BE384433A - - Google Patents
Info
- Publication number
- BE384433A BE384433A BE384433DA BE384433A BE 384433 A BE384433 A BE 384433A BE 384433D A BE384433D A BE 384433DA BE 384433 A BE384433 A BE 384433A
- Authority
- BE
- Belgium
- Prior art keywords
- ammonia
- decomposition products
- nitrogen
- crude
- superphosphate
- Prior art date
Links
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 20
- 238000000354 decomposition reaction Methods 0.000 claims description 8
- 229910019142 PO4 Inorganic materials 0.000 claims description 7
- 229910021529 ammonia Inorganic materials 0.000 claims description 7
- 235000021317 phosphate Nutrition 0.000 claims description 7
- 230000002378 acidificating effect Effects 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims description 4
- 239000001506 calcium phosphate Substances 0.000 claims description 2
- 235000011010 calcium phosphates Nutrition 0.000 claims description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical class [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 claims description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- YYRMJZQKEFZXMX-UHFFFAOYSA-N calcium;phosphoric acid Chemical compound [Ca+2].OP(O)(O)=O.OP(O)(O)=O YYRMJZQKEFZXMX-UHFFFAOYSA-N 0.000 description 5
- 239000002426 superphosphate Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 3
- 239000010452 phosphate Substances 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 206010039509 Scab Diseases 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05B—PHOSPHATIC FERTILISERS
- C05B1/00—Superphosphates, i.e. fertilisers produced by reacting rock or bone phosphates with sulfuric or phosphoric acid in such amounts and concentrations as to yield solid products directly
- C05B1/06—Ammoniation of superphosphates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Fertilizers (AREA)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BE384433A true BE384433A (enrdf_load_html_response) |
Family
ID=53461
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BE384433D BE384433A (enrdf_load_html_response) |
Country Status (1)
| Country | Link |
|---|---|
| BE (1) | BE384433A (enrdf_load_html_response) |
-
0
- BE BE384433D patent/BE384433A/fr unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2437576C2 (de) | Verfahren zur gleichzeitigen Entwässerung und Süßung von Naturgas | |
| US4663490A (en) | Process for the production of dinitrotoluene | |
| US2902342A (en) | Method and apparatus for producing ammonium salts | |
| EP3224223B1 (en) | Method and plant for producing urea-ammonium nitrate (uan) | |
| SU1494865A3 (ru) | Способ получени мочевины | |
| HU188717B (en) | Method for removing the urea, ammonia and carbon dioxide from lean aqueous solution | |
| JPH0920747A (ja) | 尿素真空蒸発器からの蒸気中の凝縮性物を回収する方法および装置 | |
| SU1494864A3 (ru) | Способ получени мочевины | |
| BE384433A (enrdf_load_html_response) | ||
| DE69101022T2 (de) | Verfahren zur Konzentrierung von Harnstofflösungen unter Vakuum. | |
| US4055627A (en) | Process for treating gases in the ammonia synthesis | |
| EP0187432B1 (en) | Aftertreatment of distilled water | |
| US3401095A (en) | Method of purifying nitric acid | |
| DE3133765C2 (de) | Verfahren zur Herstellung von Harnstoff | |
| SU1367853A3 (ru) | Способ получени нитрата аммони | |
| PL141369B1 (en) | Method of obtaining urea | |
| CA1256672A (fr) | Procede et appareillage pour la production de nitrate d'ammonium | |
| US3157466A (en) | Process for producing ammonium nitrate | |
| US6280494B1 (en) | Method for producing fertilizer grade DAP having an increased nitrogen concentration in a spray column | |
| DD160409A1 (de) | Abtrennung von ammoniak und wasserstoff aus gasen | |
| US4500734A (en) | Process for the production of urea | |
| US1142068A (en) | Process of making mono-ammonium phosphate. | |
| DE2143583C3 (de) | Verfahren zur Herstellung von Harnstoff | |
| DE2840440A1 (de) | Verfahren zur rueckgewinnung von methanol aus einem gasstrom | |
| WO1999021818A1 (de) | Verfahren und vorrichtung zur herstellung von reinem formaldehyd |