US2768065A - Auto-oxidation of alkylated anthraquinones - Google Patents
Auto-oxidation of alkylated anthraquinones Download PDFInfo
- Publication number
- US2768065A US2768065A US261762A US26176251A US2768065A US 2768065 A US2768065 A US 2768065A US 261762 A US261762 A US 261762A US 26176251 A US26176251 A US 26176251A US 2768065 A US2768065 A US 2768065A
- Authority
- US
- United States
- Prior art keywords
- solvent
- solution
- quinone
- hydrogen peroxide
- naphthalene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 150000004056 anthraquinones Chemical class 0.000 title claims description 23
- 238000007254 oxidation reaction Methods 0.000 title claims description 23
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 92
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 claims description 62
- 239000002904 solvent Substances 0.000 claims description 53
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 32
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 29
- 238000000034 method Methods 0.000 claims description 21
- 230000008569 process Effects 0.000 claims description 19
- 239000011877 solvent mixture Substances 0.000 claims description 17
- 239000008207 working material Substances 0.000 claims description 15
- 230000006872 improvement Effects 0.000 claims description 10
- 239000000470 constituent Substances 0.000 claims description 9
- 230000009467 reduction Effects 0.000 claims description 9
- FZZHAEBWLMVRHU-UHFFFAOYSA-N 5-[[4-[4-(2,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2,2-dimethylbutoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione Chemical compound O=C1C(C)=CC(=O)C(C)=C1CCC(C)(C)COC(C=C1)=CC=C1CC1C(=O)NC(=O)S1 FZZHAEBWLMVRHU-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 65
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- -1 aliphatic alcohols Chemical class 0.000 description 22
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 18
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 15
- 229930195733 hydrocarbon Natural products 0.000 description 15
- 239000001301 oxygen Substances 0.000 description 15
- 229910052760 oxygen Inorganic materials 0.000 description 15
- 239000001257 hydrogen Substances 0.000 description 14
- 229910052739 hydrogen Inorganic materials 0.000 description 14
- 230000005484 gravity Effects 0.000 description 13
- 150000004053 quinones Chemical class 0.000 description 13
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- 230000003647 oxidation Effects 0.000 description 11
- 239000004215 Carbon black (E152) Substances 0.000 description 10
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 10
- QNLZIZAQLLYXTC-UHFFFAOYSA-N 1,2-dimethylnaphthalene Chemical compound C1=CC=CC2=C(C)C(C)=CC=C21 QNLZIZAQLLYXTC-UHFFFAOYSA-N 0.000 description 9
- 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 8
- 125000004151 quinonyl group Chemical group 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 238000010521 absorption reaction Methods 0.000 description 7
- 150000002430 hydrocarbons Chemical class 0.000 description 7
- 238000005984 hydrogenation reaction Methods 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 7
- 150000002790 naphthalenes Chemical class 0.000 description 7
- SJEBAWHUJDUKQK-UHFFFAOYSA-N 2-ethylanthraquinone Chemical compound C1=CC=C2C(=O)C3=CC(CC)=CC=C3C(=O)C2=C1 SJEBAWHUJDUKQK-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- FDHDUXOBMHHFFJ-UHFFFAOYSA-N 1-pentylnaphthalene Chemical compound C1=CC=C2C(CCCCC)=CC=CC2=C1 FDHDUXOBMHHFFJ-UHFFFAOYSA-N 0.000 description 5
- 238000000605 extraction Methods 0.000 description 5
- 239000007800 oxidant agent Substances 0.000 description 5
- WWGUMAYGTYQSGA-UHFFFAOYSA-N 2,3-dimethylnaphthalene Chemical compound C1=CC=C2C=C(C)C(C)=CC2=C1 WWGUMAYGTYQSGA-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 238000004880 explosion Methods 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 150000002978 peroxides Chemical class 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- OTBHDFWQZHPNPU-UHFFFAOYSA-N 1,2,3,4-tetrahydroanthracene-9,10-dione Chemical class O=C1C2=CC=CC=C2C(=O)C2=C1CCCC2 OTBHDFWQZHPNPU-UHFFFAOYSA-N 0.000 description 3
- RKMPHYRYSONWOL-UHFFFAOYSA-N 1-ethyl-1,2,3,4-tetrahydroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(CC)CCC2 RKMPHYRYSONWOL-UHFFFAOYSA-N 0.000 description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- IYDMICQAKLQHLA-UHFFFAOYSA-N 1-phenylnaphthalene Chemical compound C1=CC=CC=C1C1=CC=CC2=CC=CC=C12 IYDMICQAKLQHLA-UHFFFAOYSA-N 0.000 description 2
- YEVQZPWSVWZAOB-UHFFFAOYSA-N 2-(bromomethyl)-1-iodo-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(I)C(CBr)=C1 YEVQZPWSVWZAOB-UHFFFAOYSA-N 0.000 description 2
- QIMMUPPBPVKWKM-UHFFFAOYSA-N 2-methylnaphthalene Chemical compound C1=CC=CC2=CC(C)=CC=C21 QIMMUPPBPVKWKM-UHFFFAOYSA-N 0.000 description 2
- BQUNPXRABCSKJZ-UHFFFAOYSA-N 2-propan-2-ylanthracene-9,10-dione Chemical compound C1=CC=C2C(=O)C3=CC(C(C)C)=CC=C3C(=O)C2=C1 BQUNPXRABCSKJZ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 238000005273 aeration Methods 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000000118 dimethyl group Chemical class [H]C([H])([H])* 0.000 description 2
- 229910001882 dioxygen Inorganic materials 0.000 description 2
- 231100001261 hazardous Toxicity 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 125000000687 hydroquinonyl group Chemical group C1(O)=C(C=C(O)C=C1)* 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- HLZKNKRTKFSKGZ-UHFFFAOYSA-N tetradecan-1-ol Chemical compound CCCCCCCCCCCCCCO HLZKNKRTKFSKGZ-UHFFFAOYSA-N 0.000 description 2
- XMNDMAQKWSQVOV-UHFFFAOYSA-N (2-methylphenyl) diphenyl phosphate Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C=CC=CC=1)OC1=CC=CC=C1 XMNDMAQKWSQVOV-UHFFFAOYSA-N 0.000 description 1
- UYYPOPWOFQHNHH-UHFFFAOYSA-N 1,2-dipentylnaphthalene Chemical compound C1=CC=CC2=C(CCCCC)C(CCCCC)=CC=C21 UYYPOPWOFQHNHH-UHFFFAOYSA-N 0.000 description 1
- FRASJONUBLZVQX-UHFFFAOYSA-N 1,4-naphthoquinone Chemical compound C1=CC=C2C(=O)C=CC(=O)C2=C1 FRASJONUBLZVQX-UHFFFAOYSA-N 0.000 description 1
- KTHUKEZOIFYPEH-UHFFFAOYSA-N 1-benzylnaphthalene Chemical compound C=1C=CC2=CC=CC=C2C=1CC1=CC=CC=C1 KTHUKEZOIFYPEH-UHFFFAOYSA-N 0.000 description 1
- ZMXIYERNXPIYFR-UHFFFAOYSA-N 1-ethylnaphthalene Chemical compound C1=CC=C2C(CC)=CC=CC2=C1 ZMXIYERNXPIYFR-UHFFFAOYSA-N 0.000 description 1
- JQLVCHDTPJYDIN-UHFFFAOYSA-N 1-methyl-1,2,3,4-tetrahydroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(C)CCC2 JQLVCHDTPJYDIN-UHFFFAOYSA-N 0.000 description 1
- JORLUGVBYJSSAW-UHFFFAOYSA-N 2-ethyl-1,2,3,4-tetrahydroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1CC(CC)CC2 JORLUGVBYJSSAW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- PYGXAGIECVVIOZ-UHFFFAOYSA-N Dibutyl decanedioate Chemical compound CCCCOC(=O)CCCCCCCCC(=O)OCCCC PYGXAGIECVVIOZ-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000005456 alcohol based solvent Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- AUYFHLCJKFSVOG-UHFFFAOYSA-N benzene-1,4-diol;phosphoric acid Chemical compound OP(O)(O)=O.OC1=CC=C(O)C=C1 AUYFHLCJKFSVOG-UHFFFAOYSA-N 0.000 description 1
- RJTJVVYSTUQWNI-UHFFFAOYSA-N beta-ethyl naphthalene Natural products C1=CC=CC2=CC(CC)=CC=C21 RJTJVVYSTUQWNI-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000011280 coal tar Substances 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000010227 cup method (microbiological evaluation) Methods 0.000 description 1
- 230000001351 cycling effect Effects 0.000 description 1
- DCZFGQYXRKMVFG-UHFFFAOYSA-N cyclohexane-1,4-dione Chemical compound O=C1CCC(=O)CC1 DCZFGQYXRKMVFG-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000003759 ester based solvent Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000033116 oxidation-reduction process Effects 0.000 description 1
- 230000036284 oxygen consumption Effects 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000012521 purified sample Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000012224 working solution Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/01—Hydrogen peroxide
- C01B15/022—Preparation from organic compounds
- C01B15/023—Preparation from organic compounds by the alkyl-anthraquinone process
Definitions
- the present invention provides a new class of quinone solvents of great permanence and of practical value in the manufacture of hydrogen peroxide according to the anthraquinone autooxidation process.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT496667D IT496667A (enExample) | 1951-12-14 | ||
| NL78559D NL78559C (enExample) | 1951-12-14 | ||
| BE516198D BE516198A (enExample) | 1951-12-14 | ||
| US261762A US2768065A (en) | 1951-12-14 | 1951-12-14 | Auto-oxidation of alkylated anthraquinones |
| FR1078403D FR1078403A (fr) | 1951-12-14 | 1952-12-12 | Procédé pour la préparation du peroxyde d'hydrogène |
| DEB23344A DE1019280B (de) | 1951-12-14 | 1952-12-12 | Verfahren zur Herstellung von Wasserstoffperoxyd |
| CH307965D CH307965A (fr) | 1951-12-14 | 1952-12-12 | Procédé pour la préparation du peroxyde d'hydrogène. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US261762A US2768065A (en) | 1951-12-14 | 1951-12-14 | Auto-oxidation of alkylated anthraquinones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US2768065A true US2768065A (en) | 1956-10-23 |
Family
ID=22994748
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US261762A Expired - Lifetime US2768065A (en) | 1951-12-14 | 1951-12-14 | Auto-oxidation of alkylated anthraquinones |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2768065A (enExample) |
| BE (1) | BE516198A (enExample) |
| CH (1) | CH307965A (enExample) |
| DE (1) | DE1019280B (enExample) |
| FR (1) | FR1078403A (enExample) |
| IT (1) | IT496667A (enExample) |
| NL (1) | NL78559C (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2935381A (en) * | 1957-04-19 | 1960-05-03 | Fmc Corp | Manufacture of hydrogen peroxide |
| US3328128A (en) * | 1963-09-03 | 1967-06-27 | Fmc Corp | Process for the manufacture of hydrogen peroxide |
| US4394369A (en) * | 1982-05-24 | 1983-07-19 | Fmc Corporation | Hydrogen peroxide process |
| JPS63100002A (ja) * | 1986-10-03 | 1988-05-02 | デグツサ・アクチエンゲゼルシヤフト | 過酸化水素の製造方法 |
Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2059569A (en) * | 1933-04-13 | 1936-11-03 | William S Pritchard | Manufacture of hydrogen peroxide |
| US2144341A (en) * | 1937-07-22 | 1939-01-17 | Mathieson Alkali Works Inc | Manufacture of hydrogen peroxide |
| US2158525A (en) * | 1935-10-10 | 1939-05-16 | Ig Farbenindustrie Ag | Production of hydrogen peroxide |
| US2178640A (en) * | 1938-12-29 | 1939-11-07 | Mathieson Alkali Works Inc | Manufacture of hydrogen peroxide |
| US2215883A (en) * | 1937-04-07 | 1940-09-24 | Walter H Duisberg | Production of hydrogen peroxide |
| US2455238A (en) * | 1946-10-15 | 1948-11-30 | Buffalo Electro Chem Co | Manufacture of hydrogen peroxide |
| US2537655A (en) * | 1950-03-09 | 1951-01-09 | Buffalo Electro Chem Co | Auto-oxidation of alkylated anthraquinones |
| US2537516A (en) * | 1950-03-09 | 1951-01-09 | Buffalo Electro Chem Co | Process of producing hydrogen peroxide by the alternate reduction and oxidation of alkylated anthraquinones |
| US2668753A (en) * | 1949-11-05 | 1954-02-09 | Du Pont | Production of hydrogen peroxide |
-
0
- BE BE516198D patent/BE516198A/xx unknown
- NL NL78559D patent/NL78559C/xx active
- IT IT496667D patent/IT496667A/it unknown
-
1951
- 1951-12-14 US US261762A patent/US2768065A/en not_active Expired - Lifetime
-
1952
- 1952-12-12 FR FR1078403D patent/FR1078403A/fr not_active Expired
- 1952-12-12 CH CH307965D patent/CH307965A/fr unknown
- 1952-12-12 DE DEB23344A patent/DE1019280B/de active Pending
Patent Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2059569A (en) * | 1933-04-13 | 1936-11-03 | William S Pritchard | Manufacture of hydrogen peroxide |
| US2158525A (en) * | 1935-10-10 | 1939-05-16 | Ig Farbenindustrie Ag | Production of hydrogen peroxide |
| US2215883A (en) * | 1937-04-07 | 1940-09-24 | Walter H Duisberg | Production of hydrogen peroxide |
| US2144341A (en) * | 1937-07-22 | 1939-01-17 | Mathieson Alkali Works Inc | Manufacture of hydrogen peroxide |
| US2178640A (en) * | 1938-12-29 | 1939-11-07 | Mathieson Alkali Works Inc | Manufacture of hydrogen peroxide |
| US2455238A (en) * | 1946-10-15 | 1948-11-30 | Buffalo Electro Chem Co | Manufacture of hydrogen peroxide |
| US2668753A (en) * | 1949-11-05 | 1954-02-09 | Du Pont | Production of hydrogen peroxide |
| US2537655A (en) * | 1950-03-09 | 1951-01-09 | Buffalo Electro Chem Co | Auto-oxidation of alkylated anthraquinones |
| US2537516A (en) * | 1950-03-09 | 1951-01-09 | Buffalo Electro Chem Co | Process of producing hydrogen peroxide by the alternate reduction and oxidation of alkylated anthraquinones |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2935381A (en) * | 1957-04-19 | 1960-05-03 | Fmc Corp | Manufacture of hydrogen peroxide |
| US3328128A (en) * | 1963-09-03 | 1967-06-27 | Fmc Corp | Process for the manufacture of hydrogen peroxide |
| US4394369A (en) * | 1982-05-24 | 1983-07-19 | Fmc Corporation | Hydrogen peroxide process |
| JPS63100002A (ja) * | 1986-10-03 | 1988-05-02 | デグツサ・アクチエンゲゼルシヤフト | 過酸化水素の製造方法 |
Also Published As
| Publication number | Publication date |
|---|---|
| BE516198A (enExample) | |
| CH307965A (fr) | 1955-06-30 |
| IT496667A (enExample) | |
| FR1078403A (fr) | 1954-11-18 |
| DE1019280B (de) | 1957-11-14 |
| NL78559C (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2158525A (en) | Production of hydrogen peroxide | |
| US2215883A (en) | Production of hydrogen peroxide | |
| Leffler | The Decomposition of p-Methoxy-p'-nitrobenzoyl Peroxide | |
| US2768065A (en) | Auto-oxidation of alkylated anthraquinones | |
| US3328128A (en) | Process for the manufacture of hydrogen peroxide | |
| US2537655A (en) | Auto-oxidation of alkylated anthraquinones | |
| US2668753A (en) | Production of hydrogen peroxide | |
| SE418496B (sv) | Forfarande for framstellning av cyklohexanon och/eller cyklohexanol genom katalytisk hydrering av cyklohexylhydroperoxid | |
| US2059569A (en) | Manufacture of hydrogen peroxide | |
| US2537516A (en) | Process of producing hydrogen peroxide by the alternate reduction and oxidation of alkylated anthraquinones | |
| US2455238A (en) | Manufacture of hydrogen peroxide | |
| US3923967A (en) | Production of hydrogen peroxide using the anthraquinone process | |
| US3767778A (en) | Process for the production of hydrogen peroxide | |
| US2768066A (en) | Manufacture of hydrogen peroxide | |
| Henbest et al. | Electronic effects in the reactions of olefins with permanganate ion and with osmium tetroxide | |
| US3041143A (en) | Production of hydrogen peroxide | |
| US3761580A (en) | Process for the production of very pure, aqueous hydrogen peroxide solutions | |
| US3880596A (en) | Apparatus for the production of hydrogen peroxide | |
| US2580622A (en) | Storage and concentration of acetylene | |
| US2215856A (en) | Production of peroxides and valuable metal compounds | |
| US2902347A (en) | Manufacture of hydrogen peroxide | |
| Lipscomb et al. | The identification of alcohols in aqueous solution | |
| RU2235680C2 (ru) | Способ получения пероксида водорода и композиция для его осуществления | |
| US2927002A (en) | Process for the manufacture of hydrogen peroxide | |
| Walling et al. | The Reaction of Olefins with Oxygen and Phosphorus1 |