ZA862795B - Preparation of substituted bisphenols and applications of the same - Google Patents
Preparation of substituted bisphenols and applications of the sameInfo
- Publication number
- ZA862795B ZA862795B ZA862795A ZA862795A ZA862795B ZA 862795 B ZA862795 B ZA 862795B ZA 862795 A ZA862795 A ZA 862795A ZA 862795 A ZA862795 A ZA 862795A ZA 862795 B ZA862795 B ZA 862795B
- Authority
- ZA
- South Africa
- Prior art keywords
- applications
- preparation
- same
- substituted bisphenols
- bisphenols
- Prior art date
Links
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 title 1
- 229930185605 Bisphenol Natural products 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/11—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms
- C07C37/115—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms using acetals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Cosmetics (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR8505681A FR2580275B1 (fr) | 1985-04-16 | 1985-04-16 | Perfectionnement a la preparation et applications de bisphenols substitues |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA862795B true ZA862795B (en) | 1987-02-25 |
Family
ID=9318260
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA862795A ZA862795B (en) | 1985-04-16 | 1986-04-15 | Preparation of substituted bisphenols and applications of the same |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4683345A (enExample) |
| AT (1) | AT395971B (enExample) |
| DE (1) | DE3634989C2 (enExample) |
| DK (1) | DK174186A (enExample) |
| FR (1) | FR2580275B1 (enExample) |
| GB (1) | GB2174090B (enExample) |
| IN (1) | IN164817B (enExample) |
| ZA (1) | ZA862795B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1635782A1 (de) * | 2003-05-24 | 2006-03-22 | JUVENA (International) AG | Gewebekulturmedien als bestandteil von kosmetika |
| JP7615920B2 (ja) * | 2021-06-30 | 2025-01-17 | 三菱ケミカル株式会社 | ビスフェノールの製造方法並びにポリカーボネート樹脂の製造方法 |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1977627A (en) * | 1932-01-21 | 1934-10-23 | Ici Ltd | Process of producing diphenylolpropane |
| US2334408A (en) * | 1941-07-26 | 1943-11-16 | Burton T Bush Inc | Process for making chlorinated phenol-aldehyde condensation products |
| GB557097A (en) * | 1941-08-07 | 1943-11-04 | Burton T Bush Inc | Process for making dihydroxy halogenated diphenyl methanes |
| GB572368A (en) * | 1943-10-13 | 1945-10-04 | Kurt Israel Jacobsohn | Improved antiseptic preparations |
| GB669797A (en) * | 1949-08-27 | 1952-04-09 | Dow Chemical Co | 2, 2-alkylidene-bis(6-alkyl-4-chlorophenols) |
| GB718335A (en) * | 1951-10-16 | 1954-11-10 | Givaudan Et Co L | Improved process of preparing bis-(3,5,6-trichloro-2-hydroxyphenyl) methane |
| GB722590A (en) * | 1951-12-29 | 1955-01-26 | Geigy Ag J R | Improvements relating to diphenyl methane derivatives |
| GB893162A (en) * | 1957-05-02 | 1962-04-04 | William Pearson Ltd | Improvements in or relating to antioxidants |
| FR4620M (enExample) * | 1965-03-24 | 1966-11-28 | ||
| US3485797A (en) * | 1966-03-14 | 1969-12-23 | Ashland Oil Inc | Phenolic resins containing benzylic ether linkages and unsubstituted para positions |
| US3426081A (en) * | 1966-07-18 | 1969-02-04 | Richardson Co | Process for preparing bis(3,5,6-trichloro-2-hydroxyphenyl) methane |
| GB1201545A (en) * | 1967-06-08 | 1970-08-05 | Edwin Bernard Michaels | Method for preparing hexachlorophene |
| GB1208325A (en) * | 1968-04-22 | 1970-10-14 | Bdh Chemicals Ltd | Improvements in or relating to the production of dichlorophen |
| US3674879A (en) * | 1968-04-24 | 1972-07-04 | Armour Ind Chem Co | Process for preparing chloro-substituted bis(hydroxyphenyl)methanes |
| US3723540A (en) * | 1969-11-26 | 1973-03-27 | E Michaels | Preparation of hexachlorophene |
| BE765323A (fr) * | 1970-05-01 | 1971-08-30 | Tenneco Chem | Condensation de phenols chlores en bis-(phenols chlores) |
| DE2260138A1 (de) * | 1972-12-08 | 1974-06-12 | Hoechst Ag | Stoffwechselwirksame bisphenolalkanderivate |
| DE2418975A1 (de) * | 1974-04-19 | 1975-10-30 | Bayer Ag | Verfahren zur herstellung von dihydroxydiphenylalkanen |
| AU4101678A (en) * | 1977-11-08 | 1980-05-01 | Ici Australia Ltd | Process for killing parasites |
| US4400554A (en) * | 1982-03-29 | 1983-08-23 | Monsanto Company | Process for making bis(hydroxyphenyl)methanes |
| US4535191A (en) * | 1982-12-06 | 1985-08-13 | General Electric Company | Dihydric phenols |
-
1985
- 1985-04-16 FR FR8505681A patent/FR2580275B1/fr not_active Expired
-
1986
- 1986-03-26 GB GB8607469A patent/GB2174090B/en not_active Expired
- 1986-04-14 AT AT0096286A patent/AT395971B/de not_active IP Right Cessation
- 1986-04-14 IN IN288/CAL/86A patent/IN164817B/en unknown
- 1986-04-15 ZA ZA862795A patent/ZA862795B/xx unknown
- 1986-04-16 US US06/852,409 patent/US4683345A/en not_active Expired - Lifetime
- 1986-04-16 DK DK174186A patent/DK174186A/da not_active Application Discontinuation
- 1986-10-14 DE DE3634989A patent/DE3634989C2/de not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| GB2174090A (en) | 1986-10-29 |
| GB8607469D0 (en) | 1986-04-30 |
| IN164817B (enExample) | 1989-06-10 |
| DK174186D0 (da) | 1986-04-16 |
| DE3634989C2 (de) | 1996-08-29 |
| ATA96286A (de) | 1992-09-15 |
| US4683345A (en) | 1987-07-28 |
| GB2174090B (en) | 1989-07-05 |
| AT395971B (de) | 1993-04-26 |
| FR2580275A1 (fr) | 1986-10-17 |
| DE3634989A1 (de) | 1988-04-21 |
| FR2580275B1 (fr) | 1988-11-18 |
| DK174186A (da) | 1986-10-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PT82226A (en) | Process for the preparation of 3-aryluraciles and pesticeides therewith | |
| GR862062B (en) | Insulation material and its preparation | |
| EP0204659A3 (en) | Polyepoxydes and their use | |
| EP0540508A3 (en) | Imide hardeners and their preparation | |
| GR860078B (en) | Spiro - dioxolanes - dithiolanes and oxothiolanes | |
| GB8609334D0 (en) | Manufacture of cornicles | |
| DE3660256D1 (en) | Camphor-di-thiolene-complexes and their use | |
| IL80735A (en) | Branched copolyether-ketones and their preparation | |
| DE3665811D1 (en) | Pharmaceutical compositions on the basis of diltiazem and aspirin | |
| GB2187191B (en) | Protection of proteins and the like | |
| IL80305A0 (en) | Preparation of epsilon-butyrolactams | |
| GB8529729D0 (en) | Preparation of fish-noodles | |
| DE3660954D1 (en) | Aircraft of the parawing type | |
| ZA862795B (en) | Preparation of substituted bisphenols and applications of the same | |
| GB8604830D0 (en) | Applications of tetrathiafulvalenes | |
| IL78379A0 (en) | Preparation of 2- ercaptobenzoxazoles | |
| IL80657A0 (en) | Preparation of monochloropinacolone | |
| DE3660220D1 (en) | Process for the preparation of chloronitroanilines and chloronitrophenols | |
| GB8511623D0 (en) | Heteroanalogs of imidazobenzodiazepines | |
| IL78977A (en) | Preparation of alkyloxiranes | |
| GB2188046B (en) | Hydroxymethylcephem compounds and their preparation | |
| IL80737A (en) | Copolyetherketones and their preparation | |
| DE3566532D1 (en) | Preparation of 4-fluorophenols | |
| JPS6483035A (en) | Manufacture of trisphenolmethanes | |
| IL92542A0 (en) | Phenoxy-propanamides and their preparation |