ZA704191B - Benzimidazole carbamates - Google Patents
Benzimidazole carbamatesInfo
- Publication number
- ZA704191B ZA704191B ZA704191A ZA704191A ZA704191B ZA 704191 B ZA704191 B ZA 704191B ZA 704191 A ZA704191 A ZA 704191A ZA 704191 A ZA704191 A ZA 704191A ZA 704191 B ZA704191 B ZA 704191B
- Authority
- ZA
- South Africa
- Prior art keywords
- benzimidazole carbamates
- carbamates
- benzimidazole
- Prior art date
Links
- BHFLSZOGGDDWQM-UHFFFAOYSA-N 1h-benzimidazole;carbamic acid Chemical class NC(O)=O.C1=CC=C2NC=NC2=C1 BHFLSZOGGDDWQM-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/22—Radicals substituted by doubly bound hetero atoms, or by two hetero atoms other than halogen singly bound to the same carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/45—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by at least one doubly—bound oxygen atom, not being part of a —CHO group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/80—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen
- C07C49/813—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen polycyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/30—Nitrogen atoms not forming part of a nitro radical
- C07D235/32—Benzimidazole-2-carbamic acids, unsubstituted or substituted; Esters thereof; Thio-analogues thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Fodder In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US83524669A | 1969-06-20 | 1969-06-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA704191B true ZA704191B (en) | 1972-02-23 |
Family
ID=25269027
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA704191A ZA704191B (en) | 1969-06-20 | 1970-06-19 | Benzimidazole carbamates |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3657267A (enExample) |
| JP (1) | JPS501272B1 (enExample) |
| AT (2) | AT302358B (enExample) |
| BE (1) | BE752089A (enExample) |
| CH (1) | CH520684A (enExample) |
| CS (1) | CS201522B2 (enExample) |
| DK (2) | DK134602B (enExample) |
| ES (1) | ES380579A1 (enExample) |
| FI (1) | FI52719C (enExample) |
| FR (1) | FR2052988B1 (enExample) |
| GB (1) | GB1307306A (enExample) |
| HK (1) | HK77976A (enExample) |
| IL (1) | IL34746A (enExample) |
| IT (1) | IT1035027B (enExample) |
| MY (1) | MY7300477A (enExample) |
| NL (1) | NL147139B (enExample) |
| PL (1) | PL72724B1 (enExample) |
| SE (1) | SE366045B (enExample) |
| YU (1) | YU34195B (enExample) |
| ZA (1) | ZA704191B (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2201208A1 (de) * | 1972-01-12 | 1973-08-02 | Basf Ag | Verfahren zur herstellung von aromatischen ketonen |
| US3929821A (en) * | 1972-12-29 | 1975-12-30 | Syntex Inc | 5 (6)-Benzene ring substituted benzimidazole-2-carbamate derivatives |
| US4258198A (en) * | 1973-05-29 | 1981-03-24 | Smithkline Corporation | 5-Cycloalkyl thio- and oxy-2-carbalkoxyaminobenzimidazoles |
| US3969526A (en) * | 1973-05-29 | 1976-07-13 | Smithkline Corporation | Anthelmintic 5-heterocycliothio and oxy-2-carbalkoxyaminobenzimidazles |
| DE2443297A1 (de) * | 1974-09-10 | 1976-03-18 | Hoechst Ag | Anthelminthisch wirksame basisch substituierte 2-carbalkoxy-amino-benzimidazolyl-5(6)-phenylaether und -ketone sowie verfahren zu ihrer herstellung |
| US4026936A (en) * | 1975-08-07 | 1977-05-31 | Hoffmann-La Roche Inc. | Anthelmintic pyridine and thiazole substituted benzimidazole carbamates |
| US4031234A (en) * | 1975-08-18 | 1977-06-21 | Syntex (U.S.A.) Inc. | 1,5(6)-Disubstituted benzimidazole-2-carbamate derivatives having anthelmintic activity |
| US4032536A (en) * | 1976-07-22 | 1977-06-28 | Janssen Pharmaceutica N.V. | (1h-benzimidazol-2-yl)carbamates |
| IT1076022B (it) * | 1977-04-20 | 1985-04-22 | Montedison Spa | Benzimidazolcarbammati antielmintici |
| JPS5535611A (en) * | 1978-08-31 | 1980-03-12 | Matsushita Electric Works Ltd | Instrument with mouth washing instrument |
| US4299837A (en) | 1979-12-05 | 1981-11-10 | Montedison S.P.A. | Anthelmintic benzimidazole-carbamates |
| US4435418A (en) | 1982-12-13 | 1984-03-06 | Smithkline Beckman Corporation | 5-Phenylethenylbenzimidazoles |
| US4438135A (en) | 1983-01-07 | 1984-03-20 | Smithkline Beckman Corporation | 1-(3,4-Bis-(3-(lower alkoxycarbonyl)-2-thioureido)-phenyl-1-phenylthylenes |
| WO1990010630A1 (en) * | 1989-03-15 | 1990-09-20 | Janssen Pharmaceutica N.V. | [5(6)-(benzisoxa-, benzisothia- or indazol-3-yl)-1h-benzimidazol-2-yl] carbamates |
| NZ232785A (en) * | 1989-03-15 | 1991-03-26 | Janssen Pharmaceutica Nv | 5-(1,2 benzisoxazol-, benzimidazol and benzisothiazol-3- yl)-1h-benzimadazol-2-yl carbamic acid ester derivatives preparatory processes, intermediates and anthelmintic compositions |
| US5256681A (en) * | 1989-03-15 | 1993-10-26 | Janssen Pharmaceutica N.V. | [5(6)-(benzisoxa-,benzisothia-or indazol-3-yl)-1H-benzimidazol-2-yl]carbamates |
| US5278181A (en) * | 1992-05-12 | 1994-01-11 | Board Of Regents Acting On Behalf Of The University Of Michigan | Soluble alkyl[5-[amino (phenyl)methyl]-1H-benzimidazol-2-yl] carbamate anthelmintics |
| WO2007014846A1 (en) * | 2005-07-28 | 2007-02-08 | Intervet International B.V. | Novel benzimidazole (thio) carbamates with antiparasitic activity and the synthesis thereof |
| CA2655056C (en) * | 2006-06-12 | 2016-04-12 | Smith & Nephew, Inc. | Systems, methods and devices for tibial resection |
| PL2037914T3 (pl) | 2006-06-14 | 2014-04-30 | Intervet Int Bv | Zawiesina zawierająca karbaminian benzoimidazolu i polisorbat |
| MX340846B (es) | 2012-01-27 | 2016-07-28 | Rhein Siegfried Sa De Cv | Composición de nitazoxanida mejorada y proceso para prepararla. |
| BR112015006861B1 (pt) | 2012-09-27 | 2021-10-13 | Siegfried Rhein S.A. De C.V. | Composição farmacêutica sinérgica e processo para preparar a dita composição |
| EP3889139B1 (en) * | 2015-11-30 | 2025-03-19 | The Children's Medical Center Corporation | Compounds for treating proliferative diseases |
| EP3641747B1 (en) | 2017-06-22 | 2023-09-06 | Cipla Limited | Par-4 secretagogues for the treatment of cancer |
| CN109467512B (zh) * | 2018-12-18 | 2021-06-08 | 苏州开元民生科技股份有限公司 | 一种3,4-二氨基-二苯甲酮的合成方法 |
| CN113979949A (zh) * | 2021-12-17 | 2022-01-28 | 山东国邦药业有限公司 | 一种氟苯咪唑的制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1111957A (en) * | 1966-05-20 | 1968-05-01 | Smith Kline French Lab | Improvements in or relating to anthelmintic compositions |
-
1969
- 1969-06-20 US US835246A patent/US3657267A/en not_active Expired - Lifetime
-
1970
- 1970-05-29 GB GB2604470A patent/GB1307306A/en not_active Expired
- 1970-05-29 CH CH809370A patent/CH520684A/fr not_active IP Right Cessation
- 1970-06-08 FR FR707021022A patent/FR2052988B1/fr not_active Expired
- 1970-06-09 ES ES380579A patent/ES380579A1/es not_active Expired
- 1970-06-16 PL PL1970141321A patent/PL72724B1/pl unknown
- 1970-06-17 SE SE08385/70A patent/SE366045B/xx unknown
- 1970-06-17 BE BE752089D patent/BE752089A/xx not_active IP Right Cessation
- 1970-06-18 FI FI701720A patent/FI52719C/fi active
- 1970-06-18 AT AT825571A patent/AT302358B/de not_active IP Right Cessation
- 1970-06-18 IT IT51551/70A patent/IT1035027B/it active
- 1970-06-18 AT AT549770A patent/AT307798B/de not_active IP Right Cessation
- 1970-06-18 IL IL34746A patent/IL34746A/xx unknown
- 1970-06-18 YU YU1544/70A patent/YU34195B/xx unknown
- 1970-06-19 NL NL707009024A patent/NL147139B/xx not_active IP Right Cessation
- 1970-06-19 JP JP45053435A patent/JPS501272B1/ja active Pending
- 1970-06-19 ZA ZA704191A patent/ZA704191B/xx unknown
- 1970-06-19 CS CS704330A patent/CS201522B2/cs unknown
- 1970-06-22 DK DK321770AA patent/DK134602B/da not_active IP Right Cessation
-
1973
- 1973-12-30 MY MY477/73A patent/MY7300477A/xx unknown
-
1975
- 1975-12-19 DK DK580275A patent/DK580275A/da unknown
-
1976
- 1976-12-09 HK HK779/76*UA patent/HK77976A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IT1035027B (it) | 1979-10-20 |
| FR2052988B1 (enExample) | 1973-08-10 |
| MY7300477A (en) | 1973-12-31 |
| SE366045B (enExample) | 1974-04-08 |
| CS201522B2 (en) | 1980-11-28 |
| BE752089A (fr) | 1970-12-17 |
| FR2052988A1 (enExample) | 1971-04-16 |
| DK134602C (enExample) | 1977-06-27 |
| DK134602B (da) | 1976-12-06 |
| IL34746A0 (en) | 1970-08-19 |
| DK580275A (da) | 1975-12-19 |
| FI52719C (fi) | 1977-11-10 |
| US3657267A (en) | 1972-04-18 |
| NL7009024A (enExample) | 1970-12-22 |
| JPS501272B1 (enExample) | 1975-01-16 |
| FI52719B (enExample) | 1977-08-01 |
| HK77976A (en) | 1976-12-17 |
| YU154470A (en) | 1978-09-18 |
| CH520684A (fr) | 1972-03-31 |
| ES380579A1 (es) | 1973-04-01 |
| PL72724B1 (enExample) | 1974-08-30 |
| DE2029637B2 (de) | 1976-09-23 |
| AT307798B (de) | 1973-06-12 |
| YU34195B (en) | 1979-02-28 |
| NL147139B (nl) | 1975-09-15 |
| AT302358B (de) | 1972-10-10 |
| GB1307306A (en) | 1973-02-21 |
| IL34746A (en) | 1973-01-30 |
| DE2029637A1 (de) | 1971-02-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA704191B (en) | Benzimidazole carbamates | |
| ZA707651B (en) | Iminoxyorganosilanes | |
| YU32453B (en) | Brodska utovarna rampa | |
| YU119570A (en) | Jonizacioni pozarni alarmni uredaj | |
| CS153064B2 (en) | Zpusob vyroby fenoxyprobanolaminu | |
| HK52076A (en) | Nitrofuryl-pyrazolopyrimidinones | |
| JPS5153682A (en) | Gasukongobutsuo bunshiryomataha genshiryoni ojite sonoseibungasuni bunrisuruhoho | |
| CS13780A2 (en) | Zpusob deformovani protahleho clenu | |
| HU171745B (hu) | Duplicating machine | |
| KE2564A (en) | Hydroxy-2-piperidinylcarbinols | |
| IL34756A (en) | N-phenacylcarbamates | |
| ZA705267B (en) | Substituted biscarbamates | |
| PH9498A (en) | Substituted benzimidazole carbamates | |
| CS153066B2 (en) | Zpusob vyroby fenoxyprobanolaminuz | |
| YU206969A (en) | Potenciometer | |
| ZA703801B (en) | D-18-methyl-17alpha-alkynyl-delta4-oestren-17beta-ols | |
| YU55370A (en) | Zupcasta spojnica | |
| AU430156B2 (en) | Benzimidazole carbamates | |
| AU1438870A (en) | Benzimidazole carbamates | |
| ZA704993B (en) | Beta-cyanoethylthiol carbamates | |
| PH10710A (en) | Benzimidazole carbamates | |
| YU32836B (en) | Elasticni stamparski tocak | |
| YU31895B (en) | Zeleznicki odbojnik | |
| MY7600187A (en) | Nitrofuryl-pyrazolopyrimidinones | |
| YU64770A (en) | Elektricni prekidac |