BG60835B2 - Епинен естер, метод за получаването му и лекарства - Google Patents
Епинен естер, метод за получаването му и лекарства Download PDFInfo
- Publication number
- BG60835B2 BG60835B2 BG098591A BG9859194A BG60835B2 BG 60835 B2 BG60835 B2 BG 60835B2 BG 098591 A BG098591 A BG 098591A BG 9859194 A BG9859194 A BG 9859194A BG 60835 B2 BG60835 B2 BG 60835B2
- Authority
- BG
- Bulgaria
- Prior art keywords
- epinine
- compounds
- formula
- preparation
- carbon atoms
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 27
- 238000000034 method Methods 0.000 title claims abstract description 9
- 238000002360 preparation method Methods 0.000 title claims abstract description 4
- 239000003814 drug Substances 0.000 claims abstract 2
- NGKZFDYBISXGGS-UHFFFAOYSA-N Epinine Natural products CNCCC1=CC=C(O)C(O)=C1 NGKZFDYBISXGGS-UHFFFAOYSA-N 0.000 claims description 19
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 11
- -1 Epinine ester Chemical class 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 6
- 230000010933 acylation Effects 0.000 claims description 4
- 238000005917 acylation reaction Methods 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- GNWNHNPGRZBUAN-UHFFFAOYSA-N carbonic acid;chloromethylbenzene Chemical compound OC(O)=O.ClCC1=CC=CC=C1 GNWNHNPGRZBUAN-UHFFFAOYSA-N 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 2
- 239000011707 mineral Substances 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 231100000252 nontoxic Toxicity 0.000 claims description 2
- 230000003000 nontoxic effect Effects 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 239000000969 carrier Substances 0.000 claims 1
- 239000000546 pharmaceutical excipient Substances 0.000 claims 1
- 230000000144 pharmacologic effect Effects 0.000 abstract description 4
- 231100000419 toxicity Toxicity 0.000 abstract description 2
- 230000001988 toxicity Effects 0.000 abstract description 2
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 229960003638 dopamine Drugs 0.000 description 9
- 230000037396 body weight Effects 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 4
- 230000001225 therapeutic effect Effects 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 230000036772 blood pressure Effects 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 2
- ACICAVVXAAEHEM-UHFFFAOYSA-N 4-[2-(methylamino)ethyl]benzene-1,2-diol;hydrobromide Chemical compound Br.CNCCC1=CC=C(O)C(O)=C1 ACICAVVXAAEHEM-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 150000001263 acyl chlorides Chemical class 0.000 description 2
- 150000001412 amines Chemical group 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 230000017531 blood circulation Effects 0.000 description 2
- 229910021538 borax Inorganic materials 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 230000008602 contraction Effects 0.000 description 2
- 230000034994 death Effects 0.000 description 2
- 231100000517 death Toxicity 0.000 description 2
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 238000001802 infusion Methods 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000033764 rhythmic process Effects 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000004328 sodium tetraborate Substances 0.000 description 2
- 235000010339 sodium tetraborate Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 2
- 239000001384 succinic acid Substances 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- ZRNSCURSJJRPGN-UHFFFAOYSA-N 4-[2-(ethylamino)ethyl]benzene-1,2-diol Chemical compound CCNCCC1=CC=C(O)C(O)=C1 ZRNSCURSJJRPGN-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 102000015554 Dopamine receptor Human genes 0.000 description 1
- 108050004812 Dopamine receptor Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- OJIJMOLDUSMOIK-UHFFFAOYSA-N [4-(2-aminoethyl)-2-(2-methylpropanoyloxy)phenyl] 2-methylpropanoate Chemical compound CC(C)C(=O)OC1=CC=C(CCN)C=C1OC(=O)C(C)C OJIJMOLDUSMOIK-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 102000012740 beta Adrenergic Receptors Human genes 0.000 description 1
- 108010079452 beta Adrenergic Receptors Proteins 0.000 description 1
- 230000000035 biogenic effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 206010007625 cardiogenic shock Diseases 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 230000010247 heart contraction Effects 0.000 description 1
- 230000000004 hemodynamic effect Effects 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 1
- 230000004526 pharmaceutical effect Effects 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C46/00—Preparation of quinones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT26074/76A IT1074038B (it) | 1976-08-05 | 1976-08-05 | Esteri della epinina |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BG60835B2 true BG60835B2 (bg) | 1996-04-30 |
Family
ID=11218576
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BG098591A BG60835B2 (bg) | 1976-08-05 | 1994-02-25 | Епинен естер, метод за получаването му и лекарства |
Country Status (17)
| Country | Link |
|---|---|
| US (2) | US4218470A (cs) |
| JP (1) | JPS6023102B2 (cs) |
| BE (1) | BE857546A (cs) |
| BG (1) | BG60835B2 (cs) |
| CA (1) | CA1113117A (cs) |
| CH (1) | CH629178A5 (cs) |
| CY (1) | CY1164A (cs) |
| DE (1) | DE2734678C2 (cs) |
| ES (1) | ES461399A1 (cs) |
| FR (1) | FR2360558A1 (cs) |
| GB (1) | GB1551661A (cs) |
| HK (1) | HK12084A (cs) |
| IT (1) | IT1074038B (cs) |
| KE (1) | KE3238A (cs) |
| MX (1) | MX9203179A (cs) |
| MY (1) | MY8300216A (cs) |
| NL (1) | NL182878C (cs) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1190925B (it) * | 1982-07-22 | 1988-02-24 | Simes | Esteri dell'epinina |
| FI832128A0 (fi) * | 1983-06-14 | 1983-06-14 | Farmos Oy | Foerfarande foer framstaellning av en amin |
| IT1194325B (it) * | 1983-07-19 | 1988-09-14 | Simes | Composizioni farmaceutiche comprendenti epinina o un suo sale farmaceuticamente accettabile e loro uso terapeutico |
| US4562206A (en) * | 1983-12-23 | 1985-12-31 | Key Pharmaceuticals, Inc. | Orally effective inotropic compounds |
| IT1178800B (it) * | 1984-12-27 | 1987-09-16 | Simes | Composizioni farmaceutiche e loro uso come midriatici |
| IT1226796B (it) * | 1988-07-15 | 1991-02-19 | Simes | Composizione farmaceutica utile per il trattamento di malattie cardiovascolari. |
| US5246949A (en) * | 1989-12-06 | 1993-09-21 | Sansho Co., Ltd. | Preparation for endermism containing dopamine derivatives |
| GB9217099D0 (en) * | 1992-08-12 | 1992-09-23 | British Tech Group | Pharmaceutical compositions |
| US20030021880A1 (en) * | 2001-01-18 | 2003-01-30 | Russ Egbert | Methods of increasing hardness of food products |
| US6787044B1 (en) * | 2003-03-10 | 2004-09-07 | Archimedes Technology Group, Inc. | High frequency wave heated plasma mass filter |
| DE602004022150D1 (de) * | 2003-03-27 | 2009-09-03 | Childrens Hosp Medical Center | Verfahren und kit zum nachweis des frühstadiums einer nierentubuluszellenverletzung |
| ITMI20040146A1 (it) * | 2004-01-30 | 2004-04-30 | Acraf | Ibopamina maleato metodo per prepararlo e composizioni farmaceutiche che lo comprendono |
| US20050272101A1 (en) * | 2004-06-07 | 2005-12-08 | Prasad Devarajan | Method for the early detection of renal injury |
| EP3489689B1 (en) * | 2004-12-20 | 2020-06-17 | Antibodyshop A/S | Determination of neutrophil gelatinase-associated lipocalin (ngal) as a diagnostic marker for renal disorders |
| US20070037232A1 (en) * | 2005-03-31 | 2007-02-15 | Barasch Jonathan M | Detection of NGAL in chronic renal disease |
| US20090197280A1 (en) | 2006-05-30 | 2009-08-06 | Kristian Bangert | Methods and Devices for Rapid Assessment of Severity of Injury |
| EP2064553B2 (en) * | 2006-08-07 | 2023-06-07 | Antibodyshop A/S | Diagnostic test to exclude significant renal injury |
| WO2008113363A1 (en) * | 2007-03-21 | 2008-09-25 | Bioporto Diagnostics A/S | Diagnostic test for renal injury |
| CN101910845A (zh) * | 2007-11-15 | 2010-12-08 | 比奥波托诊断股份公司 | 个体分子形式的生物标志的诊断用途 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2400038A (en) * | 1944-09-07 | 1946-05-07 | Burroughs Wellcome Co | Esters of secondary phenolic amines |
| US3809714A (en) * | 1972-08-31 | 1974-05-07 | Interx Research Corp | Novel ester of ((methylamino)methyl) benzyl alcohol |
| US3868461A (en) * | 1972-11-22 | 1975-02-25 | Interx Research Corp | Ester of 3,4-dihydroxy-alpha (isopropylamino) methyl benzyl alcohol, composition and anti-asthma use thereof |
| US4031242A (en) * | 1975-09-11 | 1977-06-21 | Abbott Laboratories | Diacylated derivatives of γ-glutamyl dopamine |
-
1976
- 1976-08-05 IT IT26074/76A patent/IT1074038B/it active
-
1977
- 1977-07-28 CH CH935877A patent/CH629178A5/it not_active IP Right Cessation
- 1977-07-28 US US05/820,007 patent/US4218470A/en not_active Expired - Lifetime
- 1977-08-01 DE DE2734678A patent/DE2734678C2/de not_active Expired
- 1977-08-03 GB GB32584/77A patent/GB1551661A/en not_active Expired
- 1977-08-03 CY CY1164A patent/CY1164A/xx unknown
- 1977-08-04 NL NLAANVRAGE7708646,A patent/NL182878C/xx not_active IP Right Cessation
- 1977-08-04 FR FR7724075A patent/FR2360558A1/fr active Granted
- 1977-08-04 CA CA284,049A patent/CA1113117A/en not_active Expired
- 1977-08-05 JP JP52093447A patent/JPS6023102B2/ja not_active Expired
- 1977-08-05 BE BE179959A patent/BE857546A/xx not_active IP Right Cessation
- 1977-08-07 ES ES461399A patent/ES461399A1/es not_active Expired
-
1980
- 1980-05-20 US US06/151,632 patent/US4302471A/en not_active Expired - Lifetime
-
1982
- 1982-10-22 KE KE3238A patent/KE3238A/xx unknown
-
1983
- 1983-12-30 MY MY216/83A patent/MY8300216A/xx unknown
-
1984
- 1984-02-09 HK HK120/84A patent/HK12084A/xx not_active IP Right Cessation
-
1992
- 1992-06-23 MX MX9203179A patent/MX9203179A/es unknown
-
1994
- 1994-02-25 BG BG098591A patent/BG60835B2/bg unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CA1113117A (en) | 1981-11-24 |
| US4302471A (en) | 1981-11-24 |
| CH629178A5 (it) | 1982-04-15 |
| DE2734678A1 (de) | 1978-02-09 |
| GB1551661A (en) | 1979-08-30 |
| ES461399A1 (es) | 1978-05-16 |
| IT1074038B (it) | 1985-04-17 |
| KE3238A (en) | 1982-12-03 |
| JPS5321130A (en) | 1978-02-27 |
| US4218470A (en) | 1980-08-19 |
| BE857546A (fr) | 1977-12-01 |
| FR2360558B1 (cs) | 1980-10-03 |
| NL182878C (nl) | 1988-06-01 |
| NL182878B (nl) | 1988-01-04 |
| CY1164A (en) | 1983-06-10 |
| NL7708646A (nl) | 1978-02-07 |
| HK12084A (en) | 1984-02-17 |
| FR2360558A1 (fr) | 1978-03-03 |
| MX9203179A (es) | 1992-07-01 |
| JPS6023102B2 (ja) | 1985-06-05 |
| MY8300216A (en) | 1983-12-31 |
| DE2734678C2 (de) | 1982-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BG60835B2 (bg) | Епинен естер, метод за получаването му и лекарства | |
| US3987177A (en) | Vincaminic acid esters | |
| US3553258A (en) | Phenylalanine compounds | |
| JPS61155375A (ja) | 新規2−アミノオキサゾリン類およびその製造方法 | |
| US4367235A (en) | 2-Benzimidazolinone compounds and therapeutic compositions | |
| US4683245A (en) | Laevorotatory antipode of moprolol as an antihypertensive | |
| US3982012A (en) | 4-Hydroxy-benzimidazole compounds and therapeutic compositions | |
| FR2503705A1 (fr) | Derives de phenethanolamine, leur preparation et leur application en therapeutique | |
| PT100216B (pt) | N-{{4,5-di-hidroxi- e 4,5,8-tri-hidroxi-9,10-di-hidro-9,10-dioxo-2-antracentil} carbonil}-aminoacidos uteis na terapia de afeccoes osteoarticulares, processo para a sua preparacao e composicoes farmaceuticas que os contem | |
| US4603019A (en) | N-(methoxyphenacyl)-amine derivatives | |
| DE2923817C2 (de) | (3-Alkylamino-2-hydroxyproposy)-furan-2-carbonsäureanilide und deren physiologisch verträgliche Säureadditionssalze und Verfahren zu deren Herstellung sowie Arzneimittel mit einem Gehalt dieser Verbindungen | |
| CH643862A5 (de) | Bis(4-demethoxydaunorubicin)dihydrazon-derivate und sie enthaltende pharmazeutische zubereitungen. | |
| US4182775A (en) | Benzoic acids and process for their preparation | |
| US4503058A (en) | Therapeutically useful 3,7a-diazacyclohepta[j,k]fluorene derivatives | |
| EP0275221B1 (fr) | Nouveaux dérivés du N-(1H-indol 4-yl) benzamide ainsi que leurs sels, leur application à titre de médicaments et les compositions les renfermant | |
| US3063899A (en) | beta-hydroxybutyric acid-cyclohexylamide and a process of preparing it | |
| DE3110376A1 (de) | Benzylalkoholderivate, verfahren zu deren herstellung und arzneimittel, welche diese enthalten | |
| EP0101633B1 (en) | Pyridinecarboxylic esters of dopamine and of its n-alkyl derivatives | |
| US4338320A (en) | Esters of 6'-hydroxycinchonine, and a method of treating arrythmia with them | |
| PL96042B1 (pl) | Sposob wytwarzania nowych aminopochodnych azydofenoli | |
| DD141927A5 (de) | Verfahren zur herstellung von 1,1-disubstituierten octahydroindolo eckige klammer auf 2,3-a eckige klammer zu chinolizinen | |
| US3288835A (en) | Substituted-carbamyl)-alk- oxyj-phenyl acetic acid esters | |
| EP0029992A1 (de) | Neue Aminopropanolderivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| JP3112754B2 (ja) | シクロアルケノン化合物及び該化合物を有効成分とする脳機能改善薬 | |
| DE3013928A1 (de) | 2-hydroxy-5- eckige klammer auf lhydroxy-2- eckige klammer auf 4-(2-oxo-lbenzimidazolinyl)-piperidino eckige klammer zu ethyl eckige klammer zu benzoesaeurederivate |