WO2022253986A1 - Méthode de synthèse de particules sphériques de matériaux - Google Patents
Méthode de synthèse de particules sphériques de matériaux Download PDFInfo
- Publication number
- WO2022253986A1 WO2022253986A1 PCT/EP2022/065130 EP2022065130W WO2022253986A1 WO 2022253986 A1 WO2022253986 A1 WO 2022253986A1 EP 2022065130 W EP2022065130 W EP 2022065130W WO 2022253986 A1 WO2022253986 A1 WO 2022253986A1
- Authority
- WO
- WIPO (PCT)
- Prior art keywords
- reaction tube
- milliseconds
- carbonate
- seconds
- less
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 28
- 239000000463 material Substances 0.000 title claims abstract description 11
- 239000002245 particle Substances 0.000 title abstract 2
- 238000006243 chemical reaction Methods 0.000 claims abstract description 95
- 239000002243 precursor Substances 0.000 claims abstract description 54
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims abstract description 38
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims abstract description 16
- 239000000203 mixture Substances 0.000 claims description 45
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 40
- 229910052723 transition metal Inorganic materials 0.000 claims description 35
- 239000011572 manganese Substances 0.000 claims description 34
- 238000001308 synthesis method Methods 0.000 claims description 25
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 20
- -1 transition metal sulphate Chemical class 0.000 claims description 19
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 15
- 229910052748 manganese Inorganic materials 0.000 claims description 12
- 239000010936 titanium Substances 0.000 claims description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 10
- 239000010949 copper Substances 0.000 claims description 10
- 239000011777 magnesium Substances 0.000 claims description 10
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 10
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 9
- 239000002738 chelating agent Substances 0.000 claims description 9
- 229910052759 nickel Inorganic materials 0.000 claims description 9
- 229910052782 aluminium Inorganic materials 0.000 claims description 7
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 7
- 230000002572 peristaltic effect Effects 0.000 claims description 7
- 229910021653 sulphate ion Inorganic materials 0.000 claims description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 6
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 claims description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 6
- 229910017052 cobalt Inorganic materials 0.000 claims description 6
- 239000010941 cobalt Substances 0.000 claims description 6
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 6
- 239000012798 spherical particle Substances 0.000 claims description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 5
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 5
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 5
- 229910021529 ammonia Inorganic materials 0.000 claims description 5
- 229910052802 copper Inorganic materials 0.000 claims description 5
- 229910052749 magnesium Inorganic materials 0.000 claims description 5
- JBQYATWDVHIOAR-UHFFFAOYSA-N tellanylidenegermanium Chemical compound [Te]=[Ge] JBQYATWDVHIOAR-UHFFFAOYSA-N 0.000 claims description 5
- 229910052719 titanium Inorganic materials 0.000 claims description 5
- 238000001556 precipitation Methods 0.000 claims description 4
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 claims description 3
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 claims description 3
- 235000012538 ammonium bicarbonate Nutrition 0.000 claims description 3
- 239000001099 ammonium carbonate Substances 0.000 claims description 3
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 claims description 3
- 229910052808 lithium carbonate Inorganic materials 0.000 claims description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 3
- 238000011084 recovery Methods 0.000 claims description 3
- 230000002194 synthesizing effect Effects 0.000 claims description 3
- 239000005725 8-Hydroxyquinoline Substances 0.000 claims description 2
- 229960003540 oxyquinoline Drugs 0.000 claims description 2
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 claims description 2
- 229910000385 transition metal sulfate Inorganic materials 0.000 abstract description 3
- 239000000243 solution Substances 0.000 description 87
- 239000002244 precipitate Substances 0.000 description 29
- 150000003624 transition metals Chemical class 0.000 description 18
- 238000004626 scanning electron microscopy Methods 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 230000015572 biosynthetic process Effects 0.000 description 11
- 239000012530 fluid Substances 0.000 description 11
- 238000003786 synthesis reaction Methods 0.000 description 11
- 239000012153 distilled water Substances 0.000 description 10
- 229910015228 Ni1/3Mn1/3CO1/3 Inorganic materials 0.000 description 9
- 239000011149 active material Substances 0.000 description 9
- 238000005070 sampling Methods 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- 238000004458 analytical method Methods 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 238000002156 mixing Methods 0.000 description 5
- 239000007774 positive electrode material Substances 0.000 description 5
- 229910000299 transition metal carbonate Inorganic materials 0.000 description 5
- 238000005303 weighing Methods 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 4
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 4
- 241000080590 Niso Species 0.000 description 4
- 238000005119 centrifugation Methods 0.000 description 4
- 239000008139 complexing agent Substances 0.000 description 4
- 239000012535 impurity Substances 0.000 description 4
- 238000006386 neutralization reaction Methods 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- 238000001636 atomic emission spectroscopy Methods 0.000 description 3
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 3
- 238000000975 co-precipitation Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 230000035800 maturation Effects 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 239000003643 water by type Substances 0.000 description 3
- SBLRHMKNNHXPHG-UHFFFAOYSA-N 4-fluoro-1,3-dioxolan-2-one Chemical compound FC1COC(=O)O1 SBLRHMKNNHXPHG-UHFFFAOYSA-N 0.000 description 2
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 2
- 239000012670 alkaline solution Substances 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 238000012512 characterization method Methods 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 239000007772 electrode material Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910001416 lithium ion Inorganic materials 0.000 description 2
- 230000010198 maturation time Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229910001415 sodium ion Inorganic materials 0.000 description 2
- 238000002411 thermogravimetry Methods 0.000 description 2
- 229910017518 Cu Zn Inorganic materials 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 229910013870 LiPF 6 Inorganic materials 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 229910018327 Ni0.25 Mn0.75 Inorganic materials 0.000 description 1
- 239000002033 PVDF binder Substances 0.000 description 1
- 241000023324 Pimenta Species 0.000 description 1
- 235000006990 Pimenta dioica Nutrition 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 238000001354 calcination Methods 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- 238000003889 chemical engineering Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000000536 complexating effect Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000005262 decarbonization Methods 0.000 description 1
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 238000000840 electrochemical analysis Methods 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000005304 joining Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 238000003760 magnetic stirring Methods 0.000 description 1
- 239000011702 manganese sulphate Substances 0.000 description 1
- 235000007079 manganese sulphate Nutrition 0.000 description 1
- SQQMAOCOWKFBNP-UHFFFAOYSA-L manganese(II) sulfate Chemical compound [Mn+2].[O-]S([O-])(=O)=O SQQMAOCOWKFBNP-UHFFFAOYSA-L 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- LGQLOGILCSXPEA-UHFFFAOYSA-L nickel sulfate Chemical compound [Ni+2].[O-]S([O-])(=O)=O LGQLOGILCSXPEA-UHFFFAOYSA-L 0.000 description 1
- 238000003921 particle size analysis Methods 0.000 description 1
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000001878 scanning electron micrograph Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- HDUMBHAAKGUHAR-UHFFFAOYSA-J titanium(4+);disulfate Chemical compound [Ti+4].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O HDUMBHAAKGUHAR-UHFFFAOYSA-J 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 238000012800 visualization Methods 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 1
- 239000011686 zinc sulphate Substances 0.000 description 1
- 235000009529 zinc sulphate Nutrition 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01G—COMPOUNDS CONTAINING METALS NOT COVERED BY SUBCLASSES C01D OR C01F
- C01G53/00—Compounds of nickel
- C01G53/006—Compounds containing, besides nickel, two or more other elements, with the exception of oxygen or hydrogen
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01G—COMPOUNDS CONTAINING METALS NOT COVERED BY SUBCLASSES C01D OR C01F
- C01G53/00—Compounds of nickel
- C01G53/40—Nickelates
- C01G53/42—Nickelates containing alkali metals, e.g. LiNiO2
- C01G53/44—Nickelates containing alkali metals, e.g. LiNiO2 containing manganese
- C01G53/50—Nickelates containing alkali metals, e.g. LiNiO2 containing manganese of the type [MnO2]n-, e.g. Li(NixMn1-x)O2, Li(MyNixMn1-x-y)O2
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01M—PROCESSES OR MEANS, e.g. BATTERIES, FOR THE DIRECT CONVERSION OF CHEMICAL ENERGY INTO ELECTRICAL ENERGY
- H01M10/00—Secondary cells; Manufacture thereof
- H01M10/05—Accumulators with non-aqueous electrolyte
- H01M10/052—Li-accumulators
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01M—PROCESSES OR MEANS, e.g. BATTERIES, FOR THE DIRECT CONVERSION OF CHEMICAL ENERGY INTO ELECTRICAL ENERGY
- H01M10/00—Secondary cells; Manufacture thereof
- H01M10/05—Accumulators with non-aqueous electrolyte
- H01M10/056—Accumulators with non-aqueous electrolyte characterised by the materials used as electrolytes, e.g. mixed inorganic/organic electrolytes
- H01M10/0564—Accumulators with non-aqueous electrolyte characterised by the materials used as electrolytes, e.g. mixed inorganic/organic electrolytes the electrolyte being constituted of organic materials only
- H01M10/0566—Liquid materials
- H01M10/0569—Liquid materials characterised by the solvents
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01M—PROCESSES OR MEANS, e.g. BATTERIES, FOR THE DIRECT CONVERSION OF CHEMICAL ENERGY INTO ELECTRICAL ENERGY
- H01M4/00—Electrodes
- H01M4/02—Electrodes composed of, or comprising, active material
- H01M4/13—Electrodes for accumulators with non-aqueous electrolyte, e.g. for lithium-accumulators; Processes of manufacture thereof
- H01M4/131—Electrodes based on mixed oxides or hydroxides, or on mixtures of oxides or hydroxides, e.g. LiCoOx
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01M—PROCESSES OR MEANS, e.g. BATTERIES, FOR THE DIRECT CONVERSION OF CHEMICAL ENERGY INTO ELECTRICAL ENERGY
- H01M4/00—Electrodes
- H01M4/02—Electrodes composed of, or comprising, active material
- H01M4/36—Selection of substances as active materials, active masses, active liquids
- H01M4/48—Selection of substances as active materials, active masses, active liquids of inorganic oxides or hydroxides
- H01M4/50—Selection of substances as active materials, active masses, active liquids of inorganic oxides or hydroxides of manganese
- H01M4/505—Selection of substances as active materials, active masses, active liquids of inorganic oxides or hydroxides of manganese of mixed oxides or hydroxides containing manganese for inserting or intercalating light metals, e.g. LiMn2O4 or LiMn2OxFy
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01M—PROCESSES OR MEANS, e.g. BATTERIES, FOR THE DIRECT CONVERSION OF CHEMICAL ENERGY INTO ELECTRICAL ENERGY
- H01M4/00—Electrodes
- H01M4/02—Electrodes composed of, or comprising, active material
- H01M4/36—Selection of substances as active materials, active masses, active liquids
- H01M4/48—Selection of substances as active materials, active masses, active liquids of inorganic oxides or hydroxides
- H01M4/52—Selection of substances as active materials, active masses, active liquids of inorganic oxides or hydroxides of nickel, cobalt or iron
- H01M4/525—Selection of substances as active materials, active masses, active liquids of inorganic oxides or hydroxides of nickel, cobalt or iron of mixed oxides or hydroxides containing iron, cobalt or nickel for inserting or intercalating light metals, e.g. LiNiO2, LiCoO2 or LiCoOxFy
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01P—INDEXING SCHEME RELATING TO STRUCTURAL AND PHYSICAL ASPECTS OF SOLID INORGANIC COMPOUNDS
- C01P2002/00—Crystal-structural characteristics
- C01P2002/70—Crystal-structural characteristics defined by measured X-ray, neutron or electron diffraction data
- C01P2002/72—Crystal-structural characteristics defined by measured X-ray, neutron or electron diffraction data by d-values or two theta-values, e.g. as X-ray diagram
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01P—INDEXING SCHEME RELATING TO STRUCTURAL AND PHYSICAL ASPECTS OF SOLID INORGANIC COMPOUNDS
- C01P2004/00—Particle morphology
- C01P2004/01—Particle morphology depicted by an image
- C01P2004/03—Particle morphology depicted by an image obtained by SEM
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01P—INDEXING SCHEME RELATING TO STRUCTURAL AND PHYSICAL ASPECTS OF SOLID INORGANIC COMPOUNDS
- C01P2004/00—Particle morphology
- C01P2004/30—Particle morphology extending in three dimensions
- C01P2004/32—Spheres
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01P—INDEXING SCHEME RELATING TO STRUCTURAL AND PHYSICAL ASPECTS OF SOLID INORGANIC COMPOUNDS
- C01P2004/00—Particle morphology
- C01P2004/51—Particles with a specific particle size distribution
- C01P2004/52—Particles with a specific particle size distribution highly monodisperse size distribution
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01P—INDEXING SCHEME RELATING TO STRUCTURAL AND PHYSICAL ASPECTS OF SOLID INORGANIC COMPOUNDS
- C01P2004/00—Particle morphology
- C01P2004/51—Particles with a specific particle size distribution
- C01P2004/53—Particles with a specific particle size distribution bimodal size distribution
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01P—INDEXING SCHEME RELATING TO STRUCTURAL AND PHYSICAL ASPECTS OF SOLID INORGANIC COMPOUNDS
- C01P2004/00—Particle morphology
- C01P2004/60—Particles characterised by their size
- C01P2004/61—Micrometer sized, i.e. from 1-100 micrometer
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01P—INDEXING SCHEME RELATING TO STRUCTURAL AND PHYSICAL ASPECTS OF SOLID INORGANIC COMPOUNDS
- C01P2006/00—Physical properties of inorganic compounds
- C01P2006/40—Electric properties
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01M—PROCESSES OR MEANS, e.g. BATTERIES, FOR THE DIRECT CONVERSION OF CHEMICAL ENERGY INTO ELECTRICAL ENERGY
- H01M4/00—Electrodes
- H01M4/02—Electrodes composed of, or comprising, active material
- H01M2004/026—Electrodes composed of, or comprising, active material characterised by the polarity
- H01M2004/028—Positive electrodes
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02E—REDUCTION OF GREENHOUSE GAS [GHG] EMISSIONS, RELATED TO ENERGY GENERATION, TRANSMISSION OR DISTRIBUTION
- Y02E60/00—Enabling technologies; Technologies with a potential or indirect contribution to GHG emissions mitigation
- Y02E60/10—Energy storage using batteries
Definitions
- the invention relates to a method for synthesizing spherical particles of materials, and in particular a method for synthesizing precursors of battery electrode materials.
- transition metal precursors Ni, Mn, Co, etc.
- sol-gel route or the solid-gel technique.
- solid These various synthetic techniques make it possible to obtain mixtures of transition metals in the form of carbonates or hydroxides.
- the coprecipitation route is the most commonly used because it makes it possible in particular to obtain aggregates that are homogeneous in morphology and composition. It is mainly carried out in thermostatically controlled stirred reactors into which are injected on the one hand a solution containing the transition metals and on the other hand an alkaline solution (containing for example a carbonate or a hydroxide - ) which will precipitate with the transition metals.
- Document CN110875472 describes a synthesis device equipped with a "T" microfluidic reactor fed with two solutions: a first solution comprising a mixture of metal salts and a second alkaline solution; leading to a maturation tank. Unfortunately, again, a 2 to 10 hour maturation in the maturation tank is required to obtain the desired transition metal precursors.
- the document H. Liang et al . , Chemical Engineering Journal 394 (2020) 124846 describes another device provided with a “T” microfluidic reactor.
- the reactor is fed with a first solution comprising a mixture of NiSO 4 ⁇ 6H 2 O, CoSO 4 ⁇ 7H 2 O and MnSO 4 ⁇ H 2 O with a molar ratio of Ni/Co/Mn equal to 0.6:0.2 : 0.2, and a second solution of sodium carbonate (Na 2 CO 3 ) dissolved in N-cetyl N,N,N-trimethyl ammonium bromide.
- the reaction is carried out at a temperature of 60°C and the time in the reactor is only 12 seconds.
- the precipitated transition metal precursors are recovered directly at the outlet of the reactor.
- this synthesis method leads to obtaining aggregates of a few hundred nanometers instead of the micrometric size expected for use as an electrochemically efficient active material in a battery.
- the aim of the invention is in particular to overcome these drawbacks of the prior art.
- the aim of the invention is to provide a method for the rapid synthesis of a precursor of active materials for a battery electrode having a homogeneous micrometric shape.
- the subject of the invention is a method for the synthesis of spherical particles of materials, said method being carried out in a continuous reactor, said continuous reactor being formed by a reaction tube, said reaction tube being fed by two tubes of inlet, the reaction tube having a length L, one of the two inlet tubes being supplied with a solution A comprising at least one transition metal sulphate chosen from nickel (Ni), aluminum (Al), magnesium (Mg), titanium (Ti), copper (Cu), zinc (Zn), iron (Fe), manganese (Mn) and cobalt (Co), the other inlet tube being supplied with a solution B comprising a hydroxide or a carbonate as well as optionally a chelating agent, said method comprising the following steps: a) the delivery of the solutions A and B to the reaction tube of the continuous reactor according to a flow rate d A and d B respectively, causing the precipitation of the precursor in the reaction tube, and b) the recovery of said precipitated precursor at the outlet of the reaction tube,
- the inventors unexpectedly discovered that a short presence time (less than or equal to 10 seconds) in the reaction tube made it possible to obtain spherical particles of materials of micrometric dimension that were homogeneous in morphology and composition. It is indeed counter-intuitive that a reaction time shorter than reaction times of the same order of magnitude used in the prior art, makes it possible to obtain aggregates of larger size (micrometric instead of nanometric). and more homogeneous in morphology. It is also surprising that a drastically shorter reaction time (seconds instead of hours) makes it possible to arrive at aggregates of the same size. These different aspects make it possible to very significantly accelerate the production time of precursors of micrometric-sized battery electrode materials.
- the residence time in the reaction tube is essential data for carrying out the synthesis method according to the invention.
- the residence time in the reaction tube is from 1 millisecond to 10 seconds.
- the presence time in the reaction tube is at least 10 milliseconds, in particular still at least 50 milliseconds, preferably at least 100 milliseconds.
- At least 10 milliseconds it is understood in the invention a time of less than 10 seconds and at least 10 milliseconds, at least 20 milliseconds, at least 30 milliseconds, at least 40 milliseconds, at least 50 milliseconds, at least 60 milliseconds, at least 70 milliseconds, at least 80 milliseconds, at least 90 milliseconds, at least 100 milliseconds, at least 110 milliseconds, at least 120 milliseconds, at least 130 milliseconds, at least 140 milliseconds, at least 150 milliseconds, at least 160 milliseconds, at least 170 milliseconds, at least 180 milliseconds, at least 190 milliseconds, at least 200 milliseconds, at least 210 milliseconds, at least 220 milliseconds, at least 230 milliseconds, at least 240 milliseconds, at least 250 milliseconds, at least 260 milliseconds, at least 270 milliseconds, at least 280 milli
- the presence time in the reaction tube is less than 10 seconds, in particular it can be less than or equal to 5 seconds, for example less than or equal to 1 second.
- less than 10 seconds it is understood in the invention a time of at least 10 milliseconds and less than 10 seconds, less than or equal to 9 seconds, less than or equal to 8 seconds, less than or equal to 7 seconds, less than or equal to 6 seconds, less than or equal to 5 seconds, less than or equal to 4 seconds, less than or equal to 3 seconds, less than or equal to 2 seconds, less than or equal to 1 second, less than or equal to 900 milliseconds, less or equal to 890 milliseconds, less than or equal to 880 milliseconds, less than or equal to 870 milliseconds, less than or equal to 860 milliseconds, less than or equal to 850 milliseconds, less than or equal to 840 milliseconds, less than or equal to 830 milliseconds, less than or equal to 820 milliseconds, less than or equal to 810 millisecond
- millisecond For example from 1 millisecond to 10 seconds, it is understood in the invention 1 millisecond, 10 milliseconds, 50 milliseconds, 100 milliseconds, 150 milliseconds, 200 milliseconds, 250 milliseconds, 300 milliseconds, 350 milliseconds, 400 milliseconds, 450 milliseconds, 500 milliseconds, 550 milliseconds, 600 milliseconds, 650 milliseconds, 700 milliseconds, 750 milliseconds, 800 milliseconds, 850 milliseconds, 900 milliseconds, 950 milliseconds, 1 second, 1.5 seconds, 2 seconds, 2.5 seconds, 3 seconds, 3, 5 seconds, 4 seconds, 4.5 seconds, 5 seconds, 5.5 seconds, 6 seconds, 6.5 seconds, 7 seconds, 7.5 seconds, 8 seconds, 8.5 seconds, 9 seconds, 9.5 seconds and 10 seconds.
- the regime in the reaction tube is a laminar regime.
- the inventors discovered unexpectedly that having only a flow with a laminar regime in the reaction tube made it possible, against all expectations, to obtain a better reaction efficiency. Indeed, it is customary in the prior art to seek, on the contrary, to obtain turbulent regimes to increase the probabilities of encounter between the reactants, in particular using high flow rates in tubes of small diameters or by elements added to the reaction tube such as beads or stationary mixing elements.
- the conditions of the invention make it possible to obtain precursors having at least two transition metals, which is impossible with an intermediate or turbulent regime.
- laminar regime in the invention a mode of flow of a fluid where all of the fluid flows more or less in the same direction, without the local differences opposing each other.
- a laminar regime can in particular be characterized by a Reynolds number lower than 1500.
- intermediate regime it is understood in the invention a mode of flow of a fluid where the whole of the fluid flows more or less in the same direction with a little mixing (small eddies).
- An intermediate regime can in particular be characterized by a Reynolds number of 1500 to 3000.
- turbulent regime it is understood in the invention a mode of flow of a fluid where the whole of the fluid presents at any point vortices whose size, location and orientation vary constantly.
- a turbulent regime can in particular be characterized by a Reynolds number greater than 3000.
- the regime in the reaction tube is laminar and has a Reynolds number of less than 1500.
- the regime in the reaction tube is laminar and has a Reynolds number of less than 1000, more preferably, the regime in the reaction tube is laminar and has a Reynolds number of less than 500.
- the length L of the reaction tube of the continuous reactor used in the synthesis method of the invention can take any dimension as long as the residence time in said tube is less than or equal to 10 seconds.
- the length L of the tube is adapted to the flow rate of the solutions A and B and in particular to obtaining a laminar regime in the reaction tube.
- the length L of the reaction tube is at least 1 mm.
- each inlet tube is adapted to obtain a laminar regime.
- each inlet tube and of the reaction tube is at least 0.5 mm.
- the reaction tube and the inlet tubes are preferably simple tubes, that is to say devoid of any internal element.
- the reaction tube and the inlet tubes preferably have a circular section.
- each inlet tube and of the reaction tube is greater than 1 mm, in particular greater than 1 cm, for example greater than 2 cm. More preferably, the internal diameter of each inlet tube and of the reaction tube is between 1 and 1.5 mm.
- the synthesis method according to the invention does not require heating of the reaction tube to enable the precursor to be obtained.
- the synthesis method can advantageously be carried out at room temperature as well as at higher temperature.
- the temperature in the reaction tube is 20°C to 70°C, preferably 25°C to 50°C.
- the pH value range in the reaction tube is obtained by adjusting the concentrations of the compounds of solutions A and B and/or the injection rates of solutions A and B.
- the pH in the reaction tube has a value of 7 to 10, especially 8, when a carbonate is present in solution B.
- the pH in the reaction tube has a value of 9 to 12, especially 11.
- the synthesis method according to the invention can be used to obtain any type of active material precursors for battery electrodes, such as precursors for batteries of the Li-ion type or of the Na-ion type.
- solution A comprises at least two transition metal sulphates chosen from nickel (Ni), aluminum (Al), magnesium (Mg), titanium (Ti), copper (Cu), zinc (Zn), iron (Fe), manganese (Mn) and cobalt (Co).
- the solution comprises at least three transition metal sulphates, in particular at least four, in particular at least five more, particularly at least six, in particular at least seven, in particular at least eight, or the transition metal sulphates.
- solution A comprises at least one transition metal sulphate, in particular at least two, in particular at least three, particularly four transition metal sulphates chosen from nickel (Ni), aluminum (Al), manganese (Mn) and cobalt (Co), of which in particular the molar ratio Ni: Co: Mn: Al is 0-1: 0-1: 0-1: 0-1.
- solution A includes one of the following fourteen combinations of transition metal sulfates:
- the Ni:Co:Mn:Al molar ratio is 0.8:0.05:0.1:0.05 or 0.2:0.15:0.6:0.05.
- the precursor comprises the transition metals Ni, Mn and Co with a molar ratio Ni: Mn: Co of 1/3: 1/3: 1/3, or even 0.2: 0.5: 0.3.
- the precursor includes the transition metals Ni and Mn with a Ni:Mn molar ratio of 0.25:0.75.
- Such a composition of transition metals makes it possible in particular to obtain precursors for Li-ion type batteries.
- solution A further comprises at least one transition metal sulphate, in particular at least two, in particular at least three, in particular still at least four, particularly five transition metal sulphates chosen from magnesium (Mg), titanium (Ti), copper (Cu), zinc (Zn) and iron (Fe).
- transition metal sulphates chosen from magnesium (Mg), titanium (Ti), copper (Cu), zinc (Zn) and iron (Fe).
- Solution A includes one of the following 433 combinations of transition metal sulfates:
- Such a composition has, for example, a nickel sulphate, a zinc sulphate, a manganese sulphate and a titanium sulphate with a molar ratio Ni: Zn: Mn: Ti equal to 0.48: 0.02: 0.4: 0.1.
- the concentration of said at least one transition metal sulphate in solution A is 0.1 mol/l until saturation, in particular 2 mol/l.
- the concentration of said at least one transition metal sulphate in solution A is at least 0.1 mol/l.
- at least 0.1 mol/l it is understood in the invention at least 0.1 mol/l, at least 0.2 mol/l, at least 0.3 mol/l, at least 0, 4 mol/l, at least 0.5 mol/l, at least 0.6 mol/l, at least 0.7 mol/l, at least 0.8 mol/l, at least 0.9 mol/l, at least 1 mol/l, at least 1.1 mol/l, at least 1.2 mol/l, at least 1.3 mol/l, at least 1.4 mol/l, at least 1.5 mol/ l, at least 1.6 mol/l, at least 1.7 mol/l, at least 1.8 mol/l and at least 1.9 mol/l.
- Solution B is an aqueous solution containing a hydroxide or a carbonate, and optionally a chelating agent.
- hydroxide any compound whose dissolution in water gives a hydroxide ion (OH ⁇ ).
- This hydroxide ion precipitates with the transition metal(s) from solution A when they come into contact in the reaction tube.
- the hydroxide is chosen from the group consisting of sodium hydroxide, potassium hydroxide, 8-hydroxyquinoline, ammonia, lithium hydroxide and their mixture.
- the hydroxide is sodium hydroxide.
- the hydroxide concentration can range from 0.1 mol/l up to saturation. For example, in the case of sodium hydroxide, the saturation concentration is 27 mol/l.
- the concentration of the hydroxide is 4 mol/l.
- carbonate it is understood in the invention any compound whose dissolution in water gives a carbonate ion (CO 3 2- ). This carbonate ion precipitates with the transition metal(s) from solution A when brought into contact in the reaction tube.
- the carbonate is chosen from the group consisting of ammonium bicarbonate, sodium carbonate, potassium carbonate, lithium carbonate and their mixture.
- the carbonate is chosen from the group consisting of sodium carbonate, potassium carbonate, lithium carbonate and mixtures thereof.
- the carbonate is sodium carbonate.
- the carbonate concentration can range from 0.1 mol/l up to saturation. In the case of sodium carbonate, saturation corresponds to a concentration of 2 mol/l at ambient temperature. Preferably, the concentration of the carbonate is that of saturation.
- the chelating agent can be any type of ammonium such as primary ammoniums, secondary ammoniums, ternary ammoniums or even quaternary ammoniums.
- the chelating agent is chosen from the group consisting of ammonia and N-cetyl N,N,N-trimethyl ammonium bromide.
- the chelating agent is ammonia.
- the concentration of the chelating agent can range from 0.1 mol/l to 5 mol/l. In particular, in the case of ammonia, the concentration is preferably 0.4 mol/l.
- Solutions A and B are conveyed using any means, and in particular using any type of pump.
- solutions A and B are conveyed using pumps allowing a constant flow.
- the pumps used can be pneumatic diaphragm pumps, peristaltic pumps or volumetric pumps.
- each solution A and B is conveyed using a peristaltic pump.
- each solution A and B is adapted so that the presence time in the reaction tube is less than or equal to 10 seconds and in particular that the regime in the reaction tube is a laminar regime.
- Solutions A and B can be routed with identical or different flow rates.
- the flow rate of the solution A d A is greater than the flow rate of the solution B d B .
- the ratio of the flow rates of the solutions A and B d A : d B is preferably from 0.5:1 to 5:1.
- the delivery rates d A and d B are each at least 0.01 ml/min.
- the inlet tubes emerge through their outlet opening in the initial part of the reaction tube.
- the initial part of the reaction tube is understood according to the direction of the flow passing through the reaction tube.
- This initial part also called a mixer, is a space for mixing solutions A and B.
- the outlet openings of the inlet tubes are configured so that the mixing of solutions A and B at the mixer level either by co-flow or by counter-flow.
- a counter-flow mixture can in particular be obtained with an orientation of the outlet openings of the inlet tubes essentially parallel to each other and an arrangement facing the each other.
- the term "essentially” is understood herein to encompass a deflection of no more than 10 degrees with a parallel orientation of the two outlets of the intake tubes.
- the outlet openings can be arranged in various ways. For example, the intersection between the inlet tubes and the reaction tube will have a “T” shape. The remaining part of the reaction tube and intake tubes can take any direction.
- the outlet opening of one of the inlet tubes has a larger diameter than that of the other outlet opening.
- the reaction tube mixer can then match the continuity of the inlet tube having the larger diameter opening and include within it the end of the smaller inlet tube.
- the remaining part of the reaction tube and the intake tubes can take any direction.
- the flow rate of the solutions is suitable and sufficiently high so that there is no reflux in the inlet tubes.
- One or more non-return valves can in particular be arranged at the end of the smallest inlet tube to prevent these refluxes.
- solutions A and B have essentially parallel flows between them and in the same direction, and the flow of one of the solutions must be contained in the flow of the other.
- the mixing between the two solutions is carried out at the level of a virtual tube corresponding to the contact zone between the two flows of solutions.
- the term "essentially” is understood herein to encompass a deflection of no more than 10 degrees with a parallel orientation of the two outlets of the intake tubes.
- a co-flow can in particular be obtained by arranging the outlet opening of one of the inlet tubes inside the outlet opening of the other tube.
- one outlet opening has a larger diameter than the other outlet opening.
- the reaction tube mixer corresponds to the extension of the inlet tube having an outlet with the largest diameter. Again, the remaining portion of the reaction tube and inlet tubes can take any direction.
- the precipitated precursor is recovered at the reactor outlet only after a period of at least 5 seconds, in particular at least 10 seconds, in particular of at least 20 seconds, for example at least 30 seconds.
- the precipitate obtained during the first 5 seconds may present a certain inhomogeneity which is no longer present once this time has passed.
- the precipitate leaving the reactor during the first 5 seconds is preferably not recovered.
- the invention also relates to the use of a continuous reactor for the synthesis of spherical particles of materials, said continuous reactor being formed by a reaction tube, said reaction tube being fed by two inlet tubes, the reaction tube having a length L, one of the two inlet tubes being supplied with a solution A comprising at least one transition metal sulphate chosen from nickel (Ni), aluminum (Al), magnesium (Mg), titanium (Ti), copper (Cu), zinc (Zn), iron (Fe), manganese (Mn) and cobalt (Co), the other inlet tube being supplied with a solution B comprising a hydroxide or a carbonate as well as optionally a chelating agent, where the routing of the solutions A and B to the reaction tube of the continuous reactor is carried out according to a flow rate of A and d B respectively, resulting in the precipitation of the precursor in the reaction tube, and the recovery of the said precipitated precursor is carried out at the outlet of the reaction tube, and wherein the length L of the reaction tube and the delivery rates d A
- the invention finally relates to the spherical particles obtained, or obtainable, by the process described above.
- FIG. a) represents the result of an X-ray diffractogram performed on said precursor.
- the x-axis represents 2 ⁇ in degrees and the y-axis is the intensity in arbitrary units.
- FIG. b) represents the result of a thermogravimetric analysis carried out on 30 mg of sample of said precursor.
- the abscissa axis represents the temperature in °C and the ordinate axis represents the mass of the sample in percentage.
- the double arrow indicates the mass loss obtained at 640° C. ( ⁇ 35.5%).
- the white bar indicates the scale for each image.
- The represents the distribution of the size of the aggregates of a sample of a precursor precipitated according to the synthesis method according to the invention in volume (FIG. 4A) and in number (FIG. 4B).
- the abscissa axis represents the size of the aggregates in micrometers and the ordinate axis represents the volume occupied by the aggregates in percentage.
- the abscissa axis represents the size of the aggregates in micrometers and the ordinate axis represents the number of aggregates in percentage.
- The represents the thermal cycle used for the synthesis of a positive electrode active material from a precursor obtained according to the synthesis method according to the invention.
- A represents the starting conditions corresponding to the ambient temperature (25°C).
- the temperature is then increased with a ramp of 3.5°C/min until it reaches 400°C.
- B corresponds to decarbonization where the temperature is maintained at 400° C. for 2 hours.
- the temperature is then increased with a ramp of 3.5°C/min until it reaches 900°C.
- C corresponds to crystallization where the temperature is maintained at 900°C for 12 hours. Then the temperature is reduced at a rate of 2°C per minute to again reach room temperature at D.
- The represents an X-ray diffractogram carried out on a positive electrode active material obtained from a precursor obtained according to the synthesis method according to the invention.
- the x-axis represents 2 ⁇ in degrees and the y-axis is the intensity in arbitrary units.
- the box represents an enlarging for a better visualization of the diffractogram for the values 30° to 80° of 2 ⁇ .
- Hollow circles represent observed intensity values.
- the black lines at the level of the hollow circles represent the expected theoretical values.
- the bottom black line represents the difference between the observed values and the expected values (an absence of a peak corresponds to no observed difference).
- the vertical black lines arranged above the black line represent the position of the Bragg reflections.
- the white bar indicates the scale on each image.
- The represents an X-ray diffractogram carried out on two precursors obtained by comparative synthesis methods where the delivery rates of solutions A and B were 4ml/min and where the length of the reaction tube of the microfluidic reactor was 1 meter (curve 1) or 2 meters (curve 2).
- the x-axis represents 2 ⁇ in degrees and the y-axis is the intensity in arbitrary units. For better readability of the figure, the origin of the ordinate axis of curve 2 has been moved.
- the white bar indicates the scale on each image.
- The represents the result of an X-ray diffractogram performed on a Ni 0 precursor . 25 mins 0 . 75 CO 3 obtained according to the method of the invention.
- the x-axis represents 2 ⁇ in degrees and the y-axis is the intensity in arbitrary units.
- the white bar indicates the scale for each image.
- The represents the result of an X-ray diffractogram carried out on a precursor Ni 1/3 Mn 1/3 Co 1/3 CO 3 obtained according to the method of the invention.
- the x-axis represents 2 ⁇ in degrees and the y-axis is the intensity in arbitrary units.
- the white bar indicates the scale for each image.
- The represents the result of an X-ray diffractogram carried out on a precursor Ni 1/3 Mn 1/3 Co 1/3 CO 3 obtained according to a method in which the regime in the reaction tube is turbulent.
- the x-axis represents 2 ⁇ in degrees and the y-axis is the intensity in arbitrary units.
- the white bar indicates the scale for each image.
- the continuous reactor 1 used in the invention is illustrated in .
- T formed by two inlet tubes 3 which face each other, each fed by a solution (A or B) joining at an intersection opening into a reaction tube 5 perpendicular to the direction of the intake tubes 3 at the intersection.
- a counter-flow is therefore obtained at the intersection of the two inlet tubes 3.
- Solution A contains the transition metal sulphates and solution B comprises a hydroxide or a carbonate as well as a complexing agent.
- Solutions A and B are conveyed to reactor 1 by means of peristaltic pumps 7. The precursor precipitates in the reaction tube which opens into a tank 9 where the precipitated precursor is recovered.
- the inventors firstly synthesized a manganese-rich carbonate precursor whose composition is Ni 0.2 Mn 0.5 Co 0.3 CO 3 .
- a 250mL solution A of transition metal sulphates was prepared by weighing 26.29g of NiSO 4 .6H 2 O, 42.26g of MnSO 4 .H 2 O and 42.17g of CoSO 4 .7H 2 O. These sulfates were dissolved in distilled water and then placed in a 250mL volumetric flask filled to the mark. The Ni/Mn/Co molar ratio is 2/5/3. The concentration of this solution is 2mol/l.
- a 250mL solution B containing sodium carbonate and a complexing agent (NH 4 OH) was prepared by dissolving 47.69g of Na 2 CO 3 and 11.26g of NH 4 OH in distilled water then placed in a volumetric flask of 250mL filled up to the mark.
- the concentration of Na 2 CO 3 is 1.8mol/L and of NH 4 OH 0.36mol/L.
- the sampling rate of the solution containing the transition metals was 20 mL/min while the sampling rate of the solution containing the carbonate was 12 mL/min.
- the pH of the solution containing the precipitate was 7.8.
- the reactor exhaust tube had a length of 10cm and an internal diameter of 1.39mm. Under these conditions, the residence time in the reactor exhaust tube was 0.3s and the fluid regime in the reactor was laminar. The precipitate was not collected during the first 30 seconds of reaction, then it is collected for 60 seconds. It is then washed by centrifugation with distilled water (until neutralization of the washing water) then dried in an oven at 70°C for 1 night.
- the morphology of the aggregates was verified by scanning electron microscopy (SEM), the results of which are shown in .
- the observed aggregates have a diameter of about 6 micrometers. This value as well as the homogeneity were verified by a laser particle size analysis, the results of which are shown in .
- the volume distribution 50 (D50) of the precipitate is 6.3 ⁇ m, in good agreement with the observations made with the SEM.
- the inventors then mixed the precursor Ni 0.2 Mn 0.5 Co 0.3 CO 3 with Li 2 CO 3 in order to synthesize a positive electrode active material for a battery of formula: Li(Li 0.15 Ni 0.17 Mn 0.425 Co 0.255 )O 2 .
- Ni 0.2 Mn 0.5 Co 0.3 CO 3 were mixed in an agate mortar with 0.8980g of Li 2 CO 3 (with an excess of 5% by mass in order to prevent a possible loss of lithium during the calcination of the material at high temperature) for at least 5min until a homogeneous color mixture is obtained.
- the mixture is then positioned in a gold crucible then placed in a tubular furnace in order to undergo a heat treatment at high temperature in air, the thermal cycle of which is shown in Fig. .
- the last line of Table 2 corresponds to the expected composition for a lithiated oxide by considering the Ni/Mn/Co ratio of 2/5/3.
- the carbonate ( 1st line of the table) and the oxide ( 2nd line of the table) obtained show a very slight difference with the expected composition (last line of the table) for a lithiated oxide by considering the Ni/Mn/Co ratio of 2/5/3.
- the materials obtained are therefore quite suitable for use as active material in a cathode of a battery.
- An electrode composed of 92% of active material obtained, 4% of carbon black and 4% of polyvinylidene fluoride (92/4/4 in mass %) was prepared.
- a solution of polivinylidene fluoride dissolved in N-Methyl-2-pyrrolidone (5% by mass) was initially prepared.
- the active material and the carbon black were then suspended in this solution and the required quantity of N-Methyl-2-pyrrolidone was added in order to obtain a dry matter content of the order of 30 to 40%. .
- the mixture was left under magnetic stirring for 1 hour.
- the ink thus obtained was coated on an aluminum strip (coating thickness of 150 ⁇ m) by the so-called "Doctor Blade" process using the Elcometer® 4340 applicator.
- Electrodes with a diameter of 16 mm were cut out with a punch and then were calendered at a uniaxial pressure of 5 tons. Finally, these electrodes were dried at 80° C. under vacuum for 12 h before being stored in a glove box under a controlled argon atmosphere. The grammage was 4mg of active material per cm2. Electrochemical tests were then carried out in CR2032 button cells facing Li with 2 Celgard® 2400 type separators.
- the electrolyte used is a mixture of fluoroethylene carbonate (FEC) and dimethyl carbonate (DMC) (30/ 70 in mass %) in which is dissolved 1M lithium hexafluorophosphate (LiPF 6 ).
- the starting solutions A and B of example 2.a. have been used.
- Two different reactors were then used (1 and 2), where reactor 1 had an exhaust tube length of 1 meter and reactor 2 had an exhaust tube length of 2 meters.
- Each reactor 1 and 2 had an internal diameter of 1.39mm.
- the sampling rate of solutions A and B was 4 mL/min.
- the residence time for the reactor 1 exhaust tube was 11.4 seconds and that in the reactor 2 exhaust tube was 22.8 seconds.
- the fluid regime in the reactor was laminar.
- the pH of each solution containing the precipitate was 8.
- the morphology of the aggregates was verified by scanning electron microscopy, the results of which are shown in .
- the aggregates observed were partly partially spherical with a strong heterogeneity in the shape and in the size of the aggregates.
- the size of the aggregates was of the order of 1 ⁇ m at best.
- a residence time of more than 10 seconds in the evacuation tube therefore degrades the properties of the precursor obtained, which no longer has the diameter and the homogeneity of the precursors obtained with the synthesis method according to the invention.
- the inventors subsequently synthesized a manganese-rich carbonate precursor whose composition is Ni 0 . 25 mins 0 . 75 CO 3 .
- transition metal sulphates were prepared by weighing 6.57g of NiSO 4 .6H 2 O and 12.68g of MnSO 4 .H 2 O. These sulphates were dissolved in distilled water then placed in a 50mL volumetric flask filled to the mark. The Ni/Mn/Co molar ratio was 1/3:1/3:1/3. The concentration of this solution is 2mol/L.
- a 50mL solution containing sodium carbonate and a complexing agent (NH 4 OH) was prepared by weighing 10.60g of Na 2 CO 3 and 2.25g of NH 4 OH.
- Na 2 CO 3 was dissolved in distilled water in the presence of NH 4 OH and then placed in a 50mL volumetric flask filled to the mark.
- the concentration of Na 2 CO 3 is 2mol/L and of NH 4 OH 0.36mol/L.
- the solutions were injected into the mixer/reactor system using peristaltic pumps.
- the reactor had a length of 10 cm and an internal diameter of 1.39 mm. Under these conditions, the residence time in the reactor was 0.91s and the flow rate of the fluid in the reactor was laminar. In order to ensure the homogeneity of the precipitate which is recovered, the precipitate was not recovered during the first 30 seconds of reaction, then it is sampled under the aforementioned conditions for 60 seconds.
- the pH of the solution containing the precipitate was 8.7.
- the precipitate was then washed by centrifugation with distilled water (until neutralization of the washing waters) then dried in an oven at 70°C for 1 night.
- the mass of transition metal carbonate recovered after drying was 2.33 g and is in good agreement with the expected theoretical quantity (2.37 g). This demonstrates that the yield of the reaction is close to 100%. 2.33g of Ni 0.25 Mn 0.75 CO 3 carbonates were therefore produced in 60 seconds . This represents a production of 140g/h for a 0.15mL reactor against 16g in a 500mL batch reactor in 6h used in the prior art.
- the morphology of the aggregates was verified by scanning electron microscopy (SEM), the results of which are shown in .
- SEM scanning electron microscopy
- the inventors subsequently synthesized a carbonate precursor whose composition is Ni 1/3 Mn 1/3 Co 1/3 CO 3 .
- transition metal sulphates were prepared by weighing 8.67g of NiSO 4 .6H 2 O, 5.58g of MnSO 4 .H 2 O and 9.28g of CoSO 4 .7H 2 O. These sulfates were dissolved in distilled water and then placed in a 50mL volumetric flask filled to the mark. The Ni/Mn/Co molar ratio is 1/3:1/3:1/3. The concentration of this solution is 2mol/L.
- a 50mL solution containing sodium carbonate and a complexing agent (NH 4 OH) was prepared by weighing 10.60g of Na 2 CO 3 and 2.25g of NH 4 OH.
- Na 2 CO 3 was dissolved in distilled water in the presence of NH 4 OH and then placed in a 50mL volumetric flask filled to the mark.
- the concentration of Na 2 CO 3 is 2mol/L and of NH 4 OH 0.36mol/L.
- the solutions were injected into the mixer/reactor system using peristaltic pumps.
- the reactor had a length of 10 cm and an internal diameter of 1.39 mm. Under these conditions, the residence time in the reactor was 0.3 s and the flow rate of the fluid in the reactor was laminar. In order to ensure the homogeneity of the precipitate which is recovered, the precipitate was not recovered during the first 30 seconds of reaction, then it is sampled under the aforementioned conditions for 60 seconds.
- the pH of the solution containing the precipitate was 7.3. The precipitate was then washed by centrifugation with distilled water (until neutralization of the washing waters) then dried in an oven at 70°C for 1 night.
- the mass of transition metal carbonate recovered after drying is 2.24 g and is in good agreement with the expected theoretical quantity (2.27 g). This demonstrates that the yield of the reaction is close to 100%. 2.24g of Ni 1/3 Mn 1/3 Co 1/3 CO 3 carbonates were therefore produced in 60s. This represents a production of 136g/h for a 0.15mL reactor, against 16g in a 500mL batch reactor in 6h used in the prior art.
- the morphology of the aggregates was verified by scanning electron microscopy (SEM), the results of which are shown in .
- SEM scanning electron microscopy
- a 50mL solution of metal sulphates was prepared with a Ni/Mn/Co molar ratio of 1/3:1/3:1/3, and a concentration of 0.1mol/L.
- a 50mL solution containing 0.2 mol/L ammonium bicarbonate was also prepared.
- the solutions were injected into the mixer/reactor system using peristaltic pumps.
- the reactor had a length of 10 cm and an internal diameter of 1.39 mm. Under these conditions, the fluid regime in the reactor was intermediate. In order to ensure the homogeneity of the precipitate which is recovered, the precipitate was not recovered during the first 30 seconds of reaction, then it is sampled under the aforementioned conditions for 60 seconds.
- the pH of the solution containing the precipitate was 7.5. The precipitate was then washed by centrifugation with distilled water (until neutralization of the washing waters) then dried in an oven at 70°C for 1 night.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Electrochemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Physics & Mathematics (AREA)
- Condensed Matter Physics & Semiconductors (AREA)
- General Physics & Mathematics (AREA)
- Materials Engineering (AREA)
- Inorganic Compounds Of Heavy Metals (AREA)
Abstract
Description
un des deux tubes d’admission étant alimenté par une solution A comprenant au moins un sulfate de métal de transition choisi parmi le nickel (Ni), l’aluminium (Al), le magnésium (Mg), le titane (Ti), le cuivre (Cu), le zinc (Zn), le fer (Fe), le manganèse (Mn) et le cobalt (Co),
l’autre tube d’admission étant alimenté par une solution B comprenant un hydroxyde ou un carbonate ainsi qu’optionnellement un agent chélateur,
ladite méthode comprenant les étapes suivantes :
a) l’acheminement des solutions A et B au tube de réaction du réacteur continu selon un débit dA et dB respectivement, entrainant la précipitation du précurseur dans le tube de réaction, et
b) la récupération dudit précurseur précipité en sortie du tube de réaction, où la longueur L du tube de réaction et les débits d’acheminement dA et dB sont configurés pour que le temps de présence dans le tube de réaction soit inférieur ou égal à 10 secondes, et où le pH dans le tube de réaction est de 7 à 12.
Combinaison | Ni | Al | Mn | Co |
1 | + | |||
2 | + | |||
3 | + | |||
4 | + | + | ||
5 | + | + | ||
6 | + | + | ||
7 | + | + | ||
8 | + | + | ||
9 | + | + | ||
10 | + | + | + | |
11 | + | + | + | |
12 | + | + | + | |
13 | + | + | + | |
14 | + | + | + | + |
Combinaison | Ni | Al | Mn | Co | Mg | Ti | Cu | Zn | Fe |
1 | + | + | |||||||
2 | + | + | |||||||
3 | + | + | |||||||
4 | + | + | |||||||
5 | + | + | |||||||
6 | + | + | + | ||||||
7 | + | + | + | ||||||
8 | + | + | + | ||||||
9 | + | + | + | ||||||
10 | + | + | + | ||||||
11 | + | + | + | ||||||
12 | + | + | + | ||||||
13 | + | + | + | ||||||
14 | + | + | + | ||||||
15 | + | + | + | ||||||
16 | + | + | + | + | |||||
17 | + | + | + | + | |||||
18 | + | + | + | + | |||||
19 | + | + | + | + | |||||
20 | + | + | + | + | |||||
21 | + | + | + | + | |||||
22 | + | + | + | + | |||||
23 | + | + | + | + | |||||
24 | + | + | + | + | + | ||||
25 | + | + | + | + | + | ||||
26 | + | + | + | + | + | ||||
27 | + | + | + | + | + | ||||
28 | + | + | + | + | + | ||||
29 | + | + | + | + | + | + | |||
30 | + | + | |||||||
31 | + | + | |||||||
32 | + | + | |||||||
33 | + | + | + | ||||||
34 | + | + | + | ||||||
35 | + | + | + | ||||||
36 | + | + | + | ||||||
37 | + | + | + | ||||||
38 | + | + | + | ||||||
39 | + | + | + | ||||||
40 | + | + | + | ||||||
41 | + | + | + | ||||||
42 | + | + | + | ||||||
43 | + | + | + | + | |||||
44 | + | + | + | + | |||||
45 | + | + | + | + | |||||
46 | + | + | + | + | |||||
47 | + | + | + | + | |||||
48 | + | + | + | + | |||||
49 | + | + | + | + | |||||
50 | + | + | + | + | |||||
51 | + | + | + | + | + | ||||
52 | + | + | + | + | + | ||||
53 | + | + | + | + | + | ||||
54 | + | + | + | + | + | ||||
55 | + | + | + | + | + | ||||
56 | + | ||||||||
57 | + | + | |||||||
58 | + | + | |||||||
59 | + | + | |||||||
60 | + | + | |||||||
61 | + | + | |||||||
62 | + | + | + | ||||||
63 | + | + | + | ||||||
64 | + | + | + | ||||||
65 | + | + | + | ||||||
66 | + | + | + | ||||||
67 | + | + | + | ||||||
68 | + | + | + | ||||||
69 | + | + | + | ||||||
70 | + | + | + | ||||||
71 | + | + | + | ||||||
72 | + | + | + | + | |||||
73 | + | + | + | + | |||||
74 | + | + | + | + | |||||
75 | + | + | + | + | |||||
76 | + | + | + | + | |||||
77 | + | + | + | + | |||||
78 | + | + | + | + | |||||
79 | + | + | + | + | |||||
80 | + | + | + | + | + | ||||
81 | + | + | + | + | + | ||||
82 | + | + | + | + | + | ||||
83 | + | + | + | + | + | ||||
84 | + | + | + | + | + | ||||
85 | + | ||||||||
86 | + | + | |||||||
87 | + | + | |||||||
88 | + | + | |||||||
89 | + | + | |||||||
90 | + | + | |||||||
91 | + | + | + | ||||||
92 | + | + | + | ||||||
93 | + | + | + | ||||||
94 | + | + | + | ||||||
95 | + | + | + | ||||||
96 | + | + | + | ||||||
97 | + | + | + | ||||||
98 | + | + | + | ||||||
99 | + | + | + | ||||||
100 | + | + | + | ||||||
101 | + | + | + | + | |||||
102 | + | + | + | + | |||||
103 | + | + | + | + | |||||
104 | + | + | + | + | |||||
105 | + | + | + | + | |||||
106 | + | + | + | + | |||||
107 | + | + | + | + | |||||
108 | + | + | + | + | |||||
109 | + | + | + | + | + | ||||
110 | + | + | + | + | + | ||||
111 | + | + | + | + | + | ||||
112 | + | + | + | + | + | ||||
113 | + | + | + | + | + | ||||
114 | + | + | + | + | + | + | |||
115 | + | + | + | ||||||
116 | + | + | + | ||||||
117 | + | + | + | ||||||
118 | + | + | + | ||||||
119 | + | + | + | ||||||
120 | + | + | + | + | |||||
121 | + | + | + | + | |||||
122 | + | + | + | + | |||||
123 | + | + | + | + | |||||
124 | + | + | + | + | |||||
125 | + | + | + | + | |||||
126 | + | + | + | + | |||||
127 | + | + | + | + | |||||
128 | + | + | + | + | |||||
129 | + | + | + | + | |||||
130 | + | + | + | + | + | ||||
131 | + | + | + | + | + | ||||
132 | + | + | + | + | + | ||||
133 | + | + | + | + | + | ||||
134 | + | + | + | + | + | ||||
135 | + | + | + | + | + | ||||
136 | + | + | + | + | + | ||||
137 | + | + | + | + | + | ||||
138 | + | + | + | + | + | + | |||
139 | + | + | + | + | + | + | |||
140 | + | + | + | + | + | + | |||
141 | + | + | + | + | + | + | |||
142 | + | + | + | + | + | + | |||
143 | + | + | + | + | + | + | + | ||
144 | + | + | + | ||||||
145 | + | + | + | ||||||
146 | + | + | + | ||||||
147 | + | + | + | ||||||
148 | + | + | + | ||||||
149 | + | + | + | + | |||||
150 | + | + | + | + | |||||
151 | + | + | + | + | |||||
152 | + | + | + | + | |||||
153 | + | + | + | + | |||||
154 | + | + | + | + | |||||
155 | + | + | + | + | |||||
156 | + | + | + | + | |||||
157 | + | + | + | + | |||||
158 | + | + | + | + | |||||
159 | + | + | + | + | + | ||||
160 | + | + | + | + | + | ||||
161 | + | + | + | + | + | ||||
162 | + | + | + | + | + | ||||
163 | + | + | + | + | + | ||||
164 | + | + | + | + | + | ||||
165 | + | + | + | + | + | ||||
166 | + | + | + | + | + | ||||
167 | + | + | + | + | + | + | |||
168 | + | + | + | + | + | + | |||
169 | + | + | + | + | + | + | |||
170 | + | + | + | + | + | + | |||
171 | + | + | + | + | + | + | |||
172 | + | + | + | + | + | + | + | ||
173 | + | + | + | ||||||
174 | + | + | + | ||||||
175 | + | + | + | ||||||
176 | + | + | + | ||||||
177 | + | + | + | ||||||
178 | + | + | + | + | |||||
179 | + | + | + | + | |||||
180 | + | + | + | + | |||||
181 | + | + | + | + | |||||
182 | + | + | + | + | |||||
183 | + | + | + | + | |||||
184 | + | + | + | + | |||||
185 | + | + | + | + | |||||
186 | + | + | + | + | |||||
187 | + | + | + | + | |||||
188 | + | + | + | + | + | ||||
189 | + | + | + | + | + | ||||
190 | + | + | + | + | + | ||||
191 | + | + | + | + | + | ||||
192 | + | + | + | + | + | ||||
193 | + | + | + | + | + | ||||
194 | + | + | + | + | + | ||||
195 | + | + | + | + | + | ||||
196 | + | + | + | + | + | + | |||
197 | + | + | + | + | + | + | |||
198 | + | + | + | + | + | + | |||
199 | + | + | + | + | + | + | |||
200 | + | + | + | + | + | + | |||
201 | + | + | + | + | + | + | + | ||
202 | + | + | + | ||||||
203 | + | + | + | ||||||
204 | + | + | + | ||||||
205 | + | + | + | ||||||
206 | + | + | + | ||||||
207 | + | + | + | + | |||||
208 | + | + | + | + | |||||
209 | + | + | + | + | |||||
210 | + | + | + | + | |||||
211 | + | + | + | + | |||||
212 | + | + | + | + | |||||
213 | + | + | + | + | |||||
214 | + | + | + | + | |||||
215 | + | + | + | + | |||||
216 | + | + | + | + | |||||
217 | + | + | + | + | + | ||||
218 | + | + | + | + | + | ||||
219 | + | + | + | + | + | ||||
220 | + | + | + | + | + | ||||
221 | + | + | + | + | + | ||||
222 | + | + | + | + | + | ||||
223 | + | + | + | + | + | ||||
224 | + | + | + | + | + | ||||
225 | + | + | + | + | + | + | |||
226 | + | + | + | + | + | + | |||
227 | + | + | + | + | + | + | |||
228 | + | + | + | + | + | + | |||
229 | + | + | + | + | + | + | |||
230 | + | + | + | + | + | + | + | ||
231 | + | + | + | ||||||
232 | + | + | + | ||||||
233 | + | + | + | ||||||
234 | + | + | + | ||||||
235 | + | + | + | ||||||
236 | + | + | + | + | |||||
237 | + | + | + | + | |||||
238 | + | + | + | + | |||||
239 | + | + | + | + | |||||
240 | + | + | + | + | |||||
241 | + | + | + | + | |||||
242 | + | + | + | + | |||||
243 | + | + | + | + | |||||
244 | + | + | + | + | |||||
245 | + | + | + | + | |||||
246 | + | + | + | + | + | ||||
247 | + | + | + | + | + | ||||
248 | + | + | + | + | + | ||||
249 | + | + | + | + | + | ||||
250 | + | + | + | + | + | ||||
251 | + | + | + | + | + | ||||
252 | + | + | + | + | + | ||||
253 | + | + | + | + | + | ||||
254 | + | + | + | + | + | + | |||
255 | + | + | + | + | + | + | |||
256 | + | + | + | + | + | + | |||
257 | + | + | + | + | + | + | |||
258 | + | + | + | + | + | + | |||
259 | + | + | + | + | + | + | + | ||
260 | + | + | + | ||||||
261 | + | + | + | ||||||
262 | + | + | + | ||||||
263 | + | + | + | ||||||
264 | + | + | + | ||||||
265 | + | + | + | + | |||||
266 | + | + | + | + | |||||
267 | + | + | + | + | |||||
268 | + | + | + | + | |||||
269 | + | + | + | + | |||||
270 | + | + | + | + | |||||
271 | + | + | + | + | |||||
272 | + | + | + | + | |||||
273 | + | + | + | + | |||||
274 | + | + | + | + | |||||
275 | + | + | + | + | + | ||||
276 | + | + | + | + | + | ||||
277 | + | + | + | + | + | ||||
278 | + | + | + | + | + | ||||
279 | + | + | + | + | + | ||||
280 | + | + | + | + | + | ||||
281 | + | + | + | + | + | ||||
282 | + | + | + | + | + | ||||
283 | + | + | + | + | + | + | |||
284 | + | + | + | + | + | + | |||
285 | + | + | + | + | + | + | |||
286 | + | + | + | + | + | + | |||
287 | + | + | + | + | + | + | |||
288 | + | + | + | + | + | + | + | ||
289 | + | + | + | + | |||||
290 | + | + | + | + | |||||
291 | + | + | + | + | |||||
292 | + | + | + | + | |||||
293 | + | + | + | + | |||||
294 | + | + | + | + | + | ||||
295 | + | + | + | + | + | ||||
296 | + | + | + | + | + | ||||
297 | + | + | + | + | + | ||||
298 | + | + | + | + | + | ||||
299 | + | + | + | + | + | ||||
300 | + | + | + | + | + | ||||
301 | + | + | + | + | + | ||||
302 | + | + | + | + | + | ||||
303 | + | + | + | + | + | ||||
304 | + | + | + | + | + | + | |||
305 | + | + | + | + | + | + | |||
306 | + | + | + | + | + | + | |||
307 | + | + | + | + | + | + | |||
308 | + | + | + | + | + | + | |||
309 | + | + | + | + | + | + | |||
310 | + | + | + | + | + | + | |||
311 | + | + | + | + | + | + | |||
312 | + | + | + | + | + | + | + | ||
313 | + | + | + | + | + | + | + | ||
314 | + | + | + | + | + | + | + | ||
315 | + | + | + | + | + | + | + | ||
316 | + | + | + | + | + | + | + | ||
317 | + | + | + | + | + | + | + | + | |
318 | + | + | + | + | |||||
319 | + | + | + | + | |||||
320 | + | + | + | + | |||||
321 | + | + | + | + | |||||
322 | + | + | + | + | |||||
323 | + | + | + | + | + | ||||
324 | + | + | + | + | + | ||||
325 | + | + | + | + | + | ||||
326 | + | + | + | + | + | ||||
327 | + | + | + | + | + | ||||
328 | + | + | + | + | + | ||||
329 | + | + | + | + | + | ||||
330 | + | + | + | + | + | ||||
331 | + | + | + | + | + | ||||
332 | + | + | + | + | + | ||||
333 | + | + | + | + | + | + | |||
334 | + | + | + | + | + | + | |||
335 | + | + | + | + | + | + | |||
336 | + | + | + | + | + | + | |||
337 | + | + | + | + | + | + | |||
338 | + | + | + | + | + | + | |||
339 | + | + | + | + | + | + | |||
340 | + | + | + | + | + | + | |||
341 | + | + | + | + | + | + | + | ||
342 | + | + | + | + | + | + | + | ||
343 | + | + | + | + | + | + | + | ||
344 | + | + | + | + | + | + | + | ||
345 | + | + | + | + | + | + | + | ||
346 | + | + | + | + | + | + | + | + | |
347 | + | + | + | + | |||||
348 | + | + | + | + | |||||
349 | + | + | + | + | |||||
350 | + | + | + | + | |||||
351 | + | + | + | + | |||||
352 | + | + | + | + | + | ||||
353 | + | + | + | + | + | ||||
354 | + | + | + | + | + | ||||
355 | + | + | + | + | + | ||||
356 | + | + | + | + | + | ||||
357 | + | + | + | + | + | ||||
358 | + | + | + | + | + | ||||
359 | + | + | + | + | + | ||||
360 | + | + | + | + | + | ||||
361 | + | + | + | + | + | ||||
362 | + | + | + | + | + | + | |||
363 | + | + | + | + | + | + | |||
364 | + | + | + | + | + | + | |||
365 | + | + | + | + | + | + | |||
366 | + | + | + | + | + | + | |||
367 | + | + | + | + | + | + | |||
368 | + | + | + | + | + | + | |||
369 | + | + | + | + | + | + | |||
370 | + | + | + | + | + | + | + | ||
371 | + | + | + | + | + | + | + | ||
372 | + | + | + | + | + | + | + | ||
373 | + | + | + | + | + | + | + | ||
374 | + | + | + | + | + | + | + | ||
375 | + | + | + | + | + | + | + | + | |
376 | + | + | + | + | |||||
377 | + | + | + | + | |||||
378 | + | + | + | + | |||||
379 | + | + | + | + | |||||
380 | + | + | + | + | |||||
381 | + | + | + | + | + | ||||
382 | + | + | + | + | + | ||||
383 | + | + | + | + | + | ||||
384 | + | + | + | + | + | ||||
385 | + | + | + | + | + | ||||
386 | + | + | + | + | + | ||||
387 | + | + | + | + | + | ||||
388 | + | + | + | + | + | ||||
389 | + | + | + | + | + | ||||
390 | + | + | + | + | + | ||||
391 | + | + | + | + | + | + | |||
392 | + | + | + | + | + | + | |||
393 | + | + | + | + | + | + | |||
394 | + | + | + | + | + | + | |||
395 | + | + | + | + | + | + | |||
396 | + | + | + | + | + | + | |||
397 | + | + | + | + | + | + | |||
398 | + | + | + | + | + | + | |||
399 | + | + | + | + | + | + | + | ||
400 | + | + | + | + | + | + | + | ||
401 | + | + | + | + | + | + | + | ||
402 | + | + | + | + | + | + | + | ||
403 | + | + | + | + | + | + | + | ||
404 | + | + | + | + | + | + | + | + | |
405 | + | + | + | + | + | ||||
406 | + | + | + | + | + | ||||
407 | + | + | + | + | + | ||||
408 | + | + | + | + | + | ||||
409 | + | + | + | + | + | ||||
410 | + | + | + | + | + | + | |||
411 | + | + | + | + | + | + | |||
412 | + | + | + | + | + | + | |||
413 | + | + | + | + | + | + | |||
414 | + | + | + | + | + | + | |||
415 | + | + | + | + | + | + | |||
416 | + | + | + | + | + | + | |||
417 | + | + | + | + | + | + | |||
418 | + | + | + | + | + | + | |||
419 | + | + | + | + | + | + | |||
420 | + | + | + | + | + | + | + | ||
421 | + | + | + | + | + | + | + | ||
422 | + | + | + | + | + | + | + | ||
423 | + | + | + | + | + | + | + | ||
424 | + | + | + | + | + | + | + | ||
425 | + | + | + | + | + | + | + | ||
426 | + | + | + | + | + | + | + | ||
427 | + | + | + | + | + | + | + | ||
428 | + | + | + | + | + | + | + | + | |
429 | + | + | + | + | + | + | + | + | |
430 | + | + | + | + | + | + | + | + | |
431 | + | + | + | + | + | + | + | + | |
432 | + | + | + | + | + | + | + | + | |
433 | + | + | + | + | + | + | + | + | + |
un des deux tubes d’admission étant alimenté par une solution A comprenant au moins un sulfate de métal de transition choisi parmi le nickel (Ni), l’aluminium (Al), le magnésium (Mg), le titane (Ti), le cuivre (Cu), le zinc (Zn), le fer (Fe), le manganèse (Mn) et le cobalt (Co),
l’autre tube d’admission étant alimenté par une solution B comprenant un hydroxyde ou un carbonate ainsi qu’optionnellement un agent chélateur,
où l’acheminement des solutions A et B au tube de réaction du réacteur continu est réalisé selon un débit dA et dB respectivement, entrainant la précipitation du précurseur dans le tube de réaction, et la récupération dudit précurseur précipité est réalisée en sortie du tube de réaction,
et où la longueur L du tube de réaction et les débits d’acheminement dA et dB sont configurés pour que le temps de présence dans le tube de réaction soit inférieur ou égal à 10 secondes, et où le pH dans le tube de réaction est de 7 à 12.
Ni | Mn | Co | |
Expérimental | 0,17 ± 0,01 |
0,53 ± 0,02 |
0,30 ± 0,01 |
Théorie | 0,2 | 0,5 | 0,3 |
Li | Ni | Mn | Co | |
Carbonate | 1.18 ±0.03 | 0.137 ±0.004 | 0.435 ±0.013 | 0.247 ±0.007 |
Oxyde | 1.15 | 0.144 | 0.450 | 0.255 |
Théorique | 1.15 | 0.17 | 0.425 | 0.255 |
Ni | Mn | Co | |
Réacteur 1 | 0.18 ±0.01 | 0.51 ±0.02 | 0.31 ±0.01 |
Réacteur 2 | 0.18 ±0.01 | 0.51 ±0.02 | 0.31 ±0.01 |
Théori que | 0.2 | 0.5 | 0.3 |
Ni | Mn | |
Expérimental | 0,24 | 0,76 |
Théorie | 0,25 | 0,75 |
Ni | Mn | Co | |
Expérimental | 0,33 | 0,33 | 0,33 |
Théorie | 0,33 | 0,33 | 0,33 |
Claims (10)
- Méthode de synthèse de particules sphériques de matériaux, ladite méthode étant réalisée dans un réacteur continu, ledit réacteur continu étant formé par un tube de réaction, ledit tube de réaction étant alimenté par deux tubes d’admission, le tube de réaction ayant une longueur L,
un des deux tubes d’admission étant alimenté par une solution A comprenant au moins un sulfate de métal de transition choisi parmi le nickel (Ni), l’aluminium (Al), le magnésium (Mg), le titane (Ti), le cuivre (Cu), le zinc (Zn), le fer (Fe), le manganèse (Mn) et le cobalt (Co),
l’autre tube d’admission étant alimenté par une solution B comprenant un hydroxyde ou un carbonate ainsi qu’optionnellement un agent chélateur,
ladite méthode comprenant les étapes suivantes :- l’acheminement des solutions A et B au tube de réaction du réacteur continu selon un débit dA et dB respectivement, entrainant la précipitation d’un précurseur dans le tube de réaction, et
- la récupération dudit précurseur précipité en sortie du tube de réaction,
- Méthode de synthèse selon la revendication 1, dans laquelle le temps de présence dans le tube de réaction est de 1 milliseconde à 10 secondes, de préférence le temps présence dans le tube de réaction est inférieur ou égal à 5 secondes, de préférence encore le temps de présence dans le tube de réaction est inférieur ou égal à 1 seconde.
- Méthode de synthèse selon la revendication 1 ou 2, dans laquelle la longueur L du tube de réaction est d’au moins 1 mm.
- Méthode de synthèse selon l’une des revendications 1 à 3, dans laquelle le diamètre interne de chaque tube d’admission et du tube de réaction est d’au moins 0,5 mm, de préférence le diamètre interne de chaque tube d’admission est supérieur à 1 mm, de préférence encore le diamètre interne de chaque tube d’admission et du tube de réaction est entre 1 et 1,5 mm.
- Méthode de synthèse selon l’une des revendications 1 à 4, dans laquelle la température dans le tube de réaction est de 20°C à 70°C, de préférence de 25°C à 50°C.
- Méthode de synthèse selon l’une des revendications 1 à 5, dans laquelle la solution A comprend au moins trois sulfates de métal de transition choisi parmi le nickel (Ni), l’aluminium (Al), le manganèse (Mn) et le cobalt (Co).
- Méthode de synthèse selon l’une des revendications 1 à 6, dans laquelle l’hydroxyde est choisi dans le groupe constitué de l’hydroxyde de sodium, de l’hydroxyde de potassium, de la 8-hydroxyquinoline, de l’ammoniaque, de l’hydroxyde de lithium et leur mélange, de préférence l’hydroxyde est l’hydroxyde de sodium.
- Méthode de synthèse selon l’une des revendications 1 à 7, dans laquelle le carbonate est choisi dans le groupe constitué par le bicarbonate d’ammonium, le carbonate de sodium, le carbonate de potassium, le carbonate de lithium et leur mélange, de préférence, le carbonate est le carbonate de sodium.
- Méthode de synthèse selon l’une des revendications 1 à 8, dans laquelle chaque solution A et B est acheminée à l’aide d’une pompe péristaltique.
- Méthode de synthèse selon l’une des revendications 1 à 9, dans laquelle les débits d’acheminement dA et dB sont chacun d’au moins 0,01ml/min.
Priority Applications (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CN202280039188.3A CN117440933A (zh) | 2021-06-02 | 2022-06-02 | 用于合成球形材料颗粒的方法 |
EP22731648.6A EP4347497A1 (fr) | 2021-06-02 | 2022-06-02 | Méthode de synthèse de particules sphériques de matériaux |
KR1020237041065A KR20240016276A (ko) | 2021-06-02 | 2022-06-02 | 구형 재료 입자의 합성 방법 |
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
FR2105819 | 2021-06-02 | ||
FRFR2105819 | 2021-06-02 |
Publications (1)
Publication Number | Publication Date |
---|---|
WO2022253986A1 true WO2022253986A1 (fr) | 2022-12-08 |
Family
ID=77710909
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
PCT/EP2022/065130 WO2022253986A1 (fr) | 2021-06-02 | 2022-06-02 | Méthode de synthèse de particules sphériques de matériaux |
Country Status (4)
Country | Link |
---|---|
EP (1) | EP4347497A1 (fr) |
KR (1) | KR20240016276A (fr) |
CN (1) | CN117440933A (fr) |
WO (1) | WO2022253986A1 (fr) |
Citations (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2015061121A1 (fr) * | 2013-10-24 | 2015-04-30 | Dow Global Technologies Llc | Matériaux de cathode améliorés à base d'un oxyde de métal lithié et leur procédé de fabrication |
WO2018113541A1 (fr) * | 2016-12-19 | 2018-06-28 | Grst International Limited | Procédé de préparation de matériau de cathode pour batterie secondaire |
EP3421422A1 (fr) * | 2017-06-26 | 2019-01-02 | Centre National De La Recherche Scientifique | Procédé de fabrication de nanoparticules de phosphate de métal par synthèse solvothermale sous- et supercritique et nanoparticules obtenues par ce procédé |
CN110875472A (zh) | 2018-08-31 | 2020-03-10 | 于志远 | 一种锂电池微纳米正极材料的制备方法 |
-
2022
- 2022-06-02 WO PCT/EP2022/065130 patent/WO2022253986A1/fr active Application Filing
- 2022-06-02 KR KR1020237041065A patent/KR20240016276A/ko unknown
- 2022-06-02 CN CN202280039188.3A patent/CN117440933A/zh active Pending
- 2022-06-02 EP EP22731648.6A patent/EP4347497A1/fr active Pending
Patent Citations (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2015061121A1 (fr) * | 2013-10-24 | 2015-04-30 | Dow Global Technologies Llc | Matériaux de cathode améliorés à base d'un oxyde de métal lithié et leur procédé de fabrication |
WO2018113541A1 (fr) * | 2016-12-19 | 2018-06-28 | Grst International Limited | Procédé de préparation de matériau de cathode pour batterie secondaire |
EP3421422A1 (fr) * | 2017-06-26 | 2019-01-02 | Centre National De La Recherche Scientifique | Procédé de fabrication de nanoparticules de phosphate de métal par synthèse solvothermale sous- et supercritique et nanoparticules obtenues par ce procédé |
CN110875472A (zh) | 2018-08-31 | 2020-03-10 | 于志远 | 一种锂电池微纳米正极材料的制备方法 |
Non-Patent Citations (5)
Title |
---|
H. LIANG ET AL., CHEMICAL ENGINEERING JOURNAL, vol. 394, 2020, pages 124846 |
PETRICEK, V.DUSEK, M.PALATINUS, L., Z. KRISTALLOGR., vol. 229, no. 5, 2014, pages 345 - 352 |
PIMENTA ET AL., CHEM. MATER., vol. 29, 2017, pages 9923 - 9936 |
SU JING ET AL: "Fast Preparation of Porous MnO/C Microspheres as Anode Materials for Lithium-Ion Batteries", 10 May 2017 (2017-05-10), pages 1 - 31, XP055895618, Retrieved from the Internet <URL:https://www.preprints.org/manuscript/201705.0094/v1> [retrieved on 20220225], DOI: 10.20944/preprints201705.0094.v1 * |
THAI DIEN KHUONG ET AL: "Agglomeration of Ni-rich hydroxide crystals in Taylor vortex flow", POWDER TECHNOLOGY, vol. 274, April 2015 (2015-04-01), Basel (CH), pages 5 - 13, XP055895582, ISSN: 0032-5910, DOI: 10.1016/j.powtec.2015.01.008 * |
Also Published As
Publication number | Publication date |
---|---|
KR20240016276A (ko) | 2024-02-06 |
CN117440933A (zh) | 2024-01-23 |
EP4347497A1 (fr) | 2024-04-10 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US11205774B2 (en) | Nickel composite hydroxide and process for producing same, positive electrode active material and process for producing same, and non-aqueous electrolyte secondary battery | |
KR101644258B1 (ko) | 니켈 복합 수산화물과 그의 제조 방법, 비수계 전해질 이차 전지용 정극 활물질과 그의 제조 방법, 및 비수계 전해질 이차 전지 | |
JP5614334B2 (ja) | ニッケルコバルト複合水酸化物およびその製造方法、ならびに該複合水酸化物を用いて得られる非水系電解質二次電池用正極活物質 | |
US8592085B2 (en) | Nickel-cobalt-maganese-based compound particles and process for producing the nickel-cobalt-manganese-based compound particles, lithium composite oxide particles and process for producing the lithium composite oxide particles, and non-aqueous electrolyte secondary battery | |
US11973223B2 (en) | Manganese composite hydroxide and process for producing same, positive electrode active material and process for producing same, and non-aqueous electrolyte secondary battery | |
US20220194814A1 (en) | Process for precipitating a mixed hydroxide, and cathode active materials made from such hydroxide | |
EP1572585B1 (fr) | Procede de preparation de composes d'insertion d'un metal alcalin, materiaux actifs les contenant, et dispositifs comprenant ces materiaux actifs | |
JP2016011226A (ja) | マンガンコバルト複合水酸化物及びその製造方法、正極活物質及びその製造方法、並びに非水系電解質二次電池 | |
CN112135931B (zh) | 使用低纯度起始前体来电镀锂化过渡金属氧化物 | |
Zhu et al. | LiNi0. 5Mn1. 5O4 nanostructures with two-phase intergrowth as enhanced cathodes for lithium-ion batteries | |
US10526212B2 (en) | Mixed transition metal oxides for lithium ion batteries | |
CN101501898A (zh) | 非水电解质二次电池用正极活性物质以及非水电解质二次电池 | |
WO2022253986A1 (fr) | Méthode de synthèse de particules sphériques de matériaux | |
EP3492427B1 (fr) | Materiau silicate phosphate de structure cristallographique olivine | |
US20230312367A1 (en) | Process For Precipitating A Mixed Hydroxide | |
FR3074159B1 (fr) | Materiau silicate phosphate de structure cristallographique olivine | |
FR3061903A1 (fr) | Procede de preparation de nanoparticules non agglomerees d'un oxyde lamellaire lithie | |
Kipfer et al. | Upcycling of lithium cobalt oxide to LiNi 1/3 Mn 1/3 Co 1/3 O 2 | |
CA3207772A1 (fr) | Procede de dissolution d'un materiau d'electrode positive | |
WO2023135055A1 (fr) | Procédé de fabrication d'(oxy) hydroxydes particulaires et d'(oxy) hydroxydes particulaires (oxy) | |
JP2019186175A (ja) | 非水系電解質二次電池用正極活物質とその製造方法、および非水系電解質二次電池 |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
121 | Ep: the epo has been informed by wipo that ep was designated in this application |
Ref document number: 22731648 Country of ref document: EP Kind code of ref document: A1 |
|
WWE | Wipo information: entry into national phase |
Ref document number: 18565313 Country of ref document: US |
|
WWE | Wipo information: entry into national phase |
Ref document number: 202280039188.3 Country of ref document: CN |
|
WWE | Wipo information: entry into national phase |
Ref document number: 2023574466 Country of ref document: JP |
|
WWE | Wipo information: entry into national phase |
Ref document number: 2022731648 Country of ref document: EP |
|
NENP | Non-entry into the national phase |
Ref country code: DE |
|
ENP | Entry into the national phase |
Ref document number: 2022731648 Country of ref document: EP Effective date: 20240102 |