ZA7540B - Substituted chalcones - Google Patents
Substituted chalconesInfo
- Publication number
- ZA7540B ZA7540B ZA00750040A ZA7540A ZA7540B ZA 7540 B ZA7540 B ZA 7540B ZA 00750040 A ZA00750040 A ZA 00750040A ZA 7540 A ZA7540 A ZA 7540A ZA 7540 B ZA7540 B ZA 7540B
- Authority
- ZA
- South Africa
- Prior art keywords
- substituted chalcones
- chalcones
- substituted
- Prior art date
Links
- DQFBYFPFKXHELB-UHFFFAOYSA-N Chalcone Natural products C=1C=CC=CC=1C(=O)C=CC1=CC=CC=C1 DQFBYFPFKXHELB-UHFFFAOYSA-N 0.000 title 1
- 150000001789 chalcones Chemical class 0.000 title 1
- 235000005513 chalcones Nutrition 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/44—Nitrogen atoms not forming part of a nitro radical
- C07D233/52—Nitrogen atoms not forming part of a nitro radical with hetero atoms directly attached to said nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/437,549 US3931152A (en) | 1974-01-29 | 1974-01-29 | 2-(1,3-Diazacycloalkenyl)-2-hydrazones of substituted chalcones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA7540B true ZA7540B (en) | 1976-01-28 |
Family
ID=23736898
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA00750040A ZA7540B (en) | 1974-01-29 | 1975-01-02 | Substituted chalcones |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3931152A (enExample) |
| JP (1) | JPS50106960A (enExample) |
| AR (1) | AR206703A1 (enExample) |
| AT (1) | AT342056B (enExample) |
| BE (1) | BE824854A (enExample) |
| CA (1) | CA1044243A (enExample) |
| CH (1) | CH595354A5 (enExample) |
| CS (1) | CS195280B2 (enExample) |
| DD (1) | DD117218A5 (enExample) |
| DE (1) | DE2502490A1 (enExample) |
| DK (1) | DK22975A (enExample) |
| ES (1) | ES434248A1 (enExample) |
| FR (1) | FR2258852B1 (enExample) |
| GB (1) | GB1477750A (enExample) |
| HU (1) | HU168476B (enExample) |
| IE (1) | IE41209B1 (enExample) |
| IN (1) | IN140834B (enExample) |
| NL (1) | NL7501032A (enExample) |
| PL (1) | PL93704B1 (enExample) |
| RO (1) | RO65454A (enExample) |
| SE (1) | SE404023B (enExample) |
| SU (1) | SU559649A3 (enExample) |
| ZA (1) | ZA7540B (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL57655A (en) * | 1978-08-17 | 1983-11-30 | American Cyanamid Co | Di-styrylketone hydrazone derivatives,method for preparing the same,and use as fire and control agent |
| US4152436A (en) * | 1978-08-17 | 1979-05-01 | American Cyanamid Company | Acylated pentadienone hydrazone, method for preparing the same, and use as fire ant control agents |
| US4258181A (en) * | 1978-09-05 | 1981-03-24 | American Cyanamid Company | Substituted 9,10-anthracenebishydrazones |
| FR2446285A1 (fr) * | 1978-09-05 | 1980-08-08 | American Cyanamid Co | Anthracene bis-(carbonyl-9,10-hydrazones) utiles comme agents antitumoraux |
| US4262122A (en) * | 1980-02-19 | 1981-04-14 | American Cyanamid Company | Preparation of 5,5-dimethyl-2-hydrazino-1,4,5,6-tetrahydro-pyrimidine hydrohalide |
| US4374135A (en) * | 1980-12-05 | 1983-02-15 | American Cyanamid Company | Compositions containing anorexigenic compounds and methods for regulating the feed intake of homothermic animals |
| IT1159074B (it) * | 1982-06-24 | 1987-02-25 | Stoppani Luigi Spa | Composto di addizione fra menadione e tiamina a reciproca stabilizzazione |
| US4574155A (en) * | 1984-03-08 | 1986-03-04 | American Cyanamid Company | Process for preparing 2-hydrazino-1,3-diazacycloalk-2-ene hydrohalides |
| US5258381A (en) * | 1984-03-19 | 1993-11-02 | The Rockefeller University | 2-substituted-2-imidazolines |
| DE3889723T2 (de) * | 1987-07-23 | 1994-09-08 | Nippon Oils & Fats Co Ltd | Nicht lineares optisches material. |
| EP0328669A4 (en) * | 1987-07-25 | 1989-10-12 | Nippon Oils & Fats Co Ltd | CONNECTIONS DERIVED FROM CHALCONES. |
| DE19629817A1 (de) * | 1996-07-24 | 1998-01-29 | Hoechst Ag | Neue Imino-Derivate als Inhibitoren der Knochenresorption und Vitronectinrezeptor-Antagonisten |
| US20040033986A1 (en) | 2002-05-17 | 2004-02-19 | Protopopova Marina Nikolaevna | Anti tubercular drug: compositions and methods |
| US7456222B2 (en) * | 2002-05-17 | 2008-11-25 | Sequella, Inc. | Anti tubercular drug: compositions and methods |
| US7652039B2 (en) * | 2002-05-17 | 2010-01-26 | Sequella, Inc. | Methods of use and compositions for the diagnosis and treatment of infectious disease |
| US7884097B2 (en) * | 2003-09-05 | 2011-02-08 | Sequella, Inc. | Methods and compositions comprising diamines as new anti-tubercular therapeutics |
| EP1975149B1 (en) * | 2005-12-26 | 2012-02-15 | Nissan Chemical Industries, Ltd. | 1,3-bis(substituted phenyl)-3-hydroxypropan-1-one or 2-propen-1-one compound, and salt thereof |
| US20090281054A1 (en) * | 2008-05-06 | 2009-11-12 | Venkata Reddy | Compositions and methods comprising capuramycin analogues |
| WO2011080132A2 (en) | 2009-12-17 | 2011-07-07 | Katholieke Universiteit Leuven, K.U. Leuven R&D | Compounds, compositions and methods for controlling biofilms |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2369817A (en) * | 1940-06-27 | 1945-02-20 | Petrolite Corp | Basic acylated cyclic diamine |
| DE1670274A1 (de) * | 1966-10-31 | 1970-07-16 | Boehringer Sohn Ingelheim | Neues Verfahren zur Herstellung von 2-Arylamino-1,3-diazacycloalkenen-(2) |
-
1974
- 1974-01-29 US US05/437,549 patent/US3931152A/en not_active Expired - Lifetime
- 1974-12-30 CA CA217,044A patent/CA1044243A/en not_active Expired
-
1975
- 1975-01-01 AR AR257335A patent/AR206703A1/es active
- 1975-01-02 ZA ZA00750040A patent/ZA7540B/xx unknown
- 1975-01-02 IN IN19/CAL/1975A patent/IN140834B/en unknown
- 1975-01-07 IE IE36/75A patent/IE41209B1/xx unknown
- 1975-01-14 GB GB159375A patent/GB1477750A/en not_active Expired
- 1975-01-22 DE DE19752502490 patent/DE2502490A1/de not_active Withdrawn
- 1975-01-24 DK DK22975*#A patent/DK22975A/da not_active Application Discontinuation
- 1975-01-27 AT AT58775A patent/AT342056B/de not_active IP Right Cessation
- 1975-01-28 CS CS75561A patent/CS195280B2/cs unknown
- 1975-01-28 FR FR7502615A patent/FR2258852B1/fr not_active Expired
- 1975-01-28 SU SU2101403A patent/SU559649A3/ru active
- 1975-01-28 BE BE152769A patent/BE824854A/xx unknown
- 1975-01-28 SE SE7500902A patent/SE404023B/xx unknown
- 1975-01-28 CH CH98875A patent/CH595354A5/xx not_active IP Right Cessation
- 1975-01-28 HU HUAE437A patent/HU168476B/hu unknown
- 1975-01-28 PL PL1975177648A patent/PL93704B1/pl unknown
- 1975-01-28 RO RO7581269A patent/RO65454A/ro unknown
- 1975-01-29 NL NL7501032A patent/NL7501032A/xx not_active Application Discontinuation
- 1975-01-29 ES ES434248A patent/ES434248A1/es not_active Expired
- 1975-01-29 DD DD183893A patent/DD117218A5/xx unknown
- 1975-01-29 JP JP50011460A patent/JPS50106960A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| AR206703A1 (es) | 1976-08-13 |
| SU559649A3 (ru) | 1977-05-25 |
| PL93704B1 (enExample) | 1977-06-30 |
| CS195280B2 (en) | 1980-01-31 |
| GB1477750A (en) | 1977-06-22 |
| HU168476B (enExample) | 1976-05-28 |
| ES434248A1 (es) | 1977-04-01 |
| SE404023B (sv) | 1978-09-18 |
| CH595354A5 (enExample) | 1978-02-15 |
| FR2258852A1 (enExample) | 1975-08-22 |
| DE2502490A1 (de) | 1975-07-31 |
| JPS50106960A (enExample) | 1975-08-22 |
| DK22975A (enExample) | 1975-09-29 |
| IE41209L (en) | 1975-07-29 |
| NL7501032A (nl) | 1975-07-31 |
| ATA58775A (de) | 1977-07-15 |
| IN140834B (enExample) | 1976-12-25 |
| SE7500902L (sv) | 1975-10-17 |
| RO65454A (ro) | 1980-01-15 |
| BE824854A (fr) | 1975-07-28 |
| DD117218A5 (enExample) | 1976-01-05 |
| AT342056B (de) | 1978-03-10 |
| IE41209B1 (en) | 1979-11-07 |
| CA1044243A (en) | 1978-12-12 |
| US3931152A (en) | 1976-01-06 |
| AU7711475A (en) | 1976-07-08 |
| FR2258852B1 (enExample) | 1978-07-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5111770A (en) | Bitamin e shibozokukarubonsanesuteruno goseiho | |
| PH12506A (en) | New pyridylguanidines | |
| ZA7540B (en) | Substituted chalcones | |
| JPS511905A (en) | M sokoryuki | |
| ZA75357B (en) | New phenol-acetals | |
| JPS5110632A (en) | Shiitozainarabini kurosuzaino seizohoho | |
| EG11730A (en) | New thiatiazolylimidazolidinones | |
| IL48557A0 (en) | Substituted ureido-compounds | |
| US3992538A (en) | Substituted o-acyl-acrylaldoximes | |
| ZA752007B (en) | Substituted triphenylethylenes | |
| JPS5117214A (en) | Konkuriito u jikoseikeiyogatawaku | |
| AU7835575A (en) | Substituted diaminoguanidines | |
| JPS519475A (en) | G kajusokuteishijisochi | |
| IL47587A0 (en) | Substituted 1-sulfonylbenzimidazoles | |
| PH14544A (en) | Substituted tetrahydrobenzothiophenes | |
| IL47989A0 (en) | New d-homo-steroids | |
| ZA753405B (en) | Substituted phenylmercapto-benzimidazoles | |
| AU8293175A (en) | Substituted hydroxyphenyl-piperidones | |
| JPS516967A (en) | Bitamin e nikochinsanesuteruno seizoho | |
| ZA751398B (en) | New halo-pregnanes | |
| JPS5125386A (en) | U jigatakeikotonoseizosochi | |
| JPS5124852A (en) | Deruta m hoshikianarogumemori | |
| JPS5143763A (en) | Bitamin e nikochinsanesuteruno seizoho | |
| IL46453A0 (en) | New thiadiazolylimidazolines | |
| IL47988A0 (en) | New d-homo-steroids |