AT149615B - Elektrischer Druckgasschalter. - Google Patents
Elektrischer Druckgasschalter.Info
- Publication number
- AT149615B AT149615B AT149615DA AT149615B AT 149615 B AT149615 B AT 149615B AT 149615D A AT149615D A AT 149615DA AT 149615 B AT149615 B AT 149615B
- Authority
- AT
- Austria
- Prior art keywords
- switching
- switch according
- metal
- copper
- switch
- Prior art date
Links
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- 229910000831 Steel Inorganic materials 0.000 claims description 2
- 229910001315 Tool steel Inorganic materials 0.000 claims description 2
- SBYXRAKIOMOBFF-UHFFFAOYSA-N copper tungsten Chemical compound [Cu].[W] SBYXRAKIOMOBFF-UHFFFAOYSA-N 0.000 claims description 2
- 239000010959 steel Substances 0.000 claims description 2
- 238000007664 blowing Methods 0.000 claims 1
- 239000007789 gas Substances 0.000 description 19
- 239000012212 insulator Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 2
- 238000010791 quenching Methods 0.000 description 2
- 230000000171 quenching effect Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229920001875 Ebonite Polymers 0.000 description 1
- VAYOSLLFUXYJDT-RDTXWAMCSA-N Lysergic acid diethylamide Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N(CC)CC)C2)=C3C2=CNC3=C1 VAYOSLLFUXYJDT-RDTXWAMCSA-N 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H33/00—High-tension or heavy-current switches with arc-extinguishing or arc-preventing means
- H01H33/70—Switches with separate means for directing, obtaining, or increasing flow of arc-extinguishing fluid
- H01H33/76—Switches with separate means for directing, obtaining, or increasing flow of arc-extinguishing fluid wherein arc-extinguishing gas is evolved from stationary parts; Selection of material therefor
Landscapes
- Arc-Extinguishing Devices That Are Switches (AREA)
- Circuit Breakers (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE443187X | 1934-09-15 | ||
| DEA74836D DE670764C (de) | 1934-09-15 | 1934-12-16 | Elektrischer Gasschalter |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT149615B true AT149615B (de) | 1937-05-10 |
Family
ID=25939919
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT149615D AT149615B (de) | 1934-09-15 | 1935-09-13 | Elektrischer Druckgasschalter. |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2056033A (enExample) |
| AT (1) | AT149615B (enExample) |
| BE (1) | BE411269A (enExample) |
| CH (1) | CH187520A (enExample) |
| DE (1) | DE670764C (enExample) |
| GB (1) | GB443187A (enExample) |
| NL (1) | NL46565C (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3345487A (en) * | 1965-02-16 | 1967-10-03 | Westinghouse Electric Corp | Hydraulically operated circuit breaker |
| DE2316009B2 (de) * | 1973-03-30 | 1977-11-10 | Zusatz in: 24 55 674 Siemews A.G, tOOQ Betlm \md 8000 München | Gasstroemungsschalter |
-
0
- NL NL46565D patent/NL46565C/xx active
- BE BE411269D patent/BE411269A/xx unknown
-
1934
- 1934-12-16 DE DEA74836D patent/DE670764C/de not_active Expired
-
1935
- 1935-09-05 GB GB24796/35A patent/GB443187A/en not_active Expired
- 1935-09-12 CH CH187520D patent/CH187520A/de unknown
- 1935-09-13 AT AT149615D patent/AT149615B/de active
- 1935-12-05 US US53074A patent/US2056033A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| BE411269A (enExample) | |
| GB443187A (en) | 1936-02-24 |
| DE670764C (de) | 1939-01-25 |
| US2056033A (en) | 1936-09-29 |
| CH187520A (de) | 1936-11-15 |
| NL46565C (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1199368B (de) | Hochspannungsleistungsschalter | |
| DE102014102929A1 (de) | Gasdämpfer für einen Hochspannungsschalter | |
| AT149615B (de) | Elektrischer Druckgasschalter. | |
| EP0744759B1 (de) | Hochspannungs-Leistungsschalter mit einem feststehenden Heizvolumen | |
| DE670720C (de) | Gasschalter | |
| DE1212191B (de) | Unterbrechungseinrichtung fuer elektrische Schalter | |
| DE644580C (de) | Trennschalter mit Lichtbogenloescheinrichtung | |
| DE671238C (de) | Elektrischer Gasschalter | |
| DE661181C (de) | Fluessigkeitsschalter mit mehreren in Druckkammern angeordneten und in Reihe geschalteten Unterbrechungsstellen | |
| DE691245C (enExample) | ||
| DE696787C (de) | Elektrischer Gasschalter | |
| DE1223918B (de) | Elektrischer Schalter mit einer Kompressions-einrichtung | |
| DE583009C (de) | OElschalter | |
| DE657734C (de) | Druckgasschalter | |
| DE1173964B (de) | Lasttrennschalter | |
| DE1941841C3 (de) | Brücken Lasttrennschalter | |
| DE1066648B (enExample) | ||
| DE660024C (de) | Elektrischer Schalter mit Haupt- und Nebenkontakten | |
| CH650100A5 (en) | Gas-blast circuit breaker | |
| DE676649C (de) | Elektrischer Gasschalter | |
| DE19603157A1 (de) | Hochspannungs-Vakuumschalter | |
| DE717481C (de) | Lichtbogenloescheinrichtung | |
| DE597068C (de) | Fluessigkeitsschalter mit leitender Schaltfluessigkeit | |
| DE697904C (de) | Elektrischer Hochspannungsschalter mit Lichtbogenloeschung in einer geschlossenen Huelle | |
| DE690204C (de) | Elektrischer Schalter mit Haupt- und Nebenkontakten |