CA1050551A - 1,1-diamino ethylene derivatives - Google Patents
1,1-diamino ethylene derivativesInfo
- Publication number
- CA1050551A CA1050551A CA200,137A CA200137A CA1050551A CA 1050551 A CA1050551 A CA 1050551A CA 200137 A CA200137 A CA 200137A CA 1050551 A CA1050551 A CA 1050551A
- Authority
- CA
- Canada
- Prior art keywords
- nitro
- ethylene
- ethylamino
- methyl
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- BSGRLBPZSRZQOR-UHFFFAOYSA-N ethene-1,1-diamine Chemical group NC(N)=C BSGRLBPZSRZQOR-UHFFFAOYSA-N 0.000 title claims abstract 5
- 238000000034 method Methods 0.000 claims abstract description 54
- 150000001875 compounds Chemical class 0.000 claims abstract description 50
- 239000000126 substance Substances 0.000 claims abstract description 16
- 239000005977 Ethylene Substances 0.000 claims description 50
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 49
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 23
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 23
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 20
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 18
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 claims description 13
- -1 2-thiazolylmethylthio Chemical group 0.000 claims description 13
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 13
- 238000002360 preparation method Methods 0.000 claims description 13
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 10
- 239000005864 Sulphur Substances 0.000 claims description 10
- 150000002431 hydrogen Chemical class 0.000 claims description 10
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 10
- NXGHEDHQXXXTTP-UHFFFAOYSA-N 1,1-bis(methylsulfanyl)-2-nitroethene Chemical group CSC(SC)=C[N+]([O-])=O NXGHEDHQXXXTTP-UHFFFAOYSA-N 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 9
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 9
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 claims description 8
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 claims description 7
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 125000002883 imidazolyl group Chemical group 0.000 claims description 5
- JEOZNMMOIBLWLV-UHFFFAOYSA-N 2-[(5-methyl-1h-imidazol-4-yl)methylsulfanyl]ethanamine Chemical compound CC=1N=CNC=1CSCCN JEOZNMMOIBLWLV-UHFFFAOYSA-N 0.000 claims description 4
- 101100037762 Caenorhabditis elegans rnh-2 gene Proteins 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 claims description 3
- 150000003852 triazoles Chemical class 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 229910052760 oxygen Chemical group 0.000 claims description 2
- 239000001301 oxygen Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 4
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims 4
- OHVKWZBKAWNPBK-UHFFFAOYSA-N 1-n'-[2-[(3-bromopyridin-2-yl)methylsulfanyl]ethyl]-1-n-methyl-2-nitroethene-1,1-diamine Chemical group [O-][N+](=O)C=C(NC)NCCSCC1=NC=CC=C1Br OHVKWZBKAWNPBK-UHFFFAOYSA-N 0.000 claims 2
- UUAXLCCQMQUBTB-UHFFFAOYSA-N 1-n,1-n'-bis[2-[(3-bromopyridin-2-yl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine Chemical group N=1C=CC=C(Br)C=1CSCCNC(=C[N+](=O)[O-])NCCSCC1=NC=CC=C1Br UUAXLCCQMQUBTB-UHFFFAOYSA-N 0.000 claims 2
- HEFSTZFKZGBJHW-UHFFFAOYSA-N 2-nitro-1-n,1-n'-bis[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethene-1,1-diamine Chemical group N=1C=CSC=1CSCCNC(=C[N+](=O)[O-])NCCSCC1=NC=CS1 HEFSTZFKZGBJHW-UHFFFAOYSA-N 0.000 claims 2
- AIAVBTROGNKBFP-UHFFFAOYSA-N 1-methylsulfanyl-2-nitro-n-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethenamine Chemical group [O-][N+](=O)C=C(SC)NCCSCC1=NC=CS1 AIAVBTROGNKBFP-UHFFFAOYSA-N 0.000 claims 1
- SFBOFXWBLWSFSM-UHFFFAOYSA-N 1-n,1-n'-bis[2-[(5-methyl-1h-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine Chemical group N1=CNC(CSCCNC(NCCSCC2=C(N=CN2)C)=C[N+]([O-])=O)=C1C SFBOFXWBLWSFSM-UHFFFAOYSA-N 0.000 claims 1
- DHXBCNRXZCWIBP-UHFFFAOYSA-N 1-n-methyl-1-n'-[2-[(5-methyl-1h-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine Chemical group [O-][N+](=O)C=C(NC)NCCSCC=1NC=NC=1C DHXBCNRXZCWIBP-UHFFFAOYSA-N 0.000 claims 1
- WFZLWBJWDHEACD-UHFFFAOYSA-N 1-n-methyl-2-nitro-1-n'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethene-1,1-diamine Chemical group [O-][N+](=O)C=C(NC)NCCSCC1=NC=CS1 WFZLWBJWDHEACD-UHFFFAOYSA-N 0.000 claims 1
- UMCHIQCDVOOJLO-UHFFFAOYSA-N 2-[(3-bromopyridin-2-yl)methylsulfanyl]ethanamine Chemical compound NCCSCC1=NC=CC=C1Br UMCHIQCDVOOJLO-UHFFFAOYSA-N 0.000 claims 1
- UZRDXAFNFDWMBE-UHFFFAOYSA-N n-[2-[(3-bromopyridin-2-yl)methylsulfanyl]ethyl]-1-methylsulfanyl-2-nitroethenamine Chemical group [O-][N+](=O)C=C(SC)NCCSCC1=NC=CC=C1Br UZRDXAFNFDWMBE-UHFFFAOYSA-N 0.000 claims 1
- MVCKONDSKZNVRK-UHFFFAOYSA-N n-[2-[(5-methyl-1h-imidazol-4-yl)methylsulfanyl]ethyl]-1-methylsulfanyl-2-nitroethenamine Chemical group [O-][N+](=O)C=C(SC)NCCSCC=1NC=NC=1C MVCKONDSKZNVRK-UHFFFAOYSA-N 0.000 claims 1
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 abstract description 18
- 229960001340 histamine Drugs 0.000 abstract description 9
- 102100021022 Gastrin Human genes 0.000 abstract description 2
- 108010052343 Gastrins Proteins 0.000 abstract description 2
- AOXOCDRNSPFDPE-UKEONUMOSA-N chembl413654 Chemical compound C([C@H](C(=O)NCC(=O)N[C@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@H](CCSC)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC=1C=CC=CC=1)C(N)=O)NC(=O)[C@@H](C)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H]1N(CCC1)C(=O)CNC(=O)[C@@H](N)CCC(O)=O)C1=CC=C(O)C=C1 AOXOCDRNSPFDPE-UKEONUMOSA-N 0.000 abstract description 2
- 239000003112 inhibitor Substances 0.000 abstract description 2
- 230000002401 inhibitory effect Effects 0.000 abstract description 2
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 40
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 17
- 238000006243 chemical reaction Methods 0.000 description 15
- 239000000243 solution Substances 0.000 description 15
- 239000000047 product Substances 0.000 description 14
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 13
- XEKOWRVHYACXOJ-UHFFFAOYSA-N ethyl acetate Substances CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 238000010828 elution Methods 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 229940093499 ethyl acetate Drugs 0.000 description 6
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 6
- 108020003175 receptors Proteins 0.000 description 6
- 102000005962 receptors Human genes 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- 239000004615 ingredient Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 239000002585 base Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 235000019439 ethyl acetate Nutrition 0.000 description 4
- 239000007903 gelatin capsule Substances 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical class C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 229940125715 antihistaminic agent Drugs 0.000 description 3
- 239000000739 antihistaminic agent Substances 0.000 description 3
- LJQKCYFTNDAAPC-UHFFFAOYSA-N ethanol;ethyl acetate Chemical compound CCO.CCOC(C)=O LJQKCYFTNDAAPC-UHFFFAOYSA-N 0.000 description 3
- 150000002460 imidazoles Chemical class 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- ZFCFFNGBCVAUDE-UHFFFAOYSA-N 2-(benzenesulfonyl)acetonitrile Chemical compound N#CCS(=O)(=O)C1=CC=CC=C1 ZFCFFNGBCVAUDE-UHFFFAOYSA-N 0.000 description 2
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 2
- 102000000543 Histamine Receptors Human genes 0.000 description 2
- 108010002059 Histamine Receptors Proteins 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- ZUCWUADHUDQXHX-UHFFFAOYSA-N but-1-en-2-amine Chemical group CCC(N)=C ZUCWUADHUDQXHX-UHFFFAOYSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- YECBIJXISLIIDS-UHFFFAOYSA-N mepyramine Chemical compound C1=CC(OC)=CC=C1CN(CCN(C)C)C1=CC=CC=N1 YECBIJXISLIIDS-UHFFFAOYSA-N 0.000 description 2
- 229960000582 mepyramine Drugs 0.000 description 2
- AMBKPYJJYUKNFI-UHFFFAOYSA-N methylsulfanylethene Chemical group CSC=C AMBKPYJJYUKNFI-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical compound O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- PCRDLOLMQZBQOC-UHFFFAOYSA-N 1-methylsulfanyl-2-nitro-n-[2-(pyridin-2-ylmethylsulfanyl)ethyl]ethenamine Chemical group [O-][N+](=O)C=C(SC)NCCSCC1=CC=CC=N1 PCRDLOLMQZBQOC-UHFFFAOYSA-N 0.000 description 1
- GKIUPDRWOXMZDT-UHFFFAOYSA-N 2-(1,2-thiazol-3-ylmethylsulfanyl)ethanamine Chemical compound NCCSCC=1C=CSN=1 GKIUPDRWOXMZDT-UHFFFAOYSA-N 0.000 description 1
- BUTQLNVJGRJSAE-UHFFFAOYSA-N 2-(1h-1,2,4-triazol-5-ylmethylsulfanyl)ethanamine Chemical compound NCCSCC=1N=CNN=1 BUTQLNVJGRJSAE-UHFFFAOYSA-N 0.000 description 1
- VWMUOSSNHJVPKI-UHFFFAOYSA-N 2-(3,4-dichlorophenyl)sulfonylacetonitrile Chemical compound ClC1=CC=C(S(=O)(=O)CC#N)C=C1Cl VWMUOSSNHJVPKI-UHFFFAOYSA-N 0.000 description 1
- CRBXIHDJWSZJIB-UHFFFAOYSA-N 2-(4-aminophenyl)sulfonylacetonitrile Chemical compound NC1=CC=C(S(=O)(=O)CC#N)C=C1 CRBXIHDJWSZJIB-UHFFFAOYSA-N 0.000 description 1
- HAQGVGPNKGGSMK-UHFFFAOYSA-N 2-(4-chlorophenyl)sulfonylacetonitrile Chemical compound ClC1=CC=C(S(=O)(=O)CC#N)C=C1 HAQGVGPNKGGSMK-UHFFFAOYSA-N 0.000 description 1
- BBNNLJMGPASZPD-UHFFFAOYSA-N 2-(4-methylphenyl)sulfonylacetonitrile Chemical compound CC1=CC=C(S(=O)(=O)CC#N)C=C1 BBNNLJMGPASZPD-UHFFFAOYSA-N 0.000 description 1
- XTYMVAZNONMQIS-UHFFFAOYSA-N 2-[2-[(1-methylsulfanyl-2-nitroethenyl)amino]ethylsulfanylmethyl]pyridin-3-ol Chemical group [O-][N+](=O)C=C(SC)NCCSCC1=NC=CC=C1O XTYMVAZNONMQIS-UHFFFAOYSA-N 0.000 description 1
- CVQIFLMXTXGREH-UHFFFAOYSA-N 2-[ethoxy(methylamino)methylidene]propanedinitrile Chemical group CCOC(NC)=C(C#N)C#N CVQIFLMXTXGREH-UHFFFAOYSA-N 0.000 description 1
- DQJLKSMNSNUNPD-UHFFFAOYSA-N 2-[methylamino(methylsulfanyl)methylidene]propanedinitrile Chemical group CNC(SC)=C(C#N)C#N DQJLKSMNSNUNPD-UHFFFAOYSA-N 0.000 description 1
- IMRWILPUOVGIMU-UHFFFAOYSA-N 2-bromopyridine Chemical compound BrC1=CC=CC=N1 IMRWILPUOVGIMU-UHFFFAOYSA-N 0.000 description 1
- NYPYPOZNGOXYSU-UHFFFAOYSA-N 3-bromopyridine Chemical compound BrC1=CC=CN=C1 NYPYPOZNGOXYSU-UHFFFAOYSA-N 0.000 description 1
- WWNBUBNALRCOHS-UHFFFAOYSA-N 3-ethoxy-3-(methylamino)prop-2-enenitrile Chemical group CCOC(NC)=CC#N WWNBUBNALRCOHS-UHFFFAOYSA-N 0.000 description 1
- VJSUMPPMFYQOMP-UHFFFAOYSA-N 4-(1h-imidazol-5-yl)butan-1-amine Chemical compound NCCCCC1=CNC=N1 VJSUMPPMFYQOMP-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 101150041968 CDC13 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 108010079943 Pentagastrin Proteins 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 241000534944 Thia Species 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 101000855453 Vespa orientalis Histamine-releasing peptide 2 Proteins 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000006309 butyl amino group Chemical group 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 210000004211 gastric acid Anatomy 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 210000002837 heart atrium Anatomy 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229940041476 lactose 100 mg Drugs 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 150000002689 maleic acids Chemical class 0.000 description 1
- CUONGYYJJVDODC-UHFFFAOYSA-N malononitrile Chemical compound N#CCC#N CUONGYYJJVDODC-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 101150009274 nhr-1 gene Proteins 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- OSDZHDOKXGSWOD-UHFFFAOYSA-N nitroxyl;hydrochloride Chemical compound Cl.O=N OSDZHDOKXGSWOD-UHFFFAOYSA-N 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- ANRIQLNBZQLTFV-DZUOILHNSA-N pentagastrin Chemical compound C([C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1[C]2C=CC=CC2=NC=1)NC(=O)CCNC(=O)OC(C)(C)C)CCSC)C(N)=O)C1=CC=CC=C1 ANRIQLNBZQLTFV-DZUOILHNSA-N 0.000 description 1
- 229960000444 pentagastrin Drugs 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/64—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms, e.g. histidine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/32—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/08—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/02—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D277/28—Radicals substituted by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/08—1,2,4-Thiadiazoles; Hydrogenated 1,2,4-thiadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/12—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles
- C07D285/125—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
- C07D285/135—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2356873A GB1421792A (en) | 1973-05-17 | 1973-05-17 | Heterocyclic substituted-1, 1-diamino-ethylene derivatives methods for their preparation and compositions containing them |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1050551A true CA1050551A (en) | 1979-03-13 |
Family
ID=10197791
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA200,137A Expired CA1050551A (en) | 1973-05-17 | 1974-05-16 | 1,1-diamino ethylene derivatives |
Country Status (29)
| Country | Link |
|---|---|
| US (3) | US3953460A (enExample) |
| JP (1) | JPS5040560A (enExample) |
| AR (1) | AR213262A1 (enExample) |
| AT (1) | AT334362B (enExample) |
| BE (1) | BE814941A (enExample) |
| BG (1) | BG25786A3 (enExample) |
| CA (1) | CA1050551A (enExample) |
| CS (1) | CS185654B2 (enExample) |
| DD (1) | DD113896A5 (enExample) |
| DE (1) | DE2423813A1 (enExample) |
| ES (1) | ES426405A1 (enExample) |
| FI (1) | FI151974A7 (enExample) |
| FR (1) | FR2229417B1 (enExample) |
| GB (1) | GB1421792A (enExample) |
| HU (1) | HU172300B (enExample) |
| IE (1) | IE39435B1 (enExample) |
| IL (1) | IL44752A (enExample) |
| IN (1) | IN141252B (enExample) |
| LU (1) | LU70104A1 (enExample) |
| MW (1) | MW1774A1 (enExample) |
| NL (1) | NL7406660A (enExample) |
| NO (1) | NO141407C (enExample) |
| PH (1) | PH11040A (enExample) |
| PL (1) | PL102353B1 (enExample) |
| RO (1) | RO69780A (enExample) |
| SE (1) | SE416049B (enExample) |
| SU (1) | SU537625A3 (enExample) |
| ZA (1) | ZA742650B (enExample) |
| ZM (1) | ZM7374A1 (enExample) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1554153A (en) * | 1975-05-15 | 1979-10-17 | Smith Kline French Lab | Process for making 2-amino-2-alkylthionitroethylenes |
| IL49528A (en) * | 1975-05-21 | 1980-11-30 | Smith Kline French Lab | Imidazolyl(or thiazolyl)methylthio(or butyl)guanidine or thiourea derivatives,their preparation and pharmaceutical compositions comprising them |
| US4192879A (en) * | 1975-05-21 | 1980-03-11 | Smith Kline & French Laboratories Limited | Imidazolyl alkylamino nitroethylene compounds |
| GB1564502A (en) | 1975-07-31 | 1980-04-10 | Smith Kline French Lab | Guanidines thioureas and 1,1-diamino-2-nitroethylene derivatives |
| US4169855A (en) * | 1976-08-04 | 1979-10-02 | Allen & Hansbury, Limited | N'-derivatives of n-(2-mercapto-ethyl)-2-nitro-1,1-ethenediamine |
| GB1565966A (en) | 1976-08-04 | 1980-04-23 | Allen & Hanburys Ltd | Aminoalkyl furan derivatives |
| US4165378A (en) | 1977-04-20 | 1979-08-21 | Ici Americas Inc. | Guanidine derivatives of imidazoles and thiazoles |
| NZ186965A (en) | 1977-04-20 | 1980-02-21 | Ici Ltd | Guanidino derivatives and pharmaceutical compositions |
| US4153704A (en) * | 1977-05-16 | 1979-05-08 | Smith Kline & French Laboratories Limited | Ethylene derivatives |
| GB1601459A (en) * | 1977-05-17 | 1981-10-28 | Allen & Hanburys Ltd | Aminoalkyl thiophene derivatives |
| IE46886B1 (en) * | 1977-05-17 | 1983-10-19 | Allen & Hanburys Ltd | Aminoalkyl-benzene derivatives |
| US4233302A (en) * | 1977-12-23 | 1980-11-11 | Glaxo Group Limited | Amine derivatives and pharmaceutical compositions containing them |
| EP0006679B1 (en) | 1978-05-24 | 1982-07-21 | Imperial Chemical Industries Plc | Antisecretory thiadiazole derivatives, processes for their manufacture and pharmaceutical compositions containing them |
| IL57415A (en) * | 1978-05-30 | 1984-08-31 | Smith Kline French Lab | Nitropyrrole compounds,process for preparing them and pharmaceutical compositions containing them |
| US4584384A (en) * | 1978-05-30 | 1986-04-22 | Smith Kline & French Laboratories Limited | Nitro pyrroles |
| IL57416A (en) * | 1978-05-30 | 1983-03-31 | Smith Kline French Lab | Nitro compounds,processes for preparing them and compositions containing them |
| US4200760A (en) * | 1978-09-26 | 1980-04-29 | Bristol-Myers Company | Imidazolylalkylthioalkylamino-ethylene derivatives |
| US4221737A (en) | 1978-09-26 | 1980-09-09 | Bristol-Myers Company | 1-(Alkynyl)amino-1-(mercaptoalkyl)amino ethylenes |
| US4282363A (en) * | 1978-11-24 | 1981-08-04 | Bristol-Myers Company | 1-Nitro-2-(2-alkynylamino)-2-[(2-pyridylmethylthio)-ethylamino]ethylene derivatives |
| US4289876A (en) * | 1978-11-24 | 1981-09-15 | Bristol-Myers Company | Antisecretory agents |
| US4250316A (en) * | 1978-11-24 | 1981-02-10 | Bristol-Myers Company | Pyridyl guanidine anti-ulcer agents |
| US4200578A (en) | 1978-12-18 | 1980-04-29 | Bristol-Myers Company | Thiazole derivatives |
| DE3069889D1 (en) | 1979-01-18 | 1985-02-14 | Ici Plc | Guanidine derivatives, processes for their manufacture and pharmaceutical compositions containing them |
| US4287346A (en) * | 1979-02-16 | 1981-09-01 | Eisai Co., Ltd. | Cyanoguanidine derivatives |
| US4220654A (en) * | 1979-06-04 | 1980-09-02 | Merck & Co., Inc. | Cyclic imidazole cyanoguanidines |
| FI803127A7 (fi) * | 1979-10-03 | 1981-04-04 | Glaxo Group Ltd | Heterosyklisiä yhdisteitä. |
| US4375547A (en) * | 1980-10-02 | 1983-03-01 | Eli Lilly And Company | N-Methyl-N'-2-([(2-dimethylaminomethyl)-4-thiazolyl]methylthio)ethyl 2-nitro-1,1-ethenediamine |
| US4382090A (en) * | 1980-10-02 | 1983-05-03 | Eli Lilly And Company | N-Thiazolylmethylthioalkyl-N'alkylamidines and related compounds |
| US4525477A (en) * | 1981-12-02 | 1985-06-25 | Smith Kline & French Laboratories Limited | 2-Thiazolyl, isothiazolyl, oxazolyl and isoxazolyl alkylamino-3-nitro-heterocyclic compounds |
| NZ202797A (en) * | 1981-12-28 | 1985-08-30 | Lilly Co Eli | Pyrimidine derivatives and pharmaceutical compositions |
| DE3232462A1 (de) * | 1982-09-01 | 1984-03-01 | Bayer Ag, 5090 Leverkusen | 2-nitro-1,1-ethendiamine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| AU2222083A (en) * | 1982-12-14 | 1984-06-21 | Smith Kline & French Laboratories Limited | Pyridine derivatives |
| DE3546858C2 (de) * | 1984-06-15 | 1995-04-20 | Glaxo Group Ltd | Verfahren zur Herstellung von Ranitidin |
| GB8415254D0 (en) * | 1984-06-15 | 1984-07-18 | Glaxo Group Ltd | Amine derivatives |
| JPH085859B2 (ja) * | 1986-07-01 | 1996-01-24 | 日本バイエルアグロケム株式会社 | 新規アルキレンジアミン類 |
| EP0285681B1 (de) * | 1987-04-06 | 1993-03-10 | HEUMANN PHARMA GMBH & CO | Verfahren zur Herstellung von Nitroethenderivaten |
| JP2001523220A (ja) * | 1996-08-06 | 2001-11-20 | スミスクライン・ビーチャム・コーポレイション | Il―8受容体アンタゴニスト |
| US5955548A (en) * | 1997-05-07 | 1999-09-21 | Novo Nordisk A/S | Substituted 3, 3-diamino-2-propenenitriles, their preparation and use |
| AU7331098A (en) * | 1997-05-07 | 1998-11-27 | Novo Nordisk A/S | Substituted 3,3-diamino-2-propenenitriles, their preparation and use |
| GB9715814D0 (en) | 1997-07-25 | 1997-10-01 | Black James Foundation | Histamine H3 receptor ligands |
| GB2344588B (en) * | 1997-07-25 | 2001-11-14 | Black James Foundation | 1H-4(5)-substituted imidazole derivatives their preparation and their use as histamine H 3 receptor ligands |
| KR100302348B1 (ko) * | 1999-04-24 | 2001-09-22 | 류덕희 | 니자티딘의 제조방법 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1078569A (en) * | 1962-12-06 | 1967-08-09 | Gen Aniline & Film Corp | Improvements in or relating to cyanoethylene compounds |
| US3404159A (en) * | 1966-12-19 | 1968-10-01 | Gaf Corp | Bis hetero methylene malononitriles |
| BE758146A (fr) * | 1969-10-29 | 1971-04-28 | Smith Kline French Lab | Derives de l'amidine |
| US3808336A (en) * | 1970-06-25 | 1974-04-30 | Smithkline Corp | Pharmaceutical compositions and methods of inhibiting histamine activity with thiourea derivatives |
| US3734924A (en) * | 1970-10-14 | 1973-05-22 | Smith Kline French Lab | Carboxamidines |
| US3905984A (en) * | 1971-03-09 | 1975-09-16 | Smith Kline French Lab | Pyridyl substituted thioalkyl-and oxyalkyl-thioureas and ureas |
| GB1338169A (en) * | 1971-03-09 | 1973-11-21 | Smith Kline French Lab | Ureas thioureas and guanidines |
| GB1397436A (en) * | 1972-09-05 | 1975-06-11 | Smith Kline French Lab | Heterocyclic n-cyanoguinidines |
-
1973
- 1973-05-17 GB GB2356873A patent/GB1421792A/en not_active Expired
-
1974
- 1974-04-23 IN IN916/CAL/74A patent/IN141252B/en unknown
- 1974-04-25 ZA ZA00742650A patent/ZA742650B/xx unknown
- 1974-04-30 MW MW17/74*UA patent/MW1774A1/xx unknown
- 1974-05-02 IL IL44752A patent/IL44752A/xx unknown
- 1974-05-06 PL PL1974171110A patent/PL102353B1/pl unknown
- 1974-05-06 ZM ZM73/74A patent/ZM7374A1/xx unknown
- 1974-05-09 US US05/468,617 patent/US3953460A/en not_active Expired - Lifetime
- 1974-05-10 PH PH15821A patent/PH11040A/en unknown
- 1974-05-13 AT AT392974A patent/AT334362B/de not_active IP Right Cessation
- 1974-05-13 BE BE144247A patent/BE814941A/xx not_active IP Right Cessation
- 1974-05-15 CS CS7400003473A patent/CS185654B2/cs unknown
- 1974-05-15 SE SE7406472A patent/SE416049B/sv not_active IP Right Cessation
- 1974-05-15 DD DD178521A patent/DD113896A5/xx unknown
- 1974-05-16 SU SU2025129A patent/SU537625A3/ru active
- 1974-05-16 FI FI1519/74A patent/FI151974A7/fi unknown
- 1974-05-16 LU LU70104A patent/LU70104A1/xx unknown
- 1974-05-16 CA CA200,137A patent/CA1050551A/en not_active Expired
- 1974-05-16 NO NO741815A patent/NO141407C/no unknown
- 1974-05-16 DE DE2423813A patent/DE2423813A1/de not_active Withdrawn
- 1974-05-16 HU HU74SI00001406A patent/HU172300B/hu unknown
- 1974-05-16 JP JP49055300A patent/JPS5040560A/ja active Pending
- 1974-05-17 NL NL7406660A patent/NL7406660A/xx not_active Application Discontinuation
- 1974-05-17 ES ES426405A patent/ES426405A1/es not_active Expired
- 1974-05-17 AR AR253803A patent/AR213262A1/es active
- 1974-05-17 IE IE1052/74A patent/IE39435B1/xx unknown
- 1974-05-17 RO RO7478828A patent/RO69780A/ro unknown
- 1974-05-17 BG BG026720A patent/BG25786A3/xx unknown
- 1974-05-17 FR FR7417347A patent/FR2229417B1/fr not_active Expired
-
1980
- 1980-02-04 US US06/117,901 patent/US4317829A/en not_active Expired - Lifetime
- 1980-02-04 US US06/117,903 patent/US4284640A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1050551A (en) | 1,1-diamino ethylene derivatives | |
| US4034101A (en) | N-Oxy and N-amino guanidines | |
| US4112104A (en) | Pharmacologically active compounds | |
| US4499101A (en) | Pharmacologically active isoxazole and triazole compounds | |
| US4062863A (en) | Pharmacologically active cyclo butenediones | |
| US4578388A (en) | Unsymmetrical guanidino, thioureido, isothioureido and nitromethyleneamino derivatives | |
| CA1053242A (en) | Heterocyclic guanidine derivatives | |
| US3975530A (en) | N-cyano-N'-heterocyclic-alkyl quanidine inhibitors of H2 histamine receptors | |
| US4265896A (en) | Amidinosulphonic acid derivatives | |
| USRE29761E (en) | Guanidino, thioureido and isothioureido derivatives containing imidazole groups | |
| US4395419A (en) | Pharmacologically active compounds | |
| US4000296A (en) | Imidazole alkylguanidine compounds | |
| US4372963A (en) | Oxazolyl, isoxazolyl, triazolyl and thiadiazolyl alkyl bisamidines | |
| US4038408A (en) | Certain thiazolyl and isothiazolyl compounds and compositions and methods which employ them | |
| US4024260A (en) | Ethylene derivatives | |
| US4277485A (en) | Oxazole or isoxazole alkylamino ethylene compounds as inhibitors of H-2 histamine receptors | |
| US4046907A (en) | Imidazole alkylaminoethylene compounds | |
| US4083988A (en) | Pharmacologically active compounds | |
| US4137319A (en) | Guanidino, thioureido, isothioureido and nitrovinylamino derivatives of pyridine | |
| US4152443A (en) | Imidazolyl thioureas, ureas and guanidines | |
| US4215125A (en) | Pyridyl ureas, thioureas and guanidines | |
| US4124717A (en) | Thiazolyl alkylaminoethylene compounds | |
| US4093729A (en) | N-Oxy and N-amino guanidines | |
| US4220652A (en) | Isothiazolyl alkylaminoethylene compounds | |
| US4129657A (en) | Imidazole guanidines and use as inhibitors of histamine activity |