CA1052934A - Moulding compositions based on abs-graft polymers - Google Patents
Moulding compositions based on abs-graft polymersInfo
- Publication number
- CA1052934A CA1052934A CA225,588A CA225588A CA1052934A CA 1052934 A CA1052934 A CA 1052934A CA 225588 A CA225588 A CA 225588A CA 1052934 A CA1052934 A CA 1052934A
- Authority
- CA
- Canada
- Prior art keywords
- weight
- parts
- styrene
- acrylonitrile
- polymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000578 graft copolymer Polymers 0.000 title claims abstract description 82
- 239000000203 mixture Substances 0.000 title claims abstract description 74
- 238000000465 moulding Methods 0.000 title claims abstract description 30
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims abstract description 131
- KAKZBPTYRLMSJV-UHFFFAOYSA-N vinyl-ethylene Natural products C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims abstract description 88
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims abstract description 62
- 239000002245 particle Substances 0.000 claims abstract description 52
- 229920001577 copolymer Polymers 0.000 claims abstract description 36
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 claims abstract description 6
- 239000000178 monomer Substances 0.000 claims description 40
- 229920005989 resin Polymers 0.000 claims description 29
- 239000011347 resin Substances 0.000 claims description 29
- 229920001971 elastomer Polymers 0.000 claims description 11
- 239000011159 matrix material Substances 0.000 claims description 11
- 239000005060 rubber Substances 0.000 claims description 11
- -1 ?-methyl styrene Chemical compound 0.000 claims description 9
- 239000000126 substance Substances 0.000 claims description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims 2
- 229910052742 iron Inorganic materials 0.000 claims 1
- 239000005062 Polybutadiene Substances 0.000 abstract description 8
- 229920002857 polybutadiene Polymers 0.000 abstract description 8
- 229920000642 polymer Polymers 0.000 description 34
- 229920000126 latex Polymers 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 21
- 239000000839 emulsion Substances 0.000 description 21
- 239000004816 latex Substances 0.000 description 17
- 229920002285 poly(styrene-co-acrylonitrile) Polymers 0.000 description 14
- 238000012360 testing method Methods 0.000 description 14
- 238000000034 method Methods 0.000 description 12
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000003995 emulsifying agent Substances 0.000 description 8
- 230000008569 process Effects 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 238000007792 addition Methods 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- 238000005259 measurement Methods 0.000 description 7
- 238000012545 processing Methods 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- 239000008367 deionised water Substances 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 239000012190 activator Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 229920000638 styrene acrylonitrile Polymers 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 238000006116 polymerization reaction Methods 0.000 description 4
- SCUZVMOVTVSBLE-UHFFFAOYSA-N prop-2-enenitrile;styrene Chemical compound C=CC#N.C=CC1=CC=CC=C1 SCUZVMOVTVSBLE-UHFFFAOYSA-N 0.000 description 4
- BTXXTMOWISPQSJ-UHFFFAOYSA-N 4,4,4-trifluorobutan-2-one Chemical compound CC(=O)CC(F)(F)F BTXXTMOWISPQSJ-UHFFFAOYSA-N 0.000 description 3
- BQACOLQNOUYJCE-FYZZASKESA-N Abietic acid Natural products CC(C)C1=CC2=CC[C@]3(C)[C@](C)(CCC[C@@]3(C)C(=O)O)[C@H]2CC1 BQACOLQNOUYJCE-FYZZASKESA-N 0.000 description 3
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 3
- 239000004159 Potassium persulphate Substances 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001993 dienes Chemical class 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 238000007373 indentation Methods 0.000 description 3
- 239000008384 inner phase Substances 0.000 description 3
- HKUFIYBZNQSHQS-UHFFFAOYSA-N n-octadecyloctadecan-1-amine Chemical compound CCCCCCCCCCCCCCCCCCNCCCCCCCCCCCCCCCCCC HKUFIYBZNQSHQS-UHFFFAOYSA-N 0.000 description 3
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 3
- 235000019394 potassium persulphate Nutrition 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 229920001897 terpolymer Polymers 0.000 description 3
- 229920001169 thermoplastic Polymers 0.000 description 3
- 239000004416 thermosoftening plastic Substances 0.000 description 3
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 239000011324 bead Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- 239000003431 cross linking reagent Substances 0.000 description 2
- 238000001493 electron microscopy Methods 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000001746 injection moulding Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 230000000717 retained effect Effects 0.000 description 2
- 238000007493 shaping process Methods 0.000 description 2
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 230000000007 visual effect Effects 0.000 description 2
- PRBHEGAFLDMLAL-GQCTYLIASA-N (4e)-hexa-1,4-diene Chemical compound C\C=C\CC=C PRBHEGAFLDMLAL-GQCTYLIASA-N 0.000 description 1
- OJOWICOBYCXEKR-KRXBUXKQSA-N (5e)-5-ethylidenebicyclo[2.2.1]hept-2-ene Chemical compound C1C2C(=C/C)/CC1C=C2 OJOWICOBYCXEKR-KRXBUXKQSA-N 0.000 description 1
- HECLRDQVFMWTQS-RGOKHQFPSA-N 1755-01-7 Chemical compound C1[C@H]2[C@@H]3CC=C[C@@H]3[C@@H]1C=C2 HECLRDQVFMWTQS-RGOKHQFPSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- LLQHSBBZNDXTIV-UHFFFAOYSA-N 6-[5-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-4,5-dihydro-1,2-oxazol-3-yl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC1CC(=NO1)C1=CC2=C(NC(O2)=O)C=C1 LLQHSBBZNDXTIV-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- 241000282320 Panthera leo Species 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000022563 Rema Species 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- HGINCPLSRVDWNT-UHFFFAOYSA-N acrylaldehyde Natural products C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 1
- 125000005396 acrylic acid ester group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 238000000149 argon plasma sintering Methods 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 230000001886 ciliary effect Effects 0.000 description 1
- 239000011362 coarse particle Substances 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000007872 degassing Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- WNAHIZMDSQCWRP-UHFFFAOYSA-N dodecane-1-thiol Chemical compound CCCCCCCCCCCCS WNAHIZMDSQCWRP-UHFFFAOYSA-N 0.000 description 1
- 239000013536 elastomeric material Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000007764 o/w emulsion Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000002530 phenolic antioxidant Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 150000003440 styrenes Chemical group 0.000 description 1
- 125000003011 styrenyl group Chemical group [H]\C(*)=C(/[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 238000010408 sweeping Methods 0.000 description 1
- 239000003784 tall oil Substances 0.000 description 1
- 150000003508 terpinolene derivatives Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- ZOKXUAHZSKEQSS-UHFFFAOYSA-N tribufos Chemical compound CCCCSP(=O)(SCCCC)SCCCC ZOKXUAHZSKEQSS-UHFFFAOYSA-N 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 238000007666 vacuum forming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L25/00—Compositions of, homopolymers or copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by an aromatic carbocyclic ring; Compositions of derivatives of such polymers
- C08L25/02—Homopolymers or copolymers of hydrocarbons
- C08L25/04—Homopolymers or copolymers of styrene
- C08L25/08—Copolymers of styrene
- C08L25/12—Copolymers of styrene with unsaturated nitriles
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L55/00—Compositions of homopolymers or copolymers, obtained by polymerisation reactions only involving carbon-to-carbon unsaturated bonds, not provided for in groups C08L23/00 - C08L53/00
- C08L55/02—ABS [Acrylonitrile-Butadiene-Styrene] polymers
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Graft Or Block Polymers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2420357A DE2420357B2 (de) | 1974-04-26 | 1974-04-26 | Formmassen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1052934A true CA1052934A (en) | 1979-04-17 |
Family
ID=5914095
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA225,588A Expired CA1052934A (en) | 1974-04-26 | 1975-04-24 | Moulding compositions based on abs-graft polymers |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4009227A (enExample) |
| JP (1) | JPS5743097B2 (enExample) |
| AT (1) | AT335175B (enExample) |
| BE (1) | BE828318A (enExample) |
| BR (1) | BR7502544A (enExample) |
| CA (1) | CA1052934A (enExample) |
| CH (1) | CH612207A5 (enExample) |
| DE (1) | DE2420357B2 (enExample) |
| ES (1) | ES436998A1 (enExample) |
| FR (1) | FR2268832B1 (enExample) |
| IN (1) | IN143232B (enExample) |
| IT (1) | IT1035447B (enExample) |
| NL (1) | NL179736B (enExample) |
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2420357B2 (de) * | 1974-04-26 | 1980-02-07 | Bayer Ag, 5090 Leverkusen | Formmassen |
| US4205019A (en) * | 1975-12-26 | 1980-05-27 | Sumitamo Naugatuck Co., Ltd. | Process for producing thermoplastic resin |
| US4243765A (en) * | 1976-12-29 | 1981-01-06 | The Dow Chemical Company | Impact-resistant polymers and rubber concentrates therefor |
| JPS601883B2 (ja) * | 1978-07-04 | 1985-01-18 | 住友ノ−ガタック株式会社 | 熱可塑性樹脂の製造法 |
| DE2846754A1 (de) * | 1978-10-27 | 1980-05-08 | Basf Ag | Schlagzaehe thermoplastische kunststoffmassen |
| JPS5848584B2 (ja) * | 1978-12-29 | 1983-10-29 | 呉羽化学工業株式会社 | グラフト共重合体の製造方法 |
| JPS5937006B2 (ja) * | 1978-12-30 | 1984-09-07 | 鐘淵化学工業株式会社 | ニトリル系樹脂の製造方法 |
| DE2901576C2 (de) * | 1979-01-17 | 1987-02-26 | Basf Ag, 6700 Ludwigshafen | Schlagzähe thermoplastische Kunststoffmassen |
| US4250271A (en) * | 1979-05-15 | 1981-02-10 | Cosden Technology, Inc. | ABS-Type polyblend compositions |
| DK397681A (da) * | 1980-09-11 | 1982-03-12 | Stamicarbon | Polymert materiale |
| US4598124A (en) * | 1982-02-12 | 1986-07-01 | Monsanto Company | Mass polymerization process for ABS polyblends |
| US4713420A (en) * | 1982-05-21 | 1987-12-15 | The Dow Chemical Company | ABS compositions having trimodal rubber particle distributions |
| DE3304544A1 (de) * | 1983-02-10 | 1984-08-16 | Bayer Ag, 5090 Leverkusen | Abs-formmassen |
| US4559386A (en) * | 1983-11-21 | 1985-12-17 | Monsanto Company | ABS compositions and process for preparing same |
| US4510287A (en) * | 1983-11-21 | 1985-04-09 | Monsanto Company | ABS Compositions and process for preparing same |
| AU590231B2 (en) * | 1984-11-30 | 1989-11-02 | Dow Chemical Company, The | Polymeric polyblend compositions having lightly-grafted rubber-reinforcing particles |
| DE3629152A1 (de) * | 1986-08-27 | 1988-03-03 | Basf Ag | Thermoplastische formmasse auf basis von abs |
| US4964895A (en) * | 1987-06-08 | 1990-10-23 | Monsanto Company | Substituted 4-(4-nitrophenoxy) pyrazoles and their use as herbicides |
| US5574099A (en) * | 1991-03-18 | 1996-11-12 | Japan Synthetic Rubber Co., Ltd. | Rubber-reinforced styrene resin composition and process for producing the same |
| KR970701215A (ko) * | 1994-02-22 | 1997-03-17 | 그레이스 스티븐 에스. | 다형태 ABS 중합체의 제조방법(Process for the preparation of multimodal ABS polymers) |
| DE4414123A1 (de) * | 1994-04-22 | 1995-10-26 | Bayer Ag | Thermoplastische Formmassen vom ABS-Typ |
| WO1996015188A1 (en) * | 1994-11-15 | 1996-05-23 | Kanegafuchi Kagaku Kogyo Kabushiki Kaisha | Resin composition excellent in impact resistance |
| MY113152A (en) * | 1996-01-31 | 2001-11-30 | Ciba Holding Inc | Synergistic mixture consisting of a 2-4-dimethyl-6-s-alkylphenol and a sterically hindered phenol |
| DE19649255A1 (de) * | 1996-11-28 | 1998-06-04 | Bayer Ag | Thermoplastische Hochglanz-Formmassen vom ABS-Typ |
| DE19649249A1 (de) * | 1996-11-28 | 1998-06-04 | Bayer Ag | Verbesserte thermoplastische Formmassen vom ABS-Typ |
| KR100417054B1 (ko) * | 1998-07-22 | 2004-05-03 | 제일모직주식회사 | 스티렌계열가소성수지조성물 |
| DE19853107A1 (de) | 1998-11-18 | 2000-05-25 | Bayer Ag | ABS-Formmassen mit verbesserter Eigenschaftskombination |
| KR100546783B1 (ko) * | 1999-09-21 | 2006-01-25 | 제일모직주식회사 | 내열성이 우수한 열가소성 수지 조성물 |
| KR100540910B1 (ko) * | 1999-12-15 | 2006-01-12 | 제일모직주식회사 | 내구성/내충격성이 우수한 abs수지 조성물 |
| DE10008418A1 (de) * | 2000-02-23 | 2001-08-30 | Bayer Ag | ABS-Formmassen mit verbesserter Verarbeitbarkeit und hohem Glanz |
| DE10060411A1 (de) | 2000-12-05 | 2002-06-06 | Bayer Ag | Thermoplastische Formmassen |
| DE10060410A1 (de) | 2000-12-05 | 2002-06-06 | Bayer Ag | Thermoplastische Formmassen |
| ES2456501T3 (es) * | 2004-05-14 | 2014-04-22 | Cray Valley Usa, Llc | Método para adherir tejido a caucho, tejido tratado, y compuestos tejido-caucho |
| JP4741202B2 (ja) * | 2004-06-10 | 2011-08-03 | ユーエムジー・エービーエス株式会社 | 熱可塑性樹脂組成物およびその成形品 |
| EP1752478A1 (en) | 2005-08-08 | 2007-02-14 | Basf Aktiengesellschaft | A process for the production of a graft copolymer having a bimodal particle distribution. |
| TWI462819B (zh) * | 2011-08-11 | 2014-12-01 | Asahi Kasei Chemicals Corp | A non - coated frame and its manufacturing method |
| JP7755599B2 (ja) * | 2020-04-15 | 2025-10-16 | レゴ エー/エス | リサイクルabs材料で作られた玩具組立ブロック |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3509237A (en) * | 1966-03-21 | 1970-04-28 | Monsanto Co | Abs graft polyblends containing two graft polymers having different particle sizes |
| US3509238A (en) * | 1966-03-21 | 1970-04-28 | Monsanto Co | Abs graft polyblends containing two graft polymers with different degrees of grafting |
| ES337359A1 (es) * | 1966-03-21 | 1968-06-01 | Monsanto Co | Procedimiento para la polimerizacion de una polimezcla. |
| DE1745098B2 (de) * | 1966-03-21 | 1974-10-24 | Monsanto Co., St. Louis, Mo. (V.St.A.) | Polymerisatgemische |
| US3576910A (en) * | 1967-10-23 | 1971-04-27 | Monsanto Co | A-b-s polyblend |
| US3652721A (en) * | 1970-07-24 | 1972-03-28 | Monsanto Co | Novel graft copolymer blends with two different particle sizes and method of making same |
| JPS4845544A (enExample) * | 1971-10-11 | 1973-06-29 | ||
| JPS5522507B2 (enExample) * | 1972-09-19 | 1980-06-17 | ||
| JPS5111090B2 (enExample) * | 1973-09-04 | 1976-04-08 | ||
| DE2420358B2 (de) * | 1974-04-26 | 1980-02-07 | Bayer Ag, 5090 Leverkusen | Formmassen |
| DE2420357B2 (de) * | 1974-04-26 | 1980-02-07 | Bayer Ag, 5090 Leverkusen | Formmassen |
-
1974
- 1974-04-26 DE DE2420357A patent/DE2420357B2/de not_active Ceased
-
1975
- 1975-04-09 IN IN712/CAL/75A patent/IN143232B/en unknown
- 1975-04-22 US US05/570,996 patent/US4009227A/en not_active Expired - Lifetime
- 1975-04-24 IT IT49273/75A patent/IT1035447B/it active
- 1975-04-24 BE BE155709A patent/BE828318A/xx not_active IP Right Cessation
- 1975-04-24 AT AT315975A patent/AT335175B/de not_active IP Right Cessation
- 1975-04-24 CA CA225,588A patent/CA1052934A/en not_active Expired
- 1975-04-24 JP JP50049227A patent/JPS5743097B2/ja not_active Expired
- 1975-04-25 ES ES436998A patent/ES436998A1/es not_active Expired
- 1975-04-25 NL NLAANVRAGE7504968,A patent/NL179736B/xx not_active Application Discontinuation
- 1975-04-25 BR BR3228/75D patent/BR7502544A/pt unknown
- 1975-04-25 CH CH531775A patent/CH612207A5/xx not_active IP Right Cessation
- 1975-04-25 FR FR7513113A patent/FR2268832B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE828318A (fr) | 1975-10-24 |
| DE2420357A1 (de) | 1975-12-11 |
| NL179736B (nl) | 1986-06-02 |
| ATA315975A (de) | 1976-06-15 |
| DE2420357B2 (de) | 1980-02-07 |
| AT335175B (de) | 1977-02-25 |
| BR7502544A (pt) | 1976-03-03 |
| IT1035447B (it) | 1979-10-20 |
| US4009227A (en) | 1977-02-22 |
| JPS50144747A (enExample) | 1975-11-20 |
| NL7504968A (nl) | 1975-10-28 |
| FR2268832A1 (enExample) | 1975-11-21 |
| CH612207A5 (enExample) | 1979-07-13 |
| JPS5743097B2 (enExample) | 1982-09-13 |
| FR2268832B1 (enExample) | 1979-01-19 |
| ES436998A1 (es) | 1977-01-16 |
| IN143232B (enExample) | 1977-10-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1052934A (en) | Moulding compositions based on abs-graft polymers | |
| CA1049188A (en) | Thermoplastic moulding compositions based on abs-graft polymers | |
| US4605699A (en) | Thermoplastic molding compositions containing polycarbonate and an acrylate graft copolymer | |
| EP0077038B2 (en) | Process for producing impact resistant resins | |
| EP0277687B1 (en) | Rubber-reinforced monovinylidene aromatic polymer resins and a method for their preparation | |
| JPS6346106B2 (enExample) | ||
| CA2376451C (en) | Thermoplastic molding compounds | |
| AU775983B2 (en) | Monovinylidene aromatic polymers with improved properties and a process for their preparation | |
| EP0208382B1 (en) | Rubber-reinforced styrenic polymer resins having improved flow and gloss characteristics | |
| EP1414877A1 (en) | Monovinylidene aromatic polymers based on highly linear high molecular weight polybutadiene rubbers and a process for their preparation | |
| US4631307A (en) | Heat-resistant high impact styrene resin, process for production thereof, and resin composition comprising said styrene resin | |
| US4427832A (en) | Thermoplastic resin compositions | |
| US4144286A (en) | Thermoplastic PVC resin compositions | |
| US20040054077A1 (en) | Thermoplastic resin composition having excellent chemical resistance and easy vacuum formability | |
| CA1041245A (en) | Rubber modified high nitrile polymers and polymer blends produced thereby | |
| US5747587A (en) | HCFC resistant resin composition | |
| EP0076162B1 (en) | A process for producing a thermoplastic resin and a resin composition containing the same | |
| KR100340616B1 (ko) | 염화비닐계 수지 조성물 | |
| US4603169A (en) | Thermoplastic molding compositions containing polycarbonate and a graft copolymer of resin-forming monomers on a rubber | |
| AU2001259683A1 (en) | Monovinylidene aromatic polymers with improved toughness and rigidity and a process for their preparation | |
| WO2001094434A1 (en) | Monovinylidene aromatic polymers with improved toughness and rigidity and a process for their preparation | |
| US4395516A (en) | Thermoplastic resin compositions comprising copolymer of unsaturated dicarboxylic acid anhydride and vinyl aromatic monomer, ABS, and methylmethacrylate polymer | |
| US3751526A (en) | Process for producing impact resistant thermoplastic resins | |
| JPH08874B2 (ja) | 熱可塑性樹脂組成物 | |
| GB2073762A (en) | Process for preparing terpolymer polyblends having low surface gloss and certain terpolymer polyblend compositions |