BRPI0617941A2 - composição de poliéster, artigo de manufatura, filme ou folha, artigo moldado por injeção, combinação, e, processo para a produção do poliéster - Google Patents
composição de poliéster, artigo de manufatura, filme ou folha, artigo moldado por injeção, combinação, e, processo para a produção do poliéster Download PDFInfo
- Publication number
- BRPI0617941A2 BRPI0617941A2 BRPI0617941-0A BRPI0617941A BRPI0617941A2 BR PI0617941 A2 BRPI0617941 A2 BR PI0617941A2 BR PI0617941 A BRPI0617941 A BR PI0617941A BR PI0617941 A2 BRPI0617941 A2 BR PI0617941A2
- Authority
- BR
- Brazil
- Prior art keywords
- mol
- polyester
- tetramethyl
- residues
- composition according
- Prior art date
Links
- 229920000728 polyester Polymers 0.000 title claims abstract description 902
- 239000000203 mixture Substances 0.000 title claims abstract description 459
- 238000000034 method Methods 0.000 title claims abstract description 174
- 230000008569 process Effects 0.000 title claims abstract description 135
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 49
- 238000002347 injection Methods 0.000 title claims description 21
- 239000007924 injection Substances 0.000 title claims description 21
- FQXGHZNSUOHCLO-UHFFFAOYSA-N 2,2,4,4-tetramethyl-1,3-cyclobutanediol Chemical group CC1(C)C(O)C(C)(C)C1O FQXGHZNSUOHCLO-UHFFFAOYSA-N 0.000 claims abstract description 361
- ORLQHILJRHBSAY-UHFFFAOYSA-N [1-(hydroxymethyl)cyclohexyl]methanol Chemical group OCC1(CO)CCCCC1 ORLQHILJRHBSAY-UHFFFAOYSA-N 0.000 claims abstract description 232
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims abstract description 223
- KKEYFWRCBNTPAC-UHFFFAOYSA-N terephthalic acid group Chemical group C(C1=CC=C(C(=O)O)C=C1)(=O)O KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims abstract description 138
- 238000001746 injection moulding Methods 0.000 claims abstract description 8
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 587
- -1 poly (carbonate ester Chemical class 0.000 claims description 287
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 253
- 125000004432 carbon atom Chemical group C* 0.000 claims description 152
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 claims description 146
- 229920000642 polymer Polymers 0.000 claims description 132
- 239000003054 catalyst Substances 0.000 claims description 111
- 239000003017 thermal stabilizer Substances 0.000 claims description 89
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 claims description 87
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 87
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 76
- 229910019142 PO4 Inorganic materials 0.000 claims description 54
- 229910052782 aluminium Inorganic materials 0.000 claims description 52
- 150000003606 tin compounds Chemical class 0.000 claims description 52
- 239000007795 chemical reaction product Substances 0.000 claims description 49
- 238000010438 heat treatment Methods 0.000 claims description 49
- 239000011541 reaction mixture Substances 0.000 claims description 49
- 229910052698 phosphorus Inorganic materials 0.000 claims description 45
- 239000011574 phosphorus Substances 0.000 claims description 45
- 125000004437 phosphorous atom Chemical group 0.000 claims description 44
- 238000002425 crystallisation Methods 0.000 claims description 43
- 150000002148 esters Chemical class 0.000 claims description 43
- 239000000047 product Substances 0.000 claims description 43
- 230000008025 crystallization Effects 0.000 claims description 39
- 239000010452 phosphate Substances 0.000 claims description 36
- 239000004417 polycarbonate Substances 0.000 claims description 36
- 239000002253 acid Substances 0.000 claims description 34
- 229920000515 polycarbonate Polymers 0.000 claims description 34
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 30
- 229910052744 lithium Inorganic materials 0.000 claims description 30
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 claims description 29
- 229910017052 cobalt Inorganic materials 0.000 claims description 29
- 239000010941 cobalt Substances 0.000 claims description 29
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 29
- 229910052733 gallium Inorganic materials 0.000 claims description 29
- 229910052732 germanium Inorganic materials 0.000 claims description 29
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims description 29
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 29
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 28
- 125000000217 alkyl group Chemical group 0.000 claims description 28
- 239000010936 titanium Substances 0.000 claims description 28
- 229910052719 titanium Inorganic materials 0.000 claims description 28
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 25
- 229910052725 zinc Inorganic materials 0.000 claims description 25
- 239000011701 zinc Substances 0.000 claims description 25
- 238000001125 extrusion Methods 0.000 claims description 24
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 23
- 229910052787 antimony Inorganic materials 0.000 claims description 23
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 23
- 125000003118 aryl group Chemical group 0.000 claims description 22
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 21
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical group OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 claims description 20
- 150000003014 phosphoric acid esters Chemical class 0.000 claims description 19
- 150000001875 compounds Chemical class 0.000 claims description 16
- ZJIPHXXDPROMEF-UHFFFAOYSA-N dihydroxyphosphanyl dihydrogen phosphite Chemical class OP(O)OP(O)O ZJIPHXXDPROMEF-UHFFFAOYSA-N 0.000 claims description 13
- 239000000155 melt Substances 0.000 claims description 12
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical group C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 claims description 11
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 10
- 239000006085 branching agent Substances 0.000 claims description 9
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 9
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 claims description 8
- 239000004793 Polystyrene Substances 0.000 claims description 7
- 238000003490 calendering Methods 0.000 claims description 7
- 150000003016 phosphoric acids Chemical class 0.000 claims description 7
- 229920002223 polystyrene Polymers 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- 239000004734 Polyphenylene sulfide Substances 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 6
- XRBCRPZXSCBRTK-UHFFFAOYSA-N phosphonous acid Chemical compound OPO XRBCRPZXSCBRTK-UHFFFAOYSA-N 0.000 claims description 6
- 229920006380 polyphenylene oxide Polymers 0.000 claims description 6
- 229920000069 polyphenylene sulfide Polymers 0.000 claims description 6
- 125000003107 substituted aryl group Chemical group 0.000 claims description 5
- 239000004952 Polyamide Substances 0.000 claims description 4
- 229920001577 copolymer Polymers 0.000 claims description 4
- 125000001142 dicarboxylic acid group Chemical group 0.000 claims description 4
- 238000010103 injection stretch blow moulding Methods 0.000 claims description 4
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical class [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 claims description 4
- 229920002492 poly(sulfone) Polymers 0.000 claims description 4
- 229920002647 polyamide Polymers 0.000 claims description 4
- 150000003457 sulfones Chemical class 0.000 claims description 4
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 3
- 238000000071 blow moulding Methods 0.000 claims description 3
- 150000002170 ethers Chemical class 0.000 claims description 3
- 238000010101 extrusion blow moulding Methods 0.000 claims description 3
- 229920002863 poly(1,4-phenylene oxide) polymer Polymers 0.000 claims description 3
- 229920001643 poly(ether ketone) Polymers 0.000 claims description 3
- 229920012287 polyphenylene sulfone Polymers 0.000 claims description 3
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 claims description 3
- 239000004677 Nylon Substances 0.000 claims description 2
- 229920006243 acrylic copolymer Polymers 0.000 claims description 2
- 239000011888 foil Substances 0.000 claims description 2
- 229920001778 nylon Polymers 0.000 claims description 2
- ACVYVLVWPXVTIT-UHFFFAOYSA-N phosphinic acid Chemical compound O[PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-N 0.000 claims description 2
- 229920003229 poly(methyl methacrylate) Polymers 0.000 claims description 2
- 229920002285 poly(styrene-co-acrylonitrile) Polymers 0.000 claims description 2
- 239000004926 polymethyl methacrylate Substances 0.000 claims description 2
- 229920005990 polystyrene resin Polymers 0.000 claims description 2
- 238000004383 yellowing Methods 0.000 claims description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical group OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims 1
- 150000002681 magnesium compounds Chemical class 0.000 claims 1
- 239000000835 fiber Substances 0.000 abstract description 9
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 108
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical group [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 75
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 73
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 67
- 239000010408 film Substances 0.000 description 61
- 230000009477 glass transition Effects 0.000 description 60
- 235000021317 phosphate Nutrition 0.000 description 49
- 239000000126 substance Substances 0.000 description 49
- 239000011521 glass Substances 0.000 description 44
- 238000003856 thermoforming Methods 0.000 description 42
- 229910052718 tin Inorganic materials 0.000 description 41
- 230000003247 decreasing effect Effects 0.000 description 38
- 229920001634 Copolyester Polymers 0.000 description 37
- 238000002474 experimental method Methods 0.000 description 36
- 235000013305 food Nutrition 0.000 description 34
- 238000002360 preparation method Methods 0.000 description 30
- 229910052749 magnesium Inorganic materials 0.000 description 29
- 239000011777 magnesium Substances 0.000 description 29
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 28
- 150000002009 diols Chemical class 0.000 description 28
- 230000015572 biosynthetic process Effects 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 26
- 238000006116 polymerization reaction Methods 0.000 description 26
- 230000002829 reductive effect Effects 0.000 description 26
- 230000000694 effects Effects 0.000 description 25
- 229910052757 nitrogen Inorganic materials 0.000 description 24
- 150000003018 phosphorus compounds Chemical class 0.000 description 23
- 238000005481 NMR spectroscopy Methods 0.000 description 22
- 238000013019 agitation Methods 0.000 description 22
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 22
- 229910052751 metal Inorganic materials 0.000 description 21
- 239000002184 metal Substances 0.000 description 21
- JGFBRKRYDCGYKD-UHFFFAOYSA-N dibutyl(oxo)tin Chemical compound CCCC[Sn](=O)CCCC JGFBRKRYDCGYKD-UHFFFAOYSA-N 0.000 description 20
- 230000003301 hydrolyzing effect Effects 0.000 description 20
- 239000000463 material Substances 0.000 description 20
- 229910001873 dinitrogen Inorganic materials 0.000 description 19
- 238000010926 purge Methods 0.000 description 19
- LUZSPGQEISANPO-UHFFFAOYSA-N butyltin Chemical compound CCCC[Sn] LUZSPGQEISANPO-UHFFFAOYSA-N 0.000 description 18
- 230000001954 sterilising effect Effects 0.000 description 18
- 238000004659 sterilization and disinfection Methods 0.000 description 18
- 230000007704 transition Effects 0.000 description 18
- XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 description 18
- 230000005540 biological transmission Effects 0.000 description 17
- 230000004888 barrier function Effects 0.000 description 16
- 230000000052 comparative effect Effects 0.000 description 16
- WNVQCJNZEDLILP-UHFFFAOYSA-N dimethyl(oxo)tin Chemical compound C[Sn](C)=O WNVQCJNZEDLILP-UHFFFAOYSA-N 0.000 description 16
- 238000001035 drying Methods 0.000 description 16
- 150000002334 glycols Chemical class 0.000 description 16
- 239000000178 monomer Substances 0.000 description 16
- 229920001169 thermoplastic Polymers 0.000 description 16
- 239000004416 thermosoftening plastic Substances 0.000 description 16
- 238000005886 esterification reaction Methods 0.000 description 15
- 238000006068 polycondensation reaction Methods 0.000 description 15
- WBWXVCMXGYSMQA-UHFFFAOYSA-N 3,9-bis[2,4-bis(2-phenylpropan-2-yl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane Chemical compound C=1C=C(OP2OCC3(CO2)COP(OC=2C(=CC(=CC=2)C(C)(C)C=2C=CC=CC=2)C(C)(C)C=2C=CC=CC=2)OC3)C(C(C)(C)C=2C=CC=CC=2)=CC=1C(C)(C)C1=CC=CC=C1 WBWXVCMXGYSMQA-UHFFFAOYSA-N 0.000 description 14
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 14
- 239000000654 additive Substances 0.000 description 14
- 238000003860 storage Methods 0.000 description 14
- 230000001143 conditioned effect Effects 0.000 description 13
- 239000010410 layer Substances 0.000 description 13
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000003153 chemical reaction reagent Substances 0.000 description 12
- 238000005259 measurement Methods 0.000 description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 12
- 238000012545 processing Methods 0.000 description 12
- 229910001220 stainless steel Inorganic materials 0.000 description 12
- 239000010935 stainless steel Substances 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 230000000996 additive effect Effects 0.000 description 11
- 238000000576 coating method Methods 0.000 description 11
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 11
- 239000000976 ink Substances 0.000 description 11
- 230000004048 modification Effects 0.000 description 11
- 238000012986 modification Methods 0.000 description 11
- 239000012298 atmosphere Substances 0.000 description 10
- 239000008280 blood Substances 0.000 description 10
- 210000004369 blood Anatomy 0.000 description 10
- 238000004821 distillation Methods 0.000 description 10
- 230000004927 fusion Effects 0.000 description 10
- 230000003287 optical effect Effects 0.000 description 10
- 235000011007 phosphoric acid Nutrition 0.000 description 10
- 229920005989 resin Polymers 0.000 description 10
- 239000011347 resin Substances 0.000 description 10
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 9
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 9
- 150000001991 dicarboxylic acids Chemical class 0.000 description 9
- 239000005340 laminated glass Substances 0.000 description 9
- 230000014759 maintenance of location Effects 0.000 description 9
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 9
- 230000004224 protection Effects 0.000 description 9
- 239000007983 Tris buffer Substances 0.000 description 8
- 125000002877 alkyl aryl group Chemical group 0.000 description 8
- 235000013361 beverage Nutrition 0.000 description 8
- 239000011248 coating agent Substances 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 230000032050 esterification Effects 0.000 description 8
- 239000006260 foam Substances 0.000 description 8
- 238000000691 measurement method Methods 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 229910052799 carbon Chemical group 0.000 description 7
- 230000001681 protective effect Effects 0.000 description 7
- 230000001012 protector Effects 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 239000012974 tin catalyst Substances 0.000 description 7
- 238000012546 transfer Methods 0.000 description 7
- 239000002023 wood Substances 0.000 description 7
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 6
- 229940058905 antimony compound for treatment of leishmaniasis and trypanosomiasis Drugs 0.000 description 6
- 150000001463 antimony compounds Chemical class 0.000 description 6
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 6
- 238000009833 condensation Methods 0.000 description 6
- 230000005494 condensation Effects 0.000 description 6
- 238000000502 dialysis Methods 0.000 description 6
- VNGOYPQMJFJDLV-UHFFFAOYSA-N dimethyl benzene-1,3-dicarboxylate Chemical group COC(=O)C1=CC=CC(C(=O)OC)=C1 VNGOYPQMJFJDLV-UHFFFAOYSA-N 0.000 description 6
- 238000004851 dishwashing Methods 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- 238000001990 intravenous administration Methods 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 229920005862 polyol Polymers 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 6
- 229910001887 tin oxide Inorganic materials 0.000 description 6
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 5
- 239000004970 Chain extender Substances 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- 150000008064 anhydrides Chemical class 0.000 description 5
- AYOHIQLKSOJJQH-UHFFFAOYSA-N dibutyltin Chemical compound CCCC[Sn]CCCC AYOHIQLKSOJJQH-UHFFFAOYSA-N 0.000 description 5
- 238000010128 melt processing Methods 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 230000000704 physical effect Effects 0.000 description 5
- 150000003077 polyols Chemical class 0.000 description 5
- 238000004886 process control Methods 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 238000011282 treatment Methods 0.000 description 5
- 238000010407 vacuum cleaning Methods 0.000 description 5
- 230000000007 visual effect Effects 0.000 description 5
- 239000004609 Impact Modifier Substances 0.000 description 4
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- 239000012790 adhesive layer Substances 0.000 description 4
- 150000004703 alkoxides Chemical class 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 229920000402 bisphenol A polycarbonate polymer Polymers 0.000 description 4
- 235000021170 buffet Nutrition 0.000 description 4
- 230000008859 change Effects 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- VEIOBOXBGYWJIT-UHFFFAOYSA-N cyclohexane;methanol Chemical compound OC.OC.C1CCCCC1 VEIOBOXBGYWJIT-UHFFFAOYSA-N 0.000 description 4
- 238000013480 data collection Methods 0.000 description 4
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 239000000975 dye Substances 0.000 description 4
- 238000003475 lamination Methods 0.000 description 4
- 229940023490 ophthalmic product Drugs 0.000 description 4
- 239000008188 pellet Substances 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 238000002560 therapeutic procedure Methods 0.000 description 4
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 4
- RSJKGSCJYJTIGS-UHFFFAOYSA-N undecane Chemical compound CCCCCCCCCCC RSJKGSCJYJTIGS-UHFFFAOYSA-N 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- 238000004876 x-ray fluorescence Methods 0.000 description 4
- 150000003752 zinc compounds Chemical class 0.000 description 4
- WIGMBAFWGLANJY-UHFFFAOYSA-N 2,3-dihydroindene-1,1-dicarboxylic acid Chemical class C1=CC=C2C(C(=O)O)(C(O)=O)CCC2=C1 WIGMBAFWGLANJY-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 229920004042 Makrolon® 2608 Polymers 0.000 description 3
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 3
- 239000000020 Nitrocellulose Substances 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000002441 X-ray diffraction Methods 0.000 description 3
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000005215 alkyl ethers Chemical class 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000007906 compression Methods 0.000 description 3
- 230000006835 compression Effects 0.000 description 3
- 238000010924 continuous production Methods 0.000 description 3
- 125000000853 cresyl group Chemical group C1(=CC=C(C=C1)C)* 0.000 description 3
- 238000010830 demodification reaction Methods 0.000 description 3
- ROORDVPLFPIABK-UHFFFAOYSA-N diphenyl carbonate Chemical compound C=1C=CC=CC=1OC(=O)OC1=CC=CC=C1 ROORDVPLFPIABK-UHFFFAOYSA-N 0.000 description 3
- ASMQGLCHMVWBQR-UHFFFAOYSA-M diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)([O-])OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-M 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 238000009863 impact test Methods 0.000 description 3
- 238000010102 injection blow moulding Methods 0.000 description 3
- 229920001220 nitrocellulos Polymers 0.000 description 3
- 238000004806 packaging method and process Methods 0.000 description 3
- 230000036961 partial effect Effects 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229920001690 polydopamine Polymers 0.000 description 3
- 239000004814 polyurethane Substances 0.000 description 3
- 229920002635 polyurethane Polymers 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- MDDUHVRJJAFRAU-YZNNVMRBSA-N tert-butyl-[(1r,3s,5z)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2-diphenylphosphorylethylidene)-4-methylidenecyclohexyl]oxy-dimethylsilane Chemical compound C1[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)C(=C)\C1=C/CP(=O)(C=1C=CC=CC=1)C1=CC=CC=C1 MDDUHVRJJAFRAU-YZNNVMRBSA-N 0.000 description 3
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 3
- XLTMWFMRJZDFFD-UHFFFAOYSA-N 1-[(2-chloro-4-nitrophenyl)diazenyl]naphthalen-2-ol Chemical compound OC1=CC=C2C=CC=CC2=C1N=NC1=CC=C([N+]([O-])=O)C=C1Cl XLTMWFMRJZDFFD-UHFFFAOYSA-N 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- CGLVZFOCZLHKOH-UHFFFAOYSA-N 8,18-dichloro-5,15-diethyl-5,15-dihydrodiindolo(3,2-b:3',2'-m)triphenodioxazine Chemical compound CCN1C2=CC=CC=C2C2=C1C=C1OC3=C(Cl)C4=NC(C=C5C6=CC=CC=C6N(C5=C5)CC)=C5OC4=C(Cl)C3=NC1=C2 CGLVZFOCZLHKOH-UHFFFAOYSA-N 0.000 description 2
- NVLLRMIRGOSIIL-UHFFFAOYSA-N C1C2(COC(O1)[P+](=O)[O-])COC(OC2)[P+](=O)[O-] Chemical group C1C2(COC(O1)[P+](=O)[O-])COC(OC2)[P+](=O)[O-] NVLLRMIRGOSIIL-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- 229920006382 Lustran Polymers 0.000 description 2
- CGSLYBDCEGBZCG-UHFFFAOYSA-N Octicizer Chemical compound C=1C=CC=CC=1OP(=O)(OCC(CC)CCCC)OC1=CC=CC=C1 CGSLYBDCEGBZCG-UHFFFAOYSA-N 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 2
- 244000269722 Thea sinensis Species 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- GTDPSWPPOUPBNX-UHFFFAOYSA-N ac1mqpva Chemical compound CC12C(=O)OC(=O)C1(C)C1(C)C2(C)C(=O)OC1=O GTDPSWPPOUPBNX-UHFFFAOYSA-N 0.000 description 2
- 230000002730 additional effect Effects 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 230000000712 assembly Effects 0.000 description 2
- 238000000429 assembly Methods 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- QMKYBPDZANOJGF-UHFFFAOYSA-N benzene-1,3,5-tricarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC(C(O)=O)=C1 QMKYBPDZANOJGF-UHFFFAOYSA-N 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 125000006267 biphenyl group Chemical group 0.000 description 2
- 235000020965 cold beverage Nutrition 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 238000000748 compression moulding Methods 0.000 description 2
- BXVLQFGQYHYURU-UHFFFAOYSA-N diethyltin Chemical compound CC[Sn]CC BXVLQFGQYHYURU-UHFFFAOYSA-N 0.000 description 2
- 238000005485 electric heating Methods 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- ZJXZSIYSNXKHEA-UHFFFAOYSA-N ethyl dihydrogen phosphate Chemical class CCOP(O)(O)=O ZJXZSIYSNXKHEA-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 244000144992 flock Species 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 235000012171 hot beverage Nutrition 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical compound C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 229960004592 isopropanol Drugs 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000004973 liquid crystal related substance Substances 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 150000002924 oxiranes Chemical class 0.000 description 2
- AUONHKJOIZSQGR-UHFFFAOYSA-N oxophosphane Chemical compound P=O AUONHKJOIZSQGR-UHFFFAOYSA-N 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 2
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 230000010287 polarization Effects 0.000 description 2
- 229920005644 polyethylene terephthalate glycol copolymer Polymers 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- YKYONYBAUNKHLG-UHFFFAOYSA-N propyl acetate Chemical compound CCCOC(C)=O YKYONYBAUNKHLG-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 230000002787 reinforcement Effects 0.000 description 2
- 239000005336 safety glass Substances 0.000 description 2
- 238000007493 shaping process Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000014347 soups Nutrition 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 2
- 150000003503 terephthalic acid derivatives Chemical class 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- QHGNHLZPVBIIPX-UHFFFAOYSA-N tin(ii) oxide Chemical class [Sn]=O QHGNHLZPVBIIPX-UHFFFAOYSA-N 0.000 description 2
- 150000003609 titanium compounds Chemical class 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 238000002235 transmission spectroscopy Methods 0.000 description 2
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical compound CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 description 2
- 229940086542 triethylamine Drugs 0.000 description 2
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- KPGXUAIFQMJJFB-UHFFFAOYSA-H tungsten hexachloride Chemical compound Cl[W](Cl)(Cl)(Cl)(Cl)Cl KPGXUAIFQMJJFB-UHFFFAOYSA-H 0.000 description 2
- 229910000634 wood's metal Inorganic materials 0.000 description 2
- OWICEWMBIBPFAH-UHFFFAOYSA-N (3-diphenoxyphosphoryloxyphenyl) diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=C(OP(=O)(OC=2C=CC=CC=2)OC=2C=CC=CC=2)C=CC=1)(=O)OC1=CC=CC=C1 OWICEWMBIBPFAH-UHFFFAOYSA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical compound CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 1
- NYYLZXREFNYPKB-UHFFFAOYSA-N 1-[ethoxy(methyl)phosphoryl]oxyethane Chemical compound CCOP(C)(=O)OCC NYYLZXREFNYPKB-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 description 1
- RWKSDJWCHGWVBF-UHFFFAOYSA-N 1-diethoxyphosphorylpentane Chemical compound CCCCCP(=O)(OCC)OCC RWKSDJWCHGWVBF-UHFFFAOYSA-N 0.000 description 1
- 238000005160 1H NMR spectroscopy Methods 0.000 description 1
- MNQNHAXVLUCZMI-UHFFFAOYSA-N 2,3-dihydro-1h-indene-1,3-dicarboxylic acid Chemical class C1=CC=C2C(C(=O)O)CC(C(O)=O)C2=C1 MNQNHAXVLUCZMI-UHFFFAOYSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- YEVQZPWSVWZAOB-UHFFFAOYSA-N 2-(bromomethyl)-1-iodo-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(I)C(CBr)=C1 YEVQZPWSVWZAOB-UHFFFAOYSA-N 0.000 description 1
- UDOPITICNQWATG-UHFFFAOYSA-N 2-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]acetic acid Chemical compound O=C1C(CC(=O)O)NC(=O)N1C1=CC=C(Cl)C=C1 UDOPITICNQWATG-UHFFFAOYSA-N 0.000 description 1
- FDSYTWVNUJTPMA-UHFFFAOYSA-N 2-[3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]acetic acid Chemical compound C1N(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC2=CC=CC1=N2 FDSYTWVNUJTPMA-UHFFFAOYSA-N 0.000 description 1
- SDTMFDGELKWGFT-UHFFFAOYSA-N 2-methylpropan-2-olate Chemical compound CC(C)(C)[O-] SDTMFDGELKWGFT-UHFFFAOYSA-N 0.000 description 1
- DUIOKRXOKLLURE-UHFFFAOYSA-N 2-octylphenol Chemical compound CCCCCCCCC1=CC=CC=C1O DUIOKRXOKLLURE-UHFFFAOYSA-N 0.000 description 1
- XFEGRFIENDJTCK-UHFFFAOYSA-N 2-phenyl-2,3-dihydroindene-1,1-dicarboxylic acid Chemical class C1C2=CC=CC=C2C(C(=O)O)(C(O)=O)C1C1=CC=CC=C1 XFEGRFIENDJTCK-UHFFFAOYSA-N 0.000 description 1
- ZQHYXNSQOIDNTL-UHFFFAOYSA-N 3-hydroxyglutaric acid Chemical compound OC(=O)CC(O)CC(O)=O ZQHYXNSQOIDNTL-UHFFFAOYSA-N 0.000 description 1
- NEQFBGHQPUXOFH-UHFFFAOYSA-N 4-(4-carboxyphenyl)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CC=C(C(O)=O)C=C1 NEQFBGHQPUXOFH-UHFFFAOYSA-N 0.000 description 1
- ZZLCFHIKESPLTH-UHFFFAOYSA-N 4-Methylbiphenyl Chemical group C1=CC(C)=CC=C1C1=CC=CC=C1 ZZLCFHIKESPLTH-UHFFFAOYSA-N 0.000 description 1
- SBBQDUFLZGOASY-OWOJBTEDSA-N 4-[(e)-2-(4-carboxyphenyl)ethenyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1\C=C\C1=CC=C(C(O)=O)C=C1 SBBQDUFLZGOASY-OWOJBTEDSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- RYUJRXVZSJCHDZ-UHFFFAOYSA-N 8-methylnonyl diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(OCCCCCCCC(C)C)OC1=CC=CC=C1 RYUJRXVZSJCHDZ-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 229920008347 Cellulose acetate propionate Polymers 0.000 description 1
- REEFSLKDEDEWAO-UHFFFAOYSA-N Chloraniformethan Chemical compound ClC1=CC=C(NC(NC=O)C(Cl)(Cl)Cl)C=C1Cl REEFSLKDEDEWAO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 101001135826 Homo sapiens Serine/threonine-protein phosphatase 2A activator Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 240000008415 Lactuca sativa Species 0.000 description 1
- OKIZCWYLBDKLSU-UHFFFAOYSA-M N,N,N-Trimethylmethanaminium chloride Chemical compound [Cl-].C[N+](C)(C)C OKIZCWYLBDKLSU-UHFFFAOYSA-M 0.000 description 1
- 239000004727 Noryl Substances 0.000 description 1
- 229920001207 Noryl Polymers 0.000 description 1
- ALQSHHUCVQOPAS-UHFFFAOYSA-N Pentane-1,5-diol Chemical compound OCCCCCO ALQSHHUCVQOPAS-UHFFFAOYSA-N 0.000 description 1
- JKIJEFPNVSHHEI-UHFFFAOYSA-N Phenol, 2,4-bis(1,1-dimethylethyl)-, phosphite (3:1) Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC=C1OP(OC=1C(=CC(=CC=1)C(C)(C)C)C(C)(C)C)OC1=CC=C(C(C)(C)C)C=C1C(C)(C)C JKIJEFPNVSHHEI-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102100036782 Serine/threonine-protein phosphatase 2A activator Human genes 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- 229920004738 ULTEM® Polymers 0.000 description 1
- 239000012963 UV stabilizer Substances 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 241000482268 Zea mays subsp. mays Species 0.000 description 1
- 229920006102 Zytel® Polymers 0.000 description 1
- LUSFFPXRDZKBMF-UHFFFAOYSA-N [3-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCCC(CO)C1 LUSFFPXRDZKBMF-UHFFFAOYSA-N 0.000 description 1
- BWVAOONFBYYRHY-UHFFFAOYSA-N [4-(hydroxymethyl)phenyl]methanol Chemical compound OCC1=CC=C(CO)C=C1 BWVAOONFBYYRHY-UHFFFAOYSA-N 0.000 description 1
- PVLBCGCPMYERHM-UHFFFAOYSA-L [benzoyloxy(dimethyl)stannyl] benzoate Chemical compound C=1C=CC=CC=1C(=O)O[Sn](C)(C)OC(=O)C1=CC=CC=C1 PVLBCGCPMYERHM-UHFFFAOYSA-L 0.000 description 1
- DWRBCWYHLKHQAP-UHFFFAOYSA-L [butanoyloxy(dibutyl)stannyl] butanoate Chemical compound CCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCC DWRBCWYHLKHQAP-UHFFFAOYSA-L 0.000 description 1
- BHUMZHDFNOXAMC-UHFFFAOYSA-N [methoxy(phenyl)phosphoryl]benzene Chemical compound C=1C=CC=CC=1P(=O)(OC)C1=CC=CC=C1 BHUMZHDFNOXAMC-UHFFFAOYSA-N 0.000 description 1
- HPUPGAFDTWIMBR-UHFFFAOYSA-N [methyl(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(C)OC1=CC=CC=C1 HPUPGAFDTWIMBR-UHFFFAOYSA-N 0.000 description 1
- BPYBCKBGKAIOBH-UHFFFAOYSA-N [methyl(phenylmethoxy)phosphoryl]oxymethylbenzene Chemical compound C=1C=CC=CC=1COP(=O)(C)OCC1=CC=CC=C1 BPYBCKBGKAIOBH-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 239000002390 adhesive tape Substances 0.000 description 1
- 235000013334 alcoholic beverage Nutrition 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- POJOORKDYOPQLS-UHFFFAOYSA-L barium(2+) 5-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylbenzenesulfonate Chemical compound [Ba+2].C1=C(Cl)C(C)=CC(N=NC=2C3=CC=CC=C3C=CC=2O)=C1S([O-])(=O)=O.C1=C(Cl)C(C)=CC(N=NC=2C3=CC=CC=C3C=CC=2O)=C1S([O-])(=O)=O POJOORKDYOPQLS-UHFFFAOYSA-L 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 235000013405 beer Nutrition 0.000 description 1
- 230000006399 behavior Effects 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- UXKIQKIUNKKZTB-UHFFFAOYSA-N benzyl dimethyl phosphite Chemical compound COP(OC)OCC1=CC=CC=C1 UXKIQKIUNKKZTB-UHFFFAOYSA-N 0.000 description 1
- KXHPPCXNWTUNSB-UHFFFAOYSA-M benzyl(trimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)(C)CC1=CC=CC=C1 KXHPPCXNWTUNSB-UHFFFAOYSA-M 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- VCYAMSXIIWQHKV-UHFFFAOYSA-N bis(2,3,4-tribromophenyl) carbonate Chemical compound BrC1=C(Br)C(Br)=CC=C1OC(=O)OC1=CC=C(Br)C(Br)=C1Br VCYAMSXIIWQHKV-UHFFFAOYSA-N 0.000 description 1
- DSEORJACOQDMQX-UHFFFAOYSA-N bis(2,3,4-trichlorophenyl) carbonate Chemical compound ClC1=C(Cl)C(Cl)=CC=C1OC(=O)OC1=CC=C(Cl)C(Cl)=C1Cl DSEORJACOQDMQX-UHFFFAOYSA-N 0.000 description 1
- SJWFGMZZMOUDTF-UHFFFAOYSA-N bis(2-chloronaphthalen-1-yl) carbonate Chemical compound C1=CC=C2C(OC(=O)OC3=C4C=CC=CC4=CC=C3Cl)=C(Cl)C=CC2=C1 SJWFGMZZMOUDTF-UHFFFAOYSA-N 0.000 description 1
- POZGCGJFBOZPCM-UHFFFAOYSA-N bis(2-methylphenyl) carbonate Chemical compound CC1=CC=CC=C1OC(=O)OC1=CC=CC=C1C POZGCGJFBOZPCM-UHFFFAOYSA-N 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- RGCPMRIOBZXXBR-UHFFFAOYSA-N butan-1-olate;dibutyltin(2+) Chemical compound CCCCO[Sn](CCCC)(CCCC)OCCCC RGCPMRIOBZXXBR-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IKWKJIWDLVYZIY-UHFFFAOYSA-M butyl(triphenyl)phosphanium;bromide Chemical compound [Br-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CCCC)C1=CC=CC=C1 IKWKJIWDLVYZIY-UHFFFAOYSA-M 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- UBAZGMLMVVQSCD-UHFFFAOYSA-N carbon dioxide;molecular oxygen Chemical compound O=O.O=C=O UBAZGMLMVVQSCD-UHFFFAOYSA-N 0.000 description 1
- 235000012174 carbonated soft drink Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- MOIPGXQKZSZOQX-UHFFFAOYSA-N carbonyl bromide Chemical compound BrC(Br)=O MOIPGXQKZSZOQX-UHFFFAOYSA-N 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- HBHZKFOUIUMKHV-UHFFFAOYSA-N chembl1982121 Chemical compound OC1=CC=C2C=CC=CC2=C1N=NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O HBHZKFOUIUMKHV-UHFFFAOYSA-N 0.000 description 1
- 229940112822 chewing gum Drugs 0.000 description 1
- 235000015218 chewing gum Nutrition 0.000 description 1
- IPDQVJYWUCDNBB-UHFFFAOYSA-N chloroform;2,2,2-trifluoroacetic acid Chemical compound ClC(Cl)Cl.OC(=O)C(F)(F)F IPDQVJYWUCDNBB-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 239000011247 coating layer Substances 0.000 description 1
- 235000021270 cold food Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- XCJYREBRNVKWGJ-UHFFFAOYSA-N copper(II) phthalocyanine Chemical compound [Cu+2].C12=CC=CC=C2C(N=C2[N-]C(C3=CC=CC=C32)=N2)=NC1=NC([C]1C=CC=CC1=1)=NC=1N=C1[C]3C=CC=CC3=C2[N-]1 XCJYREBRNVKWGJ-UHFFFAOYSA-N 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- NBBUYPNTAABDEY-UHFFFAOYSA-N cyclobutane-1,1-diol Chemical compound OC1(O)CCC1 NBBUYPNTAABDEY-UHFFFAOYSA-N 0.000 description 1
- STENYDAIMALDKF-UHFFFAOYSA-N cyclobutane-1,3-diol Chemical compound OC1CC(O)C1 STENYDAIMALDKF-UHFFFAOYSA-N 0.000 description 1
- QYQADNCHXSEGJT-UHFFFAOYSA-N cyclohexane-1,1-dicarboxylate;hydron Chemical compound OC(=O)C1(C(O)=O)CCCCC1 QYQADNCHXSEGJT-UHFFFAOYSA-N 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 235000013365 dairy product Nutrition 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- NGDPCAMPVQYGCW-UHFFFAOYSA-N dibenzothiophene 5-oxide Chemical compound C1=CC=C2S(=O)C3=CC=CC=C3C2=C1 NGDPCAMPVQYGCW-UHFFFAOYSA-N 0.000 description 1
- DRNWASHEONIABT-UHFFFAOYSA-N dibenzyl(oxo)tin Chemical compound C=1C=CC=CC=1C[Sn](=O)CC1=CC=CC=C1 DRNWASHEONIABT-UHFFFAOYSA-N 0.000 description 1
- RDLZJCXTAYHYHX-UHFFFAOYSA-N dibenzylphosphorylmethylbenzene Chemical compound C=1C=CC=CC=1CP(CC=1C=CC=CC=1)(=O)CC1=CC=CC=C1 RDLZJCXTAYHYHX-UHFFFAOYSA-N 0.000 description 1
- SVSRQMUJHHQAAX-UHFFFAOYSA-N dibenzyltin Chemical compound C=1C=CC=CC=1C[Sn]CC1=CC=CC=C1 SVSRQMUJHHQAAX-UHFFFAOYSA-N 0.000 description 1
- YICSVBJRVMLQNS-UHFFFAOYSA-N dibutyl phenyl phosphate Chemical compound CCCCOP(=O)(OCCCC)OC1=CC=CC=C1 YICSVBJRVMLQNS-UHFFFAOYSA-N 0.000 description 1
- RJGHQTVXGKYATR-UHFFFAOYSA-L dibutyl(dichloro)stannane Chemical compound CCCC[Sn](Cl)(Cl)CCCC RJGHQTVXGKYATR-UHFFFAOYSA-L 0.000 description 1
- DTYWIPLKZHQUMW-UHFFFAOYSA-N dibutyl(diphenyl)stannane Chemical compound C=1C=CC=CC=1[Sn](CCCC)(CCCC)C1=CC=CC=C1 DTYWIPLKZHQUMW-UHFFFAOYSA-N 0.000 description 1
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 1
- YFAXVVMIXZAKSR-UHFFFAOYSA-L dichloro(diethyl)stannane Chemical compound CC[Sn](Cl)(Cl)CC YFAXVVMIXZAKSR-UHFFFAOYSA-L 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- IDUSTNHRSGBKQU-UHFFFAOYSA-N diethyl phenyl phosphite Chemical compound CCOP(OCC)OC1=CC=CC=C1 IDUSTNHRSGBKQU-UHFFFAOYSA-N 0.000 description 1
- HZHUAESPXGNNFV-UHFFFAOYSA-N diethyl(methyl)phosphane Chemical compound CCP(C)CC HZHUAESPXGNNFV-UHFFFAOYSA-N 0.000 description 1
- WBZUGMBTDHTVLI-UHFFFAOYSA-N diheptyl(oxo)tin Chemical compound CCCCCCC[Sn](=O)CCCCCCC WBZUGMBTDHTVLI-UHFFFAOYSA-N 0.000 description 1
- HRFMZHBXTDWTJD-UHFFFAOYSA-N dihexyltin Chemical compound CCCCCC[Sn]CCCCCC HRFMZHBXTDWTJD-UHFFFAOYSA-N 0.000 description 1
- YIGFHWPRNWYZAE-UHFFFAOYSA-N dihexyltin(2+);methanolate Chemical compound [O-]C.[O-]C.CCCCCC[Sn+2]CCCCCC YIGFHWPRNWYZAE-UHFFFAOYSA-N 0.000 description 1
- MSUGWOFEYLTQEV-UHFFFAOYSA-N dihydroxy-methoxy-dimethyl-$l^{5}-phosphane Chemical compound COP(C)(C)(O)O MSUGWOFEYLTQEV-UHFFFAOYSA-N 0.000 description 1
- ZXMSTCRBSAVFDO-UHFFFAOYSA-N dimethoxy(methyl)phosphane Chemical compound COP(C)OC ZXMSTCRBSAVFDO-UHFFFAOYSA-N 0.000 description 1
- XLGKKDZDZBIMRD-UHFFFAOYSA-N dimethyl phenyl phosphite Chemical compound COP(OC)OC1=CC=CC=C1 XLGKKDZDZBIMRD-UHFFFAOYSA-N 0.000 description 1
- LRMLWYXJORUTBG-UHFFFAOYSA-N dimethylphosphorylmethane Chemical compound CP(C)(C)=O LRMLWYXJORUTBG-UHFFFAOYSA-N 0.000 description 1
- ZQUZPFYNEARCQO-UHFFFAOYSA-N dinaphthalen-1-yl carbonate Chemical compound C1=CC=C2C(OC(OC=3C4=CC=CC=C4C=CC=3)=O)=CC=CC2=C1 ZQUZPFYNEARCQO-UHFFFAOYSA-N 0.000 description 1
- HGQSXVKHVMGQRG-UHFFFAOYSA-N dioctyltin Chemical compound CCCCCCCC[Sn]CCCCCCCC HGQSXVKHVMGQRG-UHFFFAOYSA-N 0.000 description 1
- SBOSGIJGEHWBKV-UHFFFAOYSA-L dioctyltin(2+);dichloride Chemical compound CCCCCCCC[Sn](Cl)(Cl)CCCCCCCC SBOSGIJGEHWBKV-UHFFFAOYSA-L 0.000 description 1
- ZHKVJZORMSRATR-UHFFFAOYSA-N diphenyl(phenylmethoxy)phosphane Chemical compound C=1C=CC=CC=1COP(C=1C=CC=CC=1)C1=CC=CC=C1 ZHKVJZORMSRATR-UHFFFAOYSA-N 0.000 description 1
- CIJWIJSYZZLMGD-UHFFFAOYSA-N diphenylphosphoryloxybenzene Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)OC1=CC=CC=C1 CIJWIJSYZZLMGD-UHFFFAOYSA-N 0.000 description 1
- BUBAPAVHHCZZMA-UHFFFAOYSA-N diphenylphosphoryloxymethylbenzene Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)OCC1=CC=CC=C1 BUBAPAVHHCZZMA-UHFFFAOYSA-N 0.000 description 1
- KUCPUSUXIGWHFB-UHFFFAOYSA-N diphenyltin Chemical compound C=1C=CC=CC=1[Sn]C1=CC=CC=C1 KUCPUSUXIGWHFB-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 238000010894 electron beam technology Methods 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 description 1
- XLADUAFJWUJPFQ-UHFFFAOYSA-N ethoxy-hydroxy-phenoxy-sulfanylidene-$l^{5}-phosphane Chemical compound CCOP(O)(=S)OC1=CC=CC=C1 XLADUAFJWUJPFQ-UHFFFAOYSA-N 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- JQVXMIPNQMYRPE-UHFFFAOYSA-N ethyl dimethyl phosphate Chemical compound CCOP(=O)(OC)OC JQVXMIPNQMYRPE-UHFFFAOYSA-N 0.000 description 1
- NMCWERWDCXNTLB-UHFFFAOYSA-N ethyl phenyl hydrogen phosphate Chemical compound CCOP(O)(=O)OC1=CC=CC=C1 NMCWERWDCXNTLB-UHFFFAOYSA-N 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 239000005357 flat glass Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 235000013611 frozen food Nutrition 0.000 description 1
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- VOZRXNHHFUQHIL-UHFFFAOYSA-N glycidyl methacrylate Chemical compound CC(=C)C(=O)OCC1CO1 VOZRXNHHFUQHIL-UHFFFAOYSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- GFMIDCCZJUXASS-UHFFFAOYSA-N hexane-1,1,6-triol Chemical compound OCCCCCC(O)O GFMIDCCZJUXASS-UHFFFAOYSA-N 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012510 hollow fiber Substances 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 235000021268 hot food Nutrition 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 238000005286 illumination Methods 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000011545 laboratory measurement Methods 0.000 description 1
- 239000002650 laminated plastic Substances 0.000 description 1
- 239000002651 laminated plastic film Substances 0.000 description 1
- 125000000400 lauroyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 235000013622 meat product Nutrition 0.000 description 1
- 238000000048 melt cooling Methods 0.000 description 1
- 239000012803 melt mixture Substances 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 239000011104 metalized film Substances 0.000 description 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- UJNZOIKQAUQOCN-UHFFFAOYSA-N methyl(diphenyl)phosphane Chemical compound C=1C=CC=CC=1P(C)C1=CC=CC=C1 UJNZOIKQAUQOCN-UHFFFAOYSA-N 0.000 description 1
- LSEFCHWGJNHZNT-UHFFFAOYSA-M methyl(triphenyl)phosphanium;bromide Chemical compound [Br-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C)C1=CC=CC=C1 LSEFCHWGJNHZNT-UHFFFAOYSA-M 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 239000003595 mist Substances 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- DNIAPMSPPWPWGF-UHFFFAOYSA-N monopropylene glycol Natural products CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical group CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- WPUMVKJOWWJPRK-UHFFFAOYSA-N naphthalene-2,7-dicarboxylic acid Chemical compound C1=CC(C(O)=O)=CC2=CC(C(=O)O)=CC=C21 WPUMVKJOWWJPRK-UHFFFAOYSA-N 0.000 description 1
- 229910052754 neon Inorganic materials 0.000 description 1
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 1
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical group C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 description 1
- 210000002445 nipple Anatomy 0.000 description 1
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000002667 nucleating agent Substances 0.000 description 1
- 230000006911 nucleation Effects 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XULSCZPZVQIMFM-IPZQJPLYSA-N odevixibat Chemical compound C12=CC(SC)=C(OCC(=O)N[C@@H](C(=O)N[C@@H](CC)C(O)=O)C=3C=CC(O)=CC=3)C=C2S(=O)(=O)NC(CCCC)(CCCC)CN1C1=CC=CC=C1 XULSCZPZVQIMFM-IPZQJPLYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 238000011017 operating method Methods 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- VPPWQRIBARKZNY-UHFFFAOYSA-N oxo(diphenyl)tin Chemical compound C=1C=CC=CC=1[Sn](=O)C1=CC=CC=C1 VPPWQRIBARKZNY-UHFFFAOYSA-N 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229920006287 phenoxy resin Polymers 0.000 description 1
- 239000013034 phenoxy resin Substances 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920003055 poly(ester-imide) Polymers 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 229920006267 polyester film Polymers 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000007639 printing Methods 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 230000010349 pulsation Effects 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000004023 quaternary phosphonium compounds Chemical class 0.000 description 1
- 239000012779 reinforcing material Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 235000012045 salad Nutrition 0.000 description 1
- 238000005488 sandblasting Methods 0.000 description 1
- 235000015067 sauces Nutrition 0.000 description 1
- 238000007650 screen-printing Methods 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 230000000391 smoking effect Effects 0.000 description 1
- 235000011888 snacks Nutrition 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000007655 standard test method Methods 0.000 description 1
- 238000013020 steam cleaning Methods 0.000 description 1
- 125000003696 stearoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000013547 stew Nutrition 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- 229920000638 styrene acrylonitrile Polymers 0.000 description 1
- 230000003746 surface roughness Effects 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- WBVCLUDHJDTUAU-UHFFFAOYSA-N tetrabenzylstannane Chemical compound C=1C=CC=CC=1C[Sn](CC=1C=CC=CC=1)(CC=1C=CC=CC=1)CC1=CC=CC=C1 WBVCLUDHJDTUAU-UHFFFAOYSA-N 0.000 description 1
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 1
- AFCAKJKUYFLYFK-UHFFFAOYSA-N tetrabutyltin Chemical compound CCCC[Sn](CCCC)(CCCC)CCCC AFCAKJKUYFLYFK-UHFFFAOYSA-N 0.000 description 1
- HWCKGOZZJDHMNC-UHFFFAOYSA-M tetraethylammonium bromide Chemical compound [Br-].CC[N+](CC)(CC)CC HWCKGOZZJDHMNC-UHFFFAOYSA-M 0.000 description 1
- RWWNQEOPUOCKGR-UHFFFAOYSA-N tetraethyltin Chemical compound CC[Sn](CC)(CC)CC RWWNQEOPUOCKGR-UHFFFAOYSA-N 0.000 description 1
- VXKWYPOMXBVZSJ-UHFFFAOYSA-N tetramethyltin Chemical compound C[Sn](C)(C)C VXKWYPOMXBVZSJ-UHFFFAOYSA-N 0.000 description 1
- BGQMOFGZRJUORO-UHFFFAOYSA-M tetrapropylammonium bromide Chemical compound [Br-].CCC[N+](CCC)(CCC)CCC BGQMOFGZRJUORO-UHFFFAOYSA-M 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- OACSUWPJZKGHHK-UHFFFAOYSA-N tribenzyl phosphate Chemical compound C=1C=CC=CC=1COP(OCC=1C=CC=CC=1)(=O)OCC1=CC=CC=C1 OACSUWPJZKGHHK-UHFFFAOYSA-N 0.000 description 1
- KKFOMYPMTJLQGA-UHFFFAOYSA-N tribenzyl phosphite Chemical compound C=1C=CC=CC=1COP(OCC=1C=CC=CC=1)OCC1=CC=CC=C1 KKFOMYPMTJLQGA-UHFFFAOYSA-N 0.000 description 1
- IFXORIIYQORRMJ-UHFFFAOYSA-N tribenzylphosphane Chemical compound C=1C=CC=CC=1CP(CC=1C=CC=CC=1)CC1=CC=CC=C1 IFXORIIYQORRMJ-UHFFFAOYSA-N 0.000 description 1
- STCOOQWBFONSKY-UHFFFAOYSA-N tributyl phosphate Chemical compound CCCCOP(=O)(OCCCC)OCCCC STCOOQWBFONSKY-UHFFFAOYSA-N 0.000 description 1
- XTTGYFREQJCEML-UHFFFAOYSA-N tributyl phosphite Chemical compound CCCCOP(OCCCC)OCCCC XTTGYFREQJCEML-UHFFFAOYSA-N 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- OHRVKCZTBPSUIK-UHFFFAOYSA-N tridodecyl phosphate Chemical compound CCCCCCCCCCCCOP(=O)(OCCCCCCCCCCCC)OCCCCCCCCCCCC OHRVKCZTBPSUIK-UHFFFAOYSA-N 0.000 description 1
- IVIIAEVMQHEPAY-UHFFFAOYSA-N tridodecyl phosphite Chemical compound CCCCCCCCCCCCOP(OCCCCCCCCCCCC)OCCCCCCCCCCCC IVIIAEVMQHEPAY-UHFFFAOYSA-N 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
- QXJQHYBHAIHNGG-UHFFFAOYSA-N trimethylolethane Chemical compound OCC(C)(CO)CO QXJQHYBHAIHNGG-UHFFFAOYSA-N 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- KOWVWXQNQNCRRS-UHFFFAOYSA-N tris(2,4-dimethylphenyl) phosphate Chemical compound CC1=CC(C)=CC=C1OP(=O)(OC=1C(=CC(C)=CC=1)C)OC1=CC=C(C)C=C1C KOWVWXQNQNCRRS-UHFFFAOYSA-N 0.000 description 1
- WTLBZVNBAKMVDP-UHFFFAOYSA-N tris(2-butoxyethyl) phosphate Chemical compound CCCCOCCOP(=O)(OCCOCCCC)OCCOCCCC WTLBZVNBAKMVDP-UHFFFAOYSA-N 0.000 description 1
- RSJKGSCJYJTIGS-BJUDXGSMSA-N undecane Chemical group CCCCCCCCCC[11CH3] RSJKGSCJYJTIGS-BJUDXGSMSA-N 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 238000009423 ventilation Methods 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000002478 γ-tocopherol Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47G—HOUSEHOLD OR TABLE EQUIPMENT
- A47G19/00—Table service
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B29—WORKING OF PLASTICS; WORKING OF SUBSTANCES IN A PLASTIC STATE IN GENERAL
- B29C—SHAPING OR JOINING OF PLASTICS; SHAPING OF MATERIAL IN A PLASTIC STATE, NOT OTHERWISE PROVIDED FOR; AFTER-TREATMENT OF THE SHAPED PRODUCTS, e.g. REPAIRING
- B29C49/00—Blow-moulding, i.e. blowing a preform or parison to a desired shape within a mould; Apparatus therefor
- B29C49/0005—Blow-moulding, i.e. blowing a preform or parison to a desired shape within a mould; Apparatus therefor characterised by the material
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/02—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds
- C08G63/12—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/16—Dicarboxylic acids and dihydroxy compounds
- C08G63/18—Dicarboxylic acids and dihydroxy compounds the acids or hydroxy compounds containing carbocyclic rings
- C08G63/199—Acids or hydroxy compounds containing cycloaliphatic rings
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/02—Polyesters derived from dicarboxylic acids and dihydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/32—Phosphorus-containing compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L101/00—Compositions of unspecified macromolecular compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Mechanical Engineering (AREA)
- Polyesters Or Polycarbonates (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Table Devices Or Equipment (AREA)
Applications Claiming Priority (19)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US73138905P | 2005-10-28 | 2005-10-28 | |
| US73145405P | 2005-10-28 | 2005-10-28 | |
| US60/731,454 | 2005-10-28 | ||
| US60/731,389 | 2005-10-28 | ||
| US73905805P | 2005-11-22 | 2005-11-22 | |
| US73886905P | 2005-11-22 | 2005-11-22 | |
| US60/738,869 | 2005-11-22 | ||
| US60/739,058 | 2005-11-22 | ||
| US75069305P | 2005-12-15 | 2005-12-15 | |
| US75068205P | 2005-12-15 | 2005-12-15 | |
| US75054705P | 2005-12-15 | 2005-12-15 | |
| US75069205P | 2005-12-15 | 2005-12-15 | |
| US60/750,693 | 2005-12-15 | ||
| US60/750,547 | 2005-12-15 | ||
| US60/750,682 | 2005-12-15 | ||
| US60/750,692 | 2005-12-15 | ||
| US11/390,629 US7803439B2 (en) | 2005-06-17 | 2006-03-28 | Blood therapy containers comprising polyester compositions formed from 2,2,4,4-tetramethyl-1,3-cyclobutanediol and 1,4-cyclohexanedimethanol |
| US11/390,629 | 2006-03-28 | ||
| PCT/US2006/042292 WO2007053549A1 (en) | 2005-10-28 | 2006-10-27 | Polyester compositions containing cyclobutanediol having a certain combination of inherent viscosity and moderate glass transition temperature and articles made therefrom |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BRPI0617941A2 true BRPI0617941A2 (pt) | 2010-03-30 |
Family
ID=36691484
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BRPI0617941-0A BRPI0617941A2 (pt) | 2005-10-28 | 2006-10-27 | composição de poliéster, artigo de manufatura, filme ou folha, artigo moldado por injeção, combinação, e, processo para a produção do poliéster |
| BRPI0617940-1A BRPI0617940A2 (pt) | 2005-10-28 | 2006-10-27 | composição de poliéster, artigo de manufatura, filme ou folha, artigo moldado por injeção, combinação, e, processo para a produção do poliéster |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BRPI0617940-1A BRPI0617940A2 (pt) | 2005-10-28 | 2006-10-27 | composição de poliéster, artigo de manufatura, filme ou folha, artigo moldado por injeção, combinação, e, processo para a produção do poliéster |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US20070105993A1 (https=) |
| EP (2) | EP1940909B1 (https=) |
| JP (1) | JP2009513237A (https=) |
| CN (2) | CN101300285B (https=) |
| AT (1) | ATE444981T1 (https=) |
| BR (2) | BRPI0617941A2 (https=) |
| DE (1) | DE602006009691D1 (https=) |
| WO (1) | WO2007050118A1 (https=) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US9598533B2 (en) | 2005-11-22 | 2017-03-21 | Eastman Chemical Company | Polyester compositions containing cyclobutanediol having a certain combination of inherent viscosity and moderate glass transition temperature and articles made therefrom |
| US9169388B2 (en) | 2006-03-28 | 2015-10-27 | Eastman Chemical Company | Polyester compositions which comprise cyclobutanediol and certain thermal stabilizers, and/or reaction products thereof |
| EP2126623B1 (en) * | 2007-03-08 | 2014-05-14 | OKIA Optical Co. Ltd. | Eyeglasses and eyeglass frames comprising glycol modified copolyesters |
| US7748137B2 (en) * | 2007-07-15 | 2010-07-06 | Yin Wang | Wood-drying solar greenhouse |
| US9062197B2 (en) * | 2009-03-27 | 2015-06-23 | Eastman Chemical Company | Polyester blends |
| US8669314B2 (en) | 2012-02-03 | 2014-03-11 | Sabic Innovative Plastics Ip B.V. | Hydrolytic stability in polycarbonate compositions |
| US20130217830A1 (en) | 2012-02-16 | 2013-08-22 | Eastman Chemical Company | Clear Semi-Crystalline Articles with Improved Heat Resistance |
| US9273206B2 (en) | 2012-07-09 | 2016-03-01 | Eastman Chemical Company | Ternary blends of terephthalate or isophthalate polyesters containing EG, CHDM and TMCD |
| WO2019018345A1 (en) * | 2017-07-20 | 2019-01-24 | Eastman Chemical Company | POLYMER COMPOSITIONS COMPRISING CRYSTALLINE POLYMERS AND A STABILIZER COMPOSITION |
| EP3655476B1 (en) | 2017-07-20 | 2026-03-18 | Eastman Chemical Company | Polymer compositions having improved properties of thermal stability, color, and/or flow |
| CN107604379B (zh) * | 2017-09-25 | 2024-11-08 | 典石科技(常州)有限公司 | 一种spe膜电极及其制备工艺 |
| WO2020114492A1 (en) | 2018-12-06 | 2020-06-11 | Eastman Chemical (China) Co., Ltd. | Adhesive compositions with polyesters comprising 2, 2, 4, 4-tetraalkyl-1, 3-cyclobutanediol and methods of making thereof |
| WO2020150209A1 (en) | 2019-01-18 | 2020-07-23 | Eastman Chemical Company | Polymer compositions with improved weathering resistance |
| WO2021016911A1 (en) * | 2019-07-31 | 2021-02-04 | Eastman Chemical (China) Co., Ltd. | Polyester articles having an improved hard-coat |
| CN111100449A (zh) * | 2019-12-03 | 2020-05-05 | 天津金发新材料有限公司 | 一种聚酰胺组合物及其制备方法 |
| WO2026044602A1 (en) * | 2024-08-29 | 2026-03-05 | Eastman Chemical (China) Co., Ltd. | Polyester resin composition with improved light transmittance |
Family Cites Families (124)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE592181A (https=) * | 1955-12-22 | |||
| BE570531A (https=) | 1957-08-22 | |||
| US3030335A (en) * | 1959-01-02 | 1962-04-17 | Gen Electric | Aromatic polycarbonate reaction products |
| FR1278284A (fr) * | 1959-12-18 | 1961-12-08 | Kodak Pathe | Nouveaux polymères dérivés des 2, 2, 4, 4-tétraalcoyl-1, 3-cyclobutanediols et leurs applications industrielles |
| FR83790E (fr) * | 1959-12-18 | 1964-10-09 | Kodak Pathe | Nouveaux polymères dérivés des 2, 2, 4, 4-tétraalcoyl-1, 3-cyclobutanediols et leurs applications industrielles |
| US3313777A (en) * | 1959-12-18 | 1967-04-11 | Eastman Kodak Co | Linear polyesters and polyester-amides from 2, 2, 4, 4-tetraalkyl-1, 3-cyclobutanediols |
| US3207814A (en) | 1961-01-03 | 1965-09-21 | Gen Electric | Carbonate-polyester copolymer resinous compositions |
| US3091600A (en) * | 1961-01-05 | 1963-05-28 | Eastman Kodak Co | Linear aromatic acid copolyesters modified with dimer glycols having 36 carbons |
| GB951818A (en) * | 1961-08-18 | 1964-03-11 | Kunoshima Kagaku Kogyo Kabushi | Polyester moulding materials |
| US3317466A (en) * | 1961-09-14 | 1967-05-02 | Eastman Kodak Co | Three-dimensional polycyclic bisphenol polycarbonates and polyesters |
| US3544514A (en) * | 1965-01-15 | 1970-12-01 | Bayer Ag | Process for the production of thermoplastic polycarbonates |
| US3541059A (en) * | 1967-04-19 | 1970-11-17 | Calgon C0Rp | Novel reaction products of glycidyl esters and alkali metal sulfite or bisulfite,and polymers thereof |
| US3502620A (en) * | 1967-05-11 | 1970-03-24 | Eastman Kodak Co | Branched polyesters containing terminal carboxyl groups |
| US3546177A (en) * | 1968-03-07 | 1970-12-08 | Eastman Kodak Co | Polyesters containing sterically hindered trialkyl phosphates |
| UST873016I4 (en) * | 1969-11-28 | 1970-04-28 | Defensive publication | |
| BE794938A (fr) | 1972-02-02 | 1973-08-02 | Eastman Kodak Co | Nouveau procede de preparation de copolyesters et applications |
| US3915913A (en) * | 1972-08-15 | 1975-10-28 | Eastman Kodak Co | Hot melt polymer blends |
| US3799953A (en) * | 1972-09-01 | 1974-03-26 | Bayer Ag | 1,4-bis(4,'4''-dihydroxy-triphenylmethyl)benzene |
| US3907754A (en) * | 1974-06-19 | 1975-09-23 | Eastman Kodak Co | Process and catalyst-inhibitor system for preparing synthetic linear polyester |
| US4056504A (en) * | 1974-08-16 | 1977-11-01 | Bayer Aktiengesellschaft | Polycarbonate molding compositions |
| US3962189A (en) * | 1974-11-01 | 1976-06-08 | Eastman Kodak Company | Process and catalyst-inhibitor systems for preparing synthetic linear polyesters |
| US4185009A (en) * | 1975-01-03 | 1980-01-22 | Bayer Aktiengesellschaft | Branched, high-molecular weight thermoplastic polycarbonates |
| US4001184A (en) * | 1975-03-31 | 1977-01-04 | General Electric Company | Process for preparing a branched polycarbonate |
| US4010145A (en) * | 1975-05-12 | 1977-03-01 | Eastman Kodak Company | Process and catalyst inhibitor systems for preparing synthetic linear polyesters |
| US4046933A (en) * | 1975-09-16 | 1977-09-06 | Ppg Industries, Inc. | Laminated window structure and its method of fabrication |
| US4156069A (en) | 1976-04-02 | 1979-05-22 | Allied Chemical Corporation | Bisphenol-A/terephthalate/carbonate melt processable copolymers |
| US4084889A (en) * | 1976-07-28 | 1978-04-18 | Vischer Optics, Inc. | Eyeglass frame |
| US4125572A (en) * | 1976-12-14 | 1978-11-14 | General Electric Company | Thermoplastic molding composition |
| US4188314A (en) * | 1976-12-14 | 1980-02-12 | General Electric Company | Shaped article obtained from a carbonate-polyester composition |
| US4391954A (en) * | 1976-12-14 | 1983-07-05 | General Electric Company | Thermoplastic molding composition |
| DE2842004A1 (de) * | 1978-09-27 | 1980-04-10 | Bayer Ag | Verfahren zur herstellung von modifizierten polycarbonat-formmassen |
| US4194038A (en) | 1979-01-25 | 1980-03-18 | Allied Chemical Corporation | Poly(ester-carbonates) from dicarboxylic acid chlorides |
| EP0078609B1 (en) * | 1980-04-30 | 1987-05-06 | Imperial Chemical Industries Plc | 3-hydroxybutyric acid polymers |
| US4430484A (en) | 1981-01-14 | 1984-02-07 | General Electric Company | Polyester-carbonate resin blends |
| US4356299A (en) * | 1982-02-04 | 1982-10-26 | Rohm And Haas Company | Catalyst system for a polyethylene terephthalate polycondensation |
| US4384106A (en) * | 1982-03-09 | 1983-05-17 | Owens-Illinois, Inc. | Copolyesters |
| US4424140A (en) * | 1982-06-03 | 1984-01-03 | Union Carbide Corporation | Stabilization of polycondensation catalysts |
| US4431793A (en) * | 1982-06-09 | 1984-02-14 | General Electric Company | Aromatic polycarbonate end capped with branched chain alkyl acyl halide or acid |
| US4786692A (en) * | 1982-12-20 | 1988-11-22 | General Electric Company | High strength, reduced heat distortion temperature thermoplastic composition |
| US4469861A (en) * | 1982-12-27 | 1984-09-04 | General Electric Company | Polycarbonate composition from branched chain dihydric phenol |
| US4465820A (en) | 1983-06-03 | 1984-08-14 | General Electric Company | Copolyestercarbonates |
| US4452933A (en) | 1983-06-09 | 1984-06-05 | General Electric Company | Stabilized polyester-polycarbonate blends and stabilization process therefor |
| US4426512A (en) * | 1983-06-09 | 1984-01-17 | Eastman Kodak Company | Polyester containers having improved gas barrier properties |
| US4480086A (en) * | 1983-09-09 | 1984-10-30 | Eastman Kodak Company | Radiation-resistant copolyesters |
| US4939186A (en) * | 1984-02-10 | 1990-07-03 | General Electric Company | Enhancing color stability to sterilizing radiation of polymer compositions |
| US4587437A (en) * | 1984-03-19 | 1986-05-06 | Rockwell International Corporation | Coupling/decoupling capacitor multiplier |
| AU603076B2 (en) * | 1985-12-09 | 1990-11-08 | W.R. Grace & Co.-Conn. | Polymeric products and their manufacture |
| JPH0741907B2 (ja) * | 1986-12-27 | 1995-05-10 | 三菱瓦斯化学株式会社 | 多層容器 |
| SE8702840D0 (sv) * | 1987-07-10 | 1987-07-10 | Plm Ab | Barrierforsterkning |
| US4749773A (en) * | 1987-07-27 | 1988-06-07 | Eastman Kodak Company | Condensation polymers containing methine ultraviolet radiation-absorbing residues and shaped articles produced therefrom |
| JP2608429B2 (ja) * | 1987-11-09 | 1997-05-07 | 東レ・ダウコーニング・シリコーン株式会社 | パターン形成用材料およびパターン形成方法 |
| US4882412A (en) * | 1987-11-30 | 1989-11-21 | Eastman Kodak Company | Polyester polymer containing the residue of the UV absorbing benzopyran compound and shaped articles produced therefrom |
| US4981898A (en) | 1987-12-31 | 1991-01-01 | General Electric Company | Polycarbonate-polyester blends |
| US4826903A (en) * | 1988-02-22 | 1989-05-02 | Eastman Kodak Company | Condensation polymer containing the residue of an acyloxystyrl compound and shaped articles produced therefrom |
| US4892923A (en) * | 1988-02-22 | 1990-01-09 | Eastman Kodak Company | Polyester compositions containing the residue of a naphthopyran compound and shaped articles produced therefrom |
| US4976057A (en) * | 1988-07-21 | 1990-12-11 | Bianchi Dennis R | Simulated neon sign |
| US4845188A (en) * | 1988-08-19 | 1989-07-04 | Eastman Kodak Company | Condensation polymers containing methine ultraviolet radiation-absorbing residues and shaped articles produced therefrom |
| US4937134A (en) * | 1989-04-17 | 1990-06-26 | The Dow Chemical Company | Elastomeric optical interference films |
| US5326584A (en) * | 1989-04-24 | 1994-07-05 | Drexel University | Biocompatible, surface modified materials and method of making the same |
| US5191038A (en) * | 1989-06-01 | 1993-03-02 | General Electric Company | Preparation of branched polycarbonate composition from cyclic aromatic polycarbonate oligomer, polyhydric phenol and polycarbonate |
| US5224958A (en) * | 1990-05-04 | 1993-07-06 | The Research Foundation Of State University Of New York | Silicone elastomer line prosthetic devices and methods of manufacture |
| US5017680A (en) * | 1990-07-03 | 1991-05-21 | Eastman Kodak Company | Process and catalyst-inhibitor systems for preparing poly(ethylene terephthalate) |
| US5486562A (en) * | 1990-07-12 | 1996-01-23 | General Electric Company | Modifications of poly(alkylene cyclohexanedicarboxylate) blends |
| AU649710B2 (en) * | 1990-09-11 | 1994-06-02 | Mitsubishi Gas Chemical Company, Inc. | Polyamide resin composition and film therefrom |
| US5219510A (en) * | 1990-09-26 | 1993-06-15 | Eastman Kodak Company | Method of manufacture of cellulose ester film |
| US5104450A (en) * | 1990-09-26 | 1992-04-14 | Eastman Kodak Company | Formulations of cellulose esters with arylene-bis(diaryl phosphate)s |
| DE4036359A1 (de) * | 1990-11-15 | 1992-05-21 | Hoechst Ag | Verfahren zur verminderung der verfaerbung einer kunststoff-formmasse bei der verarbeitungstemperatur |
| US5292783A (en) * | 1990-11-30 | 1994-03-08 | Eastman Kodak Company | Aliphatic-aromatic copolyesters and cellulose ester/polymer blends |
| US5118760A (en) * | 1990-12-26 | 1992-06-02 | Eastman Kodak Company | Impact resistant polymer blends |
| US5142088A (en) * | 1991-01-28 | 1992-08-25 | General Electric Company | Preparation of branched polycarbonates and chloroformates, and intermediates therefor |
| US5434227A (en) * | 1991-05-08 | 1995-07-18 | Daicel Chemical Industries, Ltd. | Process for producing polycarbonate |
| US5310787A (en) * | 1991-06-04 | 1994-05-10 | Du Pont-Mitsui Polychemicals Co., Ltd. | Polyester packaging material |
| EP0535930B1 (en) * | 1991-10-04 | 1997-01-02 | Oki Electric Industry Co., Ltd. | Thermoreversible recording material, thermoreversible recording medium and recording method |
| JP2797804B2 (ja) * | 1992-01-09 | 1998-09-17 | 日本電気株式会社 | バックライト及び液晶表示装置 |
| JPH05247325A (ja) * | 1992-02-27 | 1993-09-24 | Toray Ind Inc | 耐熱食器用ポリエステル樹脂組成物 |
| US5207967A (en) * | 1992-03-02 | 1993-05-04 | Eastman Kodak Company | Multicomponent polyester/polycarbonate blends with improved impact strength and processability |
| US5494992A (en) * | 1993-01-29 | 1996-02-27 | Daicel Chemical Industries, Ltd. | (Co)polycarbonate and process for producing the same |
| US5288764A (en) * | 1993-01-29 | 1994-02-22 | Amoco Corporation | Increased throughput in foaming and other melt fabrication of polyester |
| US5372879A (en) * | 1993-02-22 | 1994-12-13 | Teijin Limited | Biaxially oriented polyester film |
| CN1099044A (zh) * | 1993-04-16 | 1995-02-22 | 大世吕化学工业株式会社 | (共)聚碳酸酯的制备方法 |
| US5372864A (en) * | 1993-09-03 | 1994-12-13 | Eastman Chemical Company | Toners for polyesters |
| IL110514A0 (en) | 1993-10-04 | 1994-10-21 | Eastman Chem Co | Concentrates for improving polyester compositions and a method for preparing such compositions |
| US5354791A (en) * | 1993-10-19 | 1994-10-11 | General Electric Company | Epoxy-functional polyester, polycarbonate with metal phosphate |
| EP0698631B1 (en) * | 1994-08-25 | 2002-12-04 | Nkk Corporation | Ester copolymer resin, alloy thereof and packaging material using the same |
| US5498668A (en) * | 1994-10-31 | 1996-03-12 | Eastman Chemical Company | Blends of certain polyesters with acrylics |
| JP3448158B2 (ja) * | 1995-05-31 | 2003-09-16 | シエル・インターナシヨネイル・リサーチ・マーチヤツピイ・ベー・ウイ | コポリエステル組成物 |
| US5696176A (en) | 1995-09-22 | 1997-12-09 | Eastman Chemical Company | Foamable polyester compositions having a low level of unreacted branching agent |
| US5608031A (en) * | 1995-11-30 | 1997-03-04 | Eastman Chemical Company | Polyesters modified with 1,4-cyclohexaned imethanol having high clarity prepared utilizing an antimony containing catalyst/stabilizer system |
| TW381104B (en) * | 1996-02-20 | 2000-02-01 | Eastman Chem Co | Process for preparing copolyesters of terephthalic acid, ethylene glycol, and 1,4-cyclohexanedimethanol |
| US6022603A (en) * | 1996-04-05 | 2000-02-08 | Teijin Limited | Ethylene terephthalate/ethylene-2,6-naphthalene-dicarboxylate copolymers for bottles |
| DE19620420A1 (de) * | 1996-05-21 | 1997-11-27 | Basf Ag | Eßbesteck aus thermoplastischen Hochleistungs-Kunststoffen |
| US5977347A (en) * | 1996-07-30 | 1999-11-02 | Daicel Chemical Industries, Ltd. | Cellulose acetate propionate |
| JPH1046021A (ja) * | 1996-08-07 | 1998-02-17 | Nippon G Ii Plast Kk | 耐洗剤性に優れた食器 |
| US6043322A (en) * | 1996-12-28 | 2000-03-28 | Eastman Chemical Company | Clear polycarbonate and polyester blends |
| US6011124A (en) * | 1996-12-28 | 2000-01-04 | Eastman Chemical Company | Blends of bisphenol a polycarbonate and polyesters |
| US5942585A (en) * | 1996-12-28 | 1999-08-24 | Eastman Chemical Company | Polycarbonate and polyester blends |
| US5989663A (en) * | 1996-12-30 | 1999-11-23 | Eastman Chemical Company | Blow-molding polyesters from terephthalic acid, 2, 2, 4, 4-tetramethyl-1,3-cyclobutanediol, and ethylene glycol |
| DE19727709A1 (de) * | 1997-06-30 | 1999-01-07 | Bayer Ag | Verfahren zur Herstellung von verzweigten Polycarbonaten |
| FR2766964B1 (fr) * | 1997-07-29 | 1999-10-29 | Pixtech Sa | Procede d'assemblage sous vide d'un ecran plat de visualisation |
| US5907026A (en) * | 1997-08-27 | 1999-05-25 | General Electric Company | Polycarbonate compositions comprising polyester resins and ultraviolet light absorbers |
| JP3445151B2 (ja) * | 1998-05-28 | 2003-09-08 | 帝人株式会社 | 食 器 |
| AR018672A1 (es) * | 1998-06-15 | 2001-11-28 | Eastman Chem Co | Una composicion de combinaciones de poliester /fenilendi(oxiacetico), acido copoliester, que tienen mejoradas propiedades de barrera de gases |
| US5962625A (en) * | 1998-06-24 | 1999-10-05 | Eastman Chemical Company | High clarity polyester containing sub-visual antimony phosphate derivatives particles |
| US6211309B1 (en) * | 1998-06-29 | 2001-04-03 | Basf Corporation | Water-dispersable materials |
| US6120889A (en) * | 1999-06-03 | 2000-09-19 | Eastman Chemical Company | Low melt viscosity amorphous copolyesters with enhanced glass transition temperatures |
| US7176252B2 (en) * | 1999-07-29 | 2007-02-13 | Dover Chemical Corporation | Solid melt blended phosphite composites |
| US6352783B1 (en) * | 1999-12-13 | 2002-03-05 | Eastman Kodak Company | Copolyester containing 4,4'-biphenyldicarboxylic acid, 1,4-cyclohexanedimethanol and an ultraviolet light absorbing compound and articles made therefrom |
| US6225436B1 (en) * | 2000-04-07 | 2001-05-01 | The Dow Chemical Company | Polycarbonate preparation process |
| US6593425B2 (en) * | 2000-05-31 | 2003-07-15 | General Electric Company | Data storage media containing transparent polycarbonate blends |
| US6458915B1 (en) * | 2000-10-13 | 2002-10-01 | Eastman Chemical Company | Process for producing poly(1,4-cyclohexylenedimethylene 1,4-cyclohexanedicarboxylate) and the reactor grade polyester therefrom |
| US6448334B1 (en) * | 2000-12-19 | 2002-09-10 | General Electric Company | Translucent polycarbonate composition, method for preparation thereof, and articles derived therefrom |
| US6635698B2 (en) * | 2000-12-22 | 2003-10-21 | General Electric Company | Flame retardant polycarbonate polyester composition |
| US6323304B1 (en) * | 2001-01-12 | 2001-11-27 | General Electric Company | Melt polycarbonate catalyst systems |
| SE523615C2 (sv) * | 2001-10-25 | 2004-05-04 | Sandvik Ab | Roterbart verktyg för spånavskiljande bearbetning med kopplingsanordning med koniska stödytor |
| US6504002B1 (en) * | 2001-12-21 | 2003-01-07 | General Electric Company | Process for the production of branched melt polycarbonate by late addition of fries-inducing catalyst |
| US20030195295A1 (en) * | 2002-04-16 | 2003-10-16 | General Electric Company | Miscible blends of polyesters and polycarbonates with good thermal characteristics, and related processes and articles |
| KR20050073592A (ko) * | 2002-10-31 | 2005-07-14 | 미쓰비시 가가꾸 가부시키가이샤 | 폴리에스테르 수지, 폴리에스테르 수지 조성물 및 이것을사용하여 얻어지는 시트, 필름 그리고 중공 성형 용기 |
| CN1809766B (zh) * | 2003-06-17 | 2010-05-26 | 帝人化成株式会社 | 正下型背光式液晶显示装置及光漫射板 |
| US20050010017A1 (en) * | 2003-07-11 | 2005-01-13 | Blakely Dale Milton | Addition of UV inhibitors to pet process for maximum yield |
| US7235623B2 (en) * | 2003-11-26 | 2007-06-26 | Eastman Chemical Company | Polyester compositions for calendering |
| US20060094858A1 (en) * | 2004-10-28 | 2006-05-04 | Turner Sam R | Novel copolyester compositions with improved impact strength at low temperatures |
| US7582690B2 (en) * | 2004-11-19 | 2009-09-01 | Eastman Chemical Company | Stabilized aliphatic polyester compositions |
| US20060270773A1 (en) * | 2005-05-26 | 2006-11-30 | Hale Wesley R | Polyester-polycarbonate blends for diffuser sheets with improved luminance |
| US20060270806A1 (en) * | 2005-05-26 | 2006-11-30 | Hale Wesley R | Miscible high Tg polyester/polymer blend compositions and films formed therefrom |
-
2006
- 2006-03-30 JP JP2008537683A patent/JP2009513237A/ja active Pending
- 2006-03-30 WO PCT/US2006/012627 patent/WO2007050118A1/en not_active Ceased
- 2006-03-30 EP EP06749318A patent/EP1940909B1/en not_active Expired - Lifetime
- 2006-03-30 AT AT06749318T patent/ATE444981T1/de not_active IP Right Cessation
- 2006-03-30 EP EP09012590A patent/EP2156935A3/en not_active Ceased
- 2006-03-30 DE DE602006009691T patent/DE602006009691D1/de not_active Expired - Lifetime
- 2006-10-27 US US11/588,883 patent/US20070105993A1/en not_active Abandoned
- 2006-10-27 BR BRPI0617941-0A patent/BRPI0617941A2/pt not_active IP Right Cessation
- 2006-10-27 CN CN2006800404333A patent/CN101300285B/zh active Active
- 2006-10-27 BR BRPI0617940-1A patent/BRPI0617940A2/pt not_active IP Right Cessation
- 2006-10-27 CN CN2006800401246A patent/CN101296992B/zh active Active
Also Published As
| Publication number | Publication date |
|---|---|
| US20070105993A1 (en) | 2007-05-10 |
| EP2156935A2 (en) | 2010-02-24 |
| BRPI0617940A2 (pt) | 2010-03-30 |
| EP1940909B1 (en) | 2009-10-07 |
| JP2009513237A (ja) | 2009-04-02 |
| WO2007050118A1 (en) | 2007-05-03 |
| CN101296992B (zh) | 2013-08-07 |
| CN101296992A (zh) | 2008-10-29 |
| EP1940909A1 (en) | 2008-07-09 |
| CN101300285B (zh) | 2012-11-21 |
| DE602006009691D1 (de) | 2009-11-19 |
| CN101300285A (zh) | 2008-11-05 |
| EP2156935A3 (en) | 2010-07-28 |
| ATE444981T1 (de) | 2009-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR101410122B1 (ko) | 사이클로뷰테인다이올 및 특정 열 안정화제, 및/또는이들의 반응 생성물을 포함하는 폴리에스터 조성물 | |
| US8507638B2 (en) | Polyester compositions containing cyclobutanediol having a certain combination of inherent viscosity and moderate glass transition temperature and articles made therefrom | |
| US20070106054A1 (en) | Polyester compositions containing cyclobutanediol having a certain combination of inherent viscosity and high glass transition temperature and articles made therefrom | |
| US20100087574A1 (en) | Polyester compositions containing cyclobutanediol having a certain combination of inherent viscosity and moderate glass transition temperature and articles made therefrom | |
| US9765203B2 (en) | Polyester compositions which comprise cyclobutanediol and certain thermal stabilizers, and/or reaction products thereof | |
| US10017606B2 (en) | Polyester compositions containing cyclobutanediol having a certain combination of inherent viscosity and moderate glass transition temperature and articles made therefrom | |
| US20070100122A1 (en) | Polyester compositions containing cyclobutanediol and articles made therefrom | |
| BRPI0617941A2 (pt) | composição de poliéster, artigo de manufatura, filme ou folha, artigo moldado por injeção, combinação, e, processo para a produção do poliéster | |
| US20100298523A1 (en) | Polyester Compositions Which Comprise Cyclobutanediol and at Least One Phosphorus Compound | |
| US20100184940A1 (en) | Polyester Compositions Which Comprise Cyclobutanediol and Certain Thermal Stabilizers, and/or Reaction Products Thereof | |
| US8193302B2 (en) | Polyester compositions which comprise cyclobutanediol and certain phosphate thermal stabilizers, and/or reaction products thereof | |
| WO2007126855A1 (en) | Polyester compositions which comprise cyclobutanediol and certain thermal stabilizers, and/or reaction products thereof | |
| US20100096589A1 (en) | Polyester compositions containing low amounts of cyclobutanediol and articles made therefrom | |
| US20070100125A1 (en) | Polyester compositions comprising minimal amounts of cyclobutanediol | |
| EP2332592B1 (en) | Polyester compositions containing 2,2,4,4-tetramethyl-1,3-cyclobutanediol having a particular combination of inherent viscosity and moderate glass transition temperature and articles therefrom | |
| BRPI0617960A2 (pt) | composição de poliéster, artigo de manufatura, e, processo para a produção de pelo menos um poliéster | |
| HK1120531B (en) | Polyester compositions containing cyclobutanediol having a certain combination of inherent viscosity and moderate glass transition temperature and articles made therefrom |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| B08F | Application dismissed because of non-payment of annual fees [chapter 8.6 patent gazette] |
Free format text: REFERENTE A 5A ANUIDADE. |
|
| B08K | Patent lapsed as no evidence of payment of the annual fee has been furnished to inpi [chapter 8.11 patent gazette] |
Free format text: REFERENTE AO DESPACHO 8.6 PUBLICADO NA RPI 2161 DE 05/06/2012. |