CA1040639A - 1,2,4-triazole derivatives, process for their production and their use as fungicides - Google Patents
1,2,4-triazole derivatives, process for their production and their use as fungicidesInfo
- Publication number
- CA1040639A CA1040639A CA160,943A CA160943A CA1040639A CA 1040639 A CA1040639 A CA 1040639A CA 160943 A CA160943 A CA 160943A CA 1040639 A CA1040639 A CA 1040639A
- Authority
- CA
- Canada
- Prior art keywords
- carbon atoms
- compound
- radical
- dimethyl
- butan
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 29
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical class C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 title claims description 14
- 239000000417 fungicide Substances 0.000 title claims description 4
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- -1 1-substituted-1,2,4-triazoles Chemical class 0.000 claims abstract description 39
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 19
- 239000001257 hydrogen Substances 0.000 claims abstract description 19
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 17
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 13
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 11
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 10
- 125000000392 cycloalkenyl group Chemical group 0.000 claims abstract description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 10
- 125000000468 ketone group Chemical group 0.000 claims abstract description 10
- 230000000855 fungicidal effect Effects 0.000 claims abstract description 5
- 125000003107 substituted aryl group Chemical group 0.000 claims abstract 6
- 150000001875 compounds Chemical class 0.000 claims description 116
- 125000004432 carbon atom Chemical group C* 0.000 claims description 30
- 238000006243 chemical reaction Methods 0.000 claims description 20
- 241000233866 Fungi Species 0.000 claims description 18
- 239000003085 diluting agent Substances 0.000 claims description 15
- 125000003118 aryl group Chemical group 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 10
- 125000005843 halogen group Chemical group 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- BWSWPOJRYCYBRQ-UHFFFAOYSA-N 4h-1,2,4-triazol-4-ium;chloride Chemical compound Cl.C=1N=CNN=1 BWSWPOJRYCYBRQ-UHFFFAOYSA-N 0.000 claims description 6
- 150000003254 radicals Chemical class 0.000 claims description 5
- 239000002689 soil Substances 0.000 claims description 5
- 150000005840 aryl radicals Chemical class 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 150000002431 hydrogen Chemical group 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- 125000004995 haloalkylthio group Chemical group 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 125000004441 haloalkylsulfonyl group Chemical group 0.000 claims 1
- 239000000460 chlorine Substances 0.000 description 62
- 241000196324 Embryophyta Species 0.000 description 36
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 32
- 239000002904 solvent Substances 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- 208000015181 infectious disease Diseases 0.000 description 19
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- 239000007788 liquid Substances 0.000 description 17
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 16
- 229910052799 carbon Inorganic materials 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- 241000220225 Malus Species 0.000 description 13
- 238000002844 melting Methods 0.000 description 13
- 230000008018 melting Effects 0.000 description 13
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 13
- 239000002253 acid Substances 0.000 description 11
- 150000001721 carbon Chemical group 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 238000009835 boiling Methods 0.000 description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 8
- 125000002877 alkyl aryl group Chemical group 0.000 description 7
- 239000012141 concentrate Substances 0.000 description 7
- 235000008504 concentrate Nutrition 0.000 description 7
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 239000010695 polyglycol Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- PJGSXYOJTGTZAV-UHFFFAOYSA-N pinacolone Chemical compound CC(=O)C(C)(C)C PJGSXYOJTGTZAV-UHFFFAOYSA-N 0.000 description 6
- 229920000151 polyglycol Polymers 0.000 description 6
- 230000001681 protective effect Effects 0.000 description 6
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000007921 spray Substances 0.000 description 6
- 240000008067 Cucumis sativus Species 0.000 description 5
- 206010039509 Scab Diseases 0.000 description 5
- 238000007792 addition Methods 0.000 description 5
- 125000004429 atom Chemical group 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 241000894007 species Species 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- 241000489964 Fusicladium Species 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- 229940052303 ethers for general anesthesia Drugs 0.000 description 4
- 238000011081 inoculation Methods 0.000 description 4
- 150000002576 ketones Chemical class 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 241000221787 Erysiphe Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000003377 acid catalyst Substances 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 230000031709 bromination Effects 0.000 description 3
- 238000005893 bromination reaction Methods 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- AQXYNOCATSFWSN-UHFFFAOYSA-N 1-bromo-3,3-dimethyl-1-phenylbutan-2-one Chemical compound CC(C)(C)C(=O)C(Br)C1=CC=CC=C1 AQXYNOCATSFWSN-UHFFFAOYSA-N 0.000 description 2
- YIKWKLYQRFRGPM-UHFFFAOYSA-N 1-dodecylguanidine acetate Chemical compound CC(O)=O.CCCCCCCCCCCCN=C(N)N YIKWKLYQRFRGPM-UHFFFAOYSA-N 0.000 description 2
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000221785 Erysiphales Species 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 229930194542 Keto Natural products 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 229950005499 carbon tetrachloride Drugs 0.000 description 2
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000012024 dehydrating agents Substances 0.000 description 2
- 229960004132 diethyl ether Drugs 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 150000003948 formamides Chemical class 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- XTEGVFVZDVNBPF-UHFFFAOYSA-N naphthalene-1,5-disulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1S(O)(=O)=O XTEGVFVZDVNBPF-UHFFFAOYSA-N 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 244000052769 pathogen Species 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000003495 polar organic solvent Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000011814 protection agent Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- PVRXXOJVVPDUMX-UHFFFAOYSA-N 1,1-bis(4-chlorophenoxy)-3,3-dimethylbutan-2-one Chemical compound C=1C=C(Cl)C=CC=1OC(C(=O)C(C)(C)C)OC1=CC=C(Cl)C=C1 PVRXXOJVVPDUMX-UHFFFAOYSA-N 0.000 description 1
- 150000000178 1,2,4-triazoles Chemical class 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- QGSJVMUQCRYUIZ-UHFFFAOYSA-N 1-(2,4-dichlorophenoxy)-3,3-dimethylbutan-2-one Chemical compound CC(C)(C)C(=O)COC1=CC=C(Cl)C=C1Cl QGSJVMUQCRYUIZ-UHFFFAOYSA-N 0.000 description 1
- RWPBXPXCYKTQSL-UHFFFAOYSA-N 1-bromo-3,3-dimethyl-1-[4-(trifluoromethyl)phenoxy]butan-2-one Chemical compound CC(C)(C)C(=O)C(Br)OC1=CC=C(C(F)(F)F)C=C1 RWPBXPXCYKTQSL-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- HAGYXNVNFOULKK-UHFFFAOYSA-N 1-trityl-1,2,4-triazole Chemical compound N1=CN=CN1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 HAGYXNVNFOULKK-UHFFFAOYSA-N 0.000 description 1
- HFZWRUODUSTPEG-UHFFFAOYSA-N 2,4-dichlorophenol Chemical compound OC1=CC=C(Cl)C=C1Cl HFZWRUODUSTPEG-UHFFFAOYSA-N 0.000 description 1
- UFQBSPGKRRSATO-UHFFFAOYSA-N 3,3-dimethoxybutan-2-one Chemical compound COC(C)(OC)C(C)=O UFQBSPGKRRSATO-UHFFFAOYSA-N 0.000 description 1
- XPHFHIMIUFOEEN-UHFFFAOYSA-N 3,3-dimethyl-1-phenylbutan-2-one Chemical compound CC(C)(C)C(=O)CC1=CC=CC=C1 XPHFHIMIUFOEEN-UHFFFAOYSA-N 0.000 description 1
- DRSZTATWOSZRAK-UHFFFAOYSA-N 3,4-dibromobutan-2-one Chemical compound CC(=O)C(Br)CBr DRSZTATWOSZRAK-UHFFFAOYSA-N 0.000 description 1
- XYYXDARQOHWBPO-UHFFFAOYSA-N 3,5-dimethyl-1h-1,2,4-triazole Chemical compound CC1=NNC(C)=N1 XYYXDARQOHWBPO-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- OBSRYHNPNYENOM-UHFFFAOYSA-N 4,4-diethoxy-2,5-dimethylhexan-3-one Chemical compound CCOC(OCC)(C(C)C)C(=O)C(C)C OBSRYHNPNYENOM-UHFFFAOYSA-N 0.000 description 1
- KWFRNVTUTFPAFY-UHFFFAOYSA-N 4,4-dimethoxy-2,5-dimethylhexan-3-one Chemical compound COC(OC)(C(C)C)C(=O)C(C)C KWFRNVTUTFPAFY-UHFFFAOYSA-N 0.000 description 1
- SCWBSTVOWDDYHH-UHFFFAOYSA-N 4-amino-2,6-dichlorophenol;4-aminophenol Chemical compound NC1=CC=C(O)C=C1.NC1=CC(Cl)=C(O)C(Cl)=C1 SCWBSTVOWDDYHH-UHFFFAOYSA-N 0.000 description 1
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 description 1
- QGOUKZPSCTVYLX-UHFFFAOYSA-N 5-chloro-1h-1,2,4-triazole Chemical compound ClC1=NC=NN1 QGOUKZPSCTVYLX-UHFFFAOYSA-N 0.000 description 1
- PZKFSRWSQOQYNR-UHFFFAOYSA-N 5-methyl-1h-1,2,4-triazole Chemical compound CC1=NC=NN1 PZKFSRWSQOQYNR-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- 241000575946 Ione Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- LTXREWYXXSTFRX-QGZVFWFLSA-N Linagliptin Chemical compound N=1C=2N(C)C(=O)N(CC=3N=C4C=CC=CC4=C(C)N=3)C(=O)C=2N(CC#CC)C=1N1CCC[C@@H](N)C1 LTXREWYXXSTFRX-QGZVFWFLSA-N 0.000 description 1
- GXCLVBGFBYZDAG-UHFFFAOYSA-N N-[2-(1H-indol-3-yl)ethyl]-N-methylprop-2-en-1-amine Chemical compound CN(CCC1=CNC2=C1C=CC=C2)CC=C GXCLVBGFBYZDAG-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 241001223281 Peronospora Species 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 241000233614 Phytophthora Species 0.000 description 1
- 241000514450 Podocarpus latifolius Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000022563 Rema Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241001617088 Thanatephorus sasakii Species 0.000 description 1
- 241000722133 Tilletia Species 0.000 description 1
- 241000031845 Tilletia laevis Species 0.000 description 1
- 241000135164 Timea Species 0.000 description 1
- 241000317942 Venturia <ichneumonid wasp> Species 0.000 description 1
- 241000228452 Venturia inaequalis Species 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 1
- 150000003973 alkyl amines Chemical group 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 150000003974 aralkylamines Chemical class 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 150000004035 chlorins Chemical class 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 125000005283 haloketone group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 235000013847 iso-butane Nutrition 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000004971 nitroalkyl group Chemical group 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 229940031826 phenolate Drugs 0.000 description 1
- HCTVWSOKIJULET-LQDWTQKMSA-M phenoxymethylpenicillin potassium Chemical compound [K+].N([C@H]1[C@H]2SC([C@@H](N2C1=O)C([O-])=O)(C)C)C(=O)COC1=CC=CC=C1 HCTVWSOKIJULET-LQDWTQKMSA-M 0.000 description 1
- JAMNHZBIQDNHMM-UHFFFAOYSA-N pivalonitrile Chemical compound CC(C)(C)C#N JAMNHZBIQDNHMM-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- BYOIUZNBVLCMNV-UHFFFAOYSA-M sodium;2,4-dichlorophenolate Chemical compound [Na+].[O-]C1=CC=C(Cl)C=C1Cl BYOIUZNBVLCMNV-UHFFFAOYSA-M 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/63—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by introduction of halogen; by substitution of halogen atoms by other halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/20—Unsaturated compounds containing keto groups bound to acyclic carbon atoms
- C07C49/213—Unsaturated compounds containing keto groups bound to acyclic carbon atoms containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722201063 DE2201063C3 (de) | 1972-01-11 | 1,2,4-Triazol-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1040639A true CA1040639A (en) | 1978-10-17 |
Family
ID=5832691
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA160,943A Expired CA1040639A (en) | 1972-01-11 | 1973-01-10 | 1,2,4-triazole derivatives, process for their production and their use as fungicides |
Country Status (31)
Families Citing this family (88)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4048318A (en) * | 1972-01-11 | 1977-09-13 | Bayer Aktiengesellschaft | 1-Substituted-1,2,4-triazole fungicides |
| US4147791A (en) * | 1972-01-11 | 1979-04-03 | Bayer Aktiengesellschaft | 1-Substituted-1,2,4-triazole fungicidal compositions and methods for combatting fungi that infect or attack plants |
| DE2247186A1 (de) * | 1972-09-26 | 1974-03-28 | Bayer Ag | Antimykotisches mittel |
| DE2350122C2 (de) * | 1973-10-05 | 1982-06-24 | Bayer Ag, 5090 Leverkusen | 1-Propyl-1,2,4-triazolyl-Derivate und deren Salze, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide |
| DE2406665C3 (de) * | 1974-02-12 | 1978-11-16 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von 1,2,4-Triazol-Derivaten |
| DE2423987C2 (de) * | 1974-05-17 | 1986-01-16 | Bayer Ag, 5090 Leverkusen | Metallkomplexe von Azolyläthern, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
| DE2431073A1 (de) * | 1974-06-28 | 1976-01-15 | Bayer Ag | Fungizides mittel |
| DE2431407C2 (de) * | 1974-06-29 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | 1,2,4-Triazol-1-yl-alkanone und -alkanole, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
| DE2455955A1 (de) * | 1974-11-27 | 1976-08-12 | Bayer Ag | Fungizide mittel |
| US4079143A (en) * | 1975-08-26 | 1978-03-14 | Imperial Chemical Industries Limited | Fungicidal 1H-1,2,4-triazoles |
| NZ181916A (en) * | 1975-09-10 | 1979-01-11 | Ici Ltd | 1-substituted-1,2,4-triazoles and fungicidal compositions |
| US4178383A (en) * | 1976-05-28 | 1979-12-11 | Bayer Aktiengesellschaft | Fungicidally active oxime-ethers of isonitrosocyanoacetamides |
| NZ184268A (en) * | 1976-06-08 | 1979-03-16 | Ici Ltd | 1,2,4-triazd-1-yl-alkone-diones derivatives and fungicidal and plant growth regulating compositions |
| GB1533375A (en) * | 1976-07-20 | 1978-11-22 | Bayer Ag | Halogenated 1-azolyl-butane derivatives and their use as fungicides |
| US4284639A (en) * | 1977-02-11 | 1981-08-18 | Bayer Aktiengesellschaft | Combating fungi with 1-phenoxy-2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-1-yl)-ethan-2-ones and -ols |
| GB1596380A (en) * | 1977-03-28 | 1981-08-26 | Lilly Industries Ltd | Fungicidal combinations |
| DE2713777C3 (de) * | 1977-03-29 | 1979-10-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von l-Azolyl-33-dimethyl-l-phenoxy-butan-2-onen |
| IL56234A (en) * | 1977-12-27 | 1983-11-30 | Lilly Co Eli | Synergistic fungicidal compositions comprising a triazole derivative together with other active compounds |
| CS217978B2 (en) * | 1978-04-01 | 1983-02-25 | Lilly Industries Ltd | Fungicide means |
| DE2846038A1 (de) * | 1978-10-23 | 1980-05-08 | Basf Ag | 1,2,4-triazolderivate, ihre herstellung und verwendung |
| DE2846127A1 (de) * | 1978-10-23 | 1980-04-30 | Basf Ag | 1,2,4-triazol-1-yl-verbindungen, ihre hersttellung und verwendung als fungizide |
| US4554007A (en) * | 1979-03-20 | 1985-11-19 | Sumitomo Chemical Company, Limited | Geometrical isomer of 1-substituted-1-triazolylstyrenes, and their production and use as fungicide, herbicide and/or plant growth regulant |
| DE2926280A1 (de) * | 1979-06-29 | 1981-01-08 | Basf Ag | Fungizide alpha -triazolylglykolderivate, ihre herstellung und verwendung |
| DE2931778A1 (de) * | 1979-08-04 | 1981-02-19 | Bayer Ag | Antimikrobielle mittel |
| DE3008477A1 (de) * | 1980-03-05 | 1981-09-17 | Bayer Ag, 5090 Leverkusen | 3,3-dimethyl-1-phenoxy-butan-2-ole, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukte |
| DE3012824A1 (de) * | 1980-04-02 | 1981-10-08 | Bayer Ag, 5090 Leverkusen | Triazolyl-benzyloxy-ketone und -carbinole, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| DE3021551A1 (de) * | 1980-06-07 | 1981-12-24 | Bayer Ag, 5090 Leverkusen | 4-substituierte 1-azolyl-1-phenoxy-3,3-dimethyl-butan-2-one und -ole, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| JPS5758671A (en) * | 1980-09-25 | 1982-04-08 | Ishihara Sangyo Kaisha Ltd | Phenoxyalkylazole type compound and agricultural and gardening fungicide comprising it |
| US4496551A (en) * | 1981-06-24 | 1985-01-29 | E. I. Du Pont De Nemours And Company | Fungicidal imidazole derivatives |
| US4510136A (en) * | 1981-06-24 | 1985-04-09 | E. I. Du Pont De Nemours And Company | Fungicidal 1,2,4-triazole derivatives |
| DE3150204A1 (de) * | 1981-12-18 | 1983-06-30 | Basf Ag, 6700 Ludwigshafen | Fungizide alpha-azolylglykole |
| DE3208142A1 (de) * | 1982-03-06 | 1983-09-08 | Bayer Ag, 5090 Leverkusen | Fungizide mittel |
| ATE30322T1 (de) * | 1982-04-01 | 1987-11-15 | Schering Agrochemicals Ltd | Heterocyclische pilztoetende und wachstumsregulierende verbindungen und diese enthaltende zusammensetzungen. |
| DE3234625A1 (de) * | 1982-09-18 | 1984-03-22 | Bayer Ag, 5090 Leverkusen | Fungizide mittel |
| DE3234624A1 (de) * | 1982-09-18 | 1984-03-22 | Bayer Ag, 5090 Leverkusen | Fungizide mittel |
| US4530922A (en) * | 1984-01-03 | 1985-07-23 | E. I. Du Pont De Nemours And Company | Fungicidal imidazoles and triazoles containing silicon |
| DE3540523A1 (de) * | 1985-11-15 | 1987-05-27 | Bayer Ag | Azolyletherketone und -alkohole |
| US4642385A (en) * | 1985-11-19 | 1987-02-10 | Mobay Corporation | Preparation of monochloropinacolone |
| WO1988007813A1 (en) * | 1987-04-14 | 1988-10-20 | Greencare Pty. Limited | Soil spreader |
| DE3900347A1 (de) * | 1989-01-07 | 1990-07-12 | Basf Ag | 1-hydroxy-1,2,4-triazole |
| DE3905766A1 (de) * | 1989-02-24 | 1990-08-30 | Basf Ag | 0-(1,2,4-triazolyl-1)-0-phenyl-acetale und diese enthaltende fungizide |
| US4970320A (en) * | 1990-01-24 | 1990-11-13 | Mobay Corporation | Preparation of phenoxy-triazolyl-pinacol-ones |
| DE4426753A1 (de) | 1994-07-28 | 1996-02-01 | Bayer Ag | Mittel zur Bekämpfung von Pflanzenschädlingen |
| DE19505938A1 (de) * | 1995-02-21 | 1996-08-22 | Bayer Ag | Verfahren zur Herstellung von 1-(4-Chlorphenyl)-4,4-dimethyl-pentan-3-on |
| DE19529091A1 (de) * | 1995-08-08 | 1997-02-13 | Bayer Ag | Mercapto-triazolyl-ketone |
| US5696150A (en) * | 1995-09-21 | 1997-12-09 | Bayer Aktiengesellschaft | Fungicidal active compound combinations |
| MD685G2 (ro) * | 1996-04-19 | 1997-10-31 | Sumitomo Chemical Company, Limited | Procedeu de protecţie al plantelor de fitopatogeni |
| DE19617282A1 (de) * | 1996-04-30 | 1997-11-06 | Bayer Ag | Triazolyl-mercaptide |
| DE19617461A1 (de) | 1996-05-02 | 1997-11-06 | Bayer Ag | Acylmercapto-triazolyl-Derivate |
| DE19619544A1 (de) * | 1996-05-15 | 1997-11-20 | Bayer Ag | Triazolyl-Disulfide |
| DE19620408A1 (de) * | 1996-05-21 | 1997-11-27 | Bayer Ag | Mercapto-imidazolyl-Derivate |
| DE19620407A1 (de) * | 1996-05-21 | 1997-11-27 | Bayer Ag | Thiocyano-triazolyl-Derivate |
| DE19620590A1 (de) * | 1996-05-22 | 1997-11-27 | Bayer Ag | Sulfonyl-mercapto-triazolyl-Derivate |
| DE19716257A1 (de) | 1997-04-18 | 1998-10-22 | Bayer Ag | Fungizide Wirkstoffkombination |
| US6297236B1 (en) | 1998-04-06 | 2001-10-02 | Bayer Aktiengesellschaft | Fungicide active substance combinations |
| US6216388B1 (en) | 1998-04-07 | 2001-04-17 | Gene W. Miller | Dissolving polymer plug for introducing nutrients and medicinal materials into tree trunks |
| DE59912987D1 (de) * | 1998-06-10 | 2006-02-02 | Bayer Cropscience Ag | Mittel zur bekämpfung von pflanzenschädlingen |
| HK1039034B (zh) * | 1998-06-17 | 2005-07-22 | 拜尔公司 | 防治植物害蟲的組合物 |
| PL200668B1 (pl) | 1999-12-13 | 2009-01-30 | Bayer Ag | Kombinacje substancji aktywnych, zastosowanie tych kombinacji i sposób wytwarzania środków grzybobójczych |
| DE10019758A1 (de) * | 2000-04-20 | 2001-10-25 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| DE10103832A1 (de) * | 2000-05-11 | 2001-11-15 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| DE10141618A1 (de) * | 2001-08-24 | 2003-03-06 | Bayer Cropscience Ag | Fungizide Wirkstoffkombinationen |
| DE10347090A1 (de) | 2003-10-10 | 2005-05-04 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE10349501A1 (de) | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| PT1744629E (pt) | 2004-04-30 | 2013-01-31 | Basf Se | Misturas fungicidas |
| DE102005015677A1 (de) * | 2005-04-06 | 2006-10-12 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE102005035300A1 (de) * | 2005-07-28 | 2007-02-01 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE102006023263A1 (de) | 2006-05-18 | 2007-11-22 | Bayer Cropscience Ag | Synergistische Wirkstoffkombinationen |
| EP2000028A1 (de) * | 2007-06-06 | 2008-12-10 | Bayer CropScience Aktiengesellschaft | Fungizide Wirkstoffkombinationen |
| BRPI0817285A2 (pt) | 2007-09-26 | 2014-10-07 | Basf Se | Composição fungicida, agente fungicida, método para o controle de fundos nocivos fitopatogênicos, sememte, e, uso de boscalida, clorotalonila e um composto |
| EP2219459A2 (en) * | 2007-11-16 | 2010-08-25 | Basf Se | Fungicidal mixtures iii |
| US9012360B2 (en) | 2009-03-25 | 2015-04-21 | Bayer Intellectual Property Gmbh | Synergistic combinations of active ingredients |
| WO2011026796A1 (en) | 2009-09-01 | 2011-03-10 | Basf Se | Synergistic fungicidal mixtures comprising lactylates and method for combating phytopathogenic fungi |
| WO2012084670A1 (en) | 2010-12-20 | 2012-06-28 | Basf Se | Pesticidal active mixtures comprising pyrazole compounds |
| CN102017956A (zh) * | 2011-01-08 | 2011-04-20 | 陕西美邦农药有限公司 | 一种含联苯三唑醇的农药组合物 |
| EP2481284A3 (en) | 2011-01-27 | 2012-10-17 | Basf Se | Pesticidal mixtures |
| CN103442567B (zh) | 2011-03-23 | 2016-02-10 | 巴斯夫欧洲公司 | 含有包含咪唑鎓基团的聚合离子型化合物的组合物 |
| CN103987261A (zh) | 2011-09-02 | 2014-08-13 | 巴斯夫欧洲公司 | 包含芳基喹唑啉酮化合物的农业混合物 |
| JP6279563B2 (ja) | 2012-06-20 | 2018-02-14 | ビーエーエスエフ ソシエタス・ヨーロピアBasf Se | ピラゾール化合物およびピラゾール化合物を含む殺有害生物性混合物 |
| US20150257383A1 (en) | 2012-10-12 | 2015-09-17 | Basf Se | Method for combating phytopathogenic harmful microbes on cultivated plants or plant propagation material |
| CA2894264C (en) | 2012-12-20 | 2023-03-07 | BASF Agro B.V. | Compositions comprising a triazole compound |
| EP2783569A1 (en) | 2013-03-28 | 2014-10-01 | Basf Se | Compositions comprising a triazole compound |
| EP2835052A1 (en) | 2013-08-07 | 2015-02-11 | Basf Se | Fungicidal mixtures comprising pyrimidine fungicides |
| US20160221964A1 (en) | 2013-09-16 | 2016-08-04 | Basf Se | Fungicidal pyrimidine compounds |
| WO2015036059A1 (en) | 2013-09-16 | 2015-03-19 | Basf Se | Fungicidal pyrimidine compounds |
| EP2979549A1 (en) | 2014-07-31 | 2016-02-03 | Basf Se | Method for improving the health of a plant |
| WO2016062880A2 (de) | 2014-10-24 | 2016-04-28 | Basf Se | Nicht-ampholytische, quaternierbare und wasserlösliche polymere zur modifikation der oberflächenladung fester teilchen |
| TW202017567A (zh) | 2018-06-21 | 2020-05-16 | 美商優曼尼蒂治療股份有限公司 | 用於治療及預防神經病症之組成物及方法 |
-
1972
- 1972-12-27 US US318963A patent/US3912752A/en not_active Expired - Lifetime
-
1973
- 1973-01-08 IL IL7341252A patent/IL41252A/en unknown
- 1973-01-08 CS CS159A patent/CS177115B2/cs unknown
- 1973-01-08 BR BR73150A patent/BR7300150D0/pt unknown
- 1973-01-09 SU SU731865673A patent/SU648045A3/ru active
- 1973-01-09 NL NLAANVRAGE7300301,A patent/NL169590C/xx not_active IP Right Cessation
- 1973-01-09 PL PL1973160204A patent/PL89104B1/pl unknown
- 1973-01-09 CH CH24073A patent/CH587012A5/xx not_active IP Right Cessation
- 1973-01-09 FI FI50/73A patent/FI54115C/fi active
- 1973-01-09 AT AT16873A patent/AT320346B/de not_active IP Right Cessation
- 1973-01-09 IT IT19103/73A patent/IT978067B/it active
- 1973-01-09 TR TR17313A patent/TR17313A/xx unknown
- 1973-01-10 RO RO7300073442A patent/RO62857A/ro unknown
- 1973-01-10 ZA ZA730180A patent/ZA73180B/xx unknown
- 1973-01-10 DK DK13073A patent/DK139226C/da not_active IP Right Cessation
- 1973-01-10 GB GB127273A patent/GB1364619A/en not_active Expired
- 1973-01-10 YU YU51/73A patent/YU39521B/xx unknown
- 1973-01-10 DD DD168174A patent/DD104903A5/xx unknown
- 1973-01-10 HU HUBA2848A patent/HU165782B/hu unknown
- 1973-01-10 NO NO73108A patent/NO136839C/no unknown
- 1973-01-10 BE BE793867A patent/BE793867A/xx not_active IP Right Cessation
- 1973-01-10 PH PH14247A patent/PH11714A/en unknown
- 1973-01-10 ES ES410493A patent/ES410493A1/es not_active Expired
- 1973-01-10 CA CA160,943A patent/CA1040639A/en not_active Expired
- 1973-01-10 SE SE7300300A patent/SE394672B/xx unknown
- 1973-01-11 JP JP556573A patent/JPS5550947B2/ja not_active Expired
- 1973-01-11 AU AU51035/73A patent/AU466722B2/en not_active Expired
- 1973-01-11 JP JP556673A patent/JPS5530485B2/ja not_active Expired
- 1973-01-11 IE IE43/73A patent/IE37099B1/xx unknown
- 1973-01-11 FR FR7300889A patent/FR2167955B1/fr not_active Expired
-
1975
- 1975-05-30 ES ES438081A patent/ES438081A1/es not_active Expired
- 1975-07-10 SU SU752152410A patent/SU615857A3/ru active
- 1975-07-10 SU SU7502152412A patent/SU577988A3/ru active
- 1975-12-31 MY MY197564A patent/MY7500064A/xx unknown
-
1976
- 1976-09-15 PH PH18908A patent/PH12795A/en unknown
-
1979
- 1979-06-06 YU YU1333/79A patent/YU40562B/xx unknown
-
1980
- 1980-07-10 GT GT198064354A patent/GT198064354A/es unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1040639A (en) | 1,2,4-triazole derivatives, process for their production and their use as fungicides | |
| US4147791A (en) | 1-Substituted-1,2,4-triazole fungicidal compositions and methods for combatting fungi that infect or attack plants | |
| US4438122A (en) | Combating fungi with 1-phenoxy-2-pyridinyl-alkanols | |
| US3952002A (en) | Triazolyl-O,N-acetals | |
| CA1187084A (en) | Phenoxyphenyl azolylmethyl ketones and carbinols, processes for their preparation, and their use as fungicides and as intermediate products | |
| CA1212952A (en) | 1-phenyl-2-triazolyl-ethyl ether derivatives and their use as fungicides | |
| US4048318A (en) | 1-Substituted-1,2,4-triazole fungicides | |
| US4232033A (en) | Combating fungi with diastereomeric form A of 1-phenoxy-3,3-dimethyl-1-(1,2,4-triazol-1-yl)-butan-2-ols | |
| CA1092128A (en) | Combatting fungi with 1-(azol-1-yl)-4-halo-1-phenoxy- butan-2-ones and -ols | |
| US3940415A (en) | 1-(Imidazolyl-1)-2-aryloxy-3-hydroxy-alkanes | |
| IL45133A (en) | 1-phenoxy-1-imidazolyl-alkanol derivatives and their salts process for their preparation and their use as fungicide | |
| CA1092130A (en) | Azolyl-carboxylic acid derivatives and their use as fungicides | |
| US3972892A (en) | 1-[1,2,4-triazolyl-(1)]-2-aryloxy-3-hydroxy-alkanes | |
| CS195322B2 (en) | Fungicide and method of preparing active substances therefor | |
| US4151287A (en) | Combating fungi with 1-diaryloxy-1-triazolyl-3,3-dimethyl-butan-2-ones and butan-2-ols | |
| IE43969B1 (en) | 1-2(-halogeno-2-phenyl-ethyl)-triazoles and their use as fungicides | |
| CA1134369A (en) | 1.1-diphenylethene derivatives as microbicides | |
| HU184047B (en) | Fungicide compositions containing 1-ethen-azol derivatives as active agents, and process for producing the active agents | |
| US3972891A (en) | 1-Phenoxy-1-[halo-1,2,4-triazolyl-(1)]-3,3-dimethyl-butan-2-ones | |
| US4322442A (en) | Combating fungi with 1-halo-1-propyn-3-ols | |
| US4207328A (en) | 1-Phenoxy-2-(2,4-dichlorophenyl)-1-imidazol-1-yl-ethan-2-ones and -ols and antimycotic and fungicidal use | |
| CA1088549A (en) | 1-acyloxy-1-phenyl-2-azolyl-ethanes, and their use as fungicides or nematocides | |
| US4073901A (en) | Metal complexes of N-trityl-azoles for combatting fungi | |
| US4921870A (en) | Fungicidal novel substituted phenethyl-triazolyl derivatives | |
| US4596815A (en) | Antifungal azolylmethyl-thienyl-carbinol derivatives |