CA1036757A - Process for delignifying and bleaching cellulose pulp - Google Patents
Process for delignifying and bleaching cellulose pulpInfo
- Publication number
- CA1036757A CA1036757A CA221,566A CA221566A CA1036757A CA 1036757 A CA1036757 A CA 1036757A CA 221566 A CA221566 A CA 221566A CA 1036757 A CA1036757 A CA 1036757A
- Authority
- CA
- Canada
- Prior art keywords
- pulp
- carbon dioxide
- process according
- acid
- oxygen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 142
- 230000008569 process Effects 0.000 title claims abstract description 128
- 229920002678 cellulose Polymers 0.000 title claims abstract description 75
- 239000001913 cellulose Substances 0.000 title claims abstract description 75
- 238000004061 bleaching Methods 0.000 title claims abstract description 69
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims abstract description 148
- 229910002092 carbon dioxide Inorganic materials 0.000 claims abstract description 75
- 239000001569 carbon dioxide Substances 0.000 claims abstract description 72
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 64
- 239000001301 oxygen Substances 0.000 claims abstract description 64
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 64
- 230000036961 partial effect Effects 0.000 claims abstract description 47
- 239000007789 gas Substances 0.000 claims abstract description 45
- 150000001720 carbohydrates Chemical class 0.000 claims abstract description 20
- 235000014633 carbohydrates Nutrition 0.000 claims abstract description 20
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 98
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 64
- 239000002253 acid Substances 0.000 claims description 49
- 235000017557 sodium bicarbonate Nutrition 0.000 claims description 49
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims description 49
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 47
- 229960001407 sodium bicarbonate Drugs 0.000 claims description 44
- 238000010521 absorption reaction Methods 0.000 claims description 28
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 23
- 150000007513 acids Chemical class 0.000 claims description 22
- 239000002699 waste material Substances 0.000 claims description 19
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 16
- 230000015556 catabolic process Effects 0.000 claims description 14
- 238000006731 degradation reaction Methods 0.000 claims description 14
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 12
- 229910001882 dioxygen Inorganic materials 0.000 claims description 12
- 239000008139 complexing agent Substances 0.000 claims description 11
- 150000002697 manganese compounds Chemical class 0.000 claims description 8
- 229910021653 sulphate ion Inorganic materials 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 239000007788 liquid Substances 0.000 claims description 5
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 claims description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- 239000000835 fiber Substances 0.000 claims description 4
- 239000011121 hardwood Substances 0.000 claims description 4
- 238000011065 in-situ storage Methods 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 239000011122 softwood Substances 0.000 claims description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 3
- 238000002485 combustion reaction Methods 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- 238000012546 transfer Methods 0.000 claims description 3
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 claims description 2
- 150000001869 cobalt compounds Chemical class 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 150000002736 metal compounds Chemical class 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 229910052720 vanadium Inorganic materials 0.000 claims description 2
- 229920000388 Polyphosphate Polymers 0.000 claims 1
- 239000001205 polyphosphate Substances 0.000 claims 1
- 235000011176 polyphosphates Nutrition 0.000 claims 1
- 239000003265 pulping liquor Substances 0.000 claims 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims 1
- 239000003513 alkali Substances 0.000 abstract description 37
- 229920005610 lignin Polymers 0.000 abstract description 36
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 abstract description 8
- 229940077731 carbohydrate nutrients Drugs 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 description 29
- 238000011282 treatment Methods 0.000 description 28
- 230000029087 digestion Effects 0.000 description 18
- 238000004537 pulping Methods 0.000 description 18
- 229920002488 Hemicellulose Polymers 0.000 description 17
- 239000011777 magnesium Substances 0.000 description 16
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 14
- 229910052749 magnesium Inorganic materials 0.000 description 14
- 239000000126 substance Substances 0.000 description 14
- 239000003112 inhibitor Substances 0.000 description 13
- 239000000243 solution Substances 0.000 description 12
- 239000002023 wood Substances 0.000 description 12
- 239000012071 phase Substances 0.000 description 11
- 150000003839 salts Chemical class 0.000 description 11
- 230000008901 benefit Effects 0.000 description 10
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 10
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- 239000007857 degradation product Substances 0.000 description 9
- 239000011572 manganese Substances 0.000 description 9
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 8
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 8
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 8
- 238000007792 addition Methods 0.000 description 8
- -1 alkali metal bicarbonate Chemical class 0.000 description 8
- 229910052748 manganese Inorganic materials 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 7
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 7
- 229910052799 carbon Inorganic materials 0.000 description 7
- 238000004090 dissolution Methods 0.000 description 7
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 6
- 235000008331 Pinus X rigitaeda Nutrition 0.000 description 6
- 235000011613 Pinus brutia Nutrition 0.000 description 6
- 241000018646 Pinus brutia Species 0.000 description 6
- 229910052783 alkali metal Inorganic materials 0.000 description 6
- 235000014655 lactic acid Nutrition 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 150000007524 organic acids Chemical class 0.000 description 6
- 235000018185 Betula X alpestris Nutrition 0.000 description 5
- 235000018212 Betula X uliginosa Nutrition 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 229920001131 Pulp (paper) Polymers 0.000 description 5
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 5
- 230000000536 complexating effect Effects 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 239000002655 kraft paper Substances 0.000 description 5
- 159000000003 magnesium salts Chemical class 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 4
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000007423 decrease Effects 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 4
- 239000004310 lactic acid Substances 0.000 description 4
- 150000002696 manganese Chemical class 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 4
- 235000005985 organic acids Nutrition 0.000 description 4
- 239000000123 paper Substances 0.000 description 4
- 238000002203 pretreatment Methods 0.000 description 4
- 230000002829 reductive effect Effects 0.000 description 4
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 4
- 238000006277 sulfonation reaction Methods 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- KQTIIICEAUMSDG-UHFFFAOYSA-N tricarballylic acid Chemical compound OC(=O)CC(C(O)=O)CC(O)=O KQTIIICEAUMSDG-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- QXKAIJAYHKCRRA-UHFFFAOYSA-N D-lyxonic acid Natural products OCC(O)C(O)C(O)C(O)=O QXKAIJAYHKCRRA-UHFFFAOYSA-N 0.000 description 3
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- WAEMQWOKJMHJLA-UHFFFAOYSA-N Manganese(2+) Chemical compound [Mn+2] WAEMQWOKJMHJLA-UHFFFAOYSA-N 0.000 description 3
- 241000218657 Picea Species 0.000 description 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 3
- 238000005903 acid hydrolysis reaction Methods 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 239000001361 adipic acid Substances 0.000 description 3
- 235000011037 adipic acid Nutrition 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 3
- 235000015165 citric acid Nutrition 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- DSLZVSRJTYRBFB-DUHBMQHGSA-N galactaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O DSLZVSRJTYRBFB-DUHBMQHGSA-N 0.000 description 3
- 150000001261 hydroxy acids Chemical class 0.000 description 3
- 230000001771 impaired effect Effects 0.000 description 3
- 150000002596 lactones Chemical class 0.000 description 3
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 3
- 239000001095 magnesium carbonate Substances 0.000 description 3
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 239000011975 tartaric acid Substances 0.000 description 3
- 235000002906 tartaric acid Nutrition 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- RGHNJXZEOKUKBD-STGXQOJASA-N (2s,3s,4s,5r)-2,3,4,5,6-pentahydroxyhexanoic acid Chemical compound OC[C@@H](O)[C@H](O)[C@H](O)[C@H](O)C(O)=O RGHNJXZEOKUKBD-STGXQOJASA-N 0.000 description 2
- XVOUMQNXTGKGMA-OWOJBTEDSA-N (E)-glutaconic acid Chemical compound OC(=O)C\C=C\C(O)=O XVOUMQNXTGKGMA-OWOJBTEDSA-N 0.000 description 2
- 239000001124 (E)-prop-1-ene-1,2,3-tricarboxylic acid Substances 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 2
- RBNPOMFGQQGHHO-UHFFFAOYSA-N -2,3-Dihydroxypropanoic acid Natural products OCC(O)C(O)=O RBNPOMFGQQGHHO-UHFFFAOYSA-N 0.000 description 2
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 2
- XHWHHMNORMIBBB-UHFFFAOYSA-N 2,2,3,3-tetrahydroxybutanedioic acid Chemical compound OC(=O)C(O)(O)C(O)(O)C(O)=O XHWHHMNORMIBBB-UHFFFAOYSA-N 0.000 description 2
- VGVLFMIJNWWPBR-UHFFFAOYSA-N 2,2,3-trihydroxypentanedioic acid Chemical compound OC(=O)CC(O)C(O)(O)C(O)=O VGVLFMIJNWWPBR-UHFFFAOYSA-N 0.000 description 2
- VBWPSWWDYVWZKA-UHFFFAOYSA-N 2-hydroxybut-3-enoic acid Chemical compound C=CC(O)C(O)=O VBWPSWWDYVWZKA-UHFFFAOYSA-N 0.000 description 2
- AXFYFNCPONWUHW-UHFFFAOYSA-N 3-hydroxyisovaleric acid Chemical compound CC(C)(O)CC(O)=O AXFYFNCPONWUHW-UHFFFAOYSA-N 0.000 description 2
- BDDLHHRCDSJVKV-UHFFFAOYSA-N 7028-40-2 Chemical compound CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O BDDLHHRCDSJVKV-UHFFFAOYSA-N 0.000 description 2
- 244000283070 Abies balsamea Species 0.000 description 2
- 235000007173 Abies balsamea Nutrition 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 2
- XFTRTWQBIOMVPK-YFKPBYRVSA-N Citramalic acid Natural products OC(=O)[C@](O)(C)CC(O)=O XFTRTWQBIOMVPK-YFKPBYRVSA-N 0.000 description 2
- QXKAIJAYHKCRRA-JJYYJPOSSA-N D-arabinonic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)C(O)=O QXKAIJAYHKCRRA-JJYYJPOSSA-N 0.000 description 2
- JPIJQSOTBSSVTP-PWNYCUMCSA-N D-erythronic acid Chemical compound OC[C@@H](O)[C@@H](O)C(O)=O JPIJQSOTBSSVTP-PWNYCUMCSA-N 0.000 description 2
- RGHNJXZEOKUKBD-MGCNEYSASA-N D-galactonic acid Chemical compound OC[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-MGCNEYSASA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- RBNPOMFGQQGHHO-UWTATZPHSA-N D-glyceric acid Chemical compound OC[C@@H](O)C(O)=O RBNPOMFGQQGHHO-UWTATZPHSA-N 0.000 description 2
- QXKAIJAYHKCRRA-UZBSEBFBSA-N D-lyxonic acid Chemical compound OC[C@@H](O)[C@H](O)[C@H](O)C(O)=O QXKAIJAYHKCRRA-UZBSEBFBSA-N 0.000 description 2
- QXKAIJAYHKCRRA-BXXZVTAOSA-N D-ribonic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@@H](O)C(O)=O QXKAIJAYHKCRRA-BXXZVTAOSA-N 0.000 description 2
- JPIJQSOTBSSVTP-GBXIJSLDSA-N D-threonic acid Chemical compound OC[C@@H](O)[C@H](O)C(O)=O JPIJQSOTBSSVTP-GBXIJSLDSA-N 0.000 description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- 240000000731 Fagus sylvatica Species 0.000 description 2
- 235000010099 Fagus sylvatica Nutrition 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 2
- DSLZVSRJTYRBFB-UHFFFAOYSA-N Galactaric acid Natural products OC(=O)C(O)C(O)C(O)C(O)C(O)=O DSLZVSRJTYRBFB-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- RGHNJXZEOKUKBD-QTBDOELSSA-N L-gulonic acid Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)=O RGHNJXZEOKUKBD-QTBDOELSSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SKNVOMKLSA-N L-idonic acid Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SKNVOMKLSA-N 0.000 description 2
- 229910021380 Manganese Chloride Inorganic materials 0.000 description 2
- GLFNIEUTAYBVOC-UHFFFAOYSA-L Manganese chloride Chemical compound Cl[Mn]Cl GLFNIEUTAYBVOC-UHFFFAOYSA-L 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000183024 Populus tremula Species 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- NPTTZSYLTYJCPR-UHFFFAOYSA-N Trihydroxy-glutarsaeure Natural products OC(=O)C(O)C(O)C(O)C(O)=O NPTTZSYLTYJCPR-UHFFFAOYSA-N 0.000 description 2
- 229940091181 aconitic acid Drugs 0.000 description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 2
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000007844 bleaching agent Substances 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 125000002843 carboxylic acid group Chemical group 0.000 description 2
- GTZCVFVGUGFEME-IWQZZHSRSA-N cis-aconitic acid Chemical compound OC(=O)C\C(C(O)=O)=C\C(O)=O GTZCVFVGUGFEME-IWQZZHSRSA-N 0.000 description 2
- XFTRTWQBIOMVPK-UHFFFAOYSA-N citramalic acid Chemical compound OC(=O)C(O)(C)CC(O)=O XFTRTWQBIOMVPK-UHFFFAOYSA-N 0.000 description 2
- 238000010411 cooking Methods 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- UKFXDFUAPNAMPJ-UHFFFAOYSA-N ethylmalonic acid Chemical compound CCC(C(O)=O)C(O)=O UKFXDFUAPNAMPJ-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 230000000670 limiting effect Effects 0.000 description 2
- 150000002680 magnesium Chemical class 0.000 description 2
- 150000002681 magnesium compounds Chemical class 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 239000001630 malic acid Substances 0.000 description 2
- 235000011090 malic acid Nutrition 0.000 description 2
- 239000011565 manganese chloride Substances 0.000 description 2
- 235000002867 manganese chloride Nutrition 0.000 description 2
- 229910001437 manganese ion Inorganic materials 0.000 description 2
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 2
- SQQMAOCOWKFBNP-UHFFFAOYSA-L manganese(II) sulfate Chemical compound [Mn+2].[O-]S([O-])(=O)=O SQQMAOCOWKFBNP-UHFFFAOYSA-L 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- ZIYVHBGGAOATLY-UHFFFAOYSA-N methylmalonic acid Chemical compound OC(=O)C(C)C(O)=O ZIYVHBGGAOATLY-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 229940045916 polymetaphosphate Drugs 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 229920001282 polysaccharide Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- 238000005486 sulfidation Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- GTZCVFVGUGFEME-UHFFFAOYSA-N trans-aconitic acid Natural products OC(=O)CC(C(O)=O)=CC(O)=O GTZCVFVGUGFEME-UHFFFAOYSA-N 0.000 description 2
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- RGHNJXZEOKUKBD-TXICZTDVSA-N (2r,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexanoic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-TXICZTDVSA-N 0.000 description 1
- WHBMMWSBFZVSSR-GSVOUGTGSA-M (R)-3-hydroxybutyrate Chemical compound C[C@@H](O)CC([O-])=O WHBMMWSBFZVSSR-GSVOUGTGSA-M 0.000 description 1
- AFENDNXGAFYKQO-VKHMYHEASA-N (S)-2-hydroxybutyric acid Chemical compound CC[C@H](O)C(O)=O AFENDNXGAFYKQO-VKHMYHEASA-N 0.000 description 1
- BZCOSCNPHJNQBP-UPHRSURJSA-N (z)-2,3-dihydroxybut-2-enedioic acid Chemical compound OC(=O)C(\O)=C(\O)C(O)=O BZCOSCNPHJNQBP-UPHRSURJSA-N 0.000 description 1
- HOULBXUZSSMBID-UHFFFAOYSA-N 2,3,3-trihydroxy-2-methylpropanoic acid Chemical compound OC(O)C(O)(C)C(O)=O HOULBXUZSSMBID-UHFFFAOYSA-N 0.000 description 1
- RNMCCPMYXUKHAZ-UHFFFAOYSA-N 2-[3,3-diamino-1,2,2-tris(carboxymethyl)cyclohexyl]acetic acid Chemical compound NC1(N)CCCC(CC(O)=O)(CC(O)=O)C1(CC(O)=O)CC(O)=O RNMCCPMYXUKHAZ-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 241000208140 Acer Species 0.000 description 1
- 240000004731 Acer pseudoplatanus Species 0.000 description 1
- 235000002754 Acer pseudoplatanus Nutrition 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000609240 Ambelania acida Species 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000167854 Bourreria succulenta Species 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 241000723418 Carya Species 0.000 description 1
- 241001070941 Castanea Species 0.000 description 1
- 235000014036 Castanea Nutrition 0.000 description 1
- DSLZVSRJTYRBFB-YCAKELIYSA-N D-altraric acid Chemical compound OC(=O)[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O DSLZVSRJTYRBFB-YCAKELIYSA-N 0.000 description 1
- RGHNJXZEOKUKBD-AIHAYLRMSA-N D-altronic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O RGHNJXZEOKUKBD-AIHAYLRMSA-N 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- RGHNJXZEOKUKBD-MBMOQRBOSA-N D-mannonic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)=O RGHNJXZEOKUKBD-MBMOQRBOSA-N 0.000 description 1
- QXKAIJAYHKCRRA-FLRLBIABSA-N D-xylonic acid Chemical compound OC[C@@H](O)[C@H](O)[C@@H](O)C(O)=O QXKAIJAYHKCRRA-FLRLBIABSA-N 0.000 description 1
- 229920000875 Dissolving pulp Polymers 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 244000166124 Eucalyptus globulus Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- JYXGIOKAKDAARW-UHFFFAOYSA-N N-(2-hydroxyethyl)iminodiacetic acid Chemical compound OCCN(CC(O)=O)CC(O)=O JYXGIOKAKDAARW-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 235000006485 Platanus occidentalis Nutrition 0.000 description 1
- 241000219000 Populus Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- FMRLDPWIRHBCCC-UHFFFAOYSA-L Zinc carbonate Chemical compound [Zn+2].[O-]C([O-])=O FMRLDPWIRHBCCC-UHFFFAOYSA-L 0.000 description 1
- YTDHOMIYNAXTMV-UHFFFAOYSA-N [Mg].[Na].[Na].[Na] Chemical compound [Mg].[Na].[Na].[Na] YTDHOMIYNAXTMV-UHFFFAOYSA-N 0.000 description 1
- NJQIFQZKRYNHTE-UHFFFAOYSA-L [Mn](=O)(=O)(Cl)Cl Chemical compound [Mn](=O)(=O)(Cl)Cl NJQIFQZKRYNHTE-UHFFFAOYSA-L 0.000 description 1
- OGCQTFHFHIMLSU-UHFFFAOYSA-J [O-]P([O-])(=O)OP(=O)([O-])[O-].[Mg+2].[Na+].[Na+] Chemical compound [O-]P([O-])(=O)OP(=O)([O-])[O-].[Mg+2].[Na+].[Na+] OGCQTFHFHIMLSU-UHFFFAOYSA-J 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- CRPUIWOPYVHPBZ-UHFFFAOYSA-N acetic acid N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine Chemical compound CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O.NCCNCCNCCNCCN CRPUIWOPYVHPBZ-UHFFFAOYSA-N 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 239000003570 air Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000005011 alkyl ether group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000010905 bagasse Substances 0.000 description 1
- AYJRCSIUFZENHW-DEQYMQKBSA-L barium(2+);oxomethanediolate Chemical compound [Ba+2].[O-][14C]([O-])=O AYJRCSIUFZENHW-DEQYMQKBSA-L 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- 235000019693 cherries Nutrition 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 230000008094 contradictory effect Effects 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- RJYMRRJVDRJMJW-UHFFFAOYSA-L dibromomanganese Chemical compound Br[Mn]Br RJYMRRJVDRJMJW-UHFFFAOYSA-L 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 239000003344 environmental pollutant Substances 0.000 description 1
- OUDSFQBUEBFSPS-UHFFFAOYSA-N ethylenediaminetriacetic acid Chemical compound OC(=O)CNCCN(CC(O)=O)CC(O)=O OUDSFQBUEBFSPS-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 235000011167 hydrochloric acid Nutrition 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-M hydrosulfide Chemical compound [SH-] RWSOTUBLDIXVET-UHFFFAOYSA-M 0.000 description 1
- NBZBKCUXIYYUSX-UHFFFAOYSA-N iminodiacetic acid Chemical compound OC(=O)CNCC(O)=O NBZBKCUXIYYUSX-UHFFFAOYSA-N 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 239000012978 lignocellulosic material Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 229940071125 manganese acetate Drugs 0.000 description 1
- 229940099607 manganese chloride Drugs 0.000 description 1
- 239000011702 manganese sulphate Substances 0.000 description 1
- 235000007079 manganese sulphate Nutrition 0.000 description 1
- MIVBAHRSNUNMPP-UHFFFAOYSA-N manganese(2+);dinitrate Chemical compound [Mn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O MIVBAHRSNUNMPP-UHFFFAOYSA-N 0.000 description 1
- MMIPFLVOWGHZQD-UHFFFAOYSA-N manganese(3+) Chemical compound [Mn+3] MMIPFLVOWGHZQD-UHFFFAOYSA-N 0.000 description 1
- PAVJEQIFHXNOSM-UHFFFAOYSA-H manganese(3+);trisulfate Chemical compound [Mn+3].[Mn+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O PAVJEQIFHXNOSM-UHFFFAOYSA-H 0.000 description 1
- XMWCXZJXESXBBY-UHFFFAOYSA-L manganese(ii) carbonate Chemical compound [Mn+2].[O-]C([O-])=O XMWCXZJXESXBBY-UHFFFAOYSA-L 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- JVKAWJASTRPFQY-UHFFFAOYSA-N n-(2-aminoethyl)hydroxylamine Chemical compound NCCNO JVKAWJASTRPFQY-UHFFFAOYSA-N 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229960003903 oxygen Drugs 0.000 description 1
- 230000036284 oxygen consumption Effects 0.000 description 1
- 231100000719 pollutant Toxicity 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000001012 protector Effects 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- XHFLOLLMZOTPSM-UHFFFAOYSA-M sodium;hydrogen carbonate;hydrate Chemical compound [OH-].[Na+].OC(O)=O XHFLOLLMZOTPSM-UHFFFAOYSA-M 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000011667 zinc carbonate Substances 0.000 description 1
- 235000004416 zinc carbonate Nutrition 0.000 description 1
- 229910000010 zinc carbonate Inorganic materials 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21C—PRODUCTION OF CELLULOSE BY REMOVING NON-CELLULOSE SUBSTANCES FROM CELLULOSE-CONTAINING MATERIALS; REGENERATION OF PULPING LIQUORS; APPARATUS THEREFOR
- D21C9/00—After-treatment of cellulose pulp, e.g. of wood pulp, or cotton linters ; Treatment of dilute or dewatered pulp or process improvement taking place after obtaining the raw cellulosic material and not provided for elsewhere
- D21C9/10—Bleaching ; Apparatus therefor
- D21C9/1068—Bleaching ; Apparatus therefor with O2
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Wood Science & Technology (AREA)
- Paper (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE7403452A SE393138B (sv) | 1974-03-14 | 1974-03-14 | Forfarande for blekning av cellulosa med en syre innehallande gas i nervaro av natriumbikarbonat |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1036757A true CA1036757A (en) | 1978-08-22 |
Family
ID=20320525
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA221,566A Expired CA1036757A (en) | 1974-03-14 | 1975-03-07 | Process for delignifying and bleaching cellulose pulp |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4016029A (enExample) |
| JP (1) | JPS5228884B2 (enExample) |
| AT (1) | AT345659B (enExample) |
| BR (1) | BR7501340A (enExample) |
| CA (1) | CA1036757A (enExample) |
| CH (1) | CH591596A5 (enExample) |
| FI (1) | FI750636A7 (enExample) |
| FR (1) | FR2264126B1 (enExample) |
| GB (1) | GB1496537A (enExample) |
| IT (1) | IT1030235B (enExample) |
| NO (1) | NO140937C (enExample) |
| SE (1) | SE393138B (enExample) |
| SU (1) | SU847933A3 (enExample) |
| ZA (1) | ZA751267B (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5281101A (en) * | 1975-12-26 | 1977-07-07 | Toyo Pulp Co Ltd | Process for separating lignin from cellulose material by circulating gaseous oxygen |
| JPS5415002A (en) * | 1977-07-04 | 1979-02-03 | Hokusan Kk | Treating method to oxidize fibrin substance |
| SE450394B (sv) * | 1981-12-30 | 1987-06-22 | Mo Och Domsjoe Ab | Forfarande for blekning av ligninhaltig cellulosamassa |
| US4596630A (en) * | 1984-12-21 | 1986-06-24 | International Paper Company | Process for the electrochemical reductive bleaching of lignocellulosic pulp |
| USRE32825E (en) * | 1984-12-21 | 1989-01-10 | International Paper Company | Process for the electrochemical reductive bleaching of lignocellulosic pulp |
| US4946555A (en) * | 1989-01-19 | 1990-08-07 | Canadian Liquid Air Ltd./Air Liquide Canada | Apparatus and method for measuring vent gas flow rates and parameters in pulp and paper processing |
| DE3923728A1 (de) * | 1989-07-18 | 1991-01-24 | Degussa | Verfahren zur stabilisierung der viskositaet von zellstoffen |
| US5171405A (en) * | 1990-08-28 | 1992-12-15 | Kamyr, Inc. | Reactor having a discontinuous conduit means between surfaces of a downwardly extending stationary spiral |
| CA2042630A1 (en) * | 1990-09-27 | 1992-03-28 | Louis O. Torregrossa | Method and apparatus for beneficiating waste-waters |
| US5571378A (en) * | 1993-11-23 | 1996-11-05 | Hampshire Chemical Ltd. | Process for high-pH metal ion chelation in pulps |
| US5770010A (en) * | 1995-04-20 | 1998-06-23 | R-J Holding Company | Pulping process employing nascent oxygen |
| US6059927A (en) * | 1997-09-23 | 2000-05-09 | Queen's University At Kingston | Method of reducing brightness reversion and yellowness (B*) of bleached mechanical wood pulps |
| WO1999054544A1 (en) * | 1998-04-17 | 1999-10-28 | Alberta Research Council Inc. | Method of producing lignocellulosic pulp from non-woody species |
| FI991241A7 (fi) | 1999-06-01 | 2000-12-02 | Aga Ab | Ligniinin valkaisu ja menetelmä paperin valmistamiseksi |
| US6302997B1 (en) * | 1999-08-30 | 2001-10-16 | North Carolina State University | Process for producing a pulp suitable for papermaking from nonwood fibrous materials |
| DE10109502A1 (de) * | 2001-02-28 | 2002-09-12 | Rhodia Acetow Gmbh | Verfahren zum Abtrennen von Hemicellulosen aus hemicellulosehaltiger Biomasse sowie die mit dem Verfahren erhältliche Biomasse und Hemicellulose |
| US8317975B2 (en) | 2004-04-20 | 2012-11-27 | The Research Foundation Of The State University Of New York | Product and processes from an integrated forest biorefinery |
| BRPI0708794B1 (pt) * | 2006-03-13 | 2016-10-11 | Fp Innovations | processo para deslignificação de uma polpa lignocelulósica em uma suspensão aquosa |
| FI20070126A0 (fi) * | 2006-09-08 | 2007-02-13 | Linde Ag | Menetelmä hartsin poistamiseksi massasta ja hiilidioksidin tai (bi)karbonaatin käyttö tähän tarkoitukseen |
| DE102008044126A1 (de) * | 2008-11-27 | 2010-06-02 | Symrise Gmbh & Co. Kg | Aromastoffinklusionscellulose |
| CN114908598B (zh) * | 2022-02-26 | 2022-12-09 | 北京林业大学 | 一种纸浆氧漂方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA553349A (en) * | 1950-10-04 | 1958-02-18 | C. Harris George | Pulping process |
| US2811518A (en) * | 1955-06-07 | 1957-10-29 | Rayonier Inc | Alkaline refining of wood pulp |
| US2926114A (en) * | 1957-08-12 | 1960-02-23 | Kimberly Clark Co | Manufacture of cellulosic products |
| US3207572A (en) * | 1961-09-12 | 1965-09-21 | Ass Pulp & Paper Mills | Wet combustion of waste liquors |
| SE353749B (enExample) * | 1970-03-02 | 1973-02-12 | Mo Och Domsjoe Ab | |
| US3654070A (en) * | 1970-04-02 | 1972-04-04 | Sterling Drug Inc | Oxidation and reuse of effluent from oxygen pulping of raw cellulose |
| SE343092B (enExample) * | 1970-06-22 | 1972-02-28 | Mo Och Domsjoe Ab | |
| SE360128C (sv) * | 1970-08-25 | 1983-10-31 | Mo Och Domsjoe Ab | Sett att bleka cellulosamassa med en syreinnehallande gas i nervaro av alkali |
-
1974
- 1974-03-14 SE SE7403452A patent/SE393138B/xx unknown
-
1975
- 1975-02-27 IT IT67507/75A patent/IT1030235B/it active
- 1975-02-28 ZA ZA00751267A patent/ZA751267B/xx unknown
- 1975-03-04 CH CH270075A patent/CH591596A5/xx not_active IP Right Cessation
- 1975-03-05 FI FI750636A patent/FI750636A7/fi not_active Application Discontinuation
- 1975-03-06 BR BR1340/75D patent/BR7501340A/pt unknown
- 1975-03-06 SU SU752113118A patent/SU847933A3/ru active
- 1975-03-06 JP JP50027941A patent/JPS5228884B2/ja not_active Expired
- 1975-03-06 GB GB9450/75A patent/GB1496537A/en not_active Expired
- 1975-03-06 NO NO750745A patent/NO140937C/no unknown
- 1975-03-06 US US05/555,752 patent/US4016029A/en not_active Expired - Lifetime
- 1975-03-07 FR FR7507207A patent/FR2264126B1/fr not_active Expired
- 1975-03-07 CA CA221,566A patent/CA1036757A/en not_active Expired
- 1975-03-07 AT AT178975A patent/AT345659B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AT345659B (de) | 1978-09-25 |
| JPS5228884B2 (enExample) | 1977-07-29 |
| DE2509691B2 (de) | 1977-03-10 |
| BR7501340A (pt) | 1975-12-09 |
| ZA751267B (en) | 1976-01-28 |
| CH591596A5 (enExample) | 1977-09-30 |
| FR2264126A1 (enExample) | 1975-10-10 |
| GB1496537A (en) | 1977-12-30 |
| IT1030235B (it) | 1979-03-30 |
| ATA178975A (de) | 1978-01-15 |
| US4016029A (en) | 1977-04-05 |
| NO140937B (no) | 1979-09-03 |
| JPS50121503A (enExample) | 1975-09-23 |
| SU847933A3 (ru) | 1981-07-15 |
| SE393138B (sv) | 1977-05-02 |
| FR2264126B1 (enExample) | 1977-11-18 |
| SE7403452L (enExample) | 1975-09-15 |
| NO750745L (enExample) | 1975-09-16 |
| DE2509691A1 (de) | 1975-09-25 |
| FI750636A7 (enExample) | 1975-09-15 |
| NO140937C (no) | 1979-12-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1036757A (en) | Process for delignifying and bleaching cellulose pulp | |
| US4087318A (en) | Oxygen-alkali delignification of lignocellulosic material in the presence of a manganese compound | |
| US4222819A (en) | Process for the acid bleaching of cellulose pulp with peroxides | |
| US3759783A (en) | Process for bleaching cellulose pulp with alkali and oxygen gas utilizing waste bleaching liquor from an alka line oxygen gas bleaching stage | |
| US3769152A (en) | Digestion of wood with oxygen in the presence of alkali | |
| US4793898A (en) | Process for bleaching organic peroxyacid cooked material with an alkaline solution of hydrogen peroxide | |
| US4439271A (en) | Process for the oxygen bleaching of cellulose pulp | |
| US4050981A (en) | Process for the delignification of lignocellulosic material by maintaining a concentration of carbon monoxide in the presence of oxygen and alkali | |
| US3944463A (en) | Pulping of lignocellulosic material with oxygen in two stages at increasing pH | |
| US3652385A (en) | Process for treating cellulosic materials from which metal ions have been removed with alkali and oxygen in the presence of complex magnesium salts | |
| US5002635A (en) | Method for producing pulp using pre-treatment with stabilizers and refining | |
| US3701712A (en) | Process for treating cellulosic materials with alkali and oxygen in the presence of complex magnesium salts | |
| US4244778A (en) | Process for the chemical refining of cellulose pulp | |
| RU2044808C1 (ru) | Способ многостадийной отбелки целлюлозы | |
| US4372811A (en) | Alkaline oxygen delignification and bleaching of cellulose pulp in the presence of aromatic diamines | |
| US3843473A (en) | Impregnation of cellulosic pulp under superatmospheric pressure with waste alkaline oxygan gas bleaching liquor followed by oxygen-alkali bleaching | |
| US3764464A (en) | Process for preparing cellulose pulp by alkaline oxygen digestion of wood in the presence of alkali metal carbonate or bicarbonate | |
| US3652386A (en) | Process for treating cellulosic materials with alkali and oxygen in the presence of complex magnesium salts | |
| US4849053A (en) | Method for producing pulp using pre-treatment with stabilizers and defibration | |
| US4406735A (en) | Process for alkaline oxygen gas bleaching of cellulose pulp | |
| EP0250422B1 (en) | Process for preparing bleached pulp from lignocellulosic raw material | |
| US4602982A (en) | Process for delignifying bleaching lignin-containing cellulose pulp by activating the pulp with NO2 and O2 gas in the presence of water, sodium nitrate and nitric acid | |
| CA1039908A (en) | Process for the delignification of lignocellulosic material | |
| JP3054378B2 (ja) | 化学パルプの脱リグニンおよび漂白方法 | |
| US5985097A (en) | Method for suppressing undesired effects of transition and alkaline metal compounds during bleaching |