5395945A (en) | Synthesis of 3,3-dinitroazetidine | |
| KR100351631B1 (ko) | 물용매하에서의 3-트리플로오로메틸-5-하이드록시피라졸인산에스테르 유도체의 개선된 제조방법 | |
| EP0444747A2 (en) | Preparation of 5,7-dihydroxy-1,2,4-triazolo(1,5-a)-pyrimidine-2-sulfonanilides | |
| US4540794A (en) | Method for preparing 5-mercapto-1,2,3-thiadiazole salts | |
| US4958030A (en) | Process for the preparation of 3-phenylpyrrole derivatives | |
| US20050203287A1 (en) | Process for the preparation of sulfamate derivatives | |
| US4150043A (en) | 0-(2,3-Epoxypropyl)-hydroximic acid esters | |
| KR19980703584A (ko) | 살절지동물성 옥사디아진 중간체 | |
| US4600792A (en) | Preparation of biphenylylsulfonylureas and intermediates therefor | |
| CA1137482A (en) | Process for the production of 5-aminoisoxazoles | |
| US3478133A (en) | Cyclic phosphate esters and process for producing same | |
| JPS5910351B2 (ja) | 3−オキシ−1,2,4−トリアゾ−ル誘導体の製造方法 | |
| US4459415A (en) | Process for the preparation of 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-3-indoleacetoxyacetic acid | |
| EP0103840B1 (en) | Method for preparing 1,2,3-trihetero 5-membered heterocyclic compounds |