TW258648B - - Google Patents
Info
- Publication number
- TW258648B TW258648B TW083101519A TW83101519A TW258648B TW 258648 B TW258648 B TW 258648B TW 083101519 A TW083101519 A TW 083101519A TW 83101519 A TW83101519 A TW 83101519A TW 258648 B TW258648 B TW 258648B
- Authority
- TW
- Taiwan
- Prior art keywords
- group
- cycloalkyl
- optionally substituted
- alkyl
- hydrogen atom
- Prior art date
Links
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- 125000000623 heterocyclic group Chemical group 0.000 abstract 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 3
- 150000001602 bicycloalkyls Chemical group 0.000 abstract 2
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 2
- 125000005346 substituted cycloalkyl group Chemical group 0.000 abstract 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- -1 alkadienyl Chemical group 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000000304 alkynyl group Chemical group 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 239000000417 fungicide Substances 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 229910052757 nitrogen Inorganic materials 0.000 abstract 1
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- 125000000547 substituted alkyl group Chemical group 0.000 abstract 1
- YWBFPKPWMSWWEA-UHFFFAOYSA-O triazolopyrimidine Chemical class BrC1=CC=CC(C=2N=C3N=CN[N+]3=C(NCC=3C=CN=CC=3)C=2)=C1 YWBFPKPWMSWWEA-UHFFFAOYSA-O 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/90—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having two or more relevant hetero rings, condensed among themselves or with a common carbocyclic ring system
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP93103465 | 1993-03-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| TW258648B true TW258648B (enFirst) | 1995-10-01 |
Family
ID=8212659
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| TW083101519A TW258648B (enFirst) | 1993-03-04 | 1994-02-22 |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US5756509A (enFirst) |
| EP (1) | EP0613900B1 (enFirst) |
| JP (1) | JP3449569B2 (enFirst) |
| KR (1) | KR940021554A (enFirst) |
| CN (1) | CN1094407A (enFirst) |
| AT (1) | ATE153025T1 (enFirst) |
| AU (1) | AU672267B2 (enFirst) |
| BG (1) | BG61647B1 (enFirst) |
| BR (1) | BR9400808A (enFirst) |
| CA (1) | CA2116946A1 (enFirst) |
| DE (1) | DE69403119T2 (enFirst) |
| DK (1) | DK0613900T3 (enFirst) |
| ES (1) | ES2101429T3 (enFirst) |
| GR (1) | GR3023587T3 (enFirst) |
| HU (1) | HUT68050A (enFirst) |
| IL (1) | IL108731A (enFirst) |
| MY (1) | MY111749A (enFirst) |
| NZ (1) | NZ250955A (enFirst) |
| OA (1) | OA09891A (enFirst) |
| PH (1) | PH31307A (enFirst) |
| RO (1) | RO112869B1 (enFirst) |
| RU (1) | RU2126408C1 (enFirst) |
| SG (1) | SG48897A1 (enFirst) |
| TW (1) | TW258648B (enFirst) |
| ZA (1) | ZA941484B (enFirst) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2147584C1 (ru) * | 1995-10-27 | 2000-04-20 | Американ Цианамид Компани | Способ получения дигалоидазолопиримидинов и способ получения дигидроксиазолопиримидинов |
| TW460476B (en) * | 1997-04-14 | 2001-10-21 | American Cyanamid Co | Fungicidal trifluoromethylalkylamino-triazolopyrimidines |
| US6117876A (en) | 1997-04-14 | 2000-09-12 | American Cyanamid Company | Fungicidal trifluorophenyl-triazolopyrimidines |
| US6559151B2 (en) | 2000-05-08 | 2003-05-06 | Basf Aktiengesellschaft | 6-(2-trifluoromethyl-phenyl)-triazolopyrimidines |
| PL362551A1 (en) | 2000-06-13 | 2004-11-02 | Basf Aktiengesellschaft | Fungicidal 5-phenyl substituted 2-(cyanoamino) pyrimidines |
| EP1577312A1 (en) * | 2000-06-13 | 2005-09-21 | Basf Aktiengesellschaft | Triazolopyrimidine intermediate compounds for fungicidal 5-phenyl substituted 2-(cyanoamino) pyrimidines |
| EP1341794B1 (en) * | 2000-12-06 | 2004-08-18 | Basf Aktiengesellschaft | Fungicidal 6-(trifluoromethyl-phenyl)-triazolopyrimidines |
| DE10121101A1 (de) * | 2001-04-27 | 2002-10-31 | Bayer Ag | Triazolopyrimidine |
| DE10121162A1 (de) * | 2001-04-30 | 2002-10-31 | Bayer Ag | Triazolopyrimidine |
| NZ531169A (en) | 2001-07-26 | 2005-09-30 | Basf Ag | 7-amino triazolopyrimidines for controlling harmful fungi |
| GB0126914D0 (en) * | 2001-11-08 | 2002-01-02 | Syngenta Ltd | Fungicides |
| DE10212886A1 (de) * | 2002-03-22 | 2003-10-02 | Bayer Cropscience Ag | Triazolopyrimidine |
| DE10218592A1 (de) * | 2002-04-26 | 2003-11-06 | Bayer Cropscience Ag | Triazolopyrimidine |
| WO2004011467A1 (ja) * | 2002-07-29 | 2004-02-05 | Hokko Chemical Industry Co., Ltd. | トリアゾロピリミジン誘導体および農園芸用殺菌剤 |
| CA2520718A1 (en) * | 2003-04-02 | 2004-10-14 | Basf Aktiengesellschaft | 7-alkinylamino-triazolopyrimidines, methods for the production and use thereof to combat harmful fungi and agents containing said compounds |
| DE10325133A1 (de) * | 2003-06-04 | 2004-12-23 | Bayer Cropscience Ag | Triazolopyrimidine |
| DE10328173A1 (de) * | 2003-06-24 | 2005-01-13 | Bayer Cropscience Ag | Triazolopyrimidine |
| DE10328171A1 (de) * | 2003-06-24 | 2005-01-13 | Bayer Cropscience Ag | Triazolopyrimidine |
| DE10328481A1 (de) * | 2003-06-25 | 2005-01-13 | Bayer Ag | Triazolopyrimidine |
| CA2530378A1 (en) * | 2003-06-27 | 2005-01-06 | Bayer Cropscience Ag | Pyrazolopyrimidines |
| KR20060098368A (ko) * | 2003-09-24 | 2006-09-18 | 와이어쓰 홀딩스 코포레이션 | 항암제로서의 6-[(치환된)페닐]트리아졸로피리미딘 |
| CN100486580C (zh) * | 2003-09-24 | 2009-05-13 | 惠氏控股公司 | 作为抗癌剂的6-芳基-7-卤基-咪唑并[1,2-a]嘧啶 |
| US7419982B2 (en) * | 2003-09-24 | 2008-09-02 | Wyeth Holdings Corporation | Crystalline forms of 5-chloro-6-{2,6-difluoro-4-[3-(methylamino)propoxy]phenyl}-N-[(1S)-2,2,2-trifluoro-1-methylethyl][1,2,4]triazolo[1,5-a]pyrimidin-7-amine salts |
| MY179926A (en) * | 2003-12-08 | 2020-11-19 | Wyeth Corp | Process for the preparation of tubulin inhibitors |
| DE10360370A1 (de) * | 2003-12-22 | 2005-07-14 | Bayer Cropscience Ag | Triazolopyrimidine |
| DE502005009862D1 (de) * | 2004-03-10 | 2010-08-19 | Basf Se | 5,6-dialkyl-7-aminotriazolopyrimidine, verfahren zu ihrer herstellung und ihre verwendung zur bekämpfung von schadpilzen sowie sie enthaltende mittel |
| WO2007023018A1 (de) * | 2005-07-13 | 2007-03-01 | Basf Aktiengesellschaft | 7-amino-6-triazolyl-1,2,4-triazolo[1,5-a]pyrimidin-verbindungen und ihre verwendung zur bekämpfung von schadpilzen |
| US20080300135A1 (en) * | 2005-07-13 | 2008-12-04 | Basf Aktiengesellschaft | 5-Alkyl-7-Amino-6-Heteroaryl-1,2,4-Triazolo[1,5-A]Pyrimidine Compounds and Their Use for Controlling Harmful Fungi |
| WO2007023020A1 (de) * | 2005-07-13 | 2007-03-01 | Basf Aktiengeseelschaft | 7-amino-6-heteroaryl-1,2,4-triazolo[1,5-a]pyrimidin-verbindungen und ihre verwendung zur bekämpfung von schadpilzen |
| PT1909579E (pt) * | 2005-07-27 | 2016-02-10 | Basf Se | Misturas fungicidas com base em azolopirimidinilaminas |
| WO2007012642A1 (de) * | 2005-07-29 | 2007-02-01 | Basf Aktiengesellschaft | 7-amino-6-thiadiazolyl- und -oxadiazolyl- 1 , 2 , 4-triazolo [1 , 5 -a] pyrimidin- verbindungen und ihre verwendung zur bekämpfung von schadpilzen |
| WO2007101870A1 (de) * | 2006-03-08 | 2007-09-13 | Basf Se | Substituierte triazolopyrimidine, verfahren zu ihrer herstellung und ihre verwendung zur bekämpfung von schadpilzen sowie sie enthaltende mittel |
| US20110144049A1 (en) * | 2009-10-21 | 2011-06-16 | Serebruany Victor L | Treating Cardiac Arrhythmias, Heart Failure, Peripheral Artery Disease and Stroke with Cyclopentyl-Triazolo-Pyrimidine or Derivative Thereof |
| RU2524266C1 (ru) * | 2013-03-14 | 2014-07-27 | Федеральное государственное бюджетное учреждение науки Институт органической и физической химии им. А.Е. Арбузова Казанского научного центра Российской академии наук | Средство защиты от плесени |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH569734A5 (en) * | 1967-07-01 | 1975-11-28 | Hydrierwerk Rodleben Veb | 5-and 7-basically subst s-triazolo 1 5-a pyrimidines |
| US4036840A (en) * | 1972-06-07 | 1977-07-19 | Icn Pharmaceuticals | 2-Substituted-s-triazolo[1,5a]pyrimidines |
| ZA781457B (en) * | 1977-03-23 | 1979-03-28 | Ici Ltd | Pesticidal compounds,compositions and processes |
| ZA782928B (en) * | 1977-05-27 | 1979-05-30 | Ici Ltd | Pesticidal compounds and compositions |
| DE3130633A1 (de) * | 1981-08-01 | 1983-02-17 | Basf Ag, 6700 Ludwigshafen | 7-amino-azolo(1,5-a)pyrimidine und diese enthaltende fungizide |
| DE3338292A1 (de) * | 1983-10-21 | 1985-05-02 | Basf Ag, 6700 Ludwigshafen | 7-amino-azolo(1,5-a)-pyrimidine und diese enthaltende fungizide |
| DE3644343A1 (de) * | 1986-12-19 | 1988-06-30 | Schering Ag | 6,7-dihydro-(1,2,4)triazolo(1,5-a)(1,3,5) triazin-2-sulfonsaeureamide, verfahren zu ihrer herstellung und ihre verwendung als mittel mit herbizider und wachstumsregulierender wirkung |
| HU208693B (en) * | 1991-02-22 | 1993-12-28 | Egyt Gyogyszervegyeszeti Gyar | Process for producing 1,2,4-triazolo (1,5-a) pyrimidinis derivatives and their carbicycli-tetrahydro-thiofurane-tetrahydrothiopyrane-, or tetrahydropyridine- condensated derivatives or medical preparatives containing them |
| US5177206A (en) * | 1991-10-08 | 1993-01-05 | Dowelanco | Process for the preparation of substituted N-(aryl)-1,2,4-triazolopyrimidine-2-sulfonamides |
| TW224044B (enFirst) * | 1991-12-30 | 1994-05-21 | Shell Internat Res Schappej B V |
-
1994
- 1994-02-22 TW TW083101519A patent/TW258648B/zh active
- 1994-02-22 IL IL108731A patent/IL108731A/xx not_active IP Right Cessation
- 1994-02-23 NZ NZ250955A patent/NZ250955A/en unknown
- 1994-02-23 AU AU56332/94A patent/AU672267B2/en not_active Ceased
- 1994-02-25 MY MYPI94000448A patent/MY111749A/en unknown
- 1994-03-01 BG BG98637A patent/BG61647B1/bg unknown
- 1994-03-02 OA OA60479A patent/OA09891A/en unknown
- 1994-03-02 DK DK94200532.3T patent/DK0613900T3/da active
- 1994-03-02 EP EP94200532A patent/EP0613900B1/en not_active Expired - Lifetime
- 1994-03-02 SG SG1996003569A patent/SG48897A1/en unknown
- 1994-03-02 DE DE69403119T patent/DE69403119T2/de not_active Expired - Fee Related
- 1994-03-02 AT AT94200532T patent/ATE153025T1/de not_active IP Right Cessation
- 1994-03-02 ES ES94200532T patent/ES2101429T3/es not_active Expired - Lifetime
- 1994-03-03 BR BR9400808A patent/BR9400808A/pt not_active Application Discontinuation
- 1994-03-03 HU HU9400647A patent/HUT68050A/hu unknown
- 1994-03-03 RO RO94-00327A patent/RO112869B1/ro unknown
- 1994-03-03 CA CA002116946A patent/CA2116946A1/en not_active Abandoned
- 1994-03-03 RU RU94007093A patent/RU2126408C1/ru active
- 1994-03-03 KR KR1019940004137A patent/KR940021554A/ko not_active Withdrawn
- 1994-03-03 ZA ZA941484A patent/ZA941484B/xx unknown
- 1994-03-03 JP JP05679994A patent/JP3449569B2/ja not_active Expired - Fee Related
- 1994-03-03 PH PH47874A patent/PH31307A/en unknown
- 1994-03-04 CN CN94102637A patent/CN1094407A/zh active Pending
-
1997
- 1997-04-22 US US08/838,013 patent/US5756509A/en not_active Expired - Fee Related
- 1997-05-30 GR GR970400114T patent/GR3023587T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL108731A (en) | 1997-03-18 |
| PH31307A (en) | 1998-07-06 |
| BG98637A (en) | 1995-01-31 |
| IL108731A0 (en) | 1994-05-30 |
| US5756509A (en) | 1998-05-26 |
| ES2101429T3 (es) | 1997-07-01 |
| RU2126408C1 (ru) | 1999-02-20 |
| AU5633294A (en) | 1994-09-08 |
| GR3023587T3 (en) | 1997-08-29 |
| OA09891A (en) | 1994-09-15 |
| BR9400808A (pt) | 1994-11-01 |
| MY111749A (en) | 2000-12-30 |
| KR940021554A (ko) | 1994-10-19 |
| AU672267B2 (en) | 1996-09-26 |
| EP0613900B1 (en) | 1997-05-14 |
| CA2116946A1 (en) | 1994-09-05 |
| HK1001054A1 (en) | 1998-05-22 |
| DE69403119T2 (de) | 1997-08-28 |
| RO112869B1 (ro) | 1998-01-30 |
| HUT68050A (en) | 1995-05-29 |
| DK0613900T3 (da) | 1997-06-23 |
| SG48897A1 (en) | 1998-05-18 |
| JPH072861A (ja) | 1995-01-06 |
| JP3449569B2 (ja) | 2003-09-22 |
| ZA941484B (en) | 1994-11-10 |
| CN1094407A (zh) | 1994-11-02 |
| HU9400647D0 (en) | 1994-05-30 |
| DE69403119D1 (de) | 1997-06-19 |
| EP0613900A1 (en) | 1994-09-07 |
| BG61647B1 (bg) | 1998-02-27 |
| NZ250955A (en) | 1995-04-27 |
| ATE153025T1 (de) | 1997-05-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| TW258648B (enFirst) | ||
| CA2086404A1 (en) | Triazolopyrimidine derivatives | |
| IL106677A0 (en) | Novel 7-(substituted)-8-(substituted-9-(substituted amino)-6-demethyl-6-deoxytetracyclines | |
| IL103875A0 (en) | Piperazinyl-and piperidinyl-cyclohexanol derivatives and pharmaceutical compositions containing the same | |
| ATE57919T1 (de) | Triazinderivate, verfahren zur herstellung der derivate und die derivate als wirksamen bestandteil enthaltende herbizide. | |
| ZA912672B (en) | Amine derivatives | |
| NZ304438A (en) | Substituted triazole derivatives and antifungal compositions | |
| IL83725A (en) | 3-methylphthalimide derivatives,their preparation and their use as herbicides and plant growth regulants | |
| HUT68474A (en) | Azoxycyanobenzene derivatives, process for their preparation and their use as fungicides | |
| GR3019145T3 (en) | Fungicidal furanone derivatives | |
| HUT42431A (en) | Herbicide compositions containing diphenyl-ether derivatives as active substances and process for preparing the active substances | |
| IL101032A0 (en) | 1,2,4-triazolo(1,5-a)pyrimidine derivatives,their preparation and pharmaceutical compositions containing them | |
| CA2177586A1 (en) | 4-benzoylisoxazoles and their use as herbicides |