US3719604A - Pressurizing-gas-producing charges containing an aminoguanidine tetrazole and an oxygen-liberating or gas-evolving additive - Google Patents
Pressurizing-gas-producing charges containing an aminoguanidine tetrazole and an oxygen-liberating or gas-evolving additive Download PDFInfo
- Publication number
- US3719604A US3719604A US00110601A US3719604DA US3719604A US 3719604 A US3719604 A US 3719604A US 00110601 A US00110601 A US 00110601A US 3719604D A US3719604D A US 3719604DA US 3719604 A US3719604 A US 3719604A
- Authority
- US
- United States
- Prior art keywords
- gas
- liberating
- composition
- oxygen
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000654 additive Substances 0.000 title claims description 13
- 230000000996 additive effect Effects 0.000 title claims description 11
- LRGWCTBZFVAJSG-UHFFFAOYSA-N 2-aminoguanidine 2H-tetrazole Chemical compound N1N=NN=C1.NNC(=N)N LRGWCTBZFVAJSG-UHFFFAOYSA-N 0.000 title description 3
- 239000000203 mixture Substances 0.000 claims abstract description 53
- HAMNKKUPIHEESI-UHFFFAOYSA-N aminoguanidine Chemical class NNC(N)=N HAMNKKUPIHEESI-UHFFFAOYSA-N 0.000 claims abstract description 12
- 239000000126 substance Substances 0.000 claims abstract description 10
- JGZAFSFVZSXXCJ-ONEGZZNKSA-N (E)-bis(2H-tetrazol-5-yl)diazene Chemical class N(=N\C1=NN=NN1)/C1=NN=NN1 JGZAFSFVZSXXCJ-ONEGZZNKSA-N 0.000 claims abstract description 7
- 229910052751 metal Inorganic materials 0.000 claims description 8
- 239000002184 metal Substances 0.000 claims description 8
- NDEMNVPZDAFUKN-UHFFFAOYSA-N guanidine;nitric acid Chemical compound NC(N)=N.O[N+]([O-])=O.O[N+]([O-])=O NDEMNVPZDAFUKN-UHFFFAOYSA-N 0.000 claims description 7
- 239000000020 Nitrocellulose Substances 0.000 claims description 6
- 229920001220 nitrocellulos Polymers 0.000 claims description 6
- IDCPFAYURAQKDZ-UHFFFAOYSA-N 1-nitroguanidine Chemical compound NC(=N)N[N+]([O-])=O IDCPFAYURAQKDZ-UHFFFAOYSA-N 0.000 claims description 5
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical class [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims description 5
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 5
- 239000003054 catalyst Substances 0.000 claims description 5
- 229910052750 molybdenum Inorganic materials 0.000 claims description 5
- 239000011733 molybdenum Substances 0.000 claims description 5
- 150000002823 nitrates Chemical class 0.000 claims description 5
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 5
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 5
- 229910052721 tungsten Inorganic materials 0.000 claims description 5
- 239000010937 tungsten Substances 0.000 claims description 5
- 229910052720 vanadium Inorganic materials 0.000 claims description 5
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052804 chromium Inorganic materials 0.000 claims description 4
- 239000011651 chromium Substances 0.000 claims description 4
- 229910017052 cobalt Inorganic materials 0.000 claims description 4
- 239000010941 cobalt Substances 0.000 claims description 4
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 4
- 238000000354 decomposition reaction Methods 0.000 claims description 4
- 150000002736 metal compounds Chemical class 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 239000002360 explosive Substances 0.000 claims description 3
- 230000002269 spontaneous effect Effects 0.000 claims description 3
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims 2
- IWOUKMZUPDVPGQ-UHFFFAOYSA-N barium nitrate Chemical compound [Ba+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O IWOUKMZUPDVPGQ-UHFFFAOYSA-N 0.000 description 10
- 239000007789 gas Substances 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- VBIXEXWLHSRNKB-UHFFFAOYSA-N ammonium oxalate Chemical compound [NH4+].[NH4+].[O-]C(=O)C([O-])=O VBIXEXWLHSRNKB-UHFFFAOYSA-N 0.000 description 4
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 4
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 230000035939 shock Effects 0.000 description 3
- 235000002906 tartaric acid Nutrition 0.000 description 3
- 239000011975 tartaric acid Substances 0.000 description 3
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- ZSWFCLXCOIISFI-UHFFFAOYSA-N cyclopentadiene Chemical compound C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 2
- 238000005474 detonation Methods 0.000 description 2
- GNTDGMZSJNCJKK-UHFFFAOYSA-N divanadium pentaoxide Chemical compound O=[V](=O)O[V](=O)=O GNTDGMZSJNCJKK-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 235000010333 potassium nitrate Nutrition 0.000 description 2
- 239000004323 potassium nitrate Substances 0.000 description 2
- VKGQPUZNCZPZKI-UHFFFAOYSA-N (diaminomethylideneamino)azanium;sulfate Chemical compound NN=C(N)N.NN=C(N)N.OS(O)(=O)=O VKGQPUZNCZPZKI-UHFFFAOYSA-N 0.000 description 1
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Substances C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 229910001069 Ti alloy Inorganic materials 0.000 description 1
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- UQZIWOQVLUASCR-UHFFFAOYSA-N alumane;titanium Chemical compound [AlH3].[Ti] UQZIWOQVLUASCR-UHFFFAOYSA-N 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 238000003889 chemical engineering Methods 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- -1 salt compounds Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B43/00—Compositions characterised by explosive or thermic constituents not provided for in groups C06B25/00 - C06B41/00
Definitions
- These materials may also consist of mixtures of oxygenliberating substances, such as potassium chlorate, and gas-evolving substances such as ammonium nitrate or guanidine nitrate. (See, for example, German patents 854,770, 851,919, and 909,424.)
- one aspect of this invention resides in novel pressurizinggas-producing charges, particularly for use in pressurizing-gas-actuated devices, which are characterized by the fact that they comprise from 40 to 100 weight percent aminoguanidine salts of azotetrazole and/or ditetrazole.
- Other components of the composition may include oxygen-liberating and/or other gas-evolving substances which do not cause detonation. These may be used singly or in combination in proportion of 0 to 60 weight percent.
- Azotetrazole has the formula and ditetrazole has the formula N N 111 1 I l
- the hydrogen atoms of these compounds have an acid reaction and consequently form, with aminoguanidine, the corresponding salts.
- These salts are prepared, for example, by mixing aqueous solutions of salts of aminoguanidine, such as aminoguanidine sulfate, with aqueous solutions of alkali salts of said tetrazoles.
- the insoluble salt compounds suitable for use in accordance with the present invention precipitate from this reaction mixture and can be recovered by conventional chemical engineering techniques.
- Suitable oxygen-liberating optional additives are chlorates, perchlorates and nitrates of inorganic bases which are all preferred. Nitroguanidine, guanidine nitrate, nitrocellulose, nitropolystyrene, polynitrophenols, polynitrocresols or the like can also be incorporated as oxygen liberators.
- Soleiy gas-evolving optional additives which are suitable are, for example, ammonium oxalate, urea, aminoguanidine, sugar, tartaric acid or the like.
- Catalysts promoting decomposition such as compounds of vanadium, tungsten, molybdenum, chromium, cobalt or the like, particularly in the highest degree of oxidation of the metal, may advantageously be added to the compositions of this invention in a proportion of from 0.5 to 5 weight percent, referred to the total mixture.
- compositions of this invention are prepared by simple mixing of the ingredients.
- the resultant solid composition may be pressed, but this is not absolutely necessary.
- EXAMPLE 1 A mixture of 500 g of azotetrazole-aminoguanidine salt and 500 g of barium nitrate was pressed into bodies which were then ignited in a pressure pipe with nozzle. A strong gas jet was thus produced. The mixture furnished 350 cc gas/g of mixture. It was not ignited by the shock of a falling weight of 2 kg dropped from a height of 2 meters.
- EXAMPLE 2 An intimate mixture of 700 g of ditetrazoleaminoguanidine salt and 300 g of potassium nitrate was pressed into bodies which were ignited in a pressure pipe with nozzle by the use of an electric primer pellet. The quantity of gas evolved was 400 cc/g. The mixture was not ignited by the shock of a falling weight of 2 kg dropped from a height of 2 meters.
- a pressure composition was prepared from 50 g of barium nitrate (Ba(NO 50 g of azotetrazoleaminoguanidine salt, 4 g of vanadium pentoxide V 0 and 15 g of an aluminum-titanium alloy. After ignition of the composition by means of an ignition mixture disposed in a central ignition tube, a reaction of the composition set in with evolution of heat. The heat generated was 768 cal/g.
- barium nitrate Ba(NO 50 g of azotetrazoleaminoguanidine salt, 4 g of vanadium pentoxide V 0 and 15 g of an aluminum-titanium alloy.
- EXAMPLE 4 A pressure composition was prepared from 40 g of barium nitrate (Ba(NO and 60 g of azotetrazoleaminoguanidine salt. After ignition of the composition by means of the ignition mixture disposed in a central ignition tube, a reaction of the composition set in with evolution of heat. The heat generated was 613 cal/g, Volumer, of evolved gas: 440 em /g.
- EXAMPLE 5 A pressure composition was prepared from 45 g of barium nitrate (Ba(NO 45 g of azotetrazoleaminoguanidine salt and g of amorphous boron. After ignition of the composition by means of the ignition mixture disposed in a central ignition tube, a reaction of the composition set in with evolution of heat. The heat generated was 826 cal/g, amount of evolved gas: 520 em /g.
- EXAMPLE 6 A pressure composition was prepared from 30 g of barium nitrate (Ba(NO 50 g of azotetrazoleaminoguanidine salt and g of potassium nitrate (K- NO After ignition of the composition by means of the ignition mixture disposed in a central ignition tube, a reaction of the composition set in with evolution of heat. The heat generated was 687 cal/g.
- a gas-producing composition comprising an aminoguanidine salt of at least one member selected from the group consisting of azotetrazole of the formula:
- II-N N and an oxygen-liberating additive or a gas-evolving additive selected from the group consisting of ammonium oxalate, urea, aminoguanidine, sugar and tartaric acid present in an amount up to 60 weight percent of the composition.
- an oxygen-liberating additive or a gas-evolving additive selected from the group consisting of ammonium oxalate, urea, aminoguanidine, sugar and tartaric acid present in an amount up to 60 weight percent of the composition.
- oxygen-liberating additive is a member selected from 5 the group consisting of inorganic chlorates, perchlorates and nitrates; nitroguanidine; guanidine nitrate; nitrocellulose; nitropolystyrene;
- an oxygen-liberating additive or a gas-evolving additive selected from the group consisting of ammonium oxalate, urea, aminoguanidine, sugar, and tartaric acid present in an amount up to 60 weight percent of the composition.
- oxygen-liberating additive is a member selected from the group consisting of inorganic chlorates, perchlorates and nitrates nitroguanidine; guanidine nitrate; nitropolystyrene; nitrocellulose; polynitrophenols; and polynitrocresols.
- oxygen-liberating or gas-evolving substance additionally contains about 0.5 to 5 weight percent, referred to the entire composition, of a metal compound catalyst wherein said metal is a member selected from the group consisting of vanadium, tungsten, molybdenum, chromium and cobalt.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Air Bags (AREA)
- Feeding, Discharge, Calcimining, Fusing, And Gas-Generation Devices (AREA)
- Catalysts (AREA)
- Treating Waste Gases (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2004620A DE2004620C3 (de) | 1970-02-03 | 1970-02-03 | Druckgaserzeugende Ladungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3719604A true US3719604A (en) | 1973-03-06 |
Family
ID=5761179
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US00110601A Expired - Lifetime US3719604A (en) | 1970-02-03 | 1971-01-28 | Pressurizing-gas-producing charges containing an aminoguanidine tetrazole and an oxygen-liberating or gas-evolving additive |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3719604A (en:Method) |
| CA (1) | CA981024A (en:Method) |
| DE (1) | DE2004620C3 (en:Method) |
| FR (1) | FR2078084A5 (en:Method) |
| GB (1) | GB1313619A (en:Method) |
Cited By (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USB235011I5 (en:Method) * | 1971-03-16 | 1975-01-28 | ||
| EP0055547A1 (en) * | 1980-12-31 | 1982-07-07 | Morton Thiokol, Inc. | Solid compositions for generating nitrogen, the generation of nitrogen therefrom and inflation of gas bags therewith |
| US4601344A (en) * | 1983-09-29 | 1986-07-22 | The United States Of America As Represented By The Secretary Of The Navy | Pyrotechnic fire extinguishing method |
| US5015309A (en) * | 1989-05-04 | 1991-05-14 | Morton International, Inc. | Gas generant compositions containing salts of 5-nitrobarbituric acid, salts of nitroorotic acid, or 5-nitrouracil |
| US5053086A (en) * | 1985-03-15 | 1991-10-01 | The United States Of America As Represented By The Secretary Of The Navy | Gas generant compositions containing energetic high nitrogen binders |
| US5160386A (en) * | 1991-11-04 | 1992-11-03 | Morton International, Inc. | Gas generant formulations containing poly(nitrito) metal complexes as oxidants and method |
| US5197758A (en) * | 1991-10-09 | 1993-03-30 | Morton International, Inc. | Non-azide gas generant formulation, method, and apparatus |
| US5198046A (en) * | 1991-03-14 | 1993-03-30 | Fraunhofer-Gesellschaft Zur Forderung Der Angewandten Forschund E.V. | Stable, nitrogen-rich composition |
| WO1995004014A1 (en) * | 1993-08-02 | 1995-02-09 | Thiokol Corporation | Method for preparing anhydrous tetrazole gas generant compositions |
| WO1995004015A1 (en) * | 1993-08-02 | 1995-02-09 | Thiokol Corporation | Bitetrazoleamine gas generant compositions and methods of use |
| WO1995004016A1 (en) * | 1993-08-02 | 1995-02-09 | Thiokol Corporation | Anhydrous tetrazole gas generant compositions and methods of preparation |
| WO1995004710A1 (en) * | 1993-08-04 | 1995-02-16 | Automotive Systems Laboratory, Inc. | Law residue azide-free gas generant composition |
| US5425886A (en) * | 1993-06-23 | 1995-06-20 | The United States Of America As Represented By The Secretary Of The Navy | On demand, non-halon, fire extinguishing systems |
| US5428165A (en) * | 1994-01-06 | 1995-06-27 | Thiokol Corporation | Process for making 5-introbarbituric acid and salts thereof |
| US5439251A (en) * | 1992-11-30 | 1995-08-08 | Toyo Kasei Kogyo Company Limited | Method of tetrazole amine salts having improved physical properties for generating gas in airbags |
| WO1995019341A3 (en) * | 1994-01-06 | 1995-08-31 | Thiokol Corp | Process for making 5-nitrobarbituric acid and salts thereof |
| US5451682A (en) * | 1994-01-10 | 1995-09-19 | Thiokol Corporation | Method for synthesizing 5-aminotetrazole |
| US5468866A (en) * | 1994-01-04 | 1995-11-21 | Thiokol Corporation | Methods for synthesizing and processing bis-(1(2)H-tetrazol-5-yl)-amine |
| US5514230A (en) * | 1995-04-14 | 1996-05-07 | Automotive Systems Laboratory, Inc. | Nonazide gas generating compositions with a built-in catalyst |
| US5516377A (en) * | 1994-01-10 | 1996-05-14 | Thiokol Corporation | Gas generating compositions based on salts of 5-nitraminotetrazole |
| US5538567A (en) * | 1994-03-18 | 1996-07-23 | Olin Corporation | Gas generating propellant |
| US5641938A (en) * | 1995-03-03 | 1997-06-24 | Primex Technologies, Inc. | Thermally stable gas generating composition |
| US5661261A (en) * | 1996-02-23 | 1997-08-26 | Breed Automotive Technology, Inc. | Gas generating composition |
| US5783773A (en) * | 1992-04-13 | 1998-07-21 | Automotive Systems Laboratory Inc. | Low-residue azide-free gas generant composition |
| US5844164A (en) * | 1996-02-23 | 1998-12-01 | Breed Automotive Technologies, Inc. | Gas generating device with specific composition |
| US5866842A (en) * | 1996-07-18 | 1999-02-02 | Primex Technologies, Inc. | Low temperature autoigniting propellant composition |
| US5872329A (en) * | 1996-11-08 | 1999-02-16 | Automotive Systems Laboratory, Inc. | Nonazide gas generant compositions |
| WO1999046222A3 (en) * | 1998-03-12 | 2000-08-03 | Automotive Systems Lab | High gas yield non-azide gas generants |
| US6306232B1 (en) | 1996-07-29 | 2001-10-23 | Automotive Systems Laboratory, Inc. | Thermally stable nonazide automotive airbag propellants |
| US6645325B1 (en) * | 1998-06-01 | 2003-11-11 | Russell R. Nickel | Fast-burning nitrocellulose compositions |
| US6764562B1 (en) | 1999-05-12 | 2004-07-20 | Bofors Bepab Ab | Composite gas-generating material for gas-actuated car safety devices |
| US20040154711A1 (en) * | 1998-12-30 | 2004-08-12 | Per Sjoberg | Gas-generating material for gas-actuated car safety devices |
| US20050257866A1 (en) * | 2004-03-29 | 2005-11-24 | Williams Graylon K | Gas generant and manufacturing method thereof |
| WO2006128910A1 (de) * | 2005-06-02 | 2006-12-07 | Ruag Ammotec Gmbh | Pyrotechnisches mittel |
| US20080110536A1 (en) * | 2006-05-05 | 2008-05-15 | Ganta Sudhakar R | Gas generant compositions |
| US20080154044A1 (en) * | 2006-05-05 | 2008-06-26 | Ganta Sudhakar R | Gas generant compositions |
| US20090008002A1 (en) * | 2006-09-30 | 2009-01-08 | Ganta Sudhakar R | Gas generant compositions |
| US9045380B1 (en) | 2007-10-31 | 2015-06-02 | Tk Holdings Inc. | Gas generating compositions |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4034645A1 (de) * | 1990-10-31 | 1992-05-07 | Fraunhofer Ges Forschung | Stabile, stickstoffreiche verbindung |
| DE19505568A1 (de) * | 1995-02-18 | 1996-08-22 | Dynamit Nobel Ag | Gaserzeugende Mischungen |
| SE513315C2 (sv) * | 1998-12-30 | 2000-08-21 | Nexplo Bofors Ab | Sätt att framställa gasbildare för gasdrivna bilsäkerhetsdetaljer och pyrotekiska gasbildare framställd i enlighet med sättet |
-
1970
- 1970-02-03 DE DE2004620A patent/DE2004620C3/de not_active Expired
-
1971
- 1971-01-28 US US00110601A patent/US3719604A/en not_active Expired - Lifetime
- 1971-02-02 CA CA104,338A patent/CA981024A/en not_active Expired
- 1971-02-02 FR FR7103450A patent/FR2078084A5/fr not_active Expired
- 1971-04-19 GB GB2062871A patent/GB1313619A/en not_active Expired
Cited By (60)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USB235011I5 (en:Method) * | 1971-03-16 | 1975-01-28 | ||
| US3925086A (en) * | 1971-03-16 | 1975-12-09 | Minnesota Mining & Mfg | Azotriazole and azotetrazole antifog, antistain and selective desensitizers for silver halide emulsions |
| EP0055547A1 (en) * | 1980-12-31 | 1982-07-07 | Morton Thiokol, Inc. | Solid compositions for generating nitrogen, the generation of nitrogen therefrom and inflation of gas bags therewith |
| US4601344A (en) * | 1983-09-29 | 1986-07-22 | The United States Of America As Represented By The Secretary Of The Navy | Pyrotechnic fire extinguishing method |
| US5053086A (en) * | 1985-03-15 | 1991-10-01 | The United States Of America As Represented By The Secretary Of The Navy | Gas generant compositions containing energetic high nitrogen binders |
| US5015309A (en) * | 1989-05-04 | 1991-05-14 | Morton International, Inc. | Gas generant compositions containing salts of 5-nitrobarbituric acid, salts of nitroorotic acid, or 5-nitrouracil |
| US5198046A (en) * | 1991-03-14 | 1993-03-30 | Fraunhofer-Gesellschaft Zur Forderung Der Angewandten Forschund E.V. | Stable, nitrogen-rich composition |
| US5197758A (en) * | 1991-10-09 | 1993-03-30 | Morton International, Inc. | Non-azide gas generant formulation, method, and apparatus |
| US5160386A (en) * | 1991-11-04 | 1992-11-03 | Morton International, Inc. | Gas generant formulations containing poly(nitrito) metal complexes as oxidants and method |
| US5783773A (en) * | 1992-04-13 | 1998-07-21 | Automotive Systems Laboratory Inc. | Low-residue azide-free gas generant composition |
| US5439251A (en) * | 1992-11-30 | 1995-08-08 | Toyo Kasei Kogyo Company Limited | Method of tetrazole amine salts having improved physical properties for generating gas in airbags |
| JP3182010B2 (ja) | 1992-11-30 | 2001-07-03 | 東洋化成工業株式会社 | エアーバック用ガス発生剤 |
| US5425886A (en) * | 1993-06-23 | 1995-06-20 | The United States Of America As Represented By The Secretary Of The Navy | On demand, non-halon, fire extinguishing systems |
| WO1995004016A1 (en) * | 1993-08-02 | 1995-02-09 | Thiokol Corporation | Anhydrous tetrazole gas generant compositions and methods of preparation |
| WO1995004015A1 (en) * | 1993-08-02 | 1995-02-09 | Thiokol Corporation | Bitetrazoleamine gas generant compositions and methods of use |
| US5500059A (en) * | 1993-08-02 | 1996-03-19 | Thiokol Corporation | Anhydrous 5-aminotetrazole gas generant compositions and methods of preparation |
| WO1995004014A1 (en) * | 1993-08-02 | 1995-02-09 | Thiokol Corporation | Method for preparing anhydrous tetrazole gas generant compositions |
| US5682014A (en) * | 1993-08-02 | 1997-10-28 | Thiokol Corporation | Bitetrazoleamine gas generant compositions |
| US5472647A (en) * | 1993-08-02 | 1995-12-05 | Thiokol Corporation | Method for preparing anhydrous tetrazole gas generant compositions |
| US5501823A (en) * | 1993-08-02 | 1996-03-26 | Thiokol Corporation | Preparation of anhydrous tetrazole gas generant compositions |
| WO1995004710A1 (en) * | 1993-08-04 | 1995-02-16 | Automotive Systems Laboratory, Inc. | Law residue azide-free gas generant composition |
| US5468866A (en) * | 1994-01-04 | 1995-11-21 | Thiokol Corporation | Methods for synthesizing and processing bis-(1(2)H-tetrazol-5-yl)-amine |
| US5428165A (en) * | 1994-01-06 | 1995-06-27 | Thiokol Corporation | Process for making 5-introbarbituric acid and salts thereof |
| WO1995019342A3 (en) * | 1994-01-06 | 1995-08-31 | Thiokol Corp | Gas generant composition containing non-metallic salts of 5-nitrobarbituric acid |
| US5472534A (en) * | 1994-01-06 | 1995-12-05 | Thiokol Corporation | Gas generant composition containing non-metallic salts of 5-nitrobarbituric acid |
| WO1995019341A3 (en) * | 1994-01-06 | 1995-08-31 | Thiokol Corp | Process for making 5-nitrobarbituric acid and salts thereof |
| US5516377A (en) * | 1994-01-10 | 1996-05-14 | Thiokol Corporation | Gas generating compositions based on salts of 5-nitraminotetrazole |
| US5451682A (en) * | 1994-01-10 | 1995-09-19 | Thiokol Corporation | Method for synthesizing 5-aminotetrazole |
| US5538567A (en) * | 1994-03-18 | 1996-07-23 | Olin Corporation | Gas generating propellant |
| US5641938A (en) * | 1995-03-03 | 1997-06-24 | Primex Technologies, Inc. | Thermally stable gas generating composition |
| US5514230A (en) * | 1995-04-14 | 1996-05-07 | Automotive Systems Laboratory, Inc. | Nonazide gas generating compositions with a built-in catalyst |
| US5844164A (en) * | 1996-02-23 | 1998-12-01 | Breed Automotive Technologies, Inc. | Gas generating device with specific composition |
| US5661261A (en) * | 1996-02-23 | 1997-08-26 | Breed Automotive Technology, Inc. | Gas generating composition |
| US5866842A (en) * | 1996-07-18 | 1999-02-02 | Primex Technologies, Inc. | Low temperature autoigniting propellant composition |
| US6306232B1 (en) | 1996-07-29 | 2001-10-23 | Automotive Systems Laboratory, Inc. | Thermally stable nonazide automotive airbag propellants |
| US5872329A (en) * | 1996-11-08 | 1999-02-16 | Automotive Systems Laboratory, Inc. | Nonazide gas generant compositions |
| US6210505B1 (en) * | 1996-11-08 | 2001-04-03 | Automotive Systems Laboratory Inc | High gas yield non-azide gas generants |
| WO1999046222A3 (en) * | 1998-03-12 | 2000-08-03 | Automotive Systems Lab | High gas yield non-azide gas generants |
| US6645325B1 (en) * | 1998-06-01 | 2003-11-11 | Russell R. Nickel | Fast-burning nitrocellulose compositions |
| US20040154711A1 (en) * | 1998-12-30 | 2004-08-12 | Per Sjoberg | Gas-generating material for gas-actuated car safety devices |
| US20040231768A1 (en) * | 1999-05-12 | 2004-11-25 | Bofors Bepab Ab | Composite gas-generating material for gas-actuated car safety devices |
| US6764562B1 (en) | 1999-05-12 | 2004-07-20 | Bofors Bepab Ab | Composite gas-generating material for gas-actuated car safety devices |
| US20050257866A1 (en) * | 2004-03-29 | 2005-11-24 | Williams Graylon K | Gas generant and manufacturing method thereof |
| US20100269965A1 (en) * | 2004-03-29 | 2010-10-28 | Williams Graylon K | Gas generant and manufacturing method thereof |
| US20090133787A1 (en) * | 2005-06-02 | 2009-05-28 | Ruag Ammotec Gmbh | Pyrotechnic agent |
| WO2006128910A1 (de) * | 2005-06-02 | 2006-12-07 | Ruag Ammotec Gmbh | Pyrotechnisches mittel |
| US10968147B2 (en) | 2005-06-02 | 2021-04-06 | Ruag Ammotec Gmbh | Pyrotechnic agent |
| JP2008542175A (ja) * | 2005-06-02 | 2008-11-27 | ルアグ アモテック ゲゼルシャフト ミット ベシュレンクテル ハフツング | パイロ技術的な作用物質 |
| US20080154044A1 (en) * | 2006-05-05 | 2008-06-26 | Ganta Sudhakar R | Gas generant compositions |
| EP2038146A4 (en) * | 2006-05-05 | 2009-09-30 | Tk Holdings Inc | GAS PRODUCTION COMPOSITIONS |
| US7692024B2 (en) * | 2006-05-05 | 2010-04-06 | Tk Holdings, Inc. | Gas generant compositions |
| US20100258220A1 (en) * | 2006-05-05 | 2010-10-14 | Ganta Sudhakar R | Gas generant compositions |
| US20100258221A1 (en) * | 2006-05-05 | 2010-10-14 | Ganta Sudhakar R | Gas generant compositions |
| US7847102B2 (en) | 2006-05-05 | 2010-12-07 | Tk Holdings, Inc. | Gas generant compositions |
| US7914632B2 (en) | 2006-05-05 | 2011-03-29 | Tk Holdings, Inc. | Gas generant compositions |
| US8088235B2 (en) | 2006-05-05 | 2012-01-03 | Tk Holdings, Inc. | Gas generant compositions |
| US20080110536A1 (en) * | 2006-05-05 | 2008-05-15 | Ganta Sudhakar R | Gas generant compositions |
| US20090008002A1 (en) * | 2006-09-30 | 2009-01-08 | Ganta Sudhakar R | Gas generant compositions |
| US8002915B2 (en) | 2006-09-30 | 2011-08-23 | Tk Holdings, Inc. | Gas generant compositions |
| US9045380B1 (en) | 2007-10-31 | 2015-06-02 | Tk Holdings Inc. | Gas generating compositions |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2004620C3 (de) | 1975-07-17 |
| DE2004620B2 (de) | 1974-12-12 |
| CA981024A (en) | 1976-01-06 |
| FR2078084A5 (en:Method) | 1971-11-05 |
| GB1313619A (en) | 1973-04-18 |
| DE2004620A1 (de) | 1971-08-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3719604A (en) | Pressurizing-gas-producing charges containing an aminoguanidine tetrazole and an oxygen-liberating or gas-evolving additive | |
| EP0430463B1 (en) | Gas generating compositions containing nitrotriazalone | |
| US6210505B1 (en) | High gas yield non-azide gas generants | |
| US2836484A (en) | Aqueous metal powder explosive | |
| KR100537348B1 (ko) | 납및바륨을함유하지않는점화성분 | |
| GB1515039A (en) | Illuminating pyrotechnic compositions | |
| Shamshina et al. | Catalytic ignition of ionic liquids for propellant applications | |
| US3886010A (en) | Stabilized and aerated blasting slurry containing thiourea and a nitrite gassing agent | |
| US3369945A (en) | Explosive composition containing an inorganic oxidizer salt,a soluble lignosulphonate,and mutual solvent therefor | |
| CZ40699A3 (cs) | Tepelná pojistka | |
| US8147627B2 (en) | Ignition means for propellant powders | |
| US3496040A (en) | Aqueous ammonium nitrate slurry explosive compositions containing hexamethylenetetramine | |
| US2988437A (en) | Cyanamide catalyst for ammonium nitrate gas generating composition | |
| US3523047A (en) | Hydrazine and aluminum containing explosive compositions | |
| US3421954A (en) | Melt explosive composition having a matrix of an inorganic oxygen supplying salt | |
| US3216872A (en) | Blasting agent and explosive compositions containing a fine-grained organic sensitizer | |
| US2885277A (en) | Hydrogen gas generating propellent compositions | |
| US3269879A (en) | Ammonium salt lattice with isomorphously substituted inorganic salts | |
| US2829036A (en) | Fire damp proof explosive compositions | |
| US3397096A (en) | Thickened inorganic oxidizer salt explosive slurry sensitized with a soluble polyflavonoid | |
| US3028273A (en) | Catalyst for nh4no3 combustion | |
| JP5019550B2 (ja) | 硝酸アンモニウムの複塩、その製造方法およびこれを用いたガス発生剤 | |
| US3374128A (en) | Stabilized blasting compositions containing at least one iron sulfide and an antacid | |
| US3671343A (en) | Composition for explosives comprising an alloy of magnesium and cerium | |
| US3053710A (en) | Magnesium hydride explosive compositions |