AU614550B2 - Apparatus for securing shoe laces - Google Patents
Apparatus for securing shoe laces Download PDFInfo
- Publication number
- AU614550B2 AU614550B2 AU24428/88A AU2442888A AU614550B2 AU 614550 B2 AU614550 B2 AU 614550B2 AU 24428/88 A AU24428/88 A AU 24428/88A AU 2442888 A AU2442888 A AU 2442888A AU 614550 B2 AU614550 B2 AU 614550B2
- Authority
- AU
- Australia
- Prior art keywords
- jaw
- shoe
- knot
- teeth
- lace
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000010276 construction Methods 0.000 description 3
- 208000002352 blister Diseases 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- SCVJRXQHFJXZFZ-KVQBGUIXSA-N 2-amino-9-[(2r,4s,5r)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purine-6-thione Chemical compound C1=2NC(N)=NC(=S)C=2N=CN1[C@H]1C[C@H](O)[C@@H](CO)O1 SCVJRXQHFJXZFZ-KVQBGUIXSA-N 0.000 description 1
- 241000271566 Aves Species 0.000 description 1
- STECJAGHUSJQJN-USLFZFAMSA-N LSM-4015 Chemical compound C1([C@@H](CO)C(=O)OC2C[C@@H]3N([C@H](C2)[C@@H]2[C@H]3O2)C)=CC=CC=C1 STECJAGHUSJQJN-USLFZFAMSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 208000006876 Multiple Endocrine Neoplasia Type 2b Diseases 0.000 description 1
- 241000282320 Panthera leo Species 0.000 description 1
- 101150110302 RND3 gene Proteins 0.000 description 1
- 102100039640 Rho-related GTP-binding protein RhoE Human genes 0.000 description 1
- 238000004873 anchoring Methods 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- ZPUCINDJVBIVPJ-LJISPDSOSA-N cocaine Chemical compound O([C@H]1C[C@@H]2CC[C@@H](N2C)[C@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-LJISPDSOSA-N 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- RCKMWOKWVGPNJF-UHFFFAOYSA-N diethylcarbamazine Chemical compound CCN(CC)C(=O)N1CCN(C)CC1 RCKMWOKWVGPNJF-UHFFFAOYSA-N 0.000 description 1
- 210000005069 ears Anatomy 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 210000000887 face Anatomy 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000000063 preceeding effect Effects 0.000 description 1
- 210000003689 pubic bone Anatomy 0.000 description 1
- 230000003014 reinforcing effect Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A43—FOOTWEAR
- A43C—FASTENINGS OR ATTACHMENTS OF FOOTWEAR; LACES IN GENERAL
- A43C7/00—Holding-devices for laces
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T24/00—Buckles, buttons, clasps, etc.
- Y10T24/37—Drawstring, laced-fastener, or separate essential cooperating device therefor
- Y10T24/3703—Includes separate device for holding drawn portion of lacing
- Y10T24/3705—Device engages tie in lacing
- Y10T24/3708—Device engages tie in lacing and fully covers tie
Landscapes
- Footwear And Its Accessory, Manufacturing Method And Apparatuses (AREA)
- Braiding, Manufacturing Of Bobbin-Net Or Lace, And Manufacturing Of Nets By Knotting (AREA)
- Decoration Of Textiles (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Supports For Pipes And Cables (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US114913 | 1987-10-30 | ||
| US07/114,913 US4805270A (en) | 1987-10-30 | 1987-10-30 | Apparatus for securing shoe laces |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU2442888A AU2442888A (en) | 1989-05-04 |
| AU614550B2 true AU614550B2 (en) | 1991-09-05 |
Family
ID=22358193
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU24428/88A Ceased AU614550B2 (en) | 1987-10-30 | 1988-10-28 | Apparatus for securing shoe laces |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4805270A (enExample) |
| EP (1) | EP0314628A3 (enExample) |
| JP (1) | JPH0444095Y2 (enExample) |
| AU (1) | AU614550B2 (enExample) |
| DE (1) | DE314628T1 (enExample) |
| NO (1) | NO168403C (enExample) |
| NZ (1) | NZ226732A (enExample) |
| ZA (1) | ZA888070B (enExample) |
Families Citing this family (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5099552A (en) * | 1989-08-08 | 1992-03-31 | Brookside Products Limited | Lace decorating device |
| USD329733S (en) | 1989-12-11 | 1992-09-29 | Reebok International Ltd. | Tongue element of a shoe upper |
| USD323419S (en) | 1989-12-11 | 1992-01-28 | Reebok International Ltd. | Element of a shoe upper |
| US5022127A (en) * | 1989-12-20 | 1991-06-11 | Hope Industries, Inc. | Shoelace locking device |
| USD342819S (en) | 1991-04-12 | 1994-01-04 | Reebok International Ltd. | Element of a shoe upper |
| USD340346S (en) | 1991-07-15 | 1993-10-19 | Reebok International Ltd. | Inflation device |
| US5182838A (en) * | 1991-08-13 | 1993-02-02 | Stenner John R | Filament, cordage locking device |
| GB2261013A (en) * | 1991-10-30 | 1993-05-05 | Chris Piponides | Lace fastener |
| DE4209425C1 (enExample) * | 1992-03-24 | 1993-09-02 | Markus 73563 Moegglingen De Dubberke | |
| US5402589A (en) * | 1993-10-29 | 1995-04-04 | Brookside Enterprises, Inc. | Apparatus for securing a shoelace coupleable to the tongue of a shoe and a shoe incorporating such an apparatus |
| ES2124938T3 (es) | 1994-07-22 | 1999-02-16 | Markus Dubberke | Dispositivo para la retencion de los extremos de cordones para zapatos. |
| DE9415687U1 (de) * | 1994-09-28 | 1995-06-22 | Adidas Ag, 91074 Herzogenaurach | Clip zur Fixierung der Schleifenenden eines Schnürsenkels |
| AUPN588495A0 (en) * | 1995-10-10 | 1995-11-02 | Hyde, Elias John | Fastening device for laces |
| US5649342A (en) * | 1996-07-10 | 1997-07-22 | Seneca Enterprises, Inc. | Decorative device for attachment to and securing of shoelaces |
| DE19814672C2 (de) | 1998-04-01 | 2000-08-10 | Markus Dubberke | Vorrichtung zur Arretierung von Endbereichen von Schnürsenkeln |
| US5924178A (en) * | 1998-04-17 | 1999-07-20 | Lazylock Ab | Tightening device for shoelaces and like elongated and pliable elements having free ends |
| US5924177A (en) * | 1998-05-07 | 1999-07-20 | Jongejan; Martin A. | Shoelace retention device |
| US6546649B1 (en) | 1999-08-24 | 2003-04-15 | Mark Tobias | Plush toy for mounting on a shoe |
| US7237347B2 (en) * | 1999-08-24 | 2007-07-03 | Mark Tobias | Plush toy for mounting on a shoe |
| US6240607B1 (en) * | 2000-01-19 | 2001-06-05 | Mccrary Patrina | Shoe string retaining device |
| GB2379858A (en) * | 2001-08-17 | 2003-03-26 | Supen Taylor | Shoe fastening means |
| US7244164B2 (en) * | 2002-04-29 | 2007-07-17 | Isenberg Barbara L | Toy with customization feature |
| US7281341B2 (en) * | 2003-12-10 | 2007-10-16 | The Burton Corporation | Lace system for footwear |
| US7044508B2 (en) * | 2004-01-30 | 2006-05-16 | James Burns | Shoelace knot assisting device |
| US7143486B2 (en) | 2004-02-06 | 2006-12-05 | Rolla Jose Santiago | Anchoring device for fastening laces |
| US7404583B1 (en) | 2004-05-21 | 2008-07-29 | Hassen Mendy K | Method and device to aid tying of lace-up shoes |
| US6988298B2 (en) * | 2004-06-24 | 2006-01-24 | Ternasky Mitchell L | Shoelace retainer |
| FR2882899B1 (fr) * | 2005-03-14 | 2007-06-01 | Thierry Cherouse | Blocage et deblocage de noeud a tirette |
| USD547532S1 (en) | 2005-09-29 | 2007-07-31 | White Sr Bruce D | Pair of shoelace retainers with hook and loop fasteners |
| US8460346B2 (en) * | 2006-01-17 | 2013-06-11 | Biodynamics Llc | Craniotomy closures |
| US20070169382A1 (en) * | 2006-01-24 | 2007-07-26 | Peter Bongard | Tethered shoelace clip |
| KR200428163Y1 (ko) * | 2006-07-13 | 2006-10-09 | 이경순 | 신발끈 고정구 |
| US7640640B1 (en) | 2007-06-05 | 2010-01-05 | Sean Michael Watkins | Shoelace containment device |
| USD591037S1 (en) | 2007-11-13 | 2009-04-28 | Ghee Leonard B | Set of shoelaces |
| US8474157B2 (en) * | 2009-08-07 | 2013-07-02 | Pierre-Andre Senizergues | Footwear lacing system |
| US20130061497A1 (en) * | 2011-09-09 | 2013-03-14 | Nike, Inc. | Lace Tag For Footwear |
| US8782860B2 (en) | 2011-11-07 | 2014-07-22 | Scott Anthony Rogers | Device for securing a shoelace knot |
| US8677578B2 (en) * | 2012-07-21 | 2014-03-25 | Playantra LLC | Device to secure shoelace knot |
| USD683116S1 (en) | 2012-11-30 | 2013-05-28 | Nike, Inc. | Lace holder for an article of footwear |
| US20140173944A1 (en) * | 2012-12-20 | 2014-06-26 | Edison Nation, Llc | Fastener for childrens footwear |
| KR101666620B1 (ko) * | 2014-12-31 | 2016-10-18 | 이성복 | 신발끈 고정구 |
| USD857357S1 (en) * | 2018-07-30 | 2019-08-27 | Nike, Inc. | Shoe |
| USD881546S1 (en) * | 2018-07-30 | 2020-04-21 | Nike, Inc. | Shoe |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4465011A (en) * | 1982-07-19 | 1984-08-14 | Schaefer Marine, Inc. | Halyard stopper |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1305884A (en) * | 1919-06-03 | George chbomy | ||
| US575412A (en) * | 1897-01-19 | Shoestring-fastener | ||
| DE194277C (enExample) * | ||||
| US674824A (en) * | 1900-09-04 | 1901-05-21 | Stewart Johnson G | Brake for railway-cars. |
| US670561A (en) * | 1901-01-07 | 1901-03-26 | Edward B Hoegemann | Shoe-lacing clasp. |
| GB190416527A (en) * | 1904-07-26 | 1905-01-19 | Japa Blinds Ltd | Improvements in Blankets or Coverlets made chiefly of Paper, Felt Paper and the like. |
| US819884A (en) * | 1906-01-23 | 1906-05-08 | Thomas Higgins | Shoestring-fastener. |
| US881041A (en) * | 1907-06-29 | 1908-03-03 | Frank Almstead | Rope-clamp. |
| GB135431A (en) * | 1919-05-15 | 1919-11-27 | Mary Dane | Improvements in and connected with Devices for Use in Securing the Laces of Boots, Shoes and the like. |
| US2200895A (en) * | 1939-09-13 | 1940-05-14 | Clarence J Rio | Shoestring fastener |
| US3066370A (en) * | 1961-02-07 | 1962-12-04 | Epstein Harry | Shoelace fastener |
| US3114950A (en) * | 1962-07-06 | 1963-12-24 | Seliman Claude | Knot keeper |
| US3176362A (en) * | 1963-12-09 | 1965-04-06 | Tames Esther | Protective clasp to prevent untying shoelaces |
| US3225402A (en) * | 1964-03-25 | 1965-12-28 | Altman | Shoe lace clasp |
| US3418733A (en) * | 1964-06-19 | 1968-12-31 | Cyril M. Tyrrell Sr. | Shoelace anchor |
| US3290745A (en) * | 1965-08-17 | 1966-12-13 | Theodore B Maxwell | Shoe lace clasp |
| US3473198A (en) * | 1967-09-18 | 1969-10-21 | Ernest Meier | Shoe tie retainer |
| US4553293A (en) * | 1983-10-04 | 1985-11-19 | Tie-Tite Products, Incorporated | Reusable tying device |
| US4715094A (en) * | 1986-06-03 | 1987-12-29 | Herdman Charles W | Shoe lace knot retainer |
-
1987
- 1987-10-30 US US07/114,913 patent/US4805270A/en not_active Expired - Lifetime
-
1988
- 1988-10-26 DE DE198888810732T patent/DE314628T1/de active Pending
- 1988-10-26 EP EP88810732A patent/EP0314628A3/en not_active Withdrawn
- 1988-10-26 NZ NZ226732A patent/NZ226732A/xx unknown
- 1988-10-27 ZA ZA888070A patent/ZA888070B/xx unknown
- 1988-10-28 NO NO884816A patent/NO168403C/no unknown
- 1988-10-28 AU AU24428/88A patent/AU614550B2/en not_active Ceased
- 1988-10-28 JP JP1988140060U patent/JPH0444095Y2/ja not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4465011A (en) * | 1982-07-19 | 1984-08-14 | Schaefer Marine, Inc. | Halyard stopper |
Also Published As
| Publication number | Publication date |
|---|---|
| NO884816D0 (no) | 1988-10-28 |
| US4805270A (en) | 1989-02-21 |
| NO168403C (no) | 1992-02-19 |
| DE314628T1 (de) | 1991-05-02 |
| EP0314628A3 (en) | 1990-06-13 |
| ZA888070B (en) | 1990-01-31 |
| NO884816L (no) | 1989-05-02 |
| EP0314628A2 (en) | 1989-05-03 |
| NZ226732A (en) | 1990-05-28 |
| NO168403B (no) | 1991-11-11 |
| JPH0177407U (enExample) | 1989-05-25 |
| AU2442888A (en) | 1989-05-04 |
| JPH0444095Y2 (enExample) | 1992-10-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU614550B2 (en) | Apparatus for securing shoe laces | |
| US6042599A (en) | Tissue approximation forceps | |
| US4958414A (en) | Reusable tie-all or bundle fastener | |
| CA2120013A1 (en) | Press-device for securing laces | |
| US5940943A (en) | Double carabiner | |
| US20070177826A1 (en) | Foot restrained closure for material container system | |
| DE10111924B4 (de) | Verschiebbare Festspanneinrichtung für Sportartikel | |
| US5772582A (en) | Nasal speculum | |
| US6059632A (en) | Hula hoop and coupling member therefor | |
| WO1994002044A1 (de) | Schuh, insbesondere sport- oder freizeitschuh | |
| US6581611B2 (en) | Hair fashion accessory | |
| DE2758976A1 (de) | Behaelter zur aufnahme und treibmittelfreien abgabe eines fuellgutes und verfahren zum fuellen eines solchen behaelters | |
| DE69201758T2 (de) | Skischuh mit Schwenksperre für den Schaft. | |
| DE19727858A1 (de) | Schwimmflosse und Kombination aus einem Schuhwerk, insbesondere einem Stiefel oder Schuh und einer Schwimmflosse | |
| US20100029168A1 (en) | Toy block | |
| NO20201259A1 (en) | A pole connection system | |
| JP2002537879A (ja) | コード固定装置 | |
| US20030229377A1 (en) | Tube and rod suture clamping system | |
| US20100275958A1 (en) | Arrangement In A Hollow Walking Or Ski Stick | |
| JP2003513736A (ja) | 外科用摘出器 | |
| EP0845069A1 (en) | Tent | |
| JP2000514892A (ja) | コンクリートセグメントを接続する接続装置 | |
| US6149207A (en) | Necktie dimpling tool | |
| DE19503792A1 (de) | Schlittschuhstiefel bzw. Rollschuhstiefel für Eis bzw. Rollhockey | |
| GB2221836A (en) | Collapsible support frame |