US3883373A - Gas generating compositions - Google Patents
Gas generating compositions Download PDFInfo
- Publication number
- US3883373A US3883373A US375654A US37565473A US3883373A US 3883373 A US3883373 A US 3883373A US 375654 A US375654 A US 375654A US 37565473 A US37565473 A US 37565473A US 3883373 A US3883373 A US 3883373A
- Authority
- US
- United States
- Prior art keywords
- nitrate
- azide
- perchlorate
- gas generating
- oxide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 68
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims abstract description 50
- 150000001875 compounds Chemical class 0.000 claims abstract description 24
- 230000001590 oxidative effect Effects 0.000 claims abstract description 22
- 239000004615 ingredient Substances 0.000 claims abstract description 21
- 239000000377 silicon dioxide Substances 0.000 claims abstract description 19
- -1 alkaline earth metal azide Chemical class 0.000 claims abstract description 18
- 229910052751 metal Inorganic materials 0.000 claims abstract description 16
- 239000002184 metal Substances 0.000 claims abstract description 16
- 229910052710 silicon Inorganic materials 0.000 claims abstract description 16
- 239000010703 silicon Substances 0.000 claims abstract description 16
- 229910052782 aluminium Inorganic materials 0.000 claims abstract description 12
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims abstract description 12
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims abstract description 7
- 239000007789 gas Substances 0.000 claims description 45
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 claims description 22
- 150000001540 azides Chemical class 0.000 claims description 19
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 14
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 13
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 10
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 9
- 229910021485 fumed silica Inorganic materials 0.000 claims description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 9
- AXZAYXJCENRGIM-UHFFFAOYSA-J dipotassium;tetrabromoplatinum(2-) Chemical compound [K+].[K+].[Br-].[Br-].[Br-].[Br-].[Pt+2] AXZAYXJCENRGIM-UHFFFAOYSA-J 0.000 claims description 8
- 229910001487 potassium perchlorate Inorganic materials 0.000 claims description 8
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims description 7
- 229910052725 zinc Inorganic materials 0.000 claims description 7
- 239000011701 zinc Substances 0.000 claims description 7
- 229910002651 NO3 Inorganic materials 0.000 claims description 6
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 6
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 6
- IWOUKMZUPDVPGQ-UHFFFAOYSA-N barium nitrate Chemical compound [Ba+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O IWOUKMZUPDVPGQ-UHFFFAOYSA-N 0.000 claims description 6
- VCJMYUPGQJHHFU-UHFFFAOYSA-N iron(3+);trinitrate Chemical compound [Fe+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O VCJMYUPGQJHHFU-UHFFFAOYSA-N 0.000 claims description 6
- IIPYXGDZVMZOAP-UHFFFAOYSA-N lithium nitrate Chemical compound [Li+].[O-][N+]([O-])=O IIPYXGDZVMZOAP-UHFFFAOYSA-N 0.000 claims description 6
- YIXJRHPUWRPCBB-UHFFFAOYSA-N magnesium nitrate Chemical compound [Mg+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O YIXJRHPUWRPCBB-UHFFFAOYSA-N 0.000 claims description 6
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 claims description 6
- XXQBEVHPUKOQEO-UHFFFAOYSA-N potassium superoxide Chemical compound [K+].[K+].[O-][O-] XXQBEVHPUKOQEO-UHFFFAOYSA-N 0.000 claims description 6
- 235000012239 silicon dioxide Nutrition 0.000 claims description 6
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 claims description 6
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 claims description 6
- 229910052718 tin Inorganic materials 0.000 claims description 6
- ONDPHDOFVYQSGI-UHFFFAOYSA-N zinc nitrate Chemical compound [Zn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ONDPHDOFVYQSGI-UHFFFAOYSA-N 0.000 claims description 6
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical group [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 5
- 239000002245 particle Substances 0.000 claims description 5
- 229910000077 silane Inorganic materials 0.000 claims description 5
- 229910001887 tin oxide Inorganic materials 0.000 claims description 5
- 239000011787 zinc oxide Substances 0.000 claims description 5
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 claims description 4
- 239000004408 titanium dioxide Substances 0.000 claims description 4
- BNGXYYYYKUGPPF-UHFFFAOYSA-M (3-methylphenyl)methyl-triphenylphosphanium;chloride Chemical compound [Cl-].CC1=CC=CC(C[P+](C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 BNGXYYYYKUGPPF-UHFFFAOYSA-M 0.000 claims description 3
- WHQOKFZWSDOTQP-UHFFFAOYSA-N 2,3-dihydroxypropyl 4-aminobenzoate Chemical compound NC1=CC=C(C(=O)OCC(O)CO)C=C1 WHQOKFZWSDOTQP-UHFFFAOYSA-N 0.000 claims description 3
- 239000004343 Calcium peroxide Substances 0.000 claims description 3
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 claims description 3
- MPCRDALPQLDDFX-UHFFFAOYSA-L Magnesium perchlorate Chemical compound [Mg+2].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O MPCRDALPQLDDFX-UHFFFAOYSA-L 0.000 claims description 3
- UUXFWHMUNNXFHD-UHFFFAOYSA-N barium azide Chemical compound [Ba+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] UUXFWHMUNNXFHD-UHFFFAOYSA-N 0.000 claims description 3
- OOULUYZFLXDWDQ-UHFFFAOYSA-L barium perchlorate Chemical compound [Ba+2].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O OOULUYZFLXDWDQ-UHFFFAOYSA-L 0.000 claims description 3
- 229910052792 caesium Inorganic materials 0.000 claims description 3
- UETLMBWMVIQIGU-UHFFFAOYSA-N calcium azide Chemical compound [Ca+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] UETLMBWMVIQIGU-UHFFFAOYSA-N 0.000 claims description 3
- LHJQIRIGXXHNLA-UHFFFAOYSA-N calcium peroxide Chemical compound [Ca+2].[O-][O-] LHJQIRIGXXHNLA-UHFFFAOYSA-N 0.000 claims description 3
- 235000019402 calcium peroxide Nutrition 0.000 claims description 3
- AYTVLULEEPNWAX-UHFFFAOYSA-N cesium;azide Chemical compound [Cs+].[N-]=[N+]=[N-] AYTVLULEEPNWAX-UHFFFAOYSA-N 0.000 claims description 3
- BSUSEPIPTZNHMN-UHFFFAOYSA-L cobalt(2+);diperchlorate Chemical compound [Co+2].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O BSUSEPIPTZNHMN-UHFFFAOYSA-L 0.000 claims description 3
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 claims description 3
- RXPAJWPEYBDXOG-UHFFFAOYSA-N hydron;methyl 4-methoxypyridine-2-carboxylate;chloride Chemical compound Cl.COC(=O)C1=CC(OC)=CC=N1 RXPAJWPEYBDXOG-UHFFFAOYSA-N 0.000 claims description 3
- 229910001484 inorganic perchlorate Inorganic materials 0.000 claims description 3
- LHOWRPZTCLUDOI-UHFFFAOYSA-K iron(3+);triperchlorate Chemical compound [Fe+3].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O LHOWRPZTCLUDOI-UHFFFAOYSA-K 0.000 claims description 3
- GUWHRJQTTVADPB-UHFFFAOYSA-N lithium azide Chemical compound [Li+].[N-]=[N+]=[N-] GUWHRJQTTVADPB-UHFFFAOYSA-N 0.000 claims description 3
- MHCFAGZWMAWTNR-UHFFFAOYSA-M lithium perchlorate Chemical compound [Li+].[O-]Cl(=O)(=O)=O MHCFAGZWMAWTNR-UHFFFAOYSA-M 0.000 claims description 3
- 229910001486 lithium perchlorate Inorganic materials 0.000 claims description 3
- TWRAJPCQPHBABR-UHFFFAOYSA-N magnesium;diazide Chemical compound [Mg+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] TWRAJPCQPHBABR-UHFFFAOYSA-N 0.000 claims description 3
- MIVBAHRSNUNMPP-UHFFFAOYSA-N manganese(2+);dinitrate Chemical compound [Mn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O MIVBAHRSNUNMPP-UHFFFAOYSA-N 0.000 claims description 3
- 229910001960 metal nitrate Inorganic materials 0.000 claims description 3
- 150000004972 metal peroxides Chemical class 0.000 claims description 3
- XMMDVXFQGOEOKH-UHFFFAOYSA-N n'-dodecylpropane-1,3-diamine Chemical compound CCCCCCCCCCCCNCCCN XMMDVXFQGOEOKH-UHFFFAOYSA-N 0.000 claims description 3
- KBJMLQFLOWQJNF-UHFFFAOYSA-N nickel(ii) nitrate Chemical compound [Ni+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O KBJMLQFLOWQJNF-UHFFFAOYSA-N 0.000 claims description 3
- FYWSTUCDSVYLPV-UHFFFAOYSA-N nitrooxythallium Chemical compound [Tl+].[O-][N+]([O-])=O FYWSTUCDSVYLPV-UHFFFAOYSA-N 0.000 claims description 3
- TZLVRPLSVNESQC-UHFFFAOYSA-N potassium azide Chemical compound [K+].[N-]=[N+]=[N-] TZLVRPLSVNESQC-UHFFFAOYSA-N 0.000 claims description 3
- 235000010333 potassium nitrate Nutrition 0.000 claims description 3
- 239000004323 potassium nitrate Substances 0.000 claims description 3
- 230000002940 repellent Effects 0.000 claims description 3
- 239000005871 repellent Substances 0.000 claims description 3
- 229910052701 rubidium Inorganic materials 0.000 claims description 3
- 229910001489 rubidium perchlorate Inorganic materials 0.000 claims description 3
- GEWQYWRSUXOTOL-UHFFFAOYSA-N rubidium(1+);azide Chemical compound [Rb+].[N-]=[N+]=[N-] GEWQYWRSUXOTOL-UHFFFAOYSA-N 0.000 claims description 3
- 229910001961 silver nitrate Inorganic materials 0.000 claims description 3
- 235000010344 sodium nitrate Nutrition 0.000 claims description 3
- 239000004317 sodium nitrate Substances 0.000 claims description 3
- BAZAXWOYCMUHIX-UHFFFAOYSA-M sodium perchlorate Chemical compound [Na+].[O-]Cl(=O)(=O)=O BAZAXWOYCMUHIX-UHFFFAOYSA-M 0.000 claims description 3
- 229910001488 sodium perchlorate Inorganic materials 0.000 claims description 3
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 claims description 3
- UHCGLDSRFKGERO-UHFFFAOYSA-N strontium peroxide Chemical compound [Sr+2].[O-][O-] UHCGLDSRFKGERO-UHFFFAOYSA-N 0.000 claims description 3
- PDEROVFZLWBVSG-UHFFFAOYSA-N strontium;diazide Chemical compound [Sr+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] PDEROVFZLWBVSG-UHFFFAOYSA-N 0.000 claims description 3
- MXRFIUHRIOLIIV-UHFFFAOYSA-L strontium;diperchlorate Chemical compound [Sr+2].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O MXRFIUHRIOLIIV-UHFFFAOYSA-L 0.000 claims description 3
- ZJRXSAYFZMGQFP-UHFFFAOYSA-N barium peroxide Chemical compound [Ba+2].[O-][O-] ZJRXSAYFZMGQFP-UHFFFAOYSA-N 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims 1
- DDSPUNTXKUFWTM-UHFFFAOYSA-N oxygen(2-);tin(4+) Chemical compound [O-2].[O-2].[Sn+4] DDSPUNTXKUFWTM-UHFFFAOYSA-N 0.000 claims 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 abstract description 3
- 239000003513 alkali Substances 0.000 abstract description 2
- 238000002485 combustion reaction Methods 0.000 description 12
- 239000000463 material Substances 0.000 description 10
- 231100000252 nontoxic Toxicity 0.000 description 5
- 230000003000 nontoxic effect Effects 0.000 description 5
- 239000003380 propellant Substances 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 239000012265 solid product Substances 0.000 description 5
- 239000011135 tin Substances 0.000 description 5
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 4
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 4
- 239000010936 titanium Substances 0.000 description 4
- 229910052719 titanium Inorganic materials 0.000 description 4
- 229910001873 dinitrogen Inorganic materials 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 230000035945 sensitivity Effects 0.000 description 3
- LIVNPJMFVYWSIS-UHFFFAOYSA-N silicon monoxide Chemical compound [Si-]#[O+] LIVNPJMFVYWSIS-UHFFFAOYSA-N 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 2
- 239000004411 aluminium Substances 0.000 description 2
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 238000005474 detonation Methods 0.000 description 2
- 230000002209 hydrophobic effect Effects 0.000 description 2
- 230000000977 initiatory effect Effects 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 230000009972 noncorrosive effect Effects 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 229910001388 sodium aluminate Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 229940090898 Desensitizer Drugs 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- 238000005422 blasting Methods 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000001473 noxious effect Effects 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 239000002341 toxic gas Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06D—MEANS FOR GENERATING SMOKE OR MIST; GAS-ATTACK COMPOSITIONS; GENERATION OF GAS FOR BLASTING OR PROPULSION (CHEMICAL PART)
- C06D5/00—Generation of pressure gas, e.g. for blasting cartridges, starting cartridges, rockets
- C06D5/06—Generation of pressure gas, e.g. for blasting cartridges, starting cartridges, rockets by reaction of two or more solids
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B23/00—Compositions characterised by non-explosive or non-thermic constituents
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B35/00—Compositions containing a metal azide
Definitions
- the compo- 149/75 149/77 sition is useful as a source of gas to inflate bags used Int. I as restraint Systems f the protection of automobile [58] Field of Search 149/6, 35, 37, 75, 40,
- This invention relates to a composition of matter suitable for generating gases.
- Pyrotechnic compositions containing an alkali metal azide, oxidizing compound and a fuel such as boron or silicon are disclosed in US. Pat. No. 3,122,462. When used as sources of gas, however, these pyrotechnic compositions, depending upon the proportions of the ingredients, may exhibit a high burning rate, approaching detonation.
- a gas generating composition suitable for inflating an automobile restraint system has now been found which avoids the disadvantages of prior art propellant and pyrotechnic compositions.
- the novel composition contains an alkali metal or alkaline earth metal azide, an oxidizing compound and an oxide of silicon, aluminium, titanium, tin or zinc with or without admixture with silicon, aluminum, titanium, tin or zinc metal, said oxide, and metal if present, being in amount sufficient to react with metallic oxides produced during the decomposition of the azide.
- the composition produces nitrogen gas at a rate suitable for inflation of an automobile restraint bag and the solid products of gas forming reaction are non-toxic and non-corrosive.
- the gas generating composition of this invention comprises l an azide of an alkali metal or an alkaline earth (2) an oxidizing compound in proportion sufficient to react completely with said azide with the liberation of nitrogen gas therefrom, and (3) an oxide selected from the group consisting of silicon oxide, aluminum oxide, titanium oxide, tin oxide and zinc oxide, with or without admixture with a metal selected from the group consisting of silicon, aluminum, titanium, tin
- compositions containing only oxide as ingredient (3) burn more slowly than compositions having only metal as ingredient (3).
- (3) is a mixture of silica and silicon
- variation of the proportions of these two components provides a range of burning rates extending from about 1 10 milliseconds with silica only to about 1 1 milliseconds with silicon only, depending on the size and configuration of the propellant mass.
- the ingredients of the gas generating composition may be mixed together in the form of solid particles and ignited by means of a hot wire or a squib.
- the composition may be employed in two separate portions, a first portion comprising the azide and the oxidizing compound, and a second portion comprising the metallic oxide. The second portion will then be placed as a sheath about the first portion, or be placed in the outlet zone of the vessel carrying the gas generating composition.
- the gas generating composition will be enclosed in a vessel that communicates with the inflatable bag of the restraint system.
- a baffle and/or filtering device will be positioned in the gas duct between the gas generating vessel and the inflatable bag for the purpose of restricting the flow of solid products into the bag.
- reaction of the gas generating composition can be represented by the equation:
- Suitable azide ingredients of the gas generating compositions of this invention are lithium azide, sodium azide, potassium azide, rubidium azide, cesium azide, calcium azide, magnesium azide, strontium azide and bar- .ium azide.
- Oxides suitable as ingredients of the gas generating compositions include silicon dioxide (silica) aluminum oxide, titanium dioxide, tin oxide, and zinc oxide.
- Metals suitable as ingredients of the compositions include silicon, aluminium, titanium, tin and zinc.
- the proportions of the azide and oxidizing compound are chosen so that the azide will be completely reacted to form gaseous nitrogen.
- Azides are toxic materials and it is undesirable to inject unreacted azide into the inflatable restraint bag.
- the proportion of oxide and when present the metal is chosen so that the metallic residue of the reaction between the azide and the oxidizing compound will react to form the non toxic solid compounds.
- the oxide is silica and the metal silicon, the compounds formed will be silicates. In the case of other oxides and metals there will be formed oxygen-containing compounds such as aluminates, titanates, etc.
- the ingredients of the gas generating composition are employed in particulate form. Although particle size is not apparently critical, it is convenient to employ material in the particle size less than 100 mesh Tyler screen size.
- EXAMPLE 1 Three 40 gram charges of a composition containing sodium azide, silicon dioxide and potassium perchlorate in the molar proportions 814:1 were placed in canisters and ignited in a field test using a No. 8 electric blasting cap to initiate ignition. The material burned in slightly less than 1 second.
- EXAMPLE 2 One gram charge of the above formulation was ignited by an S1 19 squib. Material required about 3 seconds for complete combustion.
- EXAMPLE 3 Three 40 gram charges of a composition containing sodium azide, silicon and potassium perchlorate in molar proportions 8:4:3 were placed in canisters and ignited in a field test using a No. 8 electric blasing cap to initiate ignition. The material burned extremely quickly at a rate only fractionally less than a detonation.
- EXAMPLE 5 Two 5 gram charges of the material in Example 3 were placed in canisters and ignited in a closed high pressure vessel. Ignition was achieved by means of a hot wire. A peak pressure of approximately 900 psi. was achieved in 22 milliseconds after the initiation of combustion.
- EXAMPLE 6 Two 20 gram charges of the material in Example 3 were placed in canisters and ignited in a closed high pressure vessel. Ignition was by means of a hot wire. A peak pressure of approximately 9,000 p.s.i. was achieved in l 1 milliseconds after initiation of combustion.
- EXAMPLE 7 Five 20 gram charges of material in Example 1 were placed in canisters and ignited in a closed pressure vessel by means of a hot wire. A peak pressure of 2,500 p.s.i. was achieved in a combustion time of milliseconds. Some ignition delay was observed using the hot wire method of ignition. The above figure of 110 milliseconds is actual burn time, and does not include the delay period.
- EXAMPLE 8 Three 20 gram charges of a composition containing sodium azide, aluminum and potassium chlorate in the molar proportions 2:2:1 were placed in canisters and ignited in a closed high pressure vessel. ignition was by means of a hot wire. The samples had an average combustion time of 14 milliseconds. The residue of combustion was extracted with water and the water extract analyzed for sodium and aluminum. The atomic ratio Al/Na is given in table 1. it can be seen that the conversion of aluminum into sodium aluminate NaA1O is on average 52 percent efficient, since complete conversion would provide a Al/Na ratio of 1.0.
- EXAMPLE 9 Three 20 gram charges of a composition containing sodium azide. alumina (A1 0 and potassium perchlorate in the molar proportions 8:4:l were placed in canisters and ignited in a closed high pressure vessel. Ignition was by means of a hot wire. The samples had an average combustion time of milliseconds. The residue was analyzed as in Example 8. The results are given in Table 1. It can be seen that the conversion into sodium aluminate is on average 48 percent efficient.
- Silanox 101 fumed silica having a silane coating
- Silanox 101 has a surface area of 225 sq. meters/gram and a pH of 2. precipitated silica coated with polysiloxane.
- fumed silica coated with a silane acts as a desensitizer.
- a gas generating composition as claimed in claim 1 wherein the azide is selected from the group consisting of lithium azide, sodium azide, potassium azide, rubidium azide, cesium azide, calcium azide, magnesium azide, strontium azide and barium azide.
- a gas generating composition as claimed in claim 1 wherein the oxidizing compound is an inorganic perchlorate selected from the group consisting of lithium perchlorate, sodium perchlorate, potassium perchlorate, rubidium perchlorate, magnesium perchlorate, calcium perchlorate, strontium perchlorate, barium perchlorate, ferric perchlorate and cobalt perchlorate.
- a gas generating composition as claimed in claim 1 including as ingredient fumed silica coated with a water repellent.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Combustion & Propulsion (AREA)
- Air Bags (AREA)
- Emergency Lowering Means (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Feeding, Discharge, Calcimining, Fusing, And Gas-Generation Devices (AREA)
- Investigating Or Analyzing Materials By The Use Of Fluid Adsorption Or Reactions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3448172A GB1391310A (en) | 1972-07-24 | 1972-07-24 | Gas generating compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3883373A true US3883373A (en) | 1975-05-13 |
Family
ID=10366188
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US375654A Expired - Lifetime US3883373A (en) | 1972-07-24 | 1973-07-02 | Gas generating compositions |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3883373A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS532156B2 (cg-RX-API-DMAC7.html) |
| BE (1) | BE802514A (cg-RX-API-DMAC7.html) |
| CA (1) | CA997933A (cg-RX-API-DMAC7.html) |
| FR (1) | FR2193801B1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1391310A (cg-RX-API-DMAC7.html) |
| IT (1) | IT995049B (cg-RX-API-DMAC7.html) |
| NL (1) | NL7310133A (cg-RX-API-DMAC7.html) |
| NO (1) | NO136091C (cg-RX-API-DMAC7.html) |
| SE (1) | SE409451B (cg-RX-API-DMAC7.html) |
Cited By (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3996079A (en) * | 1973-12-17 | 1976-12-07 | Canadian Industries, Ltd. | Metal oxide/azide gas generating compositions |
| US4094028A (en) * | 1976-04-01 | 1978-06-13 | Nippon Oil And Fats Co., Ltd. | Automatic inflating lifesaving buoy |
| US4214438A (en) * | 1978-02-03 | 1980-07-29 | Allied Chemical Corporation | Pyrotechnic composition and method of inflating an inflatable device |
| US4244758A (en) * | 1978-05-15 | 1981-01-13 | Allied Chemical Corporation | Ignition enhancer coating compositions for azide propellant |
| US4386979A (en) * | 1979-07-19 | 1983-06-07 | Jackson Jr Charles H | Gas generating compositions |
| DE3316529A1 (de) * | 1982-10-16 | 1984-11-08 | Erno Raumfahrttechnik Gmbh, 2800 Bremen | Stoffgemisch zur gaserzeugung |
| US4533416A (en) * | 1979-11-07 | 1985-08-06 | Rockcor, Inc. | Pelletizable propellant |
| US4547235A (en) * | 1984-06-14 | 1985-10-15 | Morton Thiokol, Inc. | Gas generant for air bag inflators |
| US4604151A (en) * | 1985-01-30 | 1986-08-05 | Talley Defense Systems, Inc. | Method and compositions for generating nitrogen gas |
| US4698107A (en) * | 1986-12-24 | 1987-10-06 | Trw Automotive Products, Inc. | Gas generating material |
| US4758287A (en) * | 1987-06-15 | 1988-07-19 | Talley Industries, Inc. | Porous propellant grain and method of making same |
| US4806180A (en) * | 1987-12-10 | 1989-02-21 | Trw Vehicle Safety Systems Inc. | Gas generating material |
| US4834818A (en) * | 1987-03-10 | 1989-05-30 | Nippon Koki Co., Ltd. | Gas-generating composition |
| DE3923179A1 (de) * | 1988-07-25 | 1990-02-01 | Hercules Inc | Treibmittelzusammensetzung fuer eine pralltasche und verfahren zum entwickeln von stickstoffgas |
| US4915756A (en) * | 1987-09-29 | 1990-04-10 | Aktiebolaget Bofors | Pyrotechnical delay charge |
| US5019220A (en) * | 1990-08-06 | 1991-05-28 | Morton International, Inc. | Process for making an enhanced thermal and ignition stability azide gas generant |
| US5034070A (en) * | 1990-06-28 | 1991-07-23 | Trw Vehicle Safety Systems Inc. | Gas generating material |
| US5143567A (en) * | 1991-08-23 | 1992-09-01 | Morton International, Inc. | Additive approach to ballistic and slag melting point control of azide-based gas generant compositions |
| US5178696A (en) * | 1990-09-03 | 1993-01-12 | Nippon Kayaku Kabushiki Kaisha | Gas generating composition for automobile air bag |
| US5223184A (en) * | 1990-08-06 | 1993-06-29 | Morton International, Inc. | Enhanced thermal and ignition stability azide gas generant |
| US5376352A (en) * | 1993-10-05 | 1994-12-27 | The Penn State Research Foundation | Oxygen storage and retrieval system |
| US5387296A (en) * | 1991-08-23 | 1995-02-07 | Morton International, Inc. | Additive approach to ballistic and slag melting point control of azide-based gas generant compositions |
| US5401340A (en) * | 1993-08-10 | 1995-03-28 | Thiokol Corporation | Borohydride fuels in gas generant compositions |
| US5429691A (en) * | 1993-08-10 | 1995-07-04 | Thiokol Corporation | Thermite compositions for use as gas generants comprising basic metal carbonates and/or basic metal nitrates |
| EP0584899A3 (en) * | 1992-08-05 | 1995-08-02 | Morton Int Inc | Approach by incorporating additives into azide-based gas-generating compositions to adjust the melting point of slag and the rate of combustion. |
| US5439537A (en) * | 1993-08-10 | 1995-08-08 | Thiokol Corporation | Thermite compositions for use as gas generants |
| US5472647A (en) * | 1993-08-02 | 1995-12-05 | Thiokol Corporation | Method for preparing anhydrous tetrazole gas generant compositions |
| US5500059A (en) * | 1993-08-02 | 1996-03-19 | Thiokol Corporation | Anhydrous 5-aminotetrazole gas generant compositions and methods of preparation |
| US5507890A (en) * | 1992-06-05 | 1996-04-16 | Trw Inc. | Multiple layered gas generating disk for use in gas generators |
| US5557062A (en) * | 1994-12-13 | 1996-09-17 | United Technologies Corporation | Breathable gas generators |
| WO1996029564A3 (en) * | 1995-03-14 | 1996-11-14 | Thiokol Corp | Infrared tracer compositions |
| US5592812A (en) * | 1994-01-19 | 1997-01-14 | Thiokol Corporation | Metal complexes for use as gas generants |
| US5725699A (en) * | 1994-01-19 | 1998-03-10 | Thiokol Corporation | Metal complexes for use as gas generants |
| US5780768A (en) * | 1995-03-10 | 1998-07-14 | Talley Defense Systems, Inc. | Gas generating compositions |
| US6235132B1 (en) | 1995-03-10 | 2001-05-22 | Talley Defense Systems, Inc. | Gas generating compositions |
| US20010020504A1 (en) * | 1995-03-10 | 2001-09-13 | Knowlton Gregory D. | Gas generating compositions |
| US6749702B1 (en) * | 1996-05-14 | 2004-06-15 | Talley Defense Systems, Inc. | Low temperature autoignition composition |
| US20050067074A1 (en) * | 1994-01-19 | 2005-03-31 | Hinshaw Jerald C. | Metal complexes for use as gas generants |
| US6878221B1 (en) * | 2003-01-30 | 2005-04-12 | Olin Corporation | Lead-free nontoxic explosive mix |
| US6969435B1 (en) | 1994-01-19 | 2005-11-29 | Alliant Techsystems Inc. | Metal complexes for use as gas generants |
| US20220371970A1 (en) * | 2021-05-21 | 2022-11-24 | Lawrence Livermore National Security, Llc | Dial-a-drive explosive formulations |
| WO2024206755A3 (en) * | 2023-03-31 | 2024-10-31 | Joyson Safety Systems Acquisition Llc | Gas generating compositions |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5040487A (cg-RX-API-DMAC7.html) * | 1973-08-14 | 1975-04-14 | ||
| FR2288721A1 (fr) * | 1974-10-25 | 1976-05-21 | Thiokol Corp | Composition pouvant engendrer des gaz non toxiques, non corrosifs et inodores, et son obtention |
| GB1520497A (en) * | 1975-04-23 | 1978-08-09 | Daicel Ltd | Gas-generating agent for air bag |
| GB2174179B (en) * | 1985-04-16 | 1989-07-05 | Graviner Ltd | Cooling apparatus and a method of cooling |
| US5035757A (en) * | 1990-10-25 | 1991-07-30 | Automotive Systems Laboratory, Inc. | Azide-free gas generant composition with easily filterable combustion products |
| EP0579781A4 (en) * | 1991-04-11 | 1994-12-07 | Talley Defence Systems Inc | AZIDAL PROPELLER COMPOSITIONS FOR EMERGENCY DEBALLASTING OF SUBMERSIBLE VESSELS. |
| US5104466A (en) * | 1991-04-16 | 1992-04-14 | Morton International, Inc. | Nitrogen gas generator |
| DE749946T1 (de) * | 1995-06-22 | 1997-09-04 | Nippon Koki Kk | Gaserzeugende Zusammensetzung |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2981616A (en) * | 1956-10-01 | 1961-04-25 | North American Aviation Inc | Gas generator grain |
| US3122462A (en) * | 1961-11-24 | 1964-02-25 | Martin H Kaufman | Novel pyrotechnics |
| US3785674A (en) * | 1971-06-14 | 1974-01-15 | Rocket Research Corp | Crash restraint nitrogen generating inflation system |
| US3797854A (en) * | 1971-06-14 | 1974-03-19 | Rocket Research Corp | Crash restraint air generating inflation system |
-
1972
- 1972-07-24 GB GB3448172A patent/GB1391310A/en not_active Expired
-
1973
- 1973-06-28 CA CA175,211A patent/CA997933A/en not_active Expired
- 1973-07-02 US US375654A patent/US3883373A/en not_active Expired - Lifetime
- 1973-07-17 NO NO2911/73A patent/NO136091C/no unknown
- 1973-07-18 BE BE133624A patent/BE802514A/xx unknown
- 1973-07-20 NL NL7310133A patent/NL7310133A/xx not_active Application Discontinuation
- 1973-07-23 FR FR7326881A patent/FR2193801B1/fr not_active Expired
- 1973-07-23 IT IT26931/73A patent/IT995049B/it active
- 1973-07-23 SE SE7310254A patent/SE409451B/xx unknown
- 1973-07-24 JP JP8281173A patent/JPS532156B2/ja not_active Expired
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2981616A (en) * | 1956-10-01 | 1961-04-25 | North American Aviation Inc | Gas generator grain |
| US3122462A (en) * | 1961-11-24 | 1964-02-25 | Martin H Kaufman | Novel pyrotechnics |
| US3785674A (en) * | 1971-06-14 | 1974-01-15 | Rocket Research Corp | Crash restraint nitrogen generating inflation system |
| US3797854A (en) * | 1971-06-14 | 1974-03-19 | Rocket Research Corp | Crash restraint air generating inflation system |
Cited By (58)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3996079A (en) * | 1973-12-17 | 1976-12-07 | Canadian Industries, Ltd. | Metal oxide/azide gas generating compositions |
| US4094028A (en) * | 1976-04-01 | 1978-06-13 | Nippon Oil And Fats Co., Ltd. | Automatic inflating lifesaving buoy |
| US4214438A (en) * | 1978-02-03 | 1980-07-29 | Allied Chemical Corporation | Pyrotechnic composition and method of inflating an inflatable device |
| US4244758A (en) * | 1978-05-15 | 1981-01-13 | Allied Chemical Corporation | Ignition enhancer coating compositions for azide propellant |
| US4386979A (en) * | 1979-07-19 | 1983-06-07 | Jackson Jr Charles H | Gas generating compositions |
| US4533416A (en) * | 1979-11-07 | 1985-08-06 | Rockcor, Inc. | Pelletizable propellant |
| DE3316529A1 (de) * | 1982-10-16 | 1984-11-08 | Erno Raumfahrttechnik Gmbh, 2800 Bremen | Stoffgemisch zur gaserzeugung |
| US4547235A (en) * | 1984-06-14 | 1985-10-15 | Morton Thiokol, Inc. | Gas generant for air bag inflators |
| US4604151A (en) * | 1985-01-30 | 1986-08-05 | Talley Defense Systems, Inc. | Method and compositions for generating nitrogen gas |
| DE3602731A1 (de) * | 1985-01-30 | 1986-10-30 | Talley Defense Systems, Inc., Mesa, Ariz. | Zusammensetzung und verfahren zur erzeugung von stickstoffgas |
| US4698107A (en) * | 1986-12-24 | 1987-10-06 | Trw Automotive Products, Inc. | Gas generating material |
| US4834818A (en) * | 1987-03-10 | 1989-05-30 | Nippon Koki Co., Ltd. | Gas-generating composition |
| US4758287A (en) * | 1987-06-15 | 1988-07-19 | Talley Industries, Inc. | Porous propellant grain and method of making same |
| US4915756A (en) * | 1987-09-29 | 1990-04-10 | Aktiebolaget Bofors | Pyrotechnical delay charge |
| US4806180A (en) * | 1987-12-10 | 1989-02-21 | Trw Vehicle Safety Systems Inc. | Gas generating material |
| DE3923179A1 (de) * | 1988-07-25 | 1990-02-01 | Hercules Inc | Treibmittelzusammensetzung fuer eine pralltasche und verfahren zum entwickeln von stickstoffgas |
| US4920743A (en) * | 1988-07-25 | 1990-05-01 | Hercules Incorporated | Crash bag propellant composition and method for generating nitrogen gas |
| DE3923179C2 (de) * | 1988-07-25 | 1998-08-13 | Hercules Inc | Gasbildende Treibmittelzusammensetzung und deren Verwendung in aufblasbaren Fahrzeug-Pralltaschen |
| US5034070A (en) * | 1990-06-28 | 1991-07-23 | Trw Vehicle Safety Systems Inc. | Gas generating material |
| US5019220A (en) * | 1990-08-06 | 1991-05-28 | Morton International, Inc. | Process for making an enhanced thermal and ignition stability azide gas generant |
| US5223184A (en) * | 1990-08-06 | 1993-06-29 | Morton International, Inc. | Enhanced thermal and ignition stability azide gas generant |
| US5437229A (en) * | 1990-08-06 | 1995-08-01 | Morton International, Inc. | Enhanced thermal and ignition stability azide gas generant intermediates |
| US5178696A (en) * | 1990-09-03 | 1993-01-12 | Nippon Kayaku Kabushiki Kaisha | Gas generating composition for automobile air bag |
| US5143567A (en) * | 1991-08-23 | 1992-09-01 | Morton International, Inc. | Additive approach to ballistic and slag melting point control of azide-based gas generant compositions |
| US5387296A (en) * | 1991-08-23 | 1995-02-07 | Morton International, Inc. | Additive approach to ballistic and slag melting point control of azide-based gas generant compositions |
| US5507890A (en) * | 1992-06-05 | 1996-04-16 | Trw Inc. | Multiple layered gas generating disk for use in gas generators |
| EP0584899A3 (en) * | 1992-08-05 | 1995-08-02 | Morton Int Inc | Approach by incorporating additives into azide-based gas-generating compositions to adjust the melting point of slag and the rate of combustion. |
| US5472647A (en) * | 1993-08-02 | 1995-12-05 | Thiokol Corporation | Method for preparing anhydrous tetrazole gas generant compositions |
| US5500059A (en) * | 1993-08-02 | 1996-03-19 | Thiokol Corporation | Anhydrous 5-aminotetrazole gas generant compositions and methods of preparation |
| US5501823A (en) * | 1993-08-02 | 1996-03-26 | Thiokol Corporation | Preparation of anhydrous tetrazole gas generant compositions |
| US5682014A (en) * | 1993-08-02 | 1997-10-28 | Thiokol Corporation | Bitetrazoleamine gas generant compositions |
| US5439537A (en) * | 1993-08-10 | 1995-08-08 | Thiokol Corporation | Thermite compositions for use as gas generants |
| US5429691A (en) * | 1993-08-10 | 1995-07-04 | Thiokol Corporation | Thermite compositions for use as gas generants comprising basic metal carbonates and/or basic metal nitrates |
| US5401340A (en) * | 1993-08-10 | 1995-03-28 | Thiokol Corporation | Borohydride fuels in gas generant compositions |
| US5376352A (en) * | 1993-10-05 | 1994-12-27 | The Penn State Research Foundation | Oxygen storage and retrieval system |
| US5592812A (en) * | 1994-01-19 | 1997-01-14 | Thiokol Corporation | Metal complexes for use as gas generants |
| US6481746B1 (en) * | 1994-01-19 | 2002-11-19 | Alliant Techsystems Inc. | Metal hydrazine complexes for use as gas generants |
| US5673935A (en) * | 1994-01-19 | 1997-10-07 | Thiokol Corporation | Metal complexes for use as gas generants |
| US9199886B2 (en) | 1994-01-19 | 2015-12-01 | Orbital Atk, Inc. | Metal complexes for use as gas generants |
| US5725699A (en) * | 1994-01-19 | 1998-03-10 | Thiokol Corporation | Metal complexes for use as gas generants |
| US5735118A (en) * | 1994-01-19 | 1998-04-07 | Thiokol Corporation | Using metal complex compositions as gas generants |
| US20100084060A1 (en) * | 1994-01-19 | 2010-04-08 | Alliant Techsystems Inc. | Metal complexes for use as gas generants |
| US5970703A (en) * | 1994-01-19 | 1999-10-26 | Cordant Technologies Inc. | Metal hydrazine complexes used as gas generants |
| US6969435B1 (en) | 1994-01-19 | 2005-11-29 | Alliant Techsystems Inc. | Metal complexes for use as gas generants |
| US20050067074A1 (en) * | 1994-01-19 | 2005-03-31 | Hinshaw Jerald C. | Metal complexes for use as gas generants |
| US5557062A (en) * | 1994-12-13 | 1996-09-17 | United Technologies Corporation | Breathable gas generators |
| US5780768A (en) * | 1995-03-10 | 1998-07-14 | Talley Defense Systems, Inc. | Gas generating compositions |
| US6860951B2 (en) | 1995-03-10 | 2005-03-01 | Talley Defense Systems, Inc. | Gas generating compositions |
| US20010020504A1 (en) * | 1995-03-10 | 2001-09-13 | Knowlton Gregory D. | Gas generating compositions |
| US6235132B1 (en) | 1995-03-10 | 2001-05-22 | Talley Defense Systems, Inc. | Gas generating compositions |
| US5639984A (en) * | 1995-03-14 | 1997-06-17 | Thiokol Corporation | Infrared tracer compositions |
| WO1996029564A3 (en) * | 1995-03-14 | 1996-11-14 | Thiokol Corp | Infrared tracer compositions |
| US6749702B1 (en) * | 1996-05-14 | 2004-06-15 | Talley Defense Systems, Inc. | Low temperature autoignition composition |
| US6878221B1 (en) * | 2003-01-30 | 2005-04-12 | Olin Corporation | Lead-free nontoxic explosive mix |
| US20050081969A1 (en) * | 2003-01-30 | 2005-04-21 | Olin Corporation | Lead-free nontoxic explosive mix |
| US20100032063A1 (en) * | 2003-01-30 | 2010-02-11 | Mei George C | Lead-free nontoxic explosive mix |
| US20220371970A1 (en) * | 2021-05-21 | 2022-11-24 | Lawrence Livermore National Security, Llc | Dial-a-drive explosive formulations |
| WO2024206755A3 (en) * | 2023-03-31 | 2024-10-31 | Joyson Safety Systems Acquisition Llc | Gas generating compositions |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7310133A (cg-RX-API-DMAC7.html) | 1974-01-28 |
| FR2193801A1 (cg-RX-API-DMAC7.html) | 1974-02-22 |
| DE2336853A1 (de) | 1974-02-21 |
| BE802514A (fr) | 1974-01-18 |
| IT995049B (it) | 1975-11-10 |
| JPS532156B2 (cg-RX-API-DMAC7.html) | 1978-01-25 |
| JPS49131977A (cg-RX-API-DMAC7.html) | 1974-12-18 |
| FR2193801B1 (cg-RX-API-DMAC7.html) | 1977-05-13 |
| GB1391310A (en) | 1975-04-23 |
| SE409451B (sv) | 1979-08-20 |
| NO136091C (no) | 1977-07-20 |
| DE2336853B2 (de) | 1976-08-12 |
| CA997933A (en) | 1976-10-05 |
| NO136091B (cg-RX-API-DMAC7.html) | 1977-04-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3883373A (en) | Gas generating compositions | |
| CA2012607C (en) | Azide gas generating composition for inflatable devices | |
| US4604151A (en) | Method and compositions for generating nitrogen gas | |
| JP4109317B2 (ja) | ガス発生剤として用いる金属錯体 | |
| US5089069A (en) | Gas generating composition for air bags | |
| US3895098A (en) | Method and composition for generating nitrogen gas | |
| US5538567A (en) | Gas generating propellant | |
| CA1146756A (en) | Multi-ingredient gas generants | |
| US4909549A (en) | Composition and process for inflating a safety crash bag | |
| US4948439A (en) | Composition and process for inflating a safety crash bag | |
| EP2444383A1 (en) | Gas generant composition | |
| US20080217894A1 (en) | Micro-gas generation | |
| USRE32584E (en) | Method and composition for generating nitrogen gas | |
| US6764562B1 (en) | Composite gas-generating material for gas-actuated car safety devices | |
| WO1995018780A1 (en) | Non-azide gas generant compositions containing dicyanamide salts | |
| JP3132169B2 (ja) | ガス発生剤 | |
| ITTO950025A1 (it) | Composizione generatrice di gas "airbag" per autoveicoli. | |
| DE2336853C3 (de) | Gaserzeugende Masse und deren Verwendung | |
| CN1044107C (zh) | 汽车安全气囊用氮气发生剂 | |
| JPH0354183A (ja) | ガス発生器用組成物 | |
| JPH0680492A (ja) | ガス発生剤組成物 |